DE1005636B - Elektrische Niederdruckentladungsroehre, insbesondere Leuchtstofflampe - Google Patents
Elektrische Niederdruckentladungsroehre, insbesondere LeuchtstofflampeInfo
- Publication number
- DE1005636B DE1005636B DEP13621A DEP0013621A DE1005636B DE 1005636 B DE1005636 B DE 1005636B DE P13621 A DEP13621 A DE P13621A DE P0013621 A DEP0013621 A DE P0013621A DE 1005636 B DE1005636 B DE 1005636B
- Authority
- DE
- Germany
- Prior art keywords
- carbonate
- barium
- strontium
- potassium
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003513 alkali Substances 0.000 claims description 16
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims description 15
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 12
- 229910052788 barium Inorganic materials 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 11
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 claims description 8
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 8
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- 239000011591 potassium Substances 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 7
- BDAGIHXWWSANSR-NJFSPNSNSA-N hydroxyformaldehyde Chemical compound O[14CH]=O BDAGIHXWWSANSR-NJFSPNSNSA-N 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 7
- 229910052712 strontium Inorganic materials 0.000 claims description 7
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 7
- 229910000018 strontium carbonate Inorganic materials 0.000 claims description 7
- 229940095064 tartrate Drugs 0.000 claims description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 6
- 150000002500 ions Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 claims description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 6
- 235000011006 sodium potassium tartrate Nutrition 0.000 claims description 6
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 5
- 238000000576 coating method Methods 0.000 claims description 5
- 239000001476 sodium potassium tartrate Substances 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 4
- 239000011248 coating agent Substances 0.000 claims description 4
- 239000013078 crystal Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 239000001569 carbon dioxide Substances 0.000 claims description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- LEDMRZGFZIAGGB-UHFFFAOYSA-L strontium carbonate Chemical class [Sr+2].[O-]C([O-])=O LEDMRZGFZIAGGB-UHFFFAOYSA-L 0.000 claims description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 238000011049 filling Methods 0.000 claims description 2
- 239000007789 gas Substances 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- 239000000375 suspending agent Substances 0.000 claims description 2
- GSGMQCDKAUYPPQ-UHFFFAOYSA-L N.[Ca+2].OC([O-])=O.OC([O-])=O Chemical compound N.[Ca+2].OC([O-])=O.OC([O-])=O GSGMQCDKAUYPPQ-UHFFFAOYSA-L 0.000 claims 1
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- HQYOWPDUMCBSLQ-UHFFFAOYSA-L barium(2+);2,3-dihydroxybutanedioate Chemical compound [Ba+2].[O-]C(=O)C(O)C(O)C([O-])=O HQYOWPDUMCBSLQ-UHFFFAOYSA-L 0.000 claims 1
- 229910000019 calcium carbonate Inorganic materials 0.000 claims 1
- JOSBBXXRYZZWLI-UHFFFAOYSA-L calcium;potassium;carbonate Chemical compound [K+].[Ca+2].[O-]C([O-])=O JOSBBXXRYZZWLI-UHFFFAOYSA-L 0.000 claims 1
- IUMOPUXDPFMEMV-UHFFFAOYSA-L strontium;2,3-dihydroxybutanedioate Chemical compound [Sr+2].[O-]C(=O)C(O)C(O)C([O-])=O IUMOPUXDPFMEMV-UHFFFAOYSA-L 0.000 claims 1
- 238000005406 washing Methods 0.000 claims 1
- 230000000694 effects Effects 0.000 description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 229910052792 caesium Inorganic materials 0.000 description 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 2
- 238000000137 annealing Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000011162 core material Substances 0.000 description 2
- -1 oxygen ions Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- 150000003892 tartrate salts Chemical class 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- SJPVUFMOBDBTHQ-UHFFFAOYSA-N barium(2+);dioxido(dioxo)tungsten Chemical compound [Ba+2].[O-][W]([O-])(=O)=O SJPVUFMOBDBTHQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 150000001674 calcium compounds Chemical class 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 229940088417 precipitated calcium carbonate Drugs 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000003870 refractory metal Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003438 strontium compounds Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/04—Electrodes; Screens; Shields
- H01J61/06—Main electrodes
- H01J61/067—Main electrodes for low-pressure discharge lamps
- H01J61/0675—Main electrodes for low-pressure discharge lamps characterised by the material of the electrode
- H01J61/0677—Main electrodes for low-pressure discharge lamps characterised by the material of the electrode characterised by the electron emissive material
Landscapes
- Discharge Lamp (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE545445D BE545445A (enrdf_load_html_response) | 1955-02-23 | ||
