CZ20033202A3 - Bicyklické heterocyklické sloučeniny obsahující dusík pro použití jako antibakteriální činidla - Google Patents
Bicyklické heterocyklické sloučeniny obsahující dusík pro použití jako antibakteriální činidla Download PDFInfo
- Publication number
- CZ20033202A3 CZ20033202A3 CZ20033202A CZ20033202A CZ20033202A3 CZ 20033202 A3 CZ20033202 A3 CZ 20033202A3 CZ 20033202 A CZ20033202 A CZ 20033202A CZ 20033202 A CZ20033202 A CZ 20033202A CZ 20033202 A3 CZ20033202 A3 CZ 20033202A3
- Authority
- CZ
- Czechia
- Prior art keywords
- amino
- alkyl
- amide
- oxo
- dihydro
- Prior art date
Links
- 239000003242 anti bacterial agent Substances 0.000 title description 5
- 238000000034 method Methods 0.000 claims abstract description 162
- 241000124008 Mammalia Species 0.000 claims abstract description 9
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 7
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 7
- -1 amino, piperidyl Chemical group 0.000 claims description 394
- 150000001875 compounds Chemical class 0.000 claims description 249
- 125000000217 alkyl group Chemical group 0.000 claims description 202
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 86
- 229910052739 hydrogen Inorganic materials 0.000 claims description 80
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 77
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 claims description 58
- 150000001408 amides Chemical class 0.000 claims description 54
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 54
- 125000003277 amino group Chemical group 0.000 claims description 49
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 48
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 48
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 47
- 230000008569 process Effects 0.000 claims description 45
- 125000003118 aryl group Chemical group 0.000 claims description 43
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 42
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 42
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 41
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 40
- 239000001257 hydrogen Substances 0.000 claims description 39
- 229910052736 halogen Inorganic materials 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 35
- VUHCPMIDSUGHNO-UHFFFAOYSA-N 6-methoxy-1,5-naphthyridin-4-amine Chemical compound N1=CC=C(N)C2=NC(OC)=CC=C21 VUHCPMIDSUGHNO-UHFFFAOYSA-N 0.000 claims description 33
- 150000002367 halogens Chemical class 0.000 claims description 32
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 31
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 claims description 31
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 claims description 29
- 229910005965 SO 2 Inorganic materials 0.000 claims description 26
- 125000001424 substituent group Chemical group 0.000 claims description 24
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 24
- 125000000623 heterocyclic group Chemical group 0.000 claims description 22
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 21
- 125000003342 alkenyl group Chemical group 0.000 claims description 20
- 125000004414 alkyl thio group Chemical group 0.000 claims description 20
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 20
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 15
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 14
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 12
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 12
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 12
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 238000005984 hydrogenation reaction Methods 0.000 claims description 12
- 125000002252 acyl group Chemical group 0.000 claims description 11
- 125000004429 atom Chemical group 0.000 claims description 11
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 125000004043 oxo group Chemical group O=* 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000005842 heteroatom Chemical group 0.000 claims description 10
- NMEZJSDUZQOPFE-UHFFFAOYSA-N Cyclohex-1-enecarboxylic acid Chemical compound OC(=O)C1=CCCCC1 NMEZJSDUZQOPFE-UHFFFAOYSA-N 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 9
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 9
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 claims description 9
- 229910052727 yttrium Inorganic materials 0.000 claims description 9
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 8
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 7
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 6
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 6
- 150000005378 cyclohexanecarboxylic acids Chemical class 0.000 claims description 6
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims description 5
- 125000005647 linker group Chemical group 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 5
- 229910052721 tungsten Inorganic materials 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 claims description 4
- 125000005035 acylthio group Chemical group 0.000 claims description 4
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 claims description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims description 3
- 125000002950 monocyclic group Chemical group 0.000 claims description 3
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims description 3
- LASPDBMDWYKLQC-IYARVYRRSA-N COC1=CC2=C(C=C1)N=CC=C2NC(=O)[C@H]1CC[C@@H](CC1)NCC1=CC=C2SCC(=O)NC2=C1 Chemical compound COC1=CC2=C(C=C1)N=CC=C2NC(=O)[C@H]1CC[C@@H](CC1)NCC1=CC=C2SCC(=O)NC2=C1 LASPDBMDWYKLQC-IYARVYRRSA-N 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000005360 alkyl sulfoxide group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000005361 aryl sulfoxide group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 claims description 2
- 150000003950 cyclic amides Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims description 2
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 2
- 125000004468 heterocyclylthio group Chemical group 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 2
- WWYLVEIKNRIFSD-UHFFFAOYSA-N n-(6-methoxy-1,5-naphthyridin-4-yl)cyclohexanecarboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1CCCCC1 WWYLVEIKNRIFSD-UHFFFAOYSA-N 0.000 claims 3
- WOXWUZCRWJWTRT-UHFFFAOYSA-N 1-amino-1-cyclohexanecarboxylic acid Chemical compound OC(=O)C1(N)CCCCC1 WOXWUZCRWJWTRT-UHFFFAOYSA-N 0.000 claims 2
- ASFAFOSQXBRFMV-LJQANCHMSA-N 3-n-(2-benzyl-1,3-dihydroxypropan-2-yl)-1-n-[(1r)-1-(4-fluorophenyl)ethyl]-5-[methyl(methylsulfonyl)amino]benzene-1,3-dicarboxamide Chemical compound N([C@H](C)C=1C=CC(F)=CC=1)C(=O)C(C=1)=CC(N(C)S(C)(=O)=O)=CC=1C(=O)NC(CO)(CO)CC1=CC=CC=C1 ASFAFOSQXBRFMV-LJQANCHMSA-N 0.000 claims 2
- UDQAHFTWCBMBAL-UHFFFAOYSA-N 6,8-difluoroquinolin-4-amine Chemical compound C1=C(F)C=C2C(N)=CC=NC2=C1F UDQAHFTWCBMBAL-UHFFFAOYSA-N 0.000 claims 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 claims 2
- VLYZXDARBDJCPT-PEXQALLHSA-N (1s,3s,4s)-3-hydroxy-4-[(2-oxo-1h-pyrido[3,4-b][1,4]oxazin-7-yl)methylamino]cyclohexane-1-carboxylic acid Chemical compound O[C@H]1C[C@@H](C(O)=O)CC[C@@H]1NCC(N=C1)=CC2=C1OCC(=O)N2 VLYZXDARBDJCPT-PEXQALLHSA-N 0.000 claims 1
- YJGLLSACEYQDLT-LSJOCFKGSA-N (1s,3s,4s)-3-hydroxy-4-[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxylic acid Chemical compound O[C@H]1C[C@@H](C(O)=O)CC[C@@H]1NCC1=CC=C(SCC(=O)N2)C2=N1 YJGLLSACEYQDLT-LSJOCFKGSA-N 0.000 claims 1
- LQPCQVDOJCRRRI-UHFFFAOYSA-N 1-(sulfonylamino)cyclohexane-1-carboxylic acid Chemical compound O=S(=O)=NC1(C(=O)O)CCCCC1 LQPCQVDOJCRRRI-UHFFFAOYSA-N 0.000 claims 1
- DKLKZOIVBZXREC-UHFFFAOYSA-N 2-aminocyclohexene-1-carboxylic acid Chemical compound NC1=C(C(O)=O)CCCC1 DKLKZOIVBZXREC-UHFFFAOYSA-N 0.000 claims 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims 1
- XEKAWZARUWARND-UHFFFAOYSA-N 6h-oxazin-3-one Chemical compound O=C1NOCC=C1 XEKAWZARUWARND-UHFFFAOYSA-N 0.000 claims 1
- 239000005711 Benzoic acid Substances 0.000 claims 1
- PVJWKMPQWFTGDW-QAQDUYKDSA-N C1=C2N(C)C(=O)OC2=CC(CN[C@H]2CC[C@@H](CC2)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 Chemical compound C1=C2N(C)C(=O)OC2=CC(CN[C@H]2CC[C@@H](CC2)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 PVJWKMPQWFTGDW-QAQDUYKDSA-N 0.000 claims 1
- KLSTXOBNGOBMHF-JCNLHEQBSA-N C1=CC(O)=C2C(=O)NC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC2=C1 Chemical compound C1=CC(O)=C2C(=O)NC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC2=C1 KLSTXOBNGOBMHF-JCNLHEQBSA-N 0.000 claims 1
- WTLYHEBGJJAVMZ-WKILWMFISA-N C1=CC2=NSN=C2C=C1CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)N=C21 Chemical compound C1=CC2=NSN=C2C=C1CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)N=C21 WTLYHEBGJJAVMZ-WKILWMFISA-N 0.000 claims 1
- SCEYQRZPEASLEG-UPNAAVACSA-N COC1=CC2=C(C=C1)N=CC=C2C(O)C[C@H]1CC[C@@H](CC1)NCC1=CC2=C(SCC(=O)N2)C=C1 Chemical compound COC1=CC2=C(C=C1)N=CC=C2C(O)C[C@H]1CC[C@@H](CC1)NCC1=CC2=C(SCC(=O)N2)C=C1 SCEYQRZPEASLEG-UPNAAVACSA-N 0.000 claims 1
- VQDYYIZWEXWVDX-QAQDUYKDSA-N COC1=CC2=C(N=CC=C2NC(=O)[C@H]2CC[C@@H](CC2)NCC2=CC=C3SCC(=O)NC3=C2)C(F)=C1 Chemical compound COC1=CC2=C(N=CC=C2NC(=O)[C@H]2CC[C@@H](CC2)NCC2=CC=C3SCC(=O)NC3=C2)C(F)=C1 VQDYYIZWEXWVDX-QAQDUYKDSA-N 0.000 claims 1
- RONNYFTVWCSTTR-WKILWMFISA-N COC=1N=C2C(=CC=NC2=CC1)NC(=O)[C@@H]1CC[C@H](CC1)NCC=1C=CC2=C(N=NS2)C1 Chemical compound COC=1N=C2C(=CC=NC2=CC1)NC(=O)[C@@H]1CC[C@H](CC1)NCC=1C=CC2=C(N=NS2)C1 RONNYFTVWCSTTR-WKILWMFISA-N 0.000 claims 1
- VUWIHBMHDCCKDK-KESTWPANSA-N COc1ccc2nccc(C(=O)C[C@H]3CC[C@@H](CC3)NCc3ccc4OCCOc4c3)c2c1 Chemical compound COc1ccc2nccc(C(=O)C[C@H]3CC[C@@H](CC3)NCc3ccc4OCCOc4c3)c2c1 VUWIHBMHDCCKDK-KESTWPANSA-N 0.000 claims 1
- KXTMYJBJTDOVIC-NUDRXGSASA-N COc1ccc2nccc(C(O)C[C@H]3CC[C@@H](CC3)NCc3ccc4OCCOc4c3)c2c1 Chemical compound COc1ccc2nccc(C(O)C[C@H]3CC[C@@H](CC3)NCc3ccc4OCCOc4c3)c2c1 KXTMYJBJTDOVIC-NUDRXGSASA-N 0.000 claims 1
- HCLNGONVVJJJSF-UHFFFAOYSA-N N-(6-methoxyquinolin-4-yl)cyclohexanecarboxamide Chemical compound COC1=CC=C2N=CC=C(NC(=O)C3CCCCC3)C2=C1 HCLNGONVVJJJSF-UHFFFAOYSA-N 0.000 claims 1
- WYUMOJZSXWEIPU-WKILWMFISA-N N1=C2SC=NC2=CC(CN[C@H]2CC[C@@H](CC2)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 Chemical compound N1=C2SC=NC2=CC(CN[C@H]2CC[C@@H](CC2)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 WYUMOJZSXWEIPU-WKILWMFISA-N 0.000 claims 1
- GINYYMFAGWWUOX-SHTZXODSSA-N N1=C2SN=NC2=CC(CN[C@H]2CC[C@@H](CC2)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 Chemical compound N1=C2SN=NC2=CC(CN[C@H]2CC[C@@H](CC2)C(=O)NC2=CC=NC3=CC=C(N=C32)OC)=C1 GINYYMFAGWWUOX-SHTZXODSSA-N 0.000 claims 1
- LXMYTYOWYIYDRP-UHFFFAOYSA-N N1=CC=C(N)C2=NC(C)=CC=C21 Chemical compound N1=CC=C(N)C2=NC(C)=CC=C21 LXMYTYOWYIYDRP-UHFFFAOYSA-N 0.000 claims 1
- INPHYSUGIAWTBU-IYARVYRRSA-N O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=C(F)C=C(C=C43)OC)=CC=C21 Chemical compound O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=C(F)C=C(C=C43)OC)=CC=C21 INPHYSUGIAWTBU-IYARVYRRSA-N 0.000 claims 1
