DE1031694B - Schwimmflosse - Google Patents
SchwimmflosseInfo
- Publication number
- DE1031694B DE1031694B DESCH8911A DESC008911A DE1031694B DE 1031694 B DE1031694 B DE 1031694B DE SCH8911 A DESCH8911 A DE SCH8911A DE SC008911 A DESC008911 A DE SC008911A DE 1031694 B DE1031694 B DE 1031694B
- Authority
- DE
- Germany
- Prior art keywords
- fin
- blade
- shoe
- foot
- fin blade
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 210000002683 foot Anatomy 0.000 claims description 23
- 230000009182 swimming Effects 0.000 claims description 5
- 210000003371 toe Anatomy 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 2
- 210000003423 ankle Anatomy 0.000 description 2
- 241000251468 Actinopterygii Species 0.000 description 1
- 210000004690 animal fin Anatomy 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B31/00—Swimming aids
- A63B31/08—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs
- A63B31/10—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs held by, or attachable to, the hands or feet
- A63B31/11—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs held by, or attachable to, the hands or feet attachable only to the feet
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63B—APPARATUS FOR PHYSICAL TRAINING, GYMNASTICS, SWIMMING, CLIMBING, OR FENCING; BALL GAMES; TRAINING EQUIPMENT
- A63B31/00—Swimming aids
- A63B31/08—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs
- A63B31/10—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs held by, or attachable to, the hands or feet
- A63B31/11—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs held by, or attachable to, the hands or feet attachable only to the feet
- A63B2031/115—Swim fins, flippers or other swimming aids held by, or attachable to, the hands, arms, feet or legs held by, or attachable to, the hands or feet attachable only to the feet with blade at an angle to the plane of the foot when in use, e.g. to reduce plantar flexion
Landscapes
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Physical Education & Sports Medicine (AREA)
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL85632D NL85632C (enExample) | 1952-02-28 | ||
| BE518015D BE518015A (enExample) | 1952-02-28 | ||
| NLAANVRAGE7212957,A NL176430B (nl) | 1952-02-28 | Werkwijze ter bereiding van haarkosmetische middelen. | |
| DESCH8911A DE1031694B (de) | 1952-02-28 | 1952-02-28 | Schwimmflosse |
| US338824A US2729832A (en) | 1952-02-28 | 1953-02-25 | Swimming fin |
| FR1085759D FR1085759A (fr) | 1952-02-28 | 1953-02-28 | Nageoire palmée pour pied de nageur |
| GB5725/53A GB731198A (en) | 1952-02-28 | 1953-03-02 | Improvements in or relating to swimming fins |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESCH8911A DE1031694B (de) | 1952-02-28 | 1952-02-28 | Schwimmflosse |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1031694B true DE1031694B (de) | 1958-06-04 |
Family
ID=7425930
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DESCH8911A Pending DE1031694B (de) | 1952-02-28 | 1952-02-28 | Schwimmflosse |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2729832A (enExample) |
| BE (1) | BE518015A (enExample) |
| DE (1) | DE1031694B (enExample) |
| FR (1) | FR1085759A (enExample) |
| GB (1) | GB731198A (enExample) |
| NL (2) | NL85632C (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2889563A (en) * | 1956-02-27 | 1959-06-09 | Edward W Lamb | Swim flipper |
| US3019458A (en) * | 1957-12-03 | 1962-02-06 | Barbieri Ettore De | Spoon-shaped swim-fin |
| US3068499A (en) * | 1958-01-14 | 1962-12-18 | Biskupsky Wassily Von | Foot fins |
| US3256540A (en) * | 1963-04-04 | 1966-06-21 | Novelli Alberto | Device for surface and subaquatic swimming |
| US4025977A (en) * | 1975-09-12 | 1977-05-31 | U. S. Divers Co. | Angular foot fin |
| IT216260Z2 (it) * | 1988-10-28 | 1991-06-21 | Mat Mas S R L | Monopinna. |
| US4934971A (en) * | 1988-10-31 | 1990-06-19 | Picken James B | Swim fin |
| US4981454A (en) * | 1989-02-01 | 1991-01-01 | Klein Kevin R | Retractable swim fin |
| US5108327A (en) * | 1989-02-01 | 1992-04-28 | Klein Kevin R | Retractable swim fin |
| US5326296A (en) * | 1993-03-04 | 1994-07-05 | Jesus Juan J De | Swimmers aid |
