DD146361A5 - Wiedergabegeraet - Google Patents
Wiedergabegeraet Download PDFInfo
- Publication number
- DD146361A5 DD146361A5 DD79215886A DD21588679A DD146361A5 DD 146361 A5 DD146361 A5 DD 146361A5 DD 79215886 A DD79215886 A DD 79215886A DD 21588679 A DD21588679 A DD 21588679A DD 146361 A5 DD146361 A5 DD 146361A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- magnetic head
- delay
- television signals
- track
- signal
- Prior art date
Links
- 230000002123 temporal effect Effects 0.000 claims abstract description 16
- 238000001208 nuclear magnetic resonance pulse sequence Methods 0.000 claims abstract description 8
- 238000010408 sweeping Methods 0.000 claims description 4
- 238000005070 sampling Methods 0.000 description 42
- 230000001419 dependent effect Effects 0.000 description 10
- 230000007704 transition Effects 0.000 description 8
- 238000010586 diagram Methods 0.000 description 6
- 230000003111 delayed effect Effects 0.000 description 5
- 238000012545 processing Methods 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 230000003321 amplification Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000009191 jumping Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 238000003199 nucleic acid amplification method Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 230000001960 triggered effect Effects 0.000 description 2
- PZBPKYOVPCNPJY-UHFFFAOYSA-N 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1C(OCC=C)CN1C=NC=C1 PZBPKYOVPCNPJY-UHFFFAOYSA-N 0.000 description 1
- 101000606504 Drosophila melanogaster Tyrosine-protein kinase-like otk Proteins 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000010363 phase shift Effects 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- 238000012549 training Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/76—Television signal recording
- H04N5/78—Television signal recording using magnetic recording
- H04N5/782—Television signal recording using magnetic recording on tape
- H04N5/783—Adaptations for reproducing at a rate different from the recording rate
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Television Signal Processing For Recording (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT711978A AT357206B (de) | 1978-10-03 | 1978-10-03 | Wiedergabegeraet |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD146361A5 true DD146361A5 (de) | 1981-02-04 |
Family
ID=3592901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79215886A DD146361A5 (de) | 1978-10-03 | 1979-09-28 | Wiedergabegeraet |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4283744A (OSRAM) |
| JP (1) | JPS5549082A (OSRAM) |
| AT (1) | AT357206B (OSRAM) |
| AU (1) | AU526417B2 (OSRAM) |
| BE (1) | BE879177A (OSRAM) |
| CA (1) | CA1134030A (OSRAM) |
| CH (1) | CH647632A5 (OSRAM) |
| DD (1) | DD146361A5 (OSRAM) |
| DE (1) | DE2939276A1 (OSRAM) |
| DK (1) | DK148029C (OSRAM) |
| ES (1) | ES484617A1 (OSRAM) |
| FR (1) | FR2438400A1 (OSRAM) |
| GB (1) | GB2032728A (OSRAM) |
| IT (1) | IT1119197B (OSRAM) |
| MX (1) | MX149621A (OSRAM) |
| NL (1) | NL7907274A (OSRAM) |
| NZ (1) | NZ191696A (OSRAM) |
| SE (1) | SE440577B (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55132440U (OSRAM) * | 1979-03-09 | 1980-09-19 | ||
| JPS55123278A (en) * | 1979-03-15 | 1980-09-22 | Matsushita Electric Ind Co Ltd | Magnetic recording and reproduction system |
| EP0024869B1 (en) * | 1979-08-21 | 1986-01-02 | Matsushita Electric Industrial Co., Ltd. | Video signal recording and reproducing apparatus |
| JPS56144684A (en) * | 1980-04-11 | 1981-11-11 | Matsushita Electric Ind Co Ltd | Reduction device for vertical picture fluctuation |
| JPS573477A (en) * | 1980-06-09 | 1982-01-08 | Matsushita Electric Ind Co Ltd | Video signal processing method |
