DE1148230B - Stabilisierung von 2-Chlorbutadien-(1, 3) - Google Patents
Stabilisierung von 2-Chlorbutadien-(1, 3)Info
- Publication number
- DE1148230B DE1148230B DEK36846A DEK0036846A DE1148230B DE 1148230 B DE1148230 B DE 1148230B DE K36846 A DEK36846 A DE K36846A DE K0036846 A DEK0036846 A DE K0036846A DE 1148230 B DE1148230 B DE 1148230B
- Authority
- DE
- Germany
- Prior art keywords
- chlorobutadiene
- polymerization
- weight
- stabilizers
- dichloroethylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000006641 stabilisation Effects 0.000 title description 8
- 238000011105 stabilization Methods 0.000 title description 8
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical group ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 claims description 45
- 238000006116 polymerization reaction Methods 0.000 claims description 20
- 239000003381 stabilizer Substances 0.000 claims description 20
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 claims description 14
- 239000007795 chemical reaction product Substances 0.000 claims description 14
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 14
- UBUCNCOMADRQHX-UHFFFAOYSA-N N-Nitrosodiphenylamine Chemical compound C=1C=CC=CC=1N(N=O)C1=CC=CC=C1 UBUCNCOMADRQHX-UHFFFAOYSA-N 0.000 claims description 11
- UKDOTCFNLHHKOF-FGRDZWBJSA-N (z)-1-chloroprop-1-ene;(z)-1,2-dichloroethene Chemical group C\C=C/Cl.Cl\C=C/Cl UKDOTCFNLHHKOF-FGRDZWBJSA-N 0.000 claims description 10
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 claims description 9
- 229950000688 phenothiazine Drugs 0.000 claims description 9
- NKNFJNPXVRMBTD-UHFFFAOYSA-N 1,2-dichloro-1-nitroethene Chemical group [O-][N+](=O)C(Cl)=CCl NKNFJNPXVRMBTD-UHFFFAOYSA-N 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 4
- XLGKXHKUXUTESU-UHFFFAOYSA-N 1-chloro-1-nitroethene Chemical group [O-][N+](=O)C(Cl)=C XLGKXHKUXUTESU-UHFFFAOYSA-N 0.000 claims description 4
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 150000002828 nitro derivatives Chemical class 0.000 claims description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 description 19
- 230000000087 stabilizing effect Effects 0.000 description 10
- 244000052616 bacterial pathogen Species 0.000 description 8
- 238000004821 distillation Methods 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 5
- WFYPICNXBKQZGB-UHFFFAOYSA-N butenyne Chemical group C=CC#C WFYPICNXBKQZGB-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 239000012808 vapor phase Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- AYLBVKUPVXVTSO-UHFFFAOYSA-N n,n-diphenylnitramide Chemical compound C=1C=CC=CC=1N([N+](=O)[O-])C1=CC=CC=C1 AYLBVKUPVXVTSO-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/38—Separation; Purification; Stabilisation; Use of additives
- C07C17/42—Use of additives, e.g. for stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymerisation Methods In General (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK36846A DE1148230B (de) | 1959-01-31 | 1959-01-31 | Stabilisierung von 2-Chlorbutadien-(1, 3) |
| US3515A US3015677A (en) | 1959-01-31 | 1960-01-20 | Process for the stabilization of chloroprene |
| FR816894A FR1248736A (fr) | 1959-01-31 | 1960-01-28 | Procédé de stabilisation du chloroprène |
| GB3174/60A GB878118A (en) | 1959-01-31 | 1960-01-28 | Process for the stabilisation of chloroprene |
| NL6701559A NL6701559A (OSRAM) | 1959-01-31 | 1967-02-01 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK36846A DE1148230B (de) | 1959-01-31 | 1959-01-31 | Stabilisierung von 2-Chlorbutadien-(1, 3) |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1148230B true DE1148230B (de) | 1963-05-09 |
Family
ID=7220821
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK36846A Pending DE1148230B (de) | 1959-01-31 | 1959-01-31 | Stabilisierung von 2-Chlorbutadien-(1, 3) |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3015677A (OSRAM) |
| DE (1) | DE1148230B (OSRAM) |
| FR (1) | FR1248736A (OSRAM) |
| GB (1) | GB878118A (OSRAM) |
| NL (1) | NL6701559A (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1114806B (de) * | 1960-07-28 | 1961-10-12 | Knapsack Ag | Verfahren zur Isolierung und Reinigung von 2-Chlorbutadien-(1, 3) |
| US3109035A (en) * | 1960-07-29 | 1963-10-29 | Ethyl Corp | Stabilized vinyl chloride monomer |
