DE102005011722B4 - Verfahren zur chemischen Reinigung von Textilmaterial - Google Patents
Verfahren zur chemischen Reinigung von Textilmaterial Download PDFInfo
- Publication number
- DE102005011722B4 DE102005011722B4 DE102005011722A DE102005011722A DE102005011722B4 DE 102005011722 B4 DE102005011722 B4 DE 102005011722B4 DE 102005011722 A DE102005011722 A DE 102005011722A DE 102005011722 A DE102005011722 A DE 102005011722A DE 102005011722 B4 DE102005011722 B4 DE 102005011722B4
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- cleaning
- formula
- phenyl
- textile material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000004753 textile Substances 0.000 title claims abstract description 39
- 238000000034 method Methods 0.000 title claims abstract description 21
- 239000000463 material Substances 0.000 title claims abstract description 11
- 238000005108 dry cleaning Methods 0.000 title claims abstract description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 9
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims abstract description 3
- 238000004140 cleaning Methods 0.000 claims description 59
- -1 deodorizers Substances 0.000 claims description 57
- 239000002904 solvent Substances 0.000 claims description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000000126 substance Substances 0.000 claims description 13
- 239000012459 cleaning agent Substances 0.000 claims description 9
- 239000003945 anionic surfactant Substances 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 239000002280 amphoteric surfactant Substances 0.000 claims description 6
- 239000002736 nonionic surfactant Substances 0.000 claims description 5
- 239000002216 antistatic agent Substances 0.000 claims description 4
- 239000006096 absorbing agent Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 239000003093 cationic surfactant Substances 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 108090000790 Enzymes Proteins 0.000 claims description 2
- 102000004190 Enzymes Human genes 0.000 claims description 2
- 230000000844 anti-bacterial effect Effects 0.000 claims description 2
- 239000003899 bactericide agent Substances 0.000 claims description 2
- 239000003995 emulsifying agent Substances 0.000 claims description 2
- 239000003205 fragrance Substances 0.000 claims description 2
- 239000000417 fungicide Substances 0.000 claims description 2
- 230000003641 microbiacidal effect Effects 0.000 claims description 2
- 229940124561 microbicide Drugs 0.000 claims description 2
- 239000003755 preservative agent Substances 0.000 claims description 2
- 239000004744 fabric Substances 0.000 description 47
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical compound ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 36
- 229950011008 tetrachloroethylene Drugs 0.000 description 36
- VPZFYLQMPOIPKH-UHFFFAOYSA-N 1,1,1,2-tetramethoxyethane Chemical compound COCC(OC)(OC)OC VPZFYLQMPOIPKH-UHFFFAOYSA-N 0.000 description 27
- 125000000217 alkyl group Chemical group 0.000 description 27
- 125000004432 carbon atom Chemical group C* 0.000 description 20
- 238000001035 drying Methods 0.000 description 18
- 238000012360 testing method Methods 0.000 description 17
- 229920000728 polyester Polymers 0.000 description 16
- 239000004094 surface-active agent Substances 0.000 description 13
- 150000001768 cations Chemical class 0.000 description 12
- 239000002689 soil Substances 0.000 description 11
- 229920000297 Rayon Polymers 0.000 description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- 229930195733 hydrocarbon Natural products 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 239000004215 Carbon black (E152) Substances 0.000 description 8
- 235000014113 dietary fatty acids Nutrition 0.000 description 8
- 229930195729 fatty acid Natural products 0.000 description 8