- WHNQBMVNTXFLDL-MXVIHJGJSA-N O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OCCCN)=CC=C21 Chemical compound O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OCCCN)=CC=C21 WHNQBMVNTXFLDL-MXVIHJGJSA-N 0.000 claims 1
- UHXALYJLYLDNOL-QAQDUYKDSA-N S1CC(=O)NC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 Chemical class S1CC(=O)NC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 UHXALYJLYLDNOL-QAQDUYKDSA-N 0.000 claims 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims 1
- 150000001555 benzenes Chemical class 0.000 claims 1
- OSVVTVLREDJKKV-WGSAOQKQSA-N chembl1926762 Chemical compound O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(C=C43)OC)=CC=C21 OSVVTVLREDJKKV-WGSAOQKQSA-N 0.000 claims 1
- MXFMDXNMFBQMSA-IYARVYRRSA-N chembl1926764 Chemical compound O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 MXFMDXNMFBQMSA-IYARVYRRSA-N 0.000 claims 1
- HVWFFJFLJLATFZ-WKILWMFISA-N chembl1926864 Chemical class O1CCOC(C=N2)=C1C=C2CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)N=C21 HVWFFJFLJLATFZ-WKILWMFISA-N 0.000 claims 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 claims 1
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- 125000000596 cyclohexenyl group Chemical class C1(=CCCCC1)* 0.000 abstract description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 411
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 352
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 218
- 239000000203 mixture Substances 0.000 description 194
- 239000000243 solution Substances 0.000 description 157
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 134
- 150000001412 amines Chemical class 0.000 description 111
- 239000007787 solid Substances 0.000 description 111
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 98
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 90
- 150000002500 ions Chemical class 0.000 description 89
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 87
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 82
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 76
- 235000019439 ethyl acetate Nutrition 0.000 description 76
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 75
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 72
- 238000006243 chemical reaction Methods 0.000 description 71
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 69
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 54
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 54
- 235000019441 ethanol Nutrition 0.000 description 53
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 52
- 239000000047 product Substances 0.000 description 52
- 239000000741 silica gel Substances 0.000 description 52
- 229910002027 silica gel Inorganic materials 0.000 description 52
- 150000002148 esters Chemical class 0.000 description 51
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 50
- 239000002904 solvent Substances 0.000 description 49
- 239000012458 free base Substances 0.000 description 47
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 45
- 230000002829 reductive effect Effects 0.000 description 45
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 44
- 239000003921 oil Substances 0.000 description 40
- 235000019198 oils Nutrition 0.000 description 40
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 38
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 36
- 239000012074 organic phase Substances 0.000 description 36
- 239000003039 volatile agent Substances 0.000 description 35
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 34
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 32
- 150000003891 oxalate salts Chemical class 0.000 description 30
- 238000010992 reflux Methods 0.000 description 29
- 238000010898 silica gel chromatography Methods 0.000 description 29
- 238000000746 purification Methods 0.000 description 28
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 27
- 235000019341 magnesium sulphate Nutrition 0.000 description 27
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 26
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 25
- 235000017557 sodium bicarbonate Nutrition 0.000 description 25
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 24
- 239000012267 brine Substances 0.000 description 23
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 23
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 22
- 238000004587 chromatography analysis Methods 0.000 description 22
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 21
- 239000012230 colorless oil Substances 0.000 description 21
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 21
- 239000012279 sodium borohydride Substances 0.000 description 21
- 229910000033 sodium borohydride Inorganic materials 0.000 description 21
- 239000000284 extract Substances 0.000 description 20
- 239000002808 molecular sieve Substances 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- 239000002002 slurry Substances 0.000 description 19
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- 229910000027 potassium carbonate Inorganic materials 0.000 description 17
- 230000009467 reduction Effects 0.000 description 16
- 238000006722 reduction reaction Methods 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000008346 aqueous phase Substances 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 13
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 13
- GBOGHJYGGDERQX-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=CC(C=O)=CC=C21 GBOGHJYGGDERQX-UHFFFAOYSA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 230000007062 hydrolysis Effects 0.000 description 12
- 238000006460 hydrolysis reaction Methods 0.000 description 12
- 239000012280 lithium aluminium hydride Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 11
- 229910052786 argon Inorganic materials 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 230000003647 oxidation Effects 0.000 description 11
- 238000007254 oxidation reaction Methods 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- 239000000377 silicon dioxide Substances 0.000 description 11
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 238000007796 conventional method Methods 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 229910000104 sodium hydride Inorganic materials 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 9
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical class OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 150000002576 ketones Chemical class 0.000 description 9
- 229910052763 palladium Inorganic materials 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 8
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 8
- 239000005909 Kieselgur Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 230000008878 coupling Effects 0.000 description 7
- 238000010168 coupling process Methods 0.000 description 7
- 239000012948 isocyanate Substances 0.000 description 7
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 6
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 150000002431 hydrogen Chemical class 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 6
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 150000002924 oxiranes Chemical class 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- 229910052720 vanadium Inorganic materials 0.000 description 6
- 239000003981 vehicle Substances 0.000 description 6
- PPZNNZQHBXZAPS-UHFFFAOYSA-N (6-methoxy-1,5-naphthyridin-4-yl) trifluoromethanesulfonate Chemical compound N1=CC=C(OS(=O)(=O)C(F)(F)F)C2=NC(OC)=CC=C21 PPZNNZQHBXZAPS-UHFFFAOYSA-N 0.000 description 5
- JKDNCRZXENNDPS-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-6-ylmethyl methanesulfonate Chemical compound O1CCOC2=CC(COS(=O)(=O)C)=CC=C21 JKDNCRZXENNDPS-UHFFFAOYSA-N 0.000 description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 5
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 150000001540 azides Chemical class 0.000 description 5
- OKQSIIZUIIHAAJ-UHFFFAOYSA-N benzyl 4-carbamoyl-3-oxa-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate Chemical compound C1=CC(C(=O)N)(O2)CCC1N2C(=O)OCC1=CC=CC=C1 OKQSIIZUIIHAAJ-UHFFFAOYSA-N 0.000 description 5
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 5
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 150000002596 lactones Chemical class 0.000 description 5
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 4
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- FQYRLEXKXQRZDH-UHFFFAOYSA-N 4-aminoquinoline Chemical compound C1=CC=C2C(N)=CC=NC2=C1 FQYRLEXKXQRZDH-UHFFFAOYSA-N 0.000 description 4
- XXLFLUJXWKXUGS-UHFFFAOYSA-N 6-methoxyquinoline-4-carboxylic acid Chemical compound N1=CC=C(C(O)=O)C2=CC(OC)=CC=C21 XXLFLUJXWKXUGS-UHFFFAOYSA-N 0.000 description 4
- OOZJPRNXHIFPQL-UHFFFAOYSA-N 7-fluoro-3-oxo-4h-1,4-benzoxazine-6-carbaldehyde Chemical compound O1CC(=O)NC2=C1C=C(F)C(C=O)=C2 OOZJPRNXHIFPQL-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- OJLZRYSTMRWWQM-UHFFFAOYSA-N 8-fluoro-6-methoxyquinolin-4-amine Chemical compound N1=CC=C(N)C2=CC(OC)=CC(F)=C21 OJLZRYSTMRWWQM-UHFFFAOYSA-N 0.000 description 4
- 241000283690 Bos taurus Species 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- NMQQBXHZBNUXGJ-SNAWJCMRSA-N [(1e)-buta-1,3-dienyl] acetate Chemical compound CC(=O)O\C=C\C=C NMQQBXHZBNUXGJ-SNAWJCMRSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 239000012223 aqueous fraction Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 4
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 4
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000005932 reductive alkylation reaction Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000010561 standard procedure Methods 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 4
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 4
- VCEGXPUFHUAMCE-UHFFFAOYSA-N 1,2,3-benzothiadiazol-5-ylmethanol Chemical compound OCC1=CC=C2SN=NC2=C1 VCEGXPUFHUAMCE-UHFFFAOYSA-N 0.000 description 3
- CWKXDPPQCVWXAG-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxine-6-carbaldehyde Chemical compound O1CCOC2=CC(C=O)=CC=C21 CWKXDPPQCVWXAG-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- RGICCULPCWNRAB-UHFFFAOYSA-N 2-[2-(2-hexoxyethoxy)ethoxy]ethanol Chemical compound CCCCCCOCCOCCOCCO RGICCULPCWNRAB-UHFFFAOYSA-N 0.000 description 3
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 3
- QFWRXHOXSMGYGY-UHFFFAOYSA-N 2h-pyrido[2,3-e]thiazine 1-oxide Chemical compound C1=CC=C2S(=O)NC=CC2=N1 QFWRXHOXSMGYGY-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- DRNGLYHKYPNTEA-UHFFFAOYSA-N 4-azaniumylcyclohexane-1-carboxylate Chemical compound NC1CCC(C(O)=O)CC1 DRNGLYHKYPNTEA-UHFFFAOYSA-N 0.000 description 3
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 3
- UUVDJIWRSIJEBS-UHFFFAOYSA-N 6-methoxypyridin-3-amine Chemical compound COC1=CC=C(N)C=N1 UUVDJIWRSIJEBS-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 238000007239 Wittig reaction Methods 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000001099 ammonium carbonate Substances 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 3