| EP0071618B2 (en) * | 1981-02-05 | 1992-11-19 | Independent Broadcasting Authority | Digital television tape recording |
| USRE33001E (en) * | 1981-02-05 | 1989-07-25 | Independent Broadcasting Authority | Digital television tape recording |
| DE3215414C2 (de) * | 1982-04-24 | 1984-03-08 | Deutsche Thomson-Brandt Gmbh, 7730 Villingen-Schwenningen | Schaltungsanordnung für Video-Recorder |
| DE3302211A1 (de) * | 1983-01-24 | 1984-07-26 | Grundig E.M.V. Elektro-Mechanische Versuchsanstalt Max Grundig & Co KG, 8510 Fürth | Verfahren zur erhoehung der uebersprechdaempfung zwischen benachbarten spuren bei magnetischer videoaufzeichnung nach dem schraegspurverfahren |
| US4672469A (en) * | 1983-08-26 | 1987-06-09 | Victor Company Of Japan, Ltd. | Delay time adjusting system for video signal reproducing apparatus having heads scanning across multiple tracks |
| JPS60127392A (ja) * | 1983-12-12 | 1985-07-08 | Sanyo Chem Ind Ltd | 燃料油用流動性改良添加剤 |
| US4785359A (en) * | 1986-10-06 | 1988-11-15 | Eastman Kodak Company | Dual purpose memory for time division multiplexing and time base error correction |
| NL8701277A (nl) * | 1987-05-29 | 1988-12-16 | Philips Nv | Inrichting voor het weergeven van een luminantiesignaal uit een magnetische registratiedrager. |
| KR930005340B1 (ko) * | 1991-01-09 | 1993-06-17 | 삼성전자 주식회사 | 비디오 테이프레코더의 헤드드럼 주행각도 조절장치 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3409736A (en) * | 1965-05-17 | 1968-11-05 | Rca Corp | Phase and frequency correction system |
| US3763317A (en) * | 1970-04-01 | 1973-10-02 | Ampex | System for correcting time-base errors in a repetitive signal |
| US3742132A (en) * | 1970-05-23 | 1973-06-26 | Nippon Electric Co | Drum servo system of a video tape recorder for an electronic editing |
| US3761605A (en) * | 1971-10-08 | 1973-09-25 | Nippon Electric Co | Phase error correction system for a video tape recorder |
| NL7201920A (OSRAM) * | 1972-02-15 | 1973-08-17 | Philips Nv | |
| US3851100A (en) * | 1972-04-03 | 1974-11-26 | Ampex | Time-base error correction system |
| US4007484A (en) * | 1973-07-31 | 1977-02-08 | Sony Corporation | Magnetic recording and/or reproducing apparatus with chrominance crosstalk elimination |
| US4007482A (en) * | 1973-07-31 | 1977-02-08 | Sony Corporation | Magnetic recording and/or reproducing apparatus |
| GB1477466A (en) * | 1973-07-31 | 1977-06-22 | Sony Corp | Magnetic recording and/or reproducing apparatus |
| US3959815A (en) * | 1974-01-28 | 1976-05-25 | Basf Aktiengesellschaft | Arrangements for time base error compensation |
| US3921202A (en) * | 1974-02-04 | 1975-11-18 | Int Video Corp | Videotape recorder and reproducer velocity compensator apparatus |
| JPS5346570B2 (OSRAM) * | 1974-02-18 | 1978-12-14 | ||
| JPS6059787B2 (ja) * | 1975-10-14 | 1985-12-26 | ソニー株式会社 | 映像信号再生装置 |
| SU567218A1 (ru) * | 1976-03-09 | 1977-07-30 | Предприятие П/Я А-1772 | Устройство дл компенсации временных искажений видеосигнала |
| DE2646899C2 (de) * | 1976-10-18 | 1985-03-21 | Robert Bosch Gmbh, 7000 Stuttgart | Verfahren zur Wiedergabe von auf Magnetband aufgezeichneten Videosignalen |
| JPS53106517A (en) * | 1977-02-28 | 1978-09-16 | Sony Corp | Magnetic recoder |
| US4135215A (en) * | 1977-07-22 | 1979-01-16 | Eastman Kodak Company | Video recording format for increasing track-to-track correlation |
| JPS54138324A (en) * | 1978-04-19 | 1979-10-26 | Sony Corp | Magnetic recording and reproducing unit |
-
1978
- 1978-10-03 AT AT711978A patent/AT357206B/de not_active IP Right Cessation
-
1979
- 1979-09-24 US US06/077,957 patent/US4283744A/en not_active Expired - Lifetime
- 1979-09-27 CA CA336,483A patent/CA1134030A/en not_active Expired
- 1979-09-28 GB GB7933772A patent/GB2032728A/en not_active Withdrawn
- 1979-09-28 DE DE19792939276 patent/DE2939276A1/de active Granted