| DEP13621A DE1005636B (de) | 1955-02-23 | 1955-02-23 | Elektrische Niederdruckentladungsroehre, insbesondere Leuchtstofflampe |
| US563754A US2831137A (en) | 1955-02-23 | 1956-02-06 | Cathode coating |
| GB4797/56A GB822553A (en) | 1955-02-23 | 1956-02-15 | Electric low-pressure discharge tubes, more particularly fluorescent lamps |
| FR1141719D FR1141719A (fr) | 1955-02-23 | 1956-02-20 | Tubes à décharge électrique à basse pression, en particulier lampes à luminescence |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP13621A DE1005636B (de) | 1955-02-23 | 1955-02-23 | Elektrische Niederdruckentladungsroehre, insbesondere Leuchtstofflampe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1005636B true DE1005636B (de) | 1957-04-04 |
Family
ID=7364719
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP13621A Pending DE1005636B (de) | 1955-02-23 | 1955-02-23 | Elektrische Niederdruckentladungsroehre, insbesondere Leuchtstofflampe |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2831137A (enrdf_load_html_response) |
| BE (1) | BE545445A (enrdf_load_html_response) |
| DE (1) | DE1005636B (enrdf_load_html_response) |
| FR (1) | FR1141719A (enrdf_load_html_response) |
| GB (1) | GB822553A (enrdf_load_html_response) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2963450A (en) * | 1958-03-17 | 1960-12-06 | Interlectric Corp | Filament coating composition |
| ITMI20012389A1 (it) * | 2001-11-12 | 2003-05-12 | Getters Spa | Catodo cavo con getter integrato per lampade a scarica e metodi per la sua realizzazione |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL24414C (enrdf_load_html_response) * | 1926-06-09 | |||
| US2201167A (en) * | 1937-03-09 | 1940-05-21 | Germeshausen Kenneth Joseph | Gaseous-discharge device |
| BE482916A (enrdf_load_html_response) * | 1947-06-05 | |||
| US2714681A (en) * | 1948-08-27 | 1955-08-02 | Gen Electric | Electric discharge device |
| US2677623A (en) * | 1949-10-27 | 1954-05-04 | Ets Claude Paz & Silva | Process for manufacturing electron emissive material and electrodes |
-
0
- BE BE545445D patent/BE545445A/xx unknown
-
1955
- 1955-02-23 DE DEP13621A patent/DE1005636B/de active Pending
-
1956
- 1956-02-06 US US563754A patent/US2831137A/en not_active Expired - Lifetime
- 1956-02-15 GB GB4797/56A patent/GB822553A/en not_active Expired
- 1956-02-20 FR FR1141719D patent/FR1141719A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1141719A (fr) | 1957-09-06 |
| US2831137A (en) | 1958-04-15 |
| GB822553A (en) | 1959-10-28 |
| BE545445A (enrdf_load_html_response) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1154215B (de) | Anorganischer Leuchtstoff und Verfahren zu seiner Herstellung | |
| DE667942C (de) | Verfahren zur Herstellung von Oxydkathoden, insbesondere Gluehkathoden fuer elektrische Entladungsgefaesse | |
| DE542965C (de) | Gasgefuellte oder luftleere elektrische Gluehlampe mit Wasserentziehungsmitteln als Fangstoff | |
| DD270797A5 (de) | Elektrische lampe mit einem getter | |
| DE2604709A1 (de) | Durch langsame elektronen erregbare leuchtanzeigevorrichtung | |
| DE597580C (de) | Elektrische Leucht- oder Ultraviolett-Bestrahlungsroehre | |
| DE1005636B (de) | Elektrische Niederdruckentladungsroehre, insbesondere Leuchtstofflampe | |
| DE2326957A1 (de) | Alkalimetalldampfgenerator und elektrische entladungsroehre, die mit mindestens einer oberflaeche fuer photoemission oder sekundaerelektronenemission versehen ist, die mit hilfe eines derartigen generators erhalten ist | |
| DE975450C (de) | Elektrolumineszenzlampe | |
| DE1671790C3 (de) | Elektrolytträger für Brennstoffzellen und Verfahren zu seiner Herstellung | |
| DE2925740C2 (de) | Verfahren zur Herstellung eines SnO↓2↓:Eu-Pulverleuchtstoffes | |
| DE917860C (de) | Aktivierungsmaterial fuer Elektroden von elektrischen Entladungsgefaessen | |
| DE2058296A1 (de) | Verfahren zur Herstellung eines Leuchtschirmes | |
| DE565464C (de) | Elektrische Entladungsroehre | |
| DE477232C (de) | Aus schwer schmelzbarem Metall, insbesondere Wolfram, bestehende Gluehkathode fuer Elektronenroehren | |
| AT141628B (de) | Verfahren zur Erhöhung des Elektronenemissionsgehaltes von Kathoden. | |
| DE1696630A1 (de) | Verfahren zur Herstellung einer zum Einsatz in eine geeignete elektrische Entladungsanordnung dienenden Elektrode mit elektronenemittierendem UEberzug | |
| DE2511340A1 (de) | Thermoionischer emitter aus lanthanstrontiumvanadaten | |
| AT123127B (de) | Verfahren zur Herstellung von Glühkathoden. | |
| DE617546C (de) | Gluehelektrode fuer gasgefuellte elektrische Entladungsgefaesse, insbesondere elektrische Leuchtroehren, und Verfahren zu ihrer Herstellung | |
| DE2126892C3 (de) | Verfahren zur Wiedergewinnung eines Leuchtstoffs der seltenen Erden | |
| DE819296C (de) | Verfahren zur Herstellung einer Kathode einer elektrischen Entladungsroehre | |
| DE603740C (de) | Verfahren zur Herstellung von Gluehkathoden | |
| DE2501232C2 (de) | Werkstoff für Kathodenoxidüberzug | |
| AT202602B (de) | Fernsehempfängerröhre mit einem fluoreszierenden Schirm |