- 150000003857 carboxamides Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000007822 coupling agent Substances 0.000 description 3
- PSVJDFLPZZXFDU-UHFFFAOYSA-N cyclohexen-1-amine Chemical compound NC1=CCCCC1 PSVJDFLPZZXFDU-UHFFFAOYSA-N 0.000 description 3
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 238000006735 epoxidation reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 3
- 238000011905 homologation Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- BRPREIDVQXJOJH-UHFFFAOYSA-N methyl 6-chloro-5-nitropyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(Cl)C([N+]([O-])=O)=C1 BRPREIDVQXJOJH-UHFFFAOYSA-N 0.000 description 3
- IMAKHNTVDGLIRY-UHFFFAOYSA-N methyl prop-2-ynoate Chemical compound COC(=O)C#C IMAKHNTVDGLIRY-UHFFFAOYSA-N 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 125000005936 piperidyl group Chemical group 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 3
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 3
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- PNHGMSJMBREBKO-UHFFFAOYSA-N thiadiazol-5-ylmethanol Chemical compound OCC1=CN=NS1 PNHGMSJMBREBKO-UHFFFAOYSA-N 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 2
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 2
- LQQKDSXCDXHLLF-UHFFFAOYSA-N 1,3-dibromopropan-2-one Chemical class BrCC(=O)CBr LQQKDSXCDXHLLF-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical group O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 2
- 150000005055 1,5-naphthyridines Chemical class 0.000 description 2
- BHKKSKOHRFHHIN-MRVPVSSYSA-N 1-[[2-[(1R)-1-aminoethyl]-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one Chemical compound N[C@H](C)C1=C(CN2C(NC(C3=C2C=CN3)=O)=S)C=CC(=C1)Cl BHKKSKOHRFHHIN-MRVPVSSYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- MFJCPDOGFAYSTF-UHFFFAOYSA-N 1H-isochromene Chemical compound C1=CC=C2COC=CC2=C1 MFJCPDOGFAYSTF-UHFFFAOYSA-N 0.000 description 2
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 2
- MVXVYAKCVDQRLW-UHFFFAOYSA-N 1h-pyrrolo[2,3-b]pyridine Chemical compound C1=CN=C2NC=CC2=C1 MVXVYAKCVDQRLW-UHFFFAOYSA-N 0.000 description 2
- KAMGPFCJHMJLOP-UHFFFAOYSA-N 2,1,3-benzothiadiazol-5-ylmethyl methanesulfonate Chemical compound C1=C(COS(=O)(=O)C)C=CC2=NSN=C21 KAMGPFCJHMJLOP-UHFFFAOYSA-N 0.000 description 2
- ZYBZYDVRLQSWGG-UHFFFAOYSA-N 2,2-dimethyloct-7-enoic acid Chemical compound OC(=O)C(C)(C)CCCCC=C ZYBZYDVRLQSWGG-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- OMWBUWDHEZIMGQ-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-c]pyridine-7-carbaldehyde Chemical compound O1CCOC2=C1C=C(C=O)N=C2 OMWBUWDHEZIMGQ-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 2
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical class C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 2
- AHIGMTHEFHHTFJ-UHFFFAOYSA-N 2-chloro-3,4-dihydro-2h-chromene;pyridine Chemical compound C1=CC=NC=C1.C1=CC=C2OC(Cl)CCC2=C1 AHIGMTHEFHHTFJ-UHFFFAOYSA-N 0.000 description 2
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- HLTDBMHJSBSAOM-UHFFFAOYSA-N 2-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CC=N1 HLTDBMHJSBSAOM-UHFFFAOYSA-N 0.000 description 2
- OYERWNJQHGYSPX-UHFFFAOYSA-N 2-oxo-1h-pyrido[3,4-b][1,4]thiazine-7-carbaldehyde Chemical compound N1C(=O)CSC2=C1C=C(C=O)N=C2 OYERWNJQHGYSPX-UHFFFAOYSA-N 0.000 description 2
- HRHFUHGNTSSIFS-UHFFFAOYSA-N 2h-thiazine 1-oxide Chemical group O=S1NC=CC=C1 HRHFUHGNTSSIFS-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- IMLXLGZJLAOKJN-UHFFFAOYSA-N 4-aminocyclohexan-1-ol Chemical compound NC1CCC(O)CC1 IMLXLGZJLAOKJN-UHFFFAOYSA-N 0.000 description 2
- KNDOFJFSHZCKGT-UHFFFAOYSA-N 4-chloroquinoline Chemical compound C1=CC=C2C(Cl)=CC=NC2=C1 KNDOFJFSHZCKGT-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SSMACLPPRSQXHH-UHFFFAOYSA-N 6-methoxy-1h-1,5-naphthyridin-4-one Chemical compound N1C=CC(=O)C2=NC(OC)=CC=C21 SSMACLPPRSQXHH-UHFFFAOYSA-N 0.000 description 2
- PHGNGVYUHOARGF-UHFFFAOYSA-N 6-methoxyquinolin-4-amine Chemical compound N1=CC=C(N)C2=CC(OC)=CC=C21 PHGNGVYUHOARGF-UHFFFAOYSA-N 0.000 description 2
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 2
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 2
- WXPVIEIATAOIBY-UHFFFAOYSA-N 7-bromo-2h-pyrido[2,3-e]thiazine 1-oxide Chemical compound C1=CNS(=O)C2=CC(Br)=CN=C21 WXPVIEIATAOIBY-UHFFFAOYSA-N 0.000 description 2
- PVFOHMXILQEIHX-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-bromophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Br PVFOHMXILQEIHX-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- 238000007341 Heck reaction Methods 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- ZKJOXOJMGXFSPF-QYZPTAICSA-N [[(2r,3r,4r,5r)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2r,3s,4r,5r)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;hydrate Chemical compound O.NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](OP(O)(O)=O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 ZKJOXOJMGXFSPF-QYZPTAICSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 2
- PQBSPTAPCMSZAA-UHFFFAOYSA-N benzyl n-hydroxycarbamate Chemical compound ONC(=O)OCC1=CC=CC=C1 PQBSPTAPCMSZAA-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 2
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 2
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- VUSWCWPCANWBFG-UHFFFAOYSA-N cyclohex-3-ene-1-carboxylic acid Chemical compound OC(=O)C1CCC=CC1 VUSWCWPCANWBFG-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- DAKIDYQCFJQMDF-UHFFFAOYSA-N dichloromethane;pyridine Chemical compound ClCCl.C1=CC=NC=C1 DAKIDYQCFJQMDF-UHFFFAOYSA-N 0.000 description 2
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 2
- 150000002013 dioxins Chemical class 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 238000006197 hydroboration reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- UFSVRHNRNVVBJR-UHFFFAOYSA-N methyl 3-oxo-4h-1,4-benzothiazine-6-carboxylate Chemical compound S1CC(=O)NC2=CC(C(=O)OC)=CC=C21 UFSVRHNRNVVBJR-UHFFFAOYSA-N 0.000 description 2
- RLNKFHZYSZFLTL-UHFFFAOYSA-N methyl 6-amino-3,5-dibromopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(N)=C(Br)C=C1Br RLNKFHZYSZFLTL-UHFFFAOYSA-N 0.000 description 2
- SYDZNYACMNJDDT-UHFFFAOYSA-N methyl 7-bromo-3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylate Chemical compound N1C(=O)CSC2=C1N=C(C(=O)OC)C(Br)=C2 SYDZNYACMNJDDT-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- SDGLZYZMEJGJDJ-UHFFFAOYSA-N n-hexylcyclohexanamine Chemical group CCCCCCNC1CCCCC1 SDGLZYZMEJGJDJ-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000007248 oxidative elimination reaction Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- PYNUOAIJIQGACY-UHFFFAOYSA-N propylazanium;chloride Chemical compound Cl.CCCN PYNUOAIJIQGACY-UHFFFAOYSA-N 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 150000003246 quinazolines Chemical class 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 2
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 2
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- RCIVUMDLBQZEHP-UHFFFAOYSA-N (2-methylpropan-2-yl)oxycarbamic acid Chemical compound CC(C)(C)ONC(O)=O RCIVUMDLBQZEHP-UHFFFAOYSA-N 0.000 description 1
- WYMKHSIYVBXRPS-UHFFFAOYSA-N (2-oxo-1h-pyrido[3,4-b][1,4]thiazin-7-yl)methyl acetate Chemical compound N1C(=O)CSC2=C1C=C(COC(=O)C)N=C2 WYMKHSIYVBXRPS-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- AJMUOCPQJLMMIB-UHFFFAOYSA-N (6-carbamoylcyclohex-2-en-1-yl) acetate Chemical compound CC(=O)OC1C=CCCC1C(N)=O AJMUOCPQJLMMIB-UHFFFAOYSA-N 0.000 description 1
- WZLCIBVIRRXDOG-UHFFFAOYSA-N (8-fluoro-6-methoxyquinolin-4-yl) trifluoromethanesulfonate Chemical compound N1=CC=C(OS(=O)(=O)C(F)(F)F)C2=CC(OC)=CC(F)=C21 WZLCIBVIRRXDOG-UHFFFAOYSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- VGKAFMKRSZAHRU-UHFFFAOYSA-N 1,2,3-benzothiadiazol-5-ylmethyl methanesulfonate Chemical compound CS(=O)(=O)OCC1=CC=C2SN=NC2=C1 VGKAFMKRSZAHRU-UHFFFAOYSA-N 0.000 description 1
- BWKIBIZZLRPKFY-UHFFFAOYSA-N 1,2,3-benzothiadiazole-5-carbaldehyde Chemical compound O=CC1=CC=C2SN=NC2=C1 BWKIBIZZLRPKFY-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical class NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- RBIZQDIIVYJNRS-UHFFFAOYSA-N 1,3-benzothiazole-5-carboxylic acid Chemical compound OC(=O)C1=CC=C2SC=NC2=C1 RBIZQDIIVYJNRS-UHFFFAOYSA-N 0.000 description 1
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 1
- HIZVCIIORGCREW-UHFFFAOYSA-N 1,4-dioxene Chemical compound C1COC=CO1 HIZVCIIORGCREW-UHFFFAOYSA-N 0.000 description 1
- KFAJXZVDBVRZRC-UHFFFAOYSA-N 1,5-naphthyridin-4-amine Chemical compound C1=CN=C2C(N)=CC=NC2=C1 KFAJXZVDBVRZRC-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- VKBXAHZIEKTJSX-UHFFFAOYSA-N 1-ethenylperoxybutane Chemical class CCCCOOC=C VKBXAHZIEKTJSX-UHFFFAOYSA-N 0.000 description 1
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 1
- SCERXXJYTIPEQY-UHFFFAOYSA-N 1-oxo-2h-isoquinoline-3-carbaldehyde Chemical compound C1=CC=C2C(=O)NC(C=O)=CC2=C1 SCERXXJYTIPEQY-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- PMZDQRJGMBOQBF-UHFFFAOYSA-N 1H-quinolin-4-one Natural products C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- NSPLFNGUPLZYHV-UHFFFAOYSA-N 1h-1,5-naphthyridin-4-one Chemical compound C1=CN=C2C(O)=CC=NC2=C1 NSPLFNGUPLZYHV-UHFFFAOYSA-N 0.000 description 1
- UFMBERDMCRCVSM-UHFFFAOYSA-N 1h-cinnolin-4-one Chemical compound C1=CC=C2C(O)=CN=NC2=C1 UFMBERDMCRCVSM-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- ATTNRYFIYJHUOG-UHFFFAOYSA-N 1h-pyrrolo[2,3-b]pyridine-2-carbaldehyde Chemical compound C1=CN=C2NC(C=O)=CC2=C1 ATTNRYFIYJHUOG-UHFFFAOYSA-N 0.000 description 1
- DXMRZBGFYBCTLR-UHFFFAOYSA-N 1h-pyrrolo[2,3-b]pyridine-2-carboxylic acid Chemical compound C1=CN=C2NC(C(=O)O)=CC2=C1 DXMRZBGFYBCTLR-UHFFFAOYSA-N 0.000 description 1
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical compound C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
- GEFIFDVQYCPLHC-UHFFFAOYSA-N 2,1,3-benzothiadiazole-5-carbaldehyde Chemical compound C1=C(C=O)C=CC2=NSN=C21 GEFIFDVQYCPLHC-UHFFFAOYSA-N 0.000 description 1
- YHMXJZVGBCACMT-UHFFFAOYSA-N 2,1,3-benzothiadiazole-5-carboxylic acid Chemical compound C1=C(C(=O)O)C=CC2=NSN=C21 YHMXJZVGBCACMT-UHFFFAOYSA-N 0.000 description 1
- FFLHNBGNAWYMRH-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-6-ylmethanol Chemical compound O1CCOC2=CC(CO)=CC=C21 FFLHNBGNAWYMRH-UHFFFAOYSA-N 0.000 description 1
- UKTOMKOGJYRREF-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-ylmethanol Chemical compound O1CCOC2=CC(CO)=CN=C21 UKTOMKOGJYRREF-UHFFFAOYSA-N 0.000 description 1
- SUDWZZCLUSUTBF-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-6-carbaldehyde Chemical compound O1CCOC2=NC(C=O)=CC=C21 SUDWZZCLUSUTBF-UHFFFAOYSA-N 0.000 description 1