| US5899781A (en) * | 1997-11-07 | 1999-05-04 | Mclaughlin; Matthew M. | Swim fin incorporating pronation compensation structure |
| US6086440A (en) * | 1999-01-11 | 2000-07-11 | Fechtner; Ryszard | Swim fin and monofin with flapping foil |
| ITSV20000008A1 (it) * | 2000-02-25 | 2001-08-27 | Salva Sub S P A | Pinna per il nuoto od attivita' subacquee. |
| AU2003254391B2 (en) * | 2002-08-26 | 2009-04-02 | Giles Wilson | A swimming aid |
| AU2002950995A0 (en) * | 2002-08-26 | 2002-09-12 | Giles Wilson | Breast stroke training fin |
| US20040209534A1 (en) * | 2003-04-17 | 2004-10-21 | Graham Richard W. | Swim fin with fabric foot pocket |
| ES1057153Y (es) * | 2003-10-24 | 2004-10-16 | Traver Ramon Jose Mingarro | Aletas ergonomicas de natacion o buceo. |
| ITBO20040273A1 (it) * | 2004-04-30 | 2004-07-30 | C4 S A S Di Marco Bonfanti & C | Pinna per nuoto subacqueo |
| US8480446B2 (en) | 2010-11-04 | 2013-07-09 | David W Woods | High efficiency swim fin using multiple high aspect ratio hydrodynamic vanes with pliable hinges and rotation limiters |
| US8926385B1 (en) | 2009-11-02 | 2015-01-06 | David Woods | High efficiency swim fin using multiple high aspect ratio hydrodynamic vanes with pliable hinges and rotation limiters |
| US9004966B2 (en) | 2011-10-05 | 2015-04-14 | Brian Mayer | Swim fin attachment |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH254269A (de) * | 1940-09-27 | 1948-04-30 | P Churchill Owen | Schwimmflosse. |
| GB613609A (en) * | 1945-06-28 | 1948-12-01 | Louis Marie De Corlieu | Improvements in or relating to a swim-fin |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE23006E (en) * | 1948-06-15 | Swim fin | ||
| US2423571A (en) * | 1944-12-20 | 1947-07-08 | Charles H Wilen | Swimming tail |
-
0
- BE BE518015D patent/BE518015A/xx unknown
- NL NLAANVRAGE7212957,A patent/NL176430B/xx unknown
- NL NL85632D patent/NL85632C/xx active
-
1952
- 1952-02-28 DE DESCH8911A patent/DE1031694B/de active Pending
-
1953
- 1953-02-25 US US338824A patent/US2729832A/en not_active Expired - Lifetime
- 1953-02-28 FR FR1085759D patent/FR1085759A/fr not_active Expired
- 1953-03-02 GB GB5725/53A patent/GB731198A/en not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH254269A (de) * | 1940-09-27 | 1948-04-30 | P Churchill Owen | Schwimmflosse. |
| GB613609A (en) * | 1945-06-28 | 1948-12-01 | Louis Marie De Corlieu | Improvements in or relating to a swim-fin |
Also Published As
| Publication number | Publication date |
|---|---|
| US2729832A (en) | 1956-01-10 |
| NL176430B (nl) | |
| FR1085759A (fr) | 1955-02-07 |
| GB731198A (en) | 1955-06-01 |
| BE518015A (enExample) | |
| NL85632C (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1031694B (de) | Schwimmflosse | |
| DE3716424A1 (de) | Laufsohle fuer sportschuhe | |
| DE1485580A1 (de) | Sportschuh,insbesondere Sprungschuh | |
| DE8707691U1 (de) | Sportschuh mit elastischer Fersenkappe | |
| CH621481A5 (enExample) | ||
| DE2009381C3 (de) | Schwimmschuh | |
| DE2828561C3 (de) | Aus Gummi oder einem anderen Material mit gummielastischen Eigenschaften bestehende Laufsohle für Sportschuhe | |
| DE2816619A1 (de) | Sohle fuer sportschuhe | |
| DE2416778A1 (de) | Trainingsgeraet | |
| DE1973891U (de) | Sportschuhsohle. | |
| DE1188475B (de) | Sohle fuer Schuhwerk | |
| DE2408360A1 (de) | Kantenteil fuer skier | |
| DE1485576C3 (de) | Sportschuh, insbesondere Renn schuh | |
| CH192694A (de) | Fersenbeinstütze. | |
| DE893316C (de) | Fussstuetze | |
| DE1085798B (de) | Gleichzeitig von beiden Fuessen eines Schwimmenden zu betaetigender Schwimmhilfskoerper | |
| DE969680C (de) | Schwimmflosse | |
| DE1193836B (de) | Formsohle aus Gummi oder Kunststoff | |
| DE2130628A1 (de) | Brandsohle fuer Schuhwerk | |
| DE461029C (de) | Vorrichtung am Schuhwerk zur Erleichterung des Gehens | |
| DE458228C (de) | Schwimmschuh mit einer die Sohlenflaeche vergroessernden, in einer Richtung nachgiebigen und bis zum Fussgelenk zurueckreichenden Flosse | |
| DE1685766C3 (de) | Skistiefel | |
| DE8215226U1 (de) | Stahlkappe für Sicherheitsschuhe | |
| DE1229879B (de) | Sicherheitsschuhwerk aus Kautschuk oder Kunststoff | |
| DE8215650U1 (de) | Absatzlose Laufsohle für Schuhe, insbesondere zu Sportzwecken |