- 239000000194 fatty acid Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 238000012546 transfer Methods 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- 210000002268 wool Anatomy 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- 230000014759 maintenance of location Effects 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 239000003599 detergent Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 238000004043 dyeing Methods 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 230000002209 hydrophobic effect Effects 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- VAYOSLLFUXYJDT-RDTXWAMCSA-N Lysergic acid diethylamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000003623 enhancer Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000000049 pigment Substances 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 239000010981 turquoise Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000003925 fat Substances 0.000 description 4
- 235000019197 fats Nutrition 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical compound O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 238000011002 quantification Methods 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 239000005662 Paraffin oil Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 235000019486 Sunflower oil Nutrition 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000001680 brushing effect Effects 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- JBTHDAVBDKKSRW-UHFFFAOYSA-N chembl1552233 Chemical compound CC1=CC(C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 JBTHDAVBDKKSRW-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- 239000000645 desinfectant Substances 0.000 description 2
- 238000003795 desorption Methods 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229940015043 glyoxal Drugs 0.000 description 2
- 239000000383 hazardous chemical Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 2
- 229920001522 polyglycol ester Polymers 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 229940073450 sudan red Drugs 0.000 description 2
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 239000002600 sunflower oil Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 2
- 230000002110 toxicologic effect Effects 0.000 description 2
- 231100000027 toxicology Toxicity 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000002888 zwitterionic surfactant Substances 0.000 description 2
- PUNFIBHMZSHFKF-KTKRTIGZSA-N (z)-henicos-12-ene-1,2,3-triol Chemical compound CCCCCCCC\C=C/CCCCCCCCC(O)C(O)CO PUNFIBHMZSHFKF-KTKRTIGZSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- WGYZMNBUZFHYRX-UHFFFAOYSA-N 1-(1-methoxypropan-2-yloxy)propan-2-ol Chemical compound COCC(C)OCC(C)O WGYZMNBUZFHYRX-UHFFFAOYSA-N 0.000 description 1
- RRBZUCWNYQUCTR-UHFFFAOYSA-N 2-(aminoazaniumyl)acetate Chemical class NNCC(O)=O RRBZUCWNYQUCTR-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-UHFFFAOYSA-N Alanine Chemical class CC([NH3+])C([O-])=O QNAYBMKLOCPYGJ-UHFFFAOYSA-N 0.000 description 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 1
- 241000282461 Canis lupus Species 0.000 description 1
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 239000004831 Hot glue Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 101500021084 Locusta migratoria 5 kDa peptide Proteins 0.000 description 1
- 102000015636 Oligopeptides Human genes 0.000 description 1
- 108010038807 Oligopeptides Proteins 0.000 description 1
- 235000019482 Palm oil Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 108010077895 Sarcosine Proteins 0.000 description 1
- PCSMJKASWLYICJ-UHFFFAOYSA-N Succinic aldehyde Chemical compound O=CCCC=O PCSMJKASWLYICJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920002359 Tetronic® Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 238000001792 White test Methods 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- MRUAUOIMASANKQ-UHFFFAOYSA-N cocamidopropyl betaine Chemical compound CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC([O-])=O MRUAUOIMASANKQ-UHFFFAOYSA-N 0.000 description 1