- OZNRIAMVJSYDHX-UHFFFAOYSA-N 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carbaldehyde Chemical compound O1CCOC2=CC(C=O)=CN=C21 OZNRIAMVJSYDHX-UHFFFAOYSA-N 0.000 description 1
- DBIAVKUZUAPQBN-UHFFFAOYSA-N 2-(2-iodo-6-methylpyridin-3-yl)oxyethanol Chemical compound CC1=CC=C(OCCO)C(I)=N1 DBIAVKUZUAPQBN-UHFFFAOYSA-N 0.000 description 1
- FPCJRQJTKHVZGV-UHFFFAOYSA-N 2-(4-aminocyclohexyl)-1-(6-methoxyquinolin-4-yl)ethanone;hydrochloride Chemical compound Cl.C12=CC(OC)=CC=C2N=CC=C1C(=O)CC1CCC(N)CC1 FPCJRQJTKHVZGV-UHFFFAOYSA-N 0.000 description 1
- OBTZDIRUQWFRFZ-UHFFFAOYSA-N 2-(5-methylfuran-2-yl)-n-(4-methylphenyl)quinoline-4-carboxamide Chemical compound O1C(C)=CC=C1C1=CC(C(=O)NC=2C=CC(C)=CC=2)=C(C=CC=C2)C2=N1 OBTZDIRUQWFRFZ-UHFFFAOYSA-N 0.000 description 1
- QANDFEYEAYUSKD-UHFFFAOYSA-N 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one Chemical compound C1=CC=CC2=NC(CCl)=CC(=O)N21 QANDFEYEAYUSKD-UHFFFAOYSA-N 0.000 description 1
- VUWIHBMHDCCKDK-UHFFFAOYSA-N 2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)cyclohexyl]-1-(6-methoxyquinolin-4-yl)ethanone Chemical compound O1CCOC2=CC(CNC3CCC(CC3)CC(=O)C3=CC=NC4=CC=C(C=C43)OC)=CC=C21 VUWIHBMHDCCKDK-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 description 1
- WJRVHFJZHFWCMS-UHFFFAOYSA-N 2-amino-6-methylpyridin-3-ol Chemical compound CC1=CC=C(O)C(N)=N1 WJRVHFJZHFWCMS-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical group FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- APIOQYRJKMQRPP-UHFFFAOYSA-N 2-ethylhept-4-enoic acid Chemical compound CCC=CCC(CC)C(O)=O APIOQYRJKMQRPP-UHFFFAOYSA-N 0.000 description 1
- REIVHYDACHXPNH-UHFFFAOYSA-N 2-fluoro-4-hydroxybenzonitrile Chemical compound OC1=CC=C(C#N)C(F)=C1 REIVHYDACHXPNH-UHFFFAOYSA-N 0.000 description 1
- YWUVOJJHVFLNJA-UHFFFAOYSA-N 2-fluoro-4-methoxyaniline Chemical compound COC1=CC=C(N)C(F)=C1 YWUVOJJHVFLNJA-UHFFFAOYSA-N 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- HRZOWBGCOJWHDY-UHFFFAOYSA-N 2-iodo-6-methylpyridin-3-ol Chemical compound CC1=CC=C(O)C(I)=N1 HRZOWBGCOJWHDY-UHFFFAOYSA-N 0.000 description 1
- XYBYNVQWRLVUCY-UHFFFAOYSA-N 2-methoxy-1,5-naphthyridine Chemical class N1=CC=CC2=NC(OC)=CC=C21 XYBYNVQWRLVUCY-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- PQMUQDZBLMQFKU-UHFFFAOYSA-N 2-oxo-1h-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde Chemical compound O1CC(=O)NC2=CC(C=O)=CN=C21 PQMUQDZBLMQFKU-UHFFFAOYSA-N 0.000 description 1
- HPXKNLCQHHPJFS-UHFFFAOYSA-N 2-oxo-1h-pyrido[2,3-b][1,4]oxazine-7-carboxylic acid Chemical compound O1CC(=O)NC2=CC(C(=O)O)=CN=C21 HPXKNLCQHHPJFS-UHFFFAOYSA-N 0.000 description 1
- WNMJMALKSRJXGO-UHFFFAOYSA-N 2-oxo-1h-pyrido[2,3-b][1,4]thiazine-7-carbaldehyde Chemical compound S1CC(=O)NC2=CC(C=O)=CN=C21 WNMJMALKSRJXGO-UHFFFAOYSA-N 0.000 description 1
- DIAWKFCBVNKMDH-UHFFFAOYSA-N 2-oxo-1h-pyrido[2,3-b][1,4]thiazine-7-carboxylic acid Chemical compound S1CC(=O)NC2=CC(C(=O)O)=CN=C21 DIAWKFCBVNKMDH-UHFFFAOYSA-N 0.000 description 1
- TYEYBOSBBBHJIV-UHFFFAOYSA-M 2-oxobutanoate Chemical compound CCC(=O)C([O-])=O TYEYBOSBBBHJIV-UHFFFAOYSA-M 0.000 description 1
- VSEMIHGYAJPPRV-UHFFFAOYSA-N 2-phenylmethoxycarbonyl-3-oxa-2-azabicyclo[2.2.2]oct-5-ene-4-carboxylic acid Chemical compound C1=CC(C(=O)O)(O2)CCC1N2C(=O)OCC1=CC=CC=C1 VSEMIHGYAJPPRV-UHFFFAOYSA-N 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- MJNPHLBKHKJDEF-UHFFFAOYSA-N 2h-1$l^{4},2-benzothiazine 1-oxide Chemical class C1=CC=C2S(=O)NC=CC2=C1 MJNPHLBKHKJDEF-UHFFFAOYSA-N 0.000 description 1
- PCJFEVUKVKQSSL-UHFFFAOYSA-N 2h-1,2,4-oxadiazol-5-one Chemical class O=C1N=CNO1 PCJFEVUKVKQSSL-UHFFFAOYSA-N 0.000 description 1
- ZAISDHPZTZIFQF-UHFFFAOYSA-N 2h-1,4-thiazine Chemical compound C1SC=CN=C1 ZAISDHPZTZIFQF-UHFFFAOYSA-N 0.000 description 1
- TUVZNNYNOBQWNP-UHFFFAOYSA-N 3,4-dihydro-2h-1,4-benzothiazine-6-carbaldehyde Chemical compound S1CCNC2=CC(C=O)=CC=C21 TUVZNNYNOBQWNP-UHFFFAOYSA-N 0.000 description 1
- CEGQHVBQSZACAR-UHFFFAOYSA-N 3,4-dihydro-2h-1,4-benzoxazin-6-ylmethanol Chemical compound O1CCNC2=CC(CO)=CC=C21 CEGQHVBQSZACAR-UHFFFAOYSA-N 0.000 description 1
- MDLWSTPFRBDHQK-UHFFFAOYSA-N 3,4-dihydro-2h-1,4-benzoxazine-6-carbaldehyde Chemical compound O1CCNC2=CC(C=O)=CC=C21 MDLWSTPFRBDHQK-UHFFFAOYSA-N 0.000 description 1
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- QXFAUYDDBRQBEV-UHFFFAOYSA-N 3-ethyl-2-(methoxymethoxy)-6-methylbenzoic acid Chemical compound CCC1=CC=C(C)C(C(O)=O)=C1OCOC QXFAUYDDBRQBEV-UHFFFAOYSA-N 0.000 description 1
- YZEVAVNJHBUZFP-UHFFFAOYSA-N 3-ethyl-2-hydroxy-6-methylbenzoic acid Chemical compound CCC1=CC=C(C)C(C(O)=O)=C1O YZEVAVNJHBUZFP-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- QBPDSKPWYWIHGA-UHFFFAOYSA-N 3-hydroxy-2-nitropyridine Chemical compound OC1=CC=CN=C1[N+]([O-])=O QBPDSKPWYWIHGA-UHFFFAOYSA-N 0.000 description 1
- WZMGQHIBXUAYGS-UHFFFAOYSA-N 3-hydroxy-6-methyl-2-nitropyridine Chemical compound CC1=CC=C(O)C([N+]([O-])=O)=N1 WZMGQHIBXUAYGS-UHFFFAOYSA-N 0.000 description 1
- QRMRRLXXFHXMBC-UHFFFAOYSA-N 3-methyl-1,3-benzoxazol-2-one Chemical compound C1=CC=C2OC(=O)N(C)C2=C1 QRMRRLXXFHXMBC-UHFFFAOYSA-N 0.000 description 1
- VNHQFRPZBXFNTO-UHFFFAOYSA-N 3-methyl-2-oxo-1,3-benzoxazole-6-carbaldehyde Chemical compound C1=C(C=O)C=C2OC(=O)N(C)C2=C1 VNHQFRPZBXFNTO-UHFFFAOYSA-N 0.000 description 1
- NBIVLYUEDPRLGI-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=CC(C(=O)O)=CC=C21 NBIVLYUEDPRLGI-UHFFFAOYSA-N 0.000 description 1
- FEXJVEZCIWUQMB-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-sulfonyl chloride Chemical compound S1CC(=O)NC2=CC(S(=O)(=O)Cl)=CC=C21 FEXJVEZCIWUQMB-UHFFFAOYSA-N 0.000 description 1
- VHKABBARGFUYOF-UHFFFAOYSA-N 3-oxo-4h-1,4-benzoxazine-6-carbaldehyde Chemical compound O1CC(=O)NC2=CC(C=O)=CC=C21 VHKABBARGFUYOF-UHFFFAOYSA-N 0.000 description 1
- XOXXGNIBXYQQNS-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde Chemical compound O1CC(=O)NC2=NC(C=O)=CC=C21 XOXXGNIBXYQQNS-UHFFFAOYSA-N 0.000 description 1
- VEPGNAIYGRUSIA-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=NC(C=O)=CC=C21 VEPGNAIYGRUSIA-UHFFFAOYSA-N 0.000 description 1
- SZHYPQDQYNLZJP-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=NC(C(=O)O)=CC=C21 SZHYPQDQYNLZJP-UHFFFAOYSA-N 0.000 description 1
- AMVLEBHYELFWJT-UHFFFAOYSA-N 3-propan-2-yloxy-4-tributylstannylcyclobut-3-ene-1,2-dione Chemical compound CCCC[Sn](CCCC)(CCCC)C1=C(OC(C)C)C(=O)C1=O AMVLEBHYELFWJT-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- KXMRDHPZQHAXML-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid Chemical compound CC(C)(C)OC(=O)NC1CCC(C(O)=O)CC1 KXMRDHPZQHAXML-UHFFFAOYSA-N 0.000 description 1
- HFIMVACULPHMOS-UHFFFAOYSA-N 4-amino-n-(6-methoxy-1,5-naphthyridin-4-yl)cyclohexane-1-carboxamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1CCC(N)CC1 HFIMVACULPHMOS-UHFFFAOYSA-N 0.000 description 1
- QTTGNHJEOUHELV-UHFFFAOYSA-N 4-amino-n-(6-methoxyquinolin-4-yl)cyclohexane-1-carboxamide Chemical compound C12=CC(OC)=CC=C2N=CC=C1NC(=O)C1CCC(N)CC1 QTTGNHJEOUHELV-UHFFFAOYSA-N 0.000 description 1
- KZTQEZIXZVBFQS-UHFFFAOYSA-N 4-amino-n-(8-fluoro-6-methoxyquinolin-4-yl)cyclohexane-1-carboxamide Chemical compound C12=CC(OC)=CC(F)=C2N=CC=C1NC(=O)C1CCC(N)CC1 KZTQEZIXZVBFQS-UHFFFAOYSA-N 0.000 description 1
- GVRRXASZZAKBMN-UHFFFAOYSA-N 4-chloroquinazoline Chemical compound C1=CC=C2C(Cl)=NC=NC2=C1 GVRRXASZZAKBMN-UHFFFAOYSA-N 0.000 description 1
- YTHJCZRFJGXPTL-UHFFFAOYSA-N 4-hydroxy-3-nitrobenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1[N+]([O-])=O YTHJCZRFJGXPTL-UHFFFAOYSA-N 0.000 description 1
- DJBWLCIMJMMOLF-UHFFFAOYSA-N 4-hydroxy-6-methylpyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)N(O)C2=NC(C)=CC=C21 DJBWLCIMJMMOLF-UHFFFAOYSA-N 0.000 description 1
- DBJMEBUKQVZWMD-UHFFFAOYSA-N 4-methyl-1,4-benzoxazin-3-one Chemical compound C1=CC=C2N(C)C(=O)COC2=C1 DBJMEBUKQVZWMD-UHFFFAOYSA-N 0.000 description 1
- GTFMIJNXNMDHAB-UHFFFAOYSA-N 4h-1,4-benzothiazin-3-one Chemical compound C1=CC=C2NC(=O)CSC2=C1 GTFMIJNXNMDHAB-UHFFFAOYSA-N 0.000 description 1
- HCSNKZQUWQGJRU-UHFFFAOYSA-N 4h-1,4-benzoxazine-6-carbaldehyde Chemical compound O1C=CNC2=CC(C=O)=CC=C21 HCSNKZQUWQGJRU-UHFFFAOYSA-N 0.000 description 1
- FBXGQDUVJBKEAJ-UHFFFAOYSA-N 4h-oxazin-3-one Chemical compound O=C1CC=CON1 FBXGQDUVJBKEAJ-UHFFFAOYSA-N 0.000 description 1
- FHZIDNIJVVSXDL-UHFFFAOYSA-N 4h-pyrido[2,3-e]oxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=N1 FHZIDNIJVVSXDL-UHFFFAOYSA-N 0.000 description 1
- YUVDZHWQKUGEJK-UHFFFAOYSA-N 4h-pyrido[2,3-e]thiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=N1 YUVDZHWQKUGEJK-UHFFFAOYSA-N 0.000 description 1
- FLDSMVTWEZKONL-AWEZNQCLSA-N 5,5-dimethyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,4,7,8-tetrahydrooxepino[4,5-c]pyrazole-3-carboxamide Chemical compound CC1(CC2=C(NN=C2C(=O)N[C@@H]2C(N(C3=C(OC2)C=CC=C3)C)=O)CCO1)C FLDSMVTWEZKONL-AWEZNQCLSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- HCWFDMJNYDNDOB-UHFFFAOYSA-N 5-amino-2-fluoro-4-hydroxybenzonitrile Chemical compound NC1=CC(C#N)=C(F)C=C1O HCWFDMJNYDNDOB-UHFFFAOYSA-N 0.000 description 1
- KXBXUHWCODHRHK-UHFFFAOYSA-N 5-bromo-3-hydroxy-1h-pyridin-2-one Chemical compound OC1=CC(Br)=CNC1=O KXBXUHWCODHRHK-UHFFFAOYSA-N 0.000 description 1
- RIUFOUJMGXWZCJ-UHFFFAOYSA-N 5-fluoro-2-methyl-1-oxidopyridin-1-ium Chemical compound CC1=CC=C(F)C=[N+]1[O-] RIUFOUJMGXWZCJ-UHFFFAOYSA-N 0.000 description 1
- BWNXTHJYONDSFG-UHFFFAOYSA-N 5-fluoro-2-methyl-4-nitro-1-oxidopyridin-1-ium Chemical compound CC1=CC([N+]([O-])=O)=C(F)C=[N+]1[O-] BWNXTHJYONDSFG-UHFFFAOYSA-N 0.000 description 1
- LXAHHHIGZXPRKQ-UHFFFAOYSA-N 5-fluoro-2-methylpyridine Chemical compound CC1=CC=C(F)C=N1 LXAHHHIGZXPRKQ-UHFFFAOYSA-N 0.000 description 1
- GMYHFMYEZAGTBN-UHFFFAOYSA-N 5-hydroxy-4-oxo-1h-pyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC(=O)C(O)=CN1 GMYHFMYEZAGTBN-UHFFFAOYSA-N 0.000 description 1
- YPXQSGWOGQPLQO-UHFFFAOYSA-N 5-nitro-1,3-dihydrobenzimidazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2N=C(S)NC2=C1 YPXQSGWOGQPLQO-UHFFFAOYSA-N 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- FDHINJNZZCOWOA-UHFFFAOYSA-N 6-(hydroxymethyl)-4h-1,4-benzothiazin-3-one Chemical compound S1CC(=O)NC2=CC(CO)=CC=C21 FDHINJNZZCOWOA-UHFFFAOYSA-N 0.000 description 1
- AWDQNVRPXBMZPW-UHFFFAOYSA-N 6-(hydroxymethyl)-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(CO)=CC=C21 AWDQNVRPXBMZPW-UHFFFAOYSA-N 0.000 description 1
- VPOGMOJKALOBMB-VOTSOKGWSA-N 6-[(e)-2-phenylethenyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound N1=C2NC(=O)COC2=CC=C1\C=C\C1=CC=CC=C1 VPOGMOJKALOBMB-VOTSOKGWSA-N 0.000 description 1
- SXKGMTDVECHQRI-UHFFFAOYSA-N 6-amino-5-bromopyridine-2-carboxylic acid Chemical compound NC1=NC(C(O)=O)=CC=C1Br SXKGMTDVECHQRI-UHFFFAOYSA-N 0.000 description 1
- GSGNTVQLHGOEMB-UHFFFAOYSA-N 6-bromo-2-nitropyridin-3-ol Chemical compound OC1=CC=C(Br)N=C1[N+]([O-])=O GSGNTVQLHGOEMB-UHFFFAOYSA-N 0.000 description 1
- GDVHYNCHZKTTSQ-UHFFFAOYSA-N 6-bromo-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(Br)=CC=C21 GDVHYNCHZKTTSQ-UHFFFAOYSA-N 0.000 description 1