- 1979-09-28 DK DK408079A patent/DK148029C/da not_active IP Right Cessation
- 1979-09-28 NZ NZ191696A patent/NZ191696A/xx unknown
- 1979-09-28 AU AU51319/79A patent/AU526417B2/en not_active Ceased
- 1979-09-28 MX MX179452A patent/MX149621A/es unknown
- 1979-09-28 IT IT68892/79A patent/IT1119197B/it active
- 1979-09-28 DD DD79215886A patent/DD146361A5/de unknown
- 1979-10-01 SE SE7908094A patent/SE440577B/sv not_active IP Right Cessation
- 1979-10-01 ES ES484617A patent/ES484617A1/es not_active Expired
- 1979-10-01 NL NL7907274A patent/NL7907274A/nl not_active Application Discontinuation
- 1979-10-01 CH CH8805/79A patent/CH647632A5/de not_active IP Right Cessation
- 1979-10-03 BE BE0/197461A patent/BE879177A/fr not_active IP Right Cessation
- 1979-10-03 JP JP12784979A patent/JPS5549082A/ja active Pending
- 1979-10-03 FR FR7924641A patent/FR2438400A1/fr active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT1119197B (it) | 1986-03-03 |
| JPS5549082A (en) | 1980-04-08 |
| DE2939276A1 (de) | 1980-04-17 |
| CA1134030A (en) | 1982-10-19 |
| DK148029B (da) | 1985-02-04 |
| ES484617A1 (es) | 1980-05-16 |
| DE2939276C2 (OSRAM) | 1987-08-13 |
| US4283744A (en) | 1981-08-11 |
| BE879177A (fr) | 1980-04-03 |
| ATA711978A (de) | 1979-11-15 |
| NZ191696A (en) | 1982-08-17 |
| SE440577B (sv) | 1985-08-05 |
| AT357206B (de) | 1980-06-25 |
| IT7968892A0 (it) | 1979-09-28 |
| DK148029C (da) | 1985-06-24 |
| DK408079A (da) | 1980-04-04 |
| GB2032728A (en) | 1980-05-08 |
| AU526417B2 (en) | 1983-01-06 |
| CH647632A5 (de) | 1985-01-31 |
| AU5131979A (en) | 1980-04-17 |
| FR2438400A1 (fr) | 1980-04-30 |
| NL7907274A (nl) | 1980-04-09 |
| SE7908094L (sv) | 1980-04-04 |
| MX149621A (es) | 1983-12-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0131316B1 (de) | System zum Wiedergeben von auf einem Magnetband gespeicherten Informationssignalen | |
| DE2853392C2 (de) | Videomagnetbandgerät für Aufzeichnung und Wiedergabe von frequenzmodulierten Videosignalen | |
| DE2835837C2 (de) | Videosignal-Wiedergabesystem | |
| DD146361A5 (de) | Wiedergabegeraet | |
| DE2911292A1 (de) | Anordnung zur durchfuehrung von generell kontinuierlichen und rauschfreien transformationen von signalinformation in bezug auf ein magnetband eines aufzeichnungs- und wiedergabegeraets mit rotierender bandabtastung | |
| DE3883574T2 (de) | Spurfolgefehler-Signalerzeugungsgerät. | |
| DE2807812C2 (de) | Anordnung zur Wiedergabe von Bildsignalen, die auf einem Aufzeichnungsträger aufgezeichnet sind | |
| DE1774833A1 (de) | Vorrichtung zur magnetischeri Aufzeichnung und Wiedergabe | |
| DE2814082C2 (de) | Videosignal-Wiedergabeanordnung mit Geschwindigkeitswechsel | |
| DE2048154C3 (de) | Schrägspur-Video-Bandaufzeichnungsund Wiedergabegerät mit Langzeitaufzeichnung | |
| DE3106372C2 (OSRAM) | ||
| DE3120881C2 (de) | Wiedergabeanordnung für ein Videosignal zum Ausführen einer Normalwiedergabe und einer Stehbildwiedergabe | |
| DE3129292C2 (de) | Gerät zur Wiedergabe von Videosignalen | |
| DE2732293A1 (de) | Wiedergabegeraet | |
| DE2941073C2 (de) | Vorrichtung zum Auslesen eines scheibenförmigen Aufzeichnungsträgers | |
| DE3440174C2 (OSRAM) | ||
| DE3714128C2 (OSRAM) | ||
| DE2162528A1 (de) | Wiedergabesystem | |
| DE2813576C3 (de) | Schrägspur-Magnetbandspeichervorrichtung für Video-Signale, bei der die Wiedergabe mit im Vergleich zur Aufzeichnung unterschiedlicher Bandgeschwindigkeit möglich ist | |
| DE3739404C2 (de) | Überwachungs-Videorekorder | |
| WO1986002190A1 (fr) | Systeme de commande a posteriori pour un magnetophone a enregistrement transversal des voies | |
| DE3115670C2 (OSRAM) | ||
| DE3146774C2 (de) | Wiedergabegerät für ein Videoband | |
| DE4001533C2 (OSRAM) | ||
| DE3430743C2 (OSRAM) |