- 229940096362 cocoamphoacetate Drugs 0.000 description 1
- 229940047648 cocoamphodiacetate Drugs 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 231100000584 environmental toxicity Toxicity 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 235000021149 fatty food Nutrition 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000011194 food seasoning agent Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000003905 indoor air pollution Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical class OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940118019 malondialdehyde Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DVEKCXOJTLDBFE-UHFFFAOYSA-N n-dodecyl-n,n-dimethylglycinate Chemical compound CCCCCCCCCCCC[N+](C)(C)CC([O-])=O DVEKCXOJTLDBFE-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940048098 sodium sarcosinate Drugs 0.000 description 1
- ZUFONQSOSYEWCN-UHFFFAOYSA-M sodium;2-(methylamino)acetate Chemical compound [Na+].CNCC([O-])=O ZUFONQSOSYEWCN-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000000930 thermomechanical effect Effects 0.000 description 1
- 229960002415 trichloroethylene Drugs 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L1/00—Dry-cleaning or washing fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods
- D06L1/02—Dry-cleaning or washing fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods using organic solvents
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE102005011722A DE102005011722B4 (de) | 2005-03-15 | 2005-03-15 | Verfahren zur chemischen Reinigung von Textilmaterial |
| US11/886,541 US20090031504A1 (en) | 2005-03-15 | 2006-03-06 | Method for Chemically Cleaning Textile Material |
| JP2008501189A JP2008535951A (ja) | 2005-03-15 | 2006-03-06 | 繊維材料のドライクリーニング方法 |
| CA002601177A CA2601177A1 (en) | 2005-03-15 | 2006-03-06 | Method for chemically cleaning textile material |
| EP06707433A EP1861543A1 (de) | 2005-03-15 | 2006-03-06 | Verfahren zur chemischen reinigung von textilmaterial |
| CNA2006800102189A CN101151411A (zh) | 2005-03-15 | 2006-03-06 | 化学清洗纺织品材料的方法 |
| PCT/EP2006/002014 WO2006097213A1 (de) | 2005-03-15 | 2006-03-06 | Verfahren zur chemischen reinigung von textilmaterial |
| RU2007137825/05A RU2404315C2 (ru) | 2005-03-15 | 2006-03-06 | Способ химической чистки текстильных материалов |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE102005011722A DE102005011722B4 (de) | 2005-03-15 | 2005-03-15 | Verfahren zur chemischen Reinigung von Textilmaterial |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE102005011722A1 DE102005011722A1 (de) | 2006-09-21 |
| DE102005011722B4 true DE102005011722B4 (de) | 2010-04-08 |
Family
ID=36293716
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE102005011722A Expired - Fee Related DE102005011722B4 (de) | 2005-03-15 | 2005-03-15 | Verfahren zur chemischen Reinigung von Textilmaterial |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US20090031504A1 (enExample) |
| EP (1) | EP1861543A1 (enExample) |
| JP (1) | JP2008535951A (enExample) |
| CN (1) | CN101151411A (enExample) |
| CA (1) | CA2601177A1 (enExample) |
| DE (1) | DE102005011722B4 (enExample) |
| RU (1) | RU2404315C2 (enExample) |
| WO (1) | WO2006097213A1 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102005011719A1 (de) * | 2005-03-15 | 2006-09-28 | Clariant Produkte (Deutschland) Gmbh | Wasch- und Reinigungsmittel enthaltend Acetale als organische Lösemittel |
| DE102009027206A1 (de) * | 2009-06-25 | 2010-12-30 | Chemische Fabrik Kreussler & Co. Gmbh | Verwendung von Dietherverbindungen bei der chemischen Reinigung von Textil-, Leder- oder Pelzwaren |