- IWBRMEJPAIVOFZ-UHFFFAOYSA-N 6-fluoro-2,3-dihydro-1,4-benzodioxine Chemical compound O1CCOC2=CC(F)=CC=C21 IWBRMEJPAIVOFZ-UHFFFAOYSA-N 0.000 description 1
- ZBNJTKYTUUSFFG-UHFFFAOYSA-N 6-fluoro-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde Chemical compound O1CCOC2=C1C=C(F)C(C=O)=C2 ZBNJTKYTUUSFFG-UHFFFAOYSA-N 0.000 description 1
- RVTLXJLNIDCHKT-UHFFFAOYSA-N 6-methoxy-1h-quinolin-4-one Chemical compound N1=CC=C(O)C2=CC(OC)=CC=C21 RVTLXJLNIDCHKT-UHFFFAOYSA-N 0.000 description 1
- TZRSKDVHKGYCON-LBPRGKRZSA-N 6-methoxy-4-[(2r)-oxiran-2-yl]quinoline Chemical compound C12=CC(OC)=CC=C2N=CC=C1[C@@H]1CO1 TZRSKDVHKGYCON-LBPRGKRZSA-N 0.000 description 1
- YJYWRWLGTIUUMZ-UHFFFAOYSA-N 6-methyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine Chemical compound O1CCOC2=NC(C)=CC=C21 YJYWRWLGTIUUMZ-UHFFFAOYSA-N 0.000 description 1
- JOVBARNMXQYDDI-UHFFFAOYSA-N 6-methyl-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(C)=CC=C21 JOVBARNMXQYDDI-UHFFFAOYSA-N 0.000 description 1
- ALORCYXBVANDDG-UHFFFAOYSA-N 6-methyl-5-oxido-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-5-ium Chemical compound O1CCOC2=[N+]([O-])C(C)=CC=C21 ALORCYXBVANDDG-UHFFFAOYSA-N 0.000 description 1
- UENBBJXGCWILBM-UHFFFAOYSA-N 6-methylpyridin-3-amine Chemical compound CC1=CC=C(N)C=N1 UENBBJXGCWILBM-UHFFFAOYSA-N 0.000 description 1
- NRZWECORTTWSEF-UHFFFAOYSA-N 6-nitro-1,3-benzodioxole-5-carbaldehyde Chemical compound C1=C(C=O)C([N+](=O)[O-])=CC2=C1OCO2 NRZWECORTTWSEF-UHFFFAOYSA-N 0.000 description 1
- BNDXSHPDRFLTRY-UHFFFAOYSA-N 7-(hydroxymethyl)-1h-pyrido[2,3-b][1,4]oxazin-2-one Chemical compound O1CC(=O)NC2=CC(CO)=CN=C21 BNDXSHPDRFLTRY-UHFFFAOYSA-N 0.000 description 1
- KKJXODIZHYFSRW-UHFFFAOYSA-N 7-(hydroxymethyl)-1h-pyrido[2,3-b][1,4]thiazin-2-one Chemical compound S1CC(=O)NC2=CC(CO)=CN=C21 KKJXODIZHYFSRW-UHFFFAOYSA-N 0.000 description 1
- ZJJRSJLBYMDCNY-UHFFFAOYSA-N 7-(hydroxymethyl)-1h-pyrido[3,4-b][1,4]thiazin-2-one Chemical compound N1C(=O)CSC2=C1C=C(CO)N=C2 ZJJRSJLBYMDCNY-UHFFFAOYSA-N 0.000 description 1
- PMNCDNRJLYPTDB-UHFFFAOYSA-N 7-bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine Chemical compound O1CCOC2=CC(Br)=CN=C21 PMNCDNRJLYPTDB-UHFFFAOYSA-N 0.000 description 1
- RTPVNSMEXOSTED-UHFFFAOYSA-N 7-bromo-3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=C1C=C(Br)C(C=O)=N2 RTPVNSMEXOSTED-UHFFFAOYSA-N 0.000 description 1
- QLJMNDBZNCJZMV-UHFFFAOYSA-N 7-bromo-3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound N1C(=O)CSC2=C1N=C(C(=O)O)C(Br)=C2 QLJMNDBZNCJZMV-UHFFFAOYSA-N 0.000 description 1
- SNUZUAUVNMCODC-UHFFFAOYSA-N 7-fluoro-3-oxo-4h-1,4-benzothiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=C1C=C(F)C(C=O)=C2 SNUZUAUVNMCODC-UHFFFAOYSA-N 0.000 description 1
- MVEOYFDOELKEJE-UHFFFAOYSA-N 7-fluoro-3-oxo-4h-1,4-benzothiazine-6-carboxylic acid Chemical compound N1C(=O)CSC2=C1C=C(C(=O)O)C(F)=C2 MVEOYFDOELKEJE-UHFFFAOYSA-N 0.000 description 1
- LIRPOUWIAUDIJY-UHFFFAOYSA-N 7-fluoro-3-oxo-4h-1,4-benzoxazine-6-carbonitrile Chemical compound O1CC(=O)NC2=C1C=C(F)C(C#N)=C2 LIRPOUWIAUDIJY-UHFFFAOYSA-N 0.000 description 1
- RWZKLTNQQDJZKY-UHFFFAOYSA-N 7-fluoro-3-oxo-4h-1,4-benzoxazine-6-carboxylic acid Chemical compound N1C(=O)COC2=C1C=C(C(=O)O)C(F)=C2 RWZKLTNQQDJZKY-UHFFFAOYSA-N 0.000 description 1
- FLUPXQVVVZWHNN-UHFFFAOYSA-N 7-fluoro-6-(hydroxymethyl)-4h-1,4-benzothiazin-3-one Chemical compound N1C(=O)CSC2=C1C=C(CO)C(F)=C2 FLUPXQVVVZWHNN-UHFFFAOYSA-N 0.000 description 1
- OTSOWKSBDVTLKA-UHFFFAOYSA-N 7-fluoro-6-(hydroxymethyl)-4h-1,4-benzoxazin-3-one Chemical compound N1C(=O)COC2=C1C=C(CO)C(F)=C2 OTSOWKSBDVTLKA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- YBRYISGEMXUBRF-UHFFFAOYSA-N 8-(methoxymethoxy)-1-oxo-2h-isoquinoline-3-carbaldehyde Chemical compound C1=C(C=O)NC(=O)C2=C1C=CC=C2OCOC YBRYISGEMXUBRF-UHFFFAOYSA-N 0.000 description 1
- RWDLOGDNLBMKML-UHFFFAOYSA-N 8-amino-1H-1,5-naphthyridin-2-one Chemical compound C1=CC(=O)NC2=C1N=CC=C2N RWDLOGDNLBMKML-UHFFFAOYSA-N 0.000 description 1
- XJLIRQPXSSUKAT-UHFFFAOYSA-N 8-amino-1H-1,5-naphthyridin-2-one hydrobromide Chemical compound Br.Nc1ccnc2ccc(=O)[nH]c12 XJLIRQPXSSUKAT-UHFFFAOYSA-N 0.000 description 1
- ROHNLVXQIAQBHB-UHFFFAOYSA-N 8-fluoro-6-methoxy-1h-quinolin-4-one Chemical compound N1C=CC(=O)C2=CC(OC)=CC(F)=C21 ROHNLVXQIAQBHB-UHFFFAOYSA-N 0.000 description 1
- WQXGYOZEIHRMHB-UHFFFAOYSA-N 8-hydroxy-3-(hydroxymethyl)-2h-isoquinolin-1-one Chemical compound C1=CC(O)=C2C(=O)NC(CO)=CC2=C1 WQXGYOZEIHRMHB-UHFFFAOYSA-N 0.000 description 1
- SLBPIHCMXPQAIQ-UHFFFAOYSA-N 8-hydroxyquinoline-2-carbaldehyde Chemical compound C1=C(C=O)N=C2C(O)=CC=CC2=C1 SLBPIHCMXPQAIQ-UHFFFAOYSA-N 0.000 description 1
- VSBFKPZWPPTBRS-UHFFFAOYSA-N 8-nitro-3-oxo-4h-1,4-benzoxazine-6-carbaldehyde Chemical compound N1C(=O)COC2=C1C=C(C=O)C=C2[N+](=O)[O-] VSBFKPZWPPTBRS-UHFFFAOYSA-N 0.000 description 1
- DFXQXFGFOLXAPO-UHFFFAOYSA-N 96-99-1 Chemical compound OC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 DFXQXFGFOLXAPO-UHFFFAOYSA-N 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 238000007125 Buchwald synthesis reaction Methods 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- TXDHPKUFDPAKLB-QDJMAMJDSA-N C(C(=O)O)(=O)O.OC(C[C@@H]1CC[C@H](CC1)NCC=1C=CC2=C(NC(CS2)=O)C1)C1=CC=NC2=CC=C(C=C12)OC Chemical compound C(C(=O)O)(=O)O.OC(C[C@@H]1CC[C@H](CC1)NCC=1C=CC2=C(NC(CS2)=O)C1)C1=CC=NC2=CC=C(C=C12)OC TXDHPKUFDPAKLB-QDJMAMJDSA-N 0.000 description 1
- FEYLUKDSKVSMSZ-KYZUINATSA-N CC(C)(C)OC(=O)N[C@H]1CC[C@H](N)CC1 Chemical compound CC(C)(C)OC(=O)N[C@H]1CC[C@H](N)CC1 FEYLUKDSKVSMSZ-KYZUINATSA-N 0.000 description 1
- CSGRHVLELICBRG-KYZUINATSA-N CC(C)(C)OC(=O)N[C@H]1CC[C@H](OC(N)=O)CC1 Chemical compound CC(C)(C)OC(=O)N[C@H]1CC[C@H](OC(N)=O)CC1 CSGRHVLELICBRG-KYZUINATSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 238000006809 Jones oxidation reaction Methods 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- HRTSEAQTLGOMOT-YHSIFKNPSA-N OC(=O)C(O)=O.C1=CC=C(O)C2=NC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 Chemical compound OC(=O)C(O)=O.C1=CC=C(O)C2=NC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 HRTSEAQTLGOMOT-YHSIFKNPSA-N 0.000 description 1
- TYGOHADRMOSXTK-BHQIMSFRSA-N OC(=O)C(O)=O.C1=CC=CC2=NC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC(=O)N21 Chemical compound OC(=O)C(O)=O.C1=CC=CC2=NC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC(=O)N21 TYGOHADRMOSXTK-BHQIMSFRSA-N 0.000 description 1
- FHRHRZWOIIPEJP-MSINBHCJSA-N OC(=O)C(O)=O.COc1ccc2nccc(C(O)C[C@H]3CC[C@@H](CC3)NCc3ccc4OCCOc4c3)c2c1 Chemical class OC(=O)C(O)=O.COc1ccc2nccc(C(O)C[C@H]3CC[C@@H](CC3)NCc3ccc4OCCOc4c3)c2c1 FHRHRZWOIIPEJP-MSINBHCJSA-N 0.000 description 1
- NEBDMIVGGPVASB-BHQIMSFRSA-N OC(=O)C(O)=O.COc1ccc2nccc(NC(=O)[C@H]3CC[C@@H](CC3)NCc3ccc4scnc4c3)c2n1 Chemical compound OC(=O)C(O)=O.COc1ccc2nccc(NC(=O)[C@H]3CC[C@@H](CC3)NCc3ccc4scnc4c3)c2n1 NEBDMIVGGPVASB-BHQIMSFRSA-N 0.000 description 1
- DAOBCFLPIGWQQS-UHFFFAOYSA-N OC(=O)C(O)=O.N1=CC=C(N)C2=NC(OC)=CC=C21 Chemical compound OC(=O)C(O)=O.N1=CC=C(N)C2=NC(OC)=CC=C21 DAOBCFLPIGWQQS-UHFFFAOYSA-N 0.000 description 1
- KAVSAAZIQTZVHP-FFPCIGOZSA-N OC(=O)C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)CC(=O)C3=CC=NC4=CC=C(C=C43)OC)=CC=C21 Chemical compound OC(=O)C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)CC(=O)C3=CC=NC4=CC=C(C=C43)OC)=CC=C21 KAVSAAZIQTZVHP-FFPCIGOZSA-N 0.000 description 1
- DIFBMNUMRDIHDB-GVVKCMBXSA-N OC(=O)C(O)=O.OC(=O)C(O)=O.N([C@H]1CC[C@@H](CC1)C(=O)NC1=CC=NC2=CC=C(N=C21)OC)CC(C(=C1)N)=CC2=C1OCO2 Chemical compound OC(=O)C(O)=O.OC(=O)C(O)=O.N([C@H]1CC[C@@H](CC1)C(=O)NC1=CC=NC2=CC=C(N=C21)OC)CC(C(=C1)N)=CC2=C1OCO2 DIFBMNUMRDIHDB-GVVKCMBXSA-N 0.000 description 1
- AHVILQCELIOBPI-RKQOQJRBSA-N OC(=O)C(O)=O.OC(=O)C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OCCCN)=CC=C21 Chemical compound OC(=O)C(O)=O.OC(=O)C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OCCCN)=CC=C21 AHVILQCELIOBPI-RKQOQJRBSA-N 0.000 description 1
- RVMRFMLBNKSUHF-PWOCQYLMSA-N OC(=O)\C=C\C(O)=O.C1=CC2=NSN=C2C=C1CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)C=C21 Chemical compound OC(=O)\C=C\C(O)=O.C1=CC2=NSN=C2C=C1CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)C=C21 RVMRFMLBNKSUHF-PWOCQYLMSA-N 0.000 description 1
- LXBVBRUKQGZMFH-WEOYRCIXSA-N OC(=O)\C=C\C(O)=O.C1=CC2=NSN=C2C=C1CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)N=C21 Chemical compound OC(=O)\C=C\C(O)=O.C1=CC2=NSN=C2C=C1CN[C@H](CC1)CC[C@@H]1C(=O)NC1=CC=NC2=CC=C(OC)N=C21 LXBVBRUKQGZMFH-WEOYRCIXSA-N 0.000 description 1
- VYRXJMPXZZSSAB-SZMMGDFBSA-N OC(=O)\C=C\C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(C=C43)OC)=CC=C21 Chemical compound OC(=O)\C=C\C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(C=C43)OC)=CC=C21 VYRXJMPXZZSSAB-SZMMGDFBSA-N 0.000 description 1
- URKFJVIQXBSUOQ-LLMDCOBBSA-N OC(=O)\C=C\C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 Chemical compound OC(=O)\C=C\C(O)=O.O1CCOC2=CC(CN[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 URKFJVIQXBSUOQ-LLMDCOBBSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- VOZMETOQQCEOLY-SHTZXODSSA-N S1CC(=O)NC2=CC(S(=O)(=O)N[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 Chemical compound S1CC(=O)NC2=CC(S(=O)(=O)N[C@H]3CC[C@@H](CC3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 VOZMETOQQCEOLY-SHTZXODSSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 238000006619 Stille reaction Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- VKIJXFIYBAYHOE-VOTSOKGWSA-N [(e)-2-phenylethenyl]boronic acid Chemical compound OB(O)\C=C\C1=CC=CC=C1 VKIJXFIYBAYHOE-VOTSOKGWSA-N 0.000 description 1
- WIHSJOJPJPJGHY-UHFFFAOYSA-N [1,3]thiazolo[5,4-b]pyridin-6-ylmethanol Chemical compound OCC1=CN=C2SC=NC2=C1 WIHSJOJPJPJGHY-UHFFFAOYSA-N 0.000 description 1
- ZQEDOHPOEKLDSP-UHFFFAOYSA-N [1,3]thiazolo[5,4-b]pyridine-6-carbaldehyde Chemical compound O=CC1=CN=C2SC=NC2=C1 ZQEDOHPOEKLDSP-UHFFFAOYSA-N 0.000 description 1
- QWRYXSDXSBMOOL-UHFFFAOYSA-N [1,4]dioxino[2,3-b]pyridine Chemical group C1=CC=C2OC=COC2=N1 QWRYXSDXSBMOOL-UHFFFAOYSA-N 0.000 description 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- QQTVULAMCGLGLN-UHFFFAOYSA-N acetonitrile;tetrachloromethane;hydrate Chemical compound O.CC#N.ClC(Cl)(Cl)Cl QQTVULAMCGLGLN-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- QGTWQXTXRILXOV-UHFFFAOYSA-N benzyl n-(3-bromopropyl)carbamate Chemical compound BrCCCNC(=O)OCC1=CC=CC=C1 QGTWQXTXRILXOV-UHFFFAOYSA-N 0.000 description 1
- NRPCQJMFESUTCI-UHFFFAOYSA-N benzyl n-[3-[(8-amino-1,5-naphthyridin-2-yl)oxy]propyl]carbamate Chemical compound N1=C2C(N)=CC=NC2=CC=C1OCCCNC(=O)OCC1=CC=CC=C1 NRPCQJMFESUTCI-UHFFFAOYSA-N 0.000 description 1
- CFUBCFFTSOIDCR-UHFFFAOYSA-N benzyl n-[3-[[8-[(4-aminocyclohexanecarbonyl)amino]-1,5-naphthyridin-2-yl]oxy]propyl]carbamate Chemical compound C1CC(N)CCC1C(=O)NC(C1=N2)=CC=NC1=CC=C2OCCCNC(=O)OCC1=CC=CC=C1 CFUBCFFTSOIDCR-UHFFFAOYSA-N 0.000 description 1