| US3175012A (en) * | 1962-02-28 | 1965-03-23 | Du Pont | Stabilization of chlorobutadiene monomers with nitrogen tetroxide diisobutylene addition product |
| DE1211150B (de) * | 1963-05-15 | 1966-02-24 | Knapsack Ag | Verfahren zur kontinuierlichen Isolierung und Reinigung von 1, 3-Dichlorbuten-(2) |
| US4016216A (en) * | 1973-02-20 | 1977-04-05 | Toyo Soda Manufacturing Co., Ltd. | Stabilizing 2,3-dichloro-1,3-butadiene with certain N-nitrosoaniline compounds |
| CN102633593A (zh) * | 2012-03-23 | 2012-08-15 | 山西合成橡胶集团有限责任公司 | 精氯丁二烯阻聚剂配制方法 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2121012A (en) * | 1937-04-26 | 1938-06-21 | Dow Chemical Co | Stabilizing vinylidene chloride |
| US2770657A (en) * | 1953-02-11 | 1956-11-13 | Du Pont | Nitrogen dioxide compounds of 1, 3-dichloro-2-butene, and compositions containing the same |
| GB797975A (en) * | 1956-01-04 | 1958-07-09 | Du Pont | Stabilization of monomers |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2181102A (en) * | 1937-06-04 | 1939-11-21 | Dow Chemical Co | Stabilization of polymerizable vinyl compouds |
| GB765522A (en) * | 1954-02-16 | 1957-01-09 | Diamond Alkali Co | Improvements in or relating to the stabilization of chlorohydrocarbons |
-
1959
- 1959-01-31 DE DEK36846A patent/DE1148230B/de active Pending
-
1960
- 1960-01-20 US US3515A patent/US3015677A/en not_active Expired - Lifetime
- 1960-01-28 GB GB3174/60A patent/GB878118A/en not_active Expired
- 1960-01-28 FR FR816894A patent/FR1248736A/fr not_active Expired
-
1967
- 1967-02-01 NL NL6701559A patent/NL6701559A/xx unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2121012A (en) * | 1937-04-26 | 1938-06-21 | Dow Chemical Co | Stabilizing vinylidene chloride |
| US2770657A (en) * | 1953-02-11 | 1956-11-13 | Du Pont | Nitrogen dioxide compounds of 1, 3-dichloro-2-butene, and compositions containing the same |
| GB797975A (en) * | 1956-01-04 | 1958-07-09 | Du Pont | Stabilization of monomers |
Also Published As
| Publication number | Publication date |
|---|---|
| US3015677A (en) | 1962-01-02 |
| GB878118A (en) | 1961-09-27 |
| NL6701559A (OSRAM) | 1967-04-25 |
| FR1248736A (fr) | 1960-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1904574C3 (de) | Verfahren zur Herstellung von p-Aminophenol | |
| DE1493316C3 (de) | Verfahren zur Stabilisierung von Acryl- und Methacrylsäure-Derivaten | |
| DE1593396A1 (de) | Verfahren zum Stabilisieren von halogenierten Kohlenwasserstoffen,insbesondere chlorierten aliphatischen Kohlenwasserstoffen | |
| DE2811722A1 (de) | Verfahren zur katalytischen isomerisierung eines cyclohexan-bis-(methylamins) | |
| DE1620161C3 (de) | 1,3,4-Oxadiazolderivate, Verfahren zu deren Herstellung und insektizide Mittel | |
| DE1092005B (de) | Stabilisierung von aethylenisch ungesaettigten, polymerisierbaren, monomeren Verbindungen gegen Polymerisation | |
| DE2258769A1 (de) | Verfahren zur herstellung von aromatischen halogenverbindungen | |
| DE1643158C3 (OSRAM) | ||
| EP0026847B1 (de) | Verfahren zur Herstellung von 4-Amino-5-chlor-1-phenyl-pyridazon-(6) | |
| DE2434016B2 (de) | Katalysator für den Austausch von Deuterium zwischen Wasserstoff und einem Alkylamin und dessen Verwendung zur Anreicherung von Deuterium | |
| DE1038283B (de) | Verfahren zur Herstellung neuartiger Epoxyverbindungen | |
| DE2522818C2 (de) | Verfahren zur Herstellung von 4-Nitro-N-methylphthalimid | |
| DE102004049015A1 (de) | Gelatinekapsel mit Chloralhydrat | |
| DE1768667A1 (de) | Verfahren zur Herstellung von aromatischen Nitroverbindungen | |
| DE3237284C2 (OSRAM) | ||
| AT201611B (de) | Verfahren zur Herstellung von neuen Chromkoordinationskomplexen | |
| DE2318115C3 (de) | Katalysator zur Herstellung von U-Dichlor-buten-(2) | |
| DE2750573C2 (de) | Verfahren zur Herstellung von 2-Chlorbutadien-(1,3) durch Dehydrochlorierung von 3,4-Dichlorbuten-(1) | |
| DE1954274A1 (de) | Verfahren zur Herstellung von Anilin aus Phenol | |
| AT229288B (de) | Verfahren zur Herstellung von Methacrylverbindungen | |
| DE234741C (OSRAM) | ||
| DE899799C (de) | Verfahren zur Herstellung von substituierten Carbonsaeuren | |
| DE2362373C3 (de) | Verfahren zur Inhibierung der Polymerisation von Acrylsäure oder Acrylsäureester« während der Destillation | |
| DE2719245A1 (de) | Verfahren zur fluorierung von uracil | |
| DE1618996C (de) | Verfahren zur Herstellung von Pivalo lacton |