| EP2546899B1 (en) | 2010-03-11 | 2015-06-24 | Panasonic Intellectual Property Management Co., Ltd. | Light emitting module, light source device, liquid crystal display device |
| WO2012014786A1 (en) * | 2010-07-30 | 2012-02-02 | Semiconductor Energy Laboratory Co., Ltd. | Semicondcutor device and manufacturing method thereof |
| CN103103742A (zh) * | 2012-12-14 | 2013-05-15 | 常熟市琴达针织印染有限公司 | 一种布料印花工艺 |
| DE102017012021A1 (de) * | 2017-12-22 | 2019-06-27 | Friedrich-Schiller-Universität Jena | Acetalischer Elektrolyt |
| CN107988728B (zh) * | 2017-12-27 | 2019-11-05 | 宁波高新区盛文途纺织品有限公司 | 一种纺织品清理方法 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0679179B1 (en) * | 1993-01-13 | 1999-04-21 | S.C. Johnson & Son, Inc. | Self-pressurized aerosol spot dry cleaning compositions |
| DE10042514A1 (de) * | 2000-08-30 | 2002-03-14 | Clariant Gmbh | Wässerige Flüssigkeiten enthaltend ein Tensid und ein Acetal |
| EP0890670B1 (en) * | 1997-07-11 | 2003-05-21 | S.C. Johnson & Son, Inc. | Spot removal compositions for use in aerosol dispensers |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2194405A (en) * | 1940-03-19 | Process of producing tetba-acetals | ||
| US30429A (en) * | 1860-10-16 | Blind-slat machine | ||
| US801157A (en) * | 1905-02-11 | 1905-10-03 | Robert R Raymond | Camp-table. |
| US847976A (en) * | 1905-09-05 | 1907-03-19 | Frederick C Warren | Fruit-jar and can closure. |
| US1084232A (en) * | 1913-06-11 | 1914-01-13 | Herman Reis | Manufacture of radiators. |
| US1184448A (en) * | 1916-01-07 | 1916-05-23 | Charles Lowry | Device for handling a plurality of train-orders and messages. |
| US1460052A (en) * | 1921-03-07 | 1923-06-26 | Westfield Mfg Company | Cycle |
| US2132898A (en) * | 1938-03-25 | 1938-10-11 | Hamel Lionel | Attachment for electric razors |
| US2321094A (en) * | 1941-03-18 | 1943-06-08 | Carbide & Carbon Chem Corp | Tetraacetals of glyoxal with glycol monoethers and process of making them |
| BE534688A (enExample) * | 1954-01-08 | |||
| ZW27980A1 (en) * | 1979-12-11 | 1981-07-22 | Aeci Ltd | Fuels for internal combustion engines |
| US4619668A (en) * | 1985-09-11 | 1986-10-28 | The United States Of America As Represented By The Secretary Of Agriculture | Dyed wrinkle-resistant and durable-press cotton fabrics |
| SU1594232A1 (ru) * | 1987-07-20 | 1990-09-23 | Омский технологический институт бытового обслуживания | Состав дл удалени гидрофобных загр знений |
| US5191127A (en) * | 1991-08-13 | 1993-03-02 | Loyola University Of Chicago | Glyoxal derivatives and method for making the same |
| ES2186816T3 (es) * | 1996-03-27 | 2003-05-16 | Kuraray Co | Fibra de copolimero de alcohol-etileno y procedimiento para su preparacion. |
| DE19636510A1 (de) * | 1996-09-09 | 1998-03-12 | Clariant Gmbh | Polyvinylalkohol-Kompositionen |
| DE19651325A1 (de) * | 1996-12-11 | 1998-06-18 | Basf Ag | Verfahren zur Herstellung von Glyoxalmonoacetalen |
| US7008458B2 (en) * | 1997-04-04 | 2006-03-07 | Hayday William A | Biodegradable ether dry cleaning solvent |
| EP1036233A1 (en) * | 1997-08-27 | 2000-09-20 | The Procter & Gamble Company | Bagless dry cleaning kits and processes for dry cleaning |
| US6177070B1 (en) * | 1998-01-05 | 2001-01-23 | Una E. Lynch | Deodorant composition |
| GB0002752D0 (en) * | 2000-02-07 | 2000-03-29 | Unilever Plc | Detergent compositions |
| EP1219699B1 (en) * | 2000-12-26 | 2004-08-11 | Shin-Etsu Chemical Co., Ltd. | Method of dry cleaning and dry cleaning solvent therefor |
| US6686637B1 (en) * | 2002-11-21 | 2004-02-03 | International Business Machines Corporation | Gate structure with independently tailored vertical doping profile |
| DE10312562A1 (de) * | 2003-03-21 | 2004-09-30 | Degussa Ag | Verfahren zur kontinuierlichen Herstellung von Acetalen von α,β-Dicarbonylverbindungen |