- OMWNJTRVDYRHAB-UHFFFAOYSA-N benzyl n-[3-[[8-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexanecarbonyl]amino]-1,5-naphthyridin-2-yl]oxy]propyl]carbamate Chemical compound C1CC(NC(=O)OC(C)(C)C)CCC1C(=O)NC(C1=N2)=CC=NC1=CC=C2OCCCNC(=O)OCC1=CC=CC=C1 OMWNJTRVDYRHAB-UHFFFAOYSA-N 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 150000001277 beta hydroxy acids Chemical class 0.000 description 1
- 239000003781 beta lactamase inhibitor Substances 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical group BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- NMQQBXHZBNUXGJ-UHFFFAOYSA-N buta-1,3-dienyl acetate Chemical compound CC(=O)OC=CC=C NMQQBXHZBNUXGJ-UHFFFAOYSA-N 0.000 description 1
- HGXJOXHYPGNVNK-UHFFFAOYSA-N butane;ethenoxyethane;tin Chemical compound CCCC[Sn](CCCC)(CCCC)C(=C)OCC HGXJOXHYPGNVNK-UHFFFAOYSA-N 0.000 description 1
- CWVOWMRQOPBSFS-UHFFFAOYSA-N butyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxylate Chemical compound O1CCOC2=CC(C(=O)OCCCC)=CN=C21 CWVOWMRQOPBSFS-UHFFFAOYSA-N 0.000 description 1
- NWCPGWHEGZTLNQ-UHFFFAOYSA-N butyl 2-acetyloxycyclohex-3-ene-1-carboxylate Chemical compound CCCCOC(=O)C1CCC=CC1OC(C)=O NWCPGWHEGZTLNQ-UHFFFAOYSA-N 0.000 description 1
- MPOUJKQFBFWRKD-UHFFFAOYSA-N butyl cyclohexa-1,3-diene-1-carboxylate Chemical compound CCCCOC(=O)C1=CC=CCC1 MPOUJKQFBFWRKD-UHFFFAOYSA-N 0.000 description 1
- BAYITFMVHKKBGM-UHFFFAOYSA-N butyl n-(4-oxocyclohexyl)carbamate Chemical compound CCCCOC(=O)NC1CCC(=O)CC1 BAYITFMVHKKBGM-UHFFFAOYSA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- PSEHHVRCDVOTID-UHFFFAOYSA-N chloro-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane Chemical compound CC1C(C2(C)C)CC2CC1B(Cl)C(C1C)CC2C(C)(C)C1C2 PSEHHVRCDVOTID-UHFFFAOYSA-N 0.000 description 1
- VTHIKKVKIVQWHV-UHFFFAOYSA-N chromium(6+) oxygen(2-) pyridine Chemical compound [O-2].[O-2].[O-2].[Cr+6].C1=CC=NC=C1 VTHIKKVKIVQWHV-UHFFFAOYSA-N 0.000 description 1
- 125000004242 cinnolin-3-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)N=NC2=C1[H] 0.000 description 1
- DODZTSARNRLOKY-UHFFFAOYSA-N cinnolin-4-amine Chemical class C1=CC=C2C(N)=CN=NC2=C1 DODZTSARNRLOKY-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000007883 cyanide addition reaction Methods 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- OSCFXGJHDOJRLC-UHFFFAOYSA-N cyclohexa-1,3-diene-1-carboxamide Chemical compound NC(=O)C1=CC=CCC1 OSCFXGJHDOJRLC-UHFFFAOYSA-N 0.000 description 1
- PNZXMIKHJXIPEK-UHFFFAOYSA-N cyclohexanecarboxamide Chemical compound NC(=O)C1CCCCC1 PNZXMIKHJXIPEK-UHFFFAOYSA-N 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- PBGGNZZGJIKBMJ-UHFFFAOYSA-N di(propan-2-yl)azanide Chemical compound CC(C)[N-]C(C)C PBGGNZZGJIKBMJ-UHFFFAOYSA-N 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical class [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- XNFVGEUMTFIVHQ-UHFFFAOYSA-N disodium;sulfide;hydrate Chemical compound O.[Na+].[Na+].[S-2] XNFVGEUMTFIVHQ-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003221 ear drop Substances 0.000 description 1
- 229940047652 ear drops Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-N ethanethioic S-acid Chemical class CC(S)=O DUYAAUVXQSMXQP-UHFFFAOYSA-N 0.000 description 1
- ZRSDQBKGDNPFLT-UHFFFAOYSA-N ethanol;oxolane Chemical compound CCO.C1CCOC1 ZRSDQBKGDNPFLT-UHFFFAOYSA-N 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- FTZFXRRUPGDGLO-UHFFFAOYSA-N ethyl 2,3-dihydro-[1,4]dioxino[2,3-c]pyridine-7-carboxylate Chemical compound O1CCOC2=C1C=C(C(=O)OCC)N=C2 FTZFXRRUPGDGLO-UHFFFAOYSA-N 0.000 description 1
- HKGIEPXOWGJFCW-UHFFFAOYSA-N ethyl 2,4-difluoro-5-nitrobenzoate Chemical compound CCOC(=O)C1=CC([N+]([O-])=O)=C(F)C=C1F HKGIEPXOWGJFCW-UHFFFAOYSA-N 0.000 description 1
- OPQFYGPAOVCNEQ-UHFFFAOYSA-N ethyl 2,4-difluorobenzoate Chemical compound CCOC(=O)C1=CC=C(F)C=C1F OPQFYGPAOVCNEQ-UHFFFAOYSA-N 0.000 description 1
- LJLACWKNDNQPQD-UHFFFAOYSA-N ethyl 2-(4-formyl-2-nitrophenoxy)acetate Chemical compound CCOC(=O)COC1=CC=C(C=O)C=C1[N+]([O-])=O LJLACWKNDNQPQD-UHFFFAOYSA-N 0.000 description 1
- HZONUGDFRUXYSA-UHFFFAOYSA-N ethyl 2-(6-bromo-2-nitropyridin-3-yl)oxyacetate Chemical compound CCOC(=O)COC1=CC=C(Br)N=C1[N+]([O-])=O HZONUGDFRUXYSA-UHFFFAOYSA-N 0.000 description 1
- ASDRYOHXTPUHKN-UHFFFAOYSA-N ethyl 2-(6-methyl-4-nitro-1-oxidopyridin-1-ium-3-yl)sulfanylacetate Chemical compound CCOC(=O)CSC1=C[N+]([O-])=C(C)C=C1[N+]([O-])=O ASDRYOHXTPUHKN-UHFFFAOYSA-N 0.000 description 1
- YAGBJRWHQMVLFO-UHFFFAOYSA-N ethyl 2-[6-(acetyloxymethyl)-4-nitropyridin-3-yl]sulfanylacetate Chemical compound CCOC(=O)CSC1=CN=C(COC(C)=O)C=C1[N+]([O-])=O YAGBJRWHQMVLFO-UHFFFAOYSA-N 0.000 description 1
- DTVZNJAXSVAVFL-UHFFFAOYSA-N ethyl 2-fluoro-4-(2-methoxy-2-oxoethyl)sulfanyl-5-nitrobenzoate Chemical compound CCOC(=O)C1=CC([N+]([O-])=O)=C(SCC(=O)OC)C=C1F DTVZNJAXSVAVFL-UHFFFAOYSA-N 0.000 description 1
- ZRPWLNJFTQIWPA-UHFFFAOYSA-N ethyl 5-hydroxy-4-oxo-1h-pyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC(O)=C(O)C=N1 ZRPWLNJFTQIWPA-UHFFFAOYSA-N 0.000 description 1
- IWDXYLMIUDCDPB-UHFFFAOYSA-N ethyl 7-fluoro-3-oxo-4h-1,4-benzothiazine-6-carboxylate Chemical compound N1C(=O)CSC2=C1C=C(C(=O)OCC)C(F)=C2 IWDXYLMIUDCDPB-UHFFFAOYSA-N 0.000 description 1
- IWSVHPREDCSOOZ-UHFFFAOYSA-N ethyl 8-(methoxymethoxy)-1-oxo-2h-isoquinoline-3-carboxylate Chemical compound C1=CC(OCOC)=C2C(=O)NC(C(=O)OCC)=CC2=C1 IWSVHPREDCSOOZ-UHFFFAOYSA-N 0.000 description 1
- NQXKNIITKAWRLJ-UHFFFAOYSA-N ethyl 8-(methoxymethoxy)-1-oxoisochromene-3-carboxylate Chemical compound C1=CC(OCOC)=C2C(=O)OC(C(=O)OCC)=CC2=C1 NQXKNIITKAWRLJ-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000006077 hetero Diels-Alder cycloaddition reaction Methods 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000004130 indan-2-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])(*)C2([H])[H] 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 1
- 229960004705 kojic acid Drugs 0.000 description 1
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 1
- 125000000686 lactone group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- HWOQCGSIDCQVRM-UHFFFAOYSA-N methyl 1h-pyrrolo[2,3-b]pyridine-2-carboxylate Chemical compound C1=CN=C2NC(C(=O)OC)=CC2=C1 HWOQCGSIDCQVRM-UHFFFAOYSA-N 0.000 description 1
- KNFRNBCZWTZJHN-UHFFFAOYSA-N methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetate Chemical compound COC(=O)CC1CCC(NC(=O)OC(C)(C)C)CC1 KNFRNBCZWTZJHN-UHFFFAOYSA-N 0.000 description 1
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 1
- NUYQDKMFCYCSAG-UHFFFAOYSA-N methyl 2-oxo-1h-pyrido[2,3-b][1,4]oxazine-7-carboxylate Chemical compound O1CC(=O)NC2=CC(C(=O)OC)=CN=C21 NUYQDKMFCYCSAG-UHFFFAOYSA-N 0.000 description 1
- HVFSNKWAUPKWPC-UHFFFAOYSA-N methyl 2-oxo-1h-pyrido[2,3-b][1,4]thiazine-7-carboxylate Chemical compound S1CC(=O)NC2=CC(C(=O)OC)=CN=C21 HVFSNKWAUPKWPC-UHFFFAOYSA-N 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- UIAHQILQYROVCF-UHFFFAOYSA-N methyl 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylate Chemical compound S1CC(=O)NC2=NC(C(=O)OC)=CC=C21 UIAHQILQYROVCF-UHFFFAOYSA-N 0.000 description 1
- BCEKOKBOHOFINY-UHFFFAOYSA-N methyl 5-amino-6-sulfanylidene-1h-pyridine-3-carboxylate Chemical compound COC(=O)C1=CNC(=S)C(N)=C1 BCEKOKBOHOFINY-UHFFFAOYSA-N 0.000 description 1
- NGPXWAVPBFAMSB-UHFFFAOYSA-N methyl 6-(2-ethoxy-2-oxoethoxy)-5-nitropyridine-3-carboxylate Chemical compound CCOC(=O)COC1=NC=C(C(=O)OC)C=C1[N+]([O-])=O NGPXWAVPBFAMSB-UHFFFAOYSA-N 0.000 description 1
- TUYDCNSJEARJEP-UHFFFAOYSA-N methyl 6-(2-methoxy-2-oxoethyl)sulfanyl-5-nitropyridine-3-carboxylate Chemical compound COC(=O)CSC1=NC=C(C(=O)OC)C=C1[N+]([O-])=O TUYDCNSJEARJEP-UHFFFAOYSA-N 0.000 description 1
- YJUKTIBOUBUOJH-UHFFFAOYSA-N methyl 6-amino-3-bromopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(N)=CC=C1Br YJUKTIBOUBUOJH-UHFFFAOYSA-N 0.000 description 1
- UXVFOFFVXPRWBZ-UHFFFAOYSA-N methyl 6-methoxyquinoline-4-carboxylate Chemical compound C1=C(OC)C=C2C(C(=O)OC)=CC=NC2=C1 UXVFOFFVXPRWBZ-UHFFFAOYSA-N 0.000 description 1
- YIMJWMNJTWDJJD-UHFFFAOYSA-N methyl [1,3]thiazolo[5,4-b]pyridine-6-carboxylate Chemical compound COC(=O)C1=CN=C2SC=NC2=C1 YIMJWMNJTWDJJD-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- SGMGASBLEOSDMW-UHFFFAOYSA-N methyl thiadiazolo[5,4-b]pyridine-6-carboxylate Chemical compound COC(=O)C1=CN=C2SN=NC2=C1 SGMGASBLEOSDMW-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- KGPQKNJSZNXOPV-UHFFFAOYSA-N moniliformin Chemical group OC1=CC(=O)C1=O KGPQKNJSZNXOPV-UHFFFAOYSA-N 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000005054 naphthyridines Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000004893 oxazines Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 239000012026 peptide coupling reagents Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004526 pyridazin-2-yl group Chemical group N1N(C=CC=C1)* 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- GPPZVGNHXBJPRM-UHFFFAOYSA-N quinolin-4-one Chemical compound C1=CC=C2C(=O)C=C=NC2=C1 GPPZVGNHXBJPRM-UHFFFAOYSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940048181 sodium sulfide nonahydrate Drugs 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- WMDLZMCDBSJMTM-UHFFFAOYSA-M sodium;sulfanide;nonahydrate Chemical compound O.O.O.O.O.O.O.O.O.[Na+].[SH-] WMDLZMCDBSJMTM-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- QGYXQBORNGRQOL-UHFFFAOYSA-N tert-butyl n-(4-carbamoyl-4-hydroxycyclohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(O)(C(N)=O)CC1 QGYXQBORNGRQOL-UHFFFAOYSA-N 0.000 description 1
- WYVFPGFWUKBXPZ-UHFFFAOYSA-N tert-butyl n-(4-oxocyclohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(=O)CC1 WYVFPGFWUKBXPZ-UHFFFAOYSA-N 0.000 description 1
- GOKOJYFPGZIEBM-UHFFFAOYSA-N tert-butyl n-[4-[(6-methoxy-1,5-naphthyridin-4-yl)carbamoyl]cyclohexyl]carbamate Chemical compound C12=NC(OC)=CC=C2N=CC=C1NC(=O)C1CCC(NC(=O)OC(C)(C)C)CC1 GOKOJYFPGZIEBM-UHFFFAOYSA-N 0.000 description 1
- NZOLJGJWAATUCT-UHFFFAOYSA-N tert-butyl n-[4-[(6-methoxyquinolin-4-yl)carbamoyl]cyclohexyl]carbamate Chemical compound C12=CC(OC)=CC=C2N=CC=C1NC(=O)C1CCC(NC(=O)OC(C)(C)C)CC1 NZOLJGJWAATUCT-UHFFFAOYSA-N 0.000 description 1
- BDTJPMZMYJMSAP-UHFFFAOYSA-N tert-butyl n-[4-[(8-fluoro-6-methoxyquinolin-4-yl)carbamoyl]cyclohexyl]carbamate Chemical compound C12=CC(OC)=CC(F)=C2N=CC=C1NC(=O)C1CCC(NC(=O)OC(C)(C)C)CC1 BDTJPMZMYJMSAP-UHFFFAOYSA-N 0.000 description 1
- GHDRBGIALGWJDN-UHFFFAOYSA-N tert-butyl n-[4-[2-(6-methoxyquinolin-4-yl)-2-oxoethyl]cyclohexyl]carbamate Chemical compound C12=CC(OC)=CC=C2N=CC=C1C(=O)CC1CCC(NC(=O)OC(C)(C)C)CC1 GHDRBGIALGWJDN-UHFFFAOYSA-N 0.000 description 1
- GNQSYKASPAINCI-UHFFFAOYSA-N tert-butyl n-[4-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]cyclohexyl]carbamate Chemical compound C12=CC(OC)=CC=C2N=CC=C1C(O)CC1CCC(NC(=O)OC(C)(C)C)CC1 GNQSYKASPAINCI-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- XJPANWOKBWZVHC-UHFFFAOYSA-N tetrazol-2-amine Chemical class NN1N=CN=N1 XJPANWOKBWZVHC-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- BXCZJWHJYRELHY-UHFFFAOYSA-N thiadiazole-5-carboxylic acid Chemical compound OC(=O)C1=CN=NS1 BXCZJWHJYRELHY-UHFFFAOYSA-N 0.000 description 1
