CS219287B2 - Method of making the substituted 3-aminosydnonimine - Google Patents
Method of making the substituted 3-aminosydnonimine Download PDFInfo
- Publication number
- CS219287B2 CS219287B2 CS805258A CS525880A CS219287B2 CS 219287 B2 CS219287 B2 CS 219287B2 CS 805258 A CS805258 A CS 805258A CS 525880 A CS525880 A CS 525880A CS 219287 B2 CS219287 B2 CS 219287B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- compound
- formula
- optionally
- acid addition
- sydnonimine
- Prior art date
Links
- QVZILVCJQMNOLN-UHFFFAOYSA-N 5-imino-1-oxa-3-azonia-2-azanidacyclopent-3-en-3-amine Chemical class N[N+]1=CC(=N)O[N-]1 QVZILVCJQMNOLN-UHFFFAOYSA-N 0.000 title claims 2
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 42
- -1 -benzyl Chemical group 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 23
- 239000003795 chemical substances by application Substances 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000010933 acylation Effects 0.000 claims description 4
- 238000005917 acylation reaction Methods 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 230000002140 halogenating effect Effects 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 230000009935 nitrosation Effects 0.000 claims description 4
- 238000007034 nitrosation reaction Methods 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 230000026030 halogenation Effects 0.000 claims description 3
- 238000005658 halogenation reaction Methods 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 125000003944 tolyl group Chemical group 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 13
- 238000000354 decomposition reaction Methods 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- GSKDBLIBBOYOFU-UHFFFAOYSA-N oxadiazol-5-amine Chemical compound NC1=CN=NO1 GSKDBLIBBOYOFU-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- FCLZOMOQCVEGLA-UHFFFAOYSA-N 3-thiomorpholin-4-yl-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine;hydrochloride Chemical compound Cl.[N-]1OC(=N)C=[N+]1N1CCSCC1 FCLZOMOQCVEGLA-UHFFFAOYSA-N 0.000 description 3
- RWRDTPMJNKGMLD-UHFFFAOYSA-N 4-methylsulfonylpiperazin-1-amine Chemical compound CS(=O)(=O)N1CCN(N)CC1 RWRDTPMJNKGMLD-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- PVHAEKCGSUFXOW-UHFFFAOYSA-N ethyl carbamate;2,2,2-trichloroacetaldehyde Chemical compound CCOC(N)=O.ClC(Cl)(Cl)C=O PVHAEKCGSUFXOW-UHFFFAOYSA-N 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229960001412 pentobarbital Drugs 0.000 description 3
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 206010002091 Anaesthesia Diseases 0.000 description 2
- 206010002383 Angina Pectoris Diseases 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- LZLWZZAMQKRTFK-UHFFFAOYSA-N ethyl 2-[1-(5-imino-1-oxa-3-azonia-2-azanidacyclopent-3-en-3-yl)-4-methylsulfonylpiperazin-2-yl]-2-oxoacetate Chemical compound C(C)OC(=O)C(=O)C1CN(CCN1[N+]=1[N-]OC(C=1)=N)S(=O)(=O)C LZLWZZAMQKRTFK-UHFFFAOYSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- YDKNASMIEZGJEJ-UHFFFAOYSA-N 1,1-dioxo-1,4-thiazinan-4-amine Chemical compound NN1CCS(=O)(=O)CC1 YDKNASMIEZGJEJ-UHFFFAOYSA-N 0.000 description 1
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical compound N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 1
- QXQAPNSHUJORMC-UHFFFAOYSA-N 1-chloro-4-propylbenzene Chemical compound CCCC1=CC=C(Cl)C=C1 QXQAPNSHUJORMC-UHFFFAOYSA-N 0.000 description 1
- ZZAKLGGGMWORRT-UHFFFAOYSA-N 1-methylsulfonylpiperazine Chemical compound CS(=O)(=O)N1CCNCC1 ZZAKLGGGMWORRT-UHFFFAOYSA-