| FR2855171B1 (fr) * | 2003-05-22 | 2005-08-05 | Clariant | Procede de separation d'un diacetal du glyoxal d'un melange brut le contenant par extraction liquide-liquide a contre-courant |
-
2005
- 2005-03-15 DE DE102005011722A patent/DE102005011722B4/de not_active Expired - Fee Related
-
2006
- 2006-03-06 CA CA002601177A patent/CA2601177A1/en not_active Abandoned
- 2006-03-06 WO PCT/EP2006/002014 patent/WO2006097213A1/de not_active Ceased
- 2006-03-06 US US11/886,541 patent/US20090031504A1/en not_active Abandoned
- 2006-03-06 CN CNA2006800102189A patent/CN101151411A/zh active Pending
- 2006-03-06 JP JP2008501189A patent/JP2008535951A/ja not_active Withdrawn
- 2006-03-06 RU RU2007137825/05A patent/RU2404315C2/ru not_active IP Right Cessation
- 2006-03-06 EP EP06707433A patent/EP1861543A1/de not_active Withdrawn
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0679179B1 (en) * | 1993-01-13 | 1999-04-21 | S.C. Johnson & Son, Inc. | Self-pressurized aerosol spot dry cleaning compositions |
| EP0890670B1 (en) * | 1997-07-11 | 2003-05-21 | S.C. Johnson & Son, Inc. | Spot removal compositions for use in aerosol dispensers |
| DE10042514A1 (de) * | 2000-08-30 | 2002-03-14 | Clariant Gmbh | Wässerige Flüssigkeiten enthaltend ein Tensid und ein Acetal |
Also Published As
| Publication number | Publication date |
|---|---|
| WO2006097213A1 (de) | 2006-09-21 |
| DE102005011722A1 (de) | 2006-09-21 |
| CN101151411A (zh) | 2008-03-26 |
| CA2601177A1 (en) | 2006-09-21 |
| JP2008535951A (ja) | 2008-09-04 |
| RU2007137825A (ru) | 2009-04-20 |
| RU2404315C2 (ru) | 2010-11-20 |
| US20090031504A1 (en) | 2009-02-05 |
| EP1861543A1 (de) | 2007-12-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU738052B2 (en) | Biodegradable dry cleaning solvent | |
| DE69405554T2 (de) | Peroxysaeure | |
| DE2726896A1 (de) | Trockne reinigungsmittelmischung | |
| EP0743358B1 (de) | Zusammensetzung zum Waschen und Reinigen von Textilmaterialien | |
| DE2728693A1 (de) | Trockenreinigungsmittel | |
| DE1617119A1 (de) | Schaumarmes Fleckenbehandlungsmittel fuer Textilien | |
| DE69817717T2 (de) | Amphotere Reinigungslösung von niedrigem pH | |
| DE102005011722B4 (de) | Verfahren zur chemischen Reinigung von Textilmaterial | |
| DE60016944T2 (de) | Flüssige reinigungsmittelzusammensetzungen mit hohem aminoxidgehalt | |
| DE60315161T2 (de) | Reinigung von textilien | |
| DE102012200673A1 (de) | Wasch-, Reinigungs- oder Vorbehandlungsmittel mit erhöhter Reinigungskraft | |
| WO2010149521A1 (de) | Verwendung von dietherverbindungen bei der chemischen reinigung von textil-, leder- oder pelzwaren | |
| EP2064353A1 (de) | Verfahren zur chemischen reinigung von leder | |
| DE2162416C3 (de) | Mittel zur Reinigung von festen Gegenständen | |
| DE2656384A1 (de) | Verfahren zur reinigung fester stoffe in organischen loesungsmittelbaedern | |
| DE60222808T2 (de) | Verfahren zum trockenreinigen unter verwendung von verdichtetem kohlendioxid | |
| DE2723234A1 (de) | Verfahren und mittel zum reinigen von textilien | |
| DE60105056T2 (de) | Reinigungssystem für textile flächengebilde | |
| DE1617136B1 (de) | Verfahren zum Chemisch-Reinigen von Textilien | |
| WO2017050821A1 (de) | Tensid-enthaltende zusammensetzung zur behandlung von textilien mit einem farbstoff | |
| RU2779207C1 (ru) | Многокомпонентный растворитель для химической чистки текстильных изделий, а также метод его применения | |
| DE1051439B (de) | Loesungsmittel fuer die Trockenreinigung | |
| DE60109059T2 (de) | Trockenreinigungssystem für textilien | |
| US1974007A (en) | Treatment substance | |
| DE1111760B (de) | Fleckentfernungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8364 | No opposition during term of opposition | ||
| R119 | Application deemed withdrawn, or ip right lapsed, due to non-payment of renewal fee |
Effective date: 20121002 |