- NFEJTKIAISYFQQ-UHFFFAOYSA-N thiadiazolo[5,4-b]pyridin-6-ylmethanol Chemical compound OCC1=CN=C2SN=NC2=C1 NFEJTKIAISYFQQ-UHFFFAOYSA-N 0.000 description 1
- LGXDAWAHSVHYCG-UHFFFAOYSA-N thiadiazolo[5,4-b]pyridine-6-carbaldehyde Chemical compound O=CC1=CN=C2SN=NC2=C1 LGXDAWAHSVHYCG-UHFFFAOYSA-N 0.000 description 1
- YFRBFGUUUDQBMZ-UHFFFAOYSA-N thiadiazolo[5,4-b]pyridine-6-carboxylic acid Chemical compound OC(=O)C1=CN=C2SN=NC2=C1 YFRBFGUUUDQBMZ-UHFFFAOYSA-N 0.000 description 1
- 150000004897 thiazines Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical compound CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- JKVRTUCVPZTEQZ-UHFFFAOYSA-N tributyltin azide Chemical compound CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] JKVRTUCVPZTEQZ-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000002827 triflate group Chemical class FC(S(=O)(=O)O*)(F)F 0.000 description 1
- AHZJKOKFZJYCLG-UHFFFAOYSA-K trifluoromethanesulfonate;ytterbium(3+) Chemical compound [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F AHZJKOKFZJYCLG-UHFFFAOYSA-K 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- PGAJYUDRKAPMPA-UHFFFAOYSA-N trimethylsilyl n-ethylcarbamate Chemical compound CCNC(=O)O[Si](C)(C)C PGAJYUDRKAPMPA-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Oncology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0112834.7A GB0112834D0 (en) | 2001-05-25 | 2001-05-25 | Medicaments |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ20033202A3 true CZ20033202A3 (cs) | 2004-08-18 |
Family
ID=9915342
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ20033202A CZ20033202A3 (cs) | 2001-05-25 | 2002-05-24 | Bicyklické heterocyklické sloučeniny obsahující dusík pro použití jako antibakteriální činidla |
Country Status (23)
Families Citing this family (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE9703377D0 (sv) * | 1997-09-18 | 1997-09-18 | Astra Ab | New compounds |
| US6803369B1 (en) | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| CN1452619A (zh) | 2000-07-26 | 2003-10-29 | 史密斯克莱·比奇曼公司 | 具有抗细菌活性的氨基哌啶喹啉和它们的氮杂等排的类似物 |
| EP1320529B1 (en) * | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| GB0031088D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0031086D0 (en) * | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0101577D0 (en) | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| GB0112836D0 (en) * | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0112834D0 (en) | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0118238D0 (en) * | 2001-07-26 | 2001-09-19 | Smithkline Beecham Plc | Medicaments |
| US7109213B2 (en) | 2002-01-29 | 2006-09-19 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| US7312212B2 (en) * | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| TW200406413A (en) * | 2002-06-26 | 2004-05-01 | Glaxo Group Ltd | Compounds |
| TW200409637A (en) * | 2002-06-26 | 2004-06-16 | Glaxo Group Ltd | Compounds |
| AU2003303956A1 (en) * | 2002-11-05 | 2004-11-23 | Smithkline Beecham Corporation | Antibacterial agents |
| US7618959B2 (en) | 2002-11-05 | 2009-11-17 | Smithklinebeecham Corp | Antibacterial agents |
| ES2312839T3 (es) * | 2002-12-04 | 2009-03-01 | Glaxo Group Limited | Quinolinas y sus derivados nitrogenados y su uso como agentes antibacterianos. |
| US7589207B2 (en) | 2002-12-13 | 2009-09-15 | Smithkline Beecham Corporation | Cyclohexyl compounds as CCR5 antagonists |
| TW200427688A (en) * | 2002-12-18 | 2004-12-16 | Glaxo Group Ltd | Antibacterial agents |
| DE102004023635A1 (de) * | 2004-05-10 | 2006-04-13 | Grünenthal GmbH | Heteroarylsubstituierte Cyclohexyl-1,4-diamin-Derivate |
| DE102004041163A1 (de) * | 2004-08-25 | 2006-03-02 | Morphochem Aktiengesellschaft für kombinatorische Chemie | Neue Verbindungen mit antibakterieller Aktivität |
| US7648980B2 (en) * | 2005-01-25 | 2010-01-19 | Glaxo Group Limited | Antibacterial agents |
| WO2006081289A2 (en) * | 2005-01-25 | 2006-08-03 | Glaxo Group Limited | Antibacterial agents |
| US7605169B2 (en) | 2005-01-25 | 2009-10-20 | Glaxo Group Limited | Antibacterial agents |
| EP1846418A4 (en) | 2005-01-25 | 2009-12-23 | Glaxo Group Ltd | ANTIBACTERIAL ACTIVE SUBSTANCES |
| US7709472B2 (en) | 2005-01-25 | 2010-05-04 | Glaxo Group Limited | Antibacterial agents |
| MY150958A (en) | 2005-06-16 | 2014-03-31 | Astrazeneca Ab | Compounds for the treatment of multi-drug resistant bacterial infections |
| CA2635126A1 (en) | 2006-01-26 | 2007-08-02 | Actelion Pharmaceuticals Ltd | Tetrahydropyrane antibiotics |
| WO2007093963A1 (en) * | 2006-02-15 | 2007-08-23 | Actelion Pharmaceuticals Ltd | Ethanol or 1,2-ethanediol cyclohexyl antibiotic derivatives |
| JP2009527562A (ja) * | 2006-02-21 | 2009-07-30 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン誘導体 |
| JP2009528365A (ja) * | 2006-02-28 | 2009-08-06 | アムゲン インコーポレイティッド | ホスホジエステラーゼ10阻害剤としてのシンノリン及びキナゾリン誘導体 |
| AU2007223801A1 (en) * | 2006-03-08 | 2007-09-13 | Amgen Inc. | Quinoline and isoquinoline derivatives as phosphodiesterase 10 inhibitors |
| JP2009532504A (ja) | 2006-04-06 | 2009-09-10 | グラクソ グループ リミテッド | 抗菌薬 |
| ATE481406T1 (de) | 2006-04-06 | 2010-10-15 | Glaxo Group Ltd | Pyrrolochinoxalinonderivate als antibakterielle mittel |
| GB0613208D0 (en) | 2006-07-03 | 2006-08-09 | Glaxo Group Ltd | Compounds |
| EP1992628A1 (en) | 2007-05-18 | 2008-11-19 | Glaxo Group Limited | Derivatives and analogs of N-ethylquinolones and N-ethylazaquinolones |
| TW200819457A (en) | 2006-08-30 | 2008-05-01 | Actelion Pharmaceuticals Ltd | Spiro antibiotic derivatives |
| CL2007003693A1 (es) * | 2006-12-22 | 2008-06-27 | Actelion Pharmaceuticals Ltd | Compuestos derivados de pirido [3,2-b] [1,4] tiazina; composicion farmaceutica que contiene dichos compuestos; y su uso en el tratamiento de infecciones bacterianas. |
| CL2008001002A1 (es) | 2007-04-11 | 2008-10-17 | Actelion Pharmaceuticals Ltd | Compuestos derivados de oxazolidinona; composicion farmaceutica que comprende a dichos compuestos; y su uso para preparar un medicamento para tratar una infeccion bacteriana. |
| CL2008001003A1 (es) | 2007-04-11 | 2008-10-17 | Actelion Pharmaceuticals Ltd | Compuestos derivados de oxazolidinona; composicion farmaceutica que comprende a dichos compuestos; y su uso para preparar un medicamento para tratar una infeccion bacteriana. |
| KR101567096B1 (ko) | 2007-04-20 | 2015-11-06 | 글락소 그룹 리미티드 | 항균제로서의 트리시클릭 질소 함유 화합물 |
| ES2380398T3 (es) | 2007-12-18 | 2012-05-11 | Actelion Pharmaceuticals Ltd. | Derivados 5-aminociclilmetil-oxazolidin-2-ona |
| EP2080761A1 (en) | 2008-01-18 | 2009-07-22 | Glaxo Group Limited | Compounds |
| KR101592046B1 (ko) | 2008-02-22 | 2016-02-05 | 액테리온 파마슈티칼 리미티드 | 옥사졸리디논 유도체 |
| TW200944529A (en) | 2008-04-15 | 2009-11-01 | Actelion Pharmaceuticals Ltd | Tricyclic antibiotics |
| US7741327B2 (en) | 2008-04-16 | 2010-06-22 | Hoffmann-La Roche Inc. | Pyrrolidinone glucokinase activators |
| CN102046603B (zh) * | 2008-06-03 | 2014-08-13 | 埃科特莱茵药品有限公司 | 作为抗细菌剂的[4-(1-氨基-乙基)-环己基]-甲基-胺及[6-(1-氨基-乙基)-四氢-吡喃-3-基]-甲基-胺衍生物 |
| JP2012505866A (ja) | 2008-10-17 | 2012-03-08 | グラクソ グループ リミテッド | 抗菌剤として使用される三環式窒素化合物 |
| WO2010045987A1 (en) * | 2008-10-23 | 2010-04-29 | Glaxo Group Limited | Substituted (aza) -1-methyl-1h-quin0lin-2-0nes as antibacterials |
| EP2346819B1 (en) | 2008-11-17 | 2013-04-10 | F. Hoffmann-La Roche AG | Naphthylacetic acids |
| PT2376497E (pt) | 2008-12-12 | 2013-11-21 | Actelion Pharmaceuticals Ltd | Derivados de 5-amino-2-(1-hidroxi-etil)-tetrahidropirano |
| US8318940B2 (en) | 2009-01-15 | 2012-11-27 | Glaxo Group Limited | Naphthyridin-2 (1 H)-one compounds useful as antibacterials |
| AR076222A1 (es) * | 2009-04-09 | 2011-05-26 | Actelion Pharmaceuticals Ltd | Derivados 2-hidroxietil-1h-quinolin-ona y sus analogos azaisotericos con actividad antibacteriana y composiciones farmaceuticas que los contienen |
| US8394858B2 (en) | 2009-12-03 | 2013-03-12 | Novartis Ag | Cyclohexane derivatives and uses thereof |
| US8178689B2 (en) | 2010-06-17 | 2012-05-15 | Hoffman-La Roche Inc. | Tricyclic compounds |
| WO2012166586A1 (en) * | 2011-05-27 | 2012-12-06 | Temple University - Of The Commonwealth System Of Higher Education | SUBSTITUTED 2-BENZYLIDENE-2H-BENZO[b][1,4]THIAZIN-3(4H)-ONES, DERIVATIVES THEREOF, AND THERAPEUTIC USES THEREOF |
| US8470884B2 (en) | 2011-11-09 | 2013-06-25 | Hoffmann-La Roche Inc. | Alkenyl naphthylacetic acids |
| AR089929A1 (es) | 2012-02-10 | 2014-10-01 | Actelion Pharmaceuticals Ltd | Proceso para manufacturar un derivado de naftiridina |
| JPWO2014157612A1 (ja) * | 2013-03-29 | 2017-02-16 | 第一三共株式会社 | (1s,4s,5s)−4−ブロモ−6−オキサビシクロ[3.2.1]オクタン−7−オンの製造方法 |
| CN104470898B (zh) | 2013-05-13 | 2016-04-06 | 上海恒瑞医药有限公司 | 环烷基甲酸类衍生物、其制备方法及其在医药上的应用 |
| BR112017003705B1 (pt) | 2014-08-22 | 2022-07-12 | Glaxosmithkline Intellectual Property Development Limited | Compostos contendo nitrogênio tricíclicos para o tratamento de infecção por neisseria gonorrhoea |
| SI3209655T1 (sl) | 2014-10-24 | 2020-11-30 | Landos Biopharma, Inc. | Terapevtiki na osnovi C-podobne lantionin sintetaze 2 |
| UY36851A (es) * | 2015-08-16 | 2017-03-31 | Glaxosmithkline Ip Dev Ltd | Compuestos para uso en aplicaciones antibacterianas |
| EP3601267A1 (en) | 2017-03-21 | 2020-02-05 | Bayer Pharma Aktiengesellschaft | 2-methyl-quinazolines |
| CA3083442A1 (en) | 2017-11-30 | 2019-06-06 | Landos Biopharma, Inc. | Therapies with lanthionine c-like protein 2 ligands and cells prepared therewith |
| WO2019201848A1 (en) | 2018-04-18 | 2019-10-24 | Bayer Pharma Aktiengesellschaft | 2-methyl-aza-quinazolines |
| WO2021076886A1 (en) | 2019-10-18 | 2021-04-22 | The Regents Of The University Of California | 3-phenylsulphonyl-quinoline derivatives as agents for treating pathogenic blood vessels disorders |
| AU2020407645B2 (en) | 2019-12-20 | 2022-10-06 | Nimmune Biopharma, Inc. | Lanthionine C-like protein 2 ligands, cells prepared therewith, and therapies using same |
| WO2022058344A1 (en) | 2020-09-18 | 2022-03-24 | Bayer Aktiengesellschaft | Pyrido[2,3-d]pyrimidin-4-amines as sos1 inhibitors |
| EP4074317A1 (en) | 2021-04-14 | 2022-10-19 | Bayer AG | Phosphorus derivatives as novel sos1 inhibitors |
| CN116102537B (zh) * | 2021-11-10 | 2024-10-01 | 四川大学 | 一种喹啉酮类衍生物及其制备方法和用途 |
| CN117568087B (zh) * | 2024-01-16 | 2024-04-05 | 洛阳轻捷润滑油科技有限公司 | 一种长寿命汽车无极变速器油及其制备方法 |
Family Cites Families (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4472404A (en) * | 1982-08-16 | 1984-09-18 | The Dow Chemical Company | 8-Quinolinyl carbamates and their use as urinary tract antimicrobials |
| US4925877A (en) | 1986-02-25 | 1990-05-15 | Zaidanhojin Biseibutsu Kagaku Kenkyukai | Physiologically active erbstatin analogue compounds and compositions |
| DE3874257T2 (de) | 1987-03-11 | 1993-02-11 | Kanegafuchi Chemical Ind | Hydroxystyren-derivate. |
| ZA899436B (en) | 1988-12-12 | 1990-08-29 | Ciba Geigy | Piperidine derivatives |
| EP0541486A1 (de) | 1991-11-07 | 1993-05-12 | Ciba-Geigy Ag | Polycyclische Konjugate |
| US5263276A (en) | 1992-09-21 | 1993-11-23 | Fred Washington | Fishing rod attachment |
| NZ273617A (en) | 1993-10-01 | 1996-11-26 | Ciba Geigy Ag | N-phenyl-2-pyrimidineamine derivatives pharmaceutical compositions |
| JPH07179407A (ja) | 1993-11-12 | 1995-07-18 | Green Cross Corp:The | 新規縮合環系化合物またはその塩、およびその医薬用途 |
| CN1120156C (zh) | 1994-06-17 | 2003-09-03 | 弗·哈夫曼-拉罗切有限公司 | N,n′-二(喹啉-4-基)-二胺衍生物、其制备及作为抗疟药的应用 |
| NZ296456A (en) | 1994-11-14 | 1999-09-29 | Warner Lambert Co | 6-aryl pyrido[2,3-d]pyrimidines and naphthyridines; inhibition of protein tyrosine kinase mediated cellular proliferation |
| US5589482A (en) | 1994-12-14 | 1996-12-31 | Pfizer Inc. | Benzo-thiophene estrogen agonists to treat prostatic hyperplasia |
| PT807630E (pt) * | 1995-02-02 | 2003-08-29 | Daiichi Seiyaku Co | Compostos heterociclicos |
| KR19990008051A (ko) | 1995-04-26 | 1999-01-25 | 히라타다다시 | 라디시콜 유도체 |
| GB9514265D0 (en) | 1995-07-13 | 1995-09-13 | Wellcome Found | Hetrocyclic compounds |
| TR199800854T2 (xx) | 1995-11-16 | 1998-08-21 | F.Hoffmann-La Roche Ag | Antis�tma kinolin t�revleri. |
| US5707990A (en) | 1996-01-30 | 1998-01-13 | Ortho Pharmaceutical Corporation | 2-substituted amino and thio alkyl benzoxazine antimicrobial agents |
| WO1997038984A1 (en) | 1996-04-17 | 1997-10-23 | Du Pont Pharmaceuticals Company | N-(amidinophenyl)-n'-(subst.)-3h-2,4-benzodiazepin-3-one derivatives as factor xa inhibitors |
| HRP970371A2 (en) | 1996-07-13 | 1998-08-31 | Kathryn Jane Smith | Heterocyclic compounds |
| PT912559E (pt) | 1996-07-13 | 2003-03-31 | Glaxo Group Ltd | Compostos heterociclicos fundidos como inibidores de proteina tirosina quinase |
| JP2001504456A (ja) | 1996-10-30 | 2001-04-03 | メルク エンド カンパニー インコーポレーテッド | インテグリン拮抗薬 |
| TW523506B (en) | 1996-12-18 | 2003-03-11 | Ono Pharmaceutical Co | Sulfonamide or carbamide derivatives and drugs containing the same as active ingredients |
| US6187797B1 (en) | 1996-12-23 | 2001-02-13 | Dupont Pharmaceuticals Company | Phenyl-isoxazoles as factor XA Inhibitors |
| CZ225699A3 (cs) | 1996-12-23 | 2000-09-13 | Du Pont Pharmaceuticals Company | Dusíkaté heteroaromatické sloučeniny jako inhibitory faktoru Xa |
| US6103905A (en) * | 1997-06-19 | 2000-08-15 | Sepracor, Inc. | Quinoline-indole antimicrobial agents, uses and compositions related thereto |
| ES2201674T3 (es) | 1998-01-26 | 2004-03-16 | Smithkline Beecham Plc | Derivados de quinolina con propiedades antibacterianas. |
| HUP0101275A3 (en) | 1998-03-26 | 2002-12-28 | Japan Tobacco Inc | Amide derivatives and pharmaceutical compositions containing them as nociceptin antagonists |
| SE9802206D0 (sv) | 1998-06-22 | 1998-06-22 | Astra Pharma Inc | Novel compounds |
| GB9822450D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| GB9822440D0 (en) | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| JP2002532493A (ja) | 1998-12-17 | 2002-10-02 | エフ.ホフマン−ラ ロシュ アーゲー | Jnkプロテインキナーゼ阻害剤としての4−アリールオキシインドール |
| AU2437900A (en) | 1999-01-20 | 2000-08-07 | Smithkline Beecham Plc | Piperidinylquinolines as protein tyrosine kinase inhibitors |
| WO2000045635A1 (en) | 1999-02-08 | 2000-08-10 | Lion Bioscience Ag | Thiazole derivatives and combinatorial libraries thereof |
| GB9910580D0 (en) | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| GB9910579D0 (en) | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| GB9910577D0 (en) | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| GB9914074D0 (en) * | 1999-06-16 | 1999-08-18 | Btg Int Ltd | Tibial component |
| GB9914486D0 (en) | 1999-06-21 | 1999-08-18 | Smithkline Beecham Plc | Medicaments |
| AU5567000A (en) | 1999-06-24 | 2001-01-09 | Toray Industries, Inc. | Alpha1b-adrenergic receptor antagonists |
| GB9917408D0 (en) | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| GB9917406D0 (en) | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| HK1052497B (zh) | 1999-09-17 | 2007-03-02 | 千禧药品公司 | 苯甲酸胺和相关的因子xa抑制剂 |
| FR2798656B1 (fr) | 1999-09-17 | 2004-12-17 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leur preparation et les compositions qui les contiennent |
| DE19955476A1 (de) | 1999-11-18 | 2001-05-23 | Boehringer Ingelheim Pharma | Bis-basische Verbindungen als Tryptase-Inhibitoren, Verfahren zu deren Herstellung sowie deren Verwendung als Arzneimittel |
| CN1481377A (zh) | 2000-03-17 | 2004-03-10 | ����˹�ж�-����˹˹����ҩƷ��˾ | 作为基质金属蛋白酶和TNF-α的抑制剂的环β-氨基酸衍生物 |
| AU2001249262A1 (en) | 2000-03-20 | 2001-10-03 | Sepracor, Inc. | Therapeutic compounds for the treatment of asthma and allergy, and methods of use thereof |
| WO2001072712A1 (en) | 2000-03-24 | 2001-10-04 | Cor Therapeutics, Inc. | ISOQUINOLONE INHIBITORS OF FACTOR Xa |
| US6548517B2 (en) | 2000-03-24 | 2003-04-15 | Millennium Pharmaceuticals, Inc. | Oxindole inhibitors of factor Xa |
| TWI290136B (en) | 2000-04-05 | 2007-11-21 | Daiichi Seiyaku Co | Ethylenediamine derivatives |
| CN1452619A (zh) * | 2000-07-26 | 2003-10-29 | 史密斯克莱·比奇曼公司 | 具有抗细菌活性的氨基哌啶喹啉和它们的氮杂等排的类似物 |
| EP1320529B1 (en) | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| FR2816618B1 (fr) | 2000-11-15 | 2002-12-27 | Aventis Pharma Sa | Derives heterocyclylalcoyl piperidine, leur preparation et les compositions qui les contiennent |
| GB0031088D0 (en) | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0031086D0 (en) | 2000-12-20 | 2001-01-31 | Smithkline Beecham Plc | Medicaments |
| GB0101577D0 (en) | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| FR2822154B1 (fr) | 2001-03-13 | 2005-10-21 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leur preparation et les compositions qui les contiennent |
| GB0112836D0 (en) | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0112834D0 (en) | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0118238D0 (en) | 2001-07-26 | 2001-09-19 | Smithkline Beecham Plc | Medicaments |
| US7312212B2 (en) | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| US7109213B2 (en) | 2002-01-29 | 2006-09-19 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| US6818772B2 (en) * | 2002-02-22 | 2004-11-16 | Abbott Laboratories | Antagonists of melanin concentrating hormone effects on the melanin concentrating hormone receptor |
| TW200406413A (en) * | 2002-06-26 | 2004-05-01 | Glaxo Group Ltd | Compounds |
| FR2844270B1 (fr) | 2002-09-11 | 2006-05-19 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leur procede et intermediaires de preparation et les compositions qui les contiennent |
| FR2844268B1 (fr) | 2002-09-11 | 2004-10-22 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leurs procedes et intermediaires de preparation et les compositions qui les contiennent |
| ATE463494T1 (de) | 2002-10-10 | 2010-04-15 | Morphochem Ag Komb Chemie | Neue verbindungen mit antibakterieller aktivität |
| TW200427688A (en) * | 2002-12-18 | 2004-12-16 | Glaxo Group Ltd | Antibacterial agents |
| DE10316081A1 (de) | 2003-04-08 | 2004-10-21 | Morphochem AG Aktiengesellschaft für kombinatorische Chemie | Neue Verbindungen mit antibakterieller Aktivität |
-
2001
- 2001-05-25 GB GBGB0112834.7A patent/GB0112834D0/en not_active Ceased
-
2002
- 2002-05-23 AR ARP020101914A patent/AR038172A1/es not_active Application Discontinuation
- 2002-05-23 TW TW091110839A patent/TWI232219B/zh not_active IP Right Cessation
- 2002-05-24 CA CA002448525A patent/CA2448525A1/en not_active Abandoned
- 2002-05-24 US US10/478,154 patent/US7141564B2/en not_active Expired - Fee Related
- 2002-05-24 CZ CZ20033202A patent/CZ20033202A3/cs unknown
- 2002-05-24 KR KR10-2003-7015379A patent/KR20040010654A/ko not_active Withdrawn
- 2002-05-24 WO PCT/EP2002/005708 patent/WO2003087098A1/en not_active Ceased
- 2002-05-24 ES ES02807202T patent/ES2298439T3/es not_active Expired - Lifetime
- 2002-05-24 DE DE60224039T patent/DE60224039T2/de not_active Expired - Lifetime
- 2002-05-24 EP EP02807202A patent/EP1399443B1/en not_active Expired - Lifetime
- 2002-05-24 CN CNA028146689A patent/CN1535272A/zh active Pending
- 2002-05-24 IL IL15886902A patent/IL158869A0/xx unknown
- 2002-05-24 AT AT02807202T patent/ATE380812T1/de not_active IP Right Cessation
- 2002-05-24 JP JP2003584054A patent/JP4463565B2/ja not_active Expired - Fee Related
- 2002-05-24 AU AU2002367697A patent/AU2002367697A1/en not_active Abandoned
- 2002-05-24 HU HU0400017A patent/HUP0400017A2/hu unknown
- 2002-05-24 PL PL02367079A patent/PL367079A1/xx not_active Application Discontinuation
- 2002-05-24 MX MXPA03010790A patent/MXPA03010790A/es unknown
- 2002-05-24 BR BR0210016-9A patent/BR0210016A/pt not_active IP Right Cessation
-
2003
- 2003-11-07 ZA ZA200308696A patent/ZA200308696B/en unknown
- 2003-11-18 CO CO03101671A patent/CO5540344A2/es not_active Application Discontinuation
- 2003-11-21 NO NO20035190A patent/NO20035190D0/no not_active Application Discontinuation
-
2006
- 2006-11-22 US US11/604,045 patent/US20070135422A1/en not_active Abandoned
-
2009
- 2009-11-13 JP JP2009259981A patent/JP2010031057A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| MXPA03010790A (es) | 2004-03-02 |
| US20040171620A1 (en) | 2004-09-02 |
| AR038172A1 (es) | 2005-01-05 |
| CN1535272A (zh) | 2004-10-06 |
| GB0112834D0 (en) | 2001-07-18 |
| CO5540344A2 (es) | 2005-07-29 |
| BR0210016A (pt) | 2004-06-15 |
| JP2010031057A (ja) | 2010-02-12 |
| TWI232219B (en) | 2005-05-11 |
| JP4463565B2 (ja) | 2010-05-19 |
| EP1399443B1 (en) | 2007-12-12 |
| ZA200308696B (en) | 2004-05-21 |
| ES2298439T3 (es) | 2008-05-16 |
| NO20035190D0 (no) | 2003-11-21 |
| AU2002367697A1 (en) | 2003-10-27 |
| JP2005519981A (ja) | 2005-07-07 |
| PL367079A1 (en) | 2005-02-21 |
| WO2003087098A1 (en) | 2003-10-23 |
| ATE380812T1 (de) | 2007-12-15 |
| HUP0400017A2 (hu) | 2004-06-28 |
| EP1399443A1 (en) | 2004-03-24 |
| IL158869A0 (en) | 2004-05-12 |
| CA2448525A1 (en) | 2003-10-23 |
| US20070135422A1 (en) | 2007-06-14 |
| DE60224039T2 (de) | 2008-11-27 |
| US7141564B2 (en) | 2006-11-28 |
| DE60224039D1 (de) | 2008-01-24 |
| KR20040010654A (ko) | 2004-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4463565B2 (ja) | 抗菌剤として用いるための窒素含有二環式複素環 | |
| EP1537123B1 (en) | Amino-substituted cyclohexane derivatives for the treatment of bacterial infections | |
| JP4472928B2 (ja) | 4位がピペリジン含有部分によって置換されたキノリンおよびその窒素化誘導体および抗菌薬としてのその使用 | |
| EP1392686B1 (en) | Bicyclic nitrogen-containing heterocyclic derivatives for use as antibacterials | |
| EP1419155B1 (en) | Piperidine derivatives as antibacterial agents | |
| JP4515260B2 (ja) | アミノシクロヘキセンキノリンおよび抗菌活性を有するそのアザアイソステリック類似体 | |
| EP2181996A1 (en) | Aminopiperidine derivatives | |
| JP2006511622A (ja) | 抗菌剤 | |
| WO2004002490A2 (en) | Piperidine compounds as antibacterials | |
| WO2004014150A1 (en) | Denatured carob flour (dcf) with a low content of soluble tannins and sugars, meant for human consumption and process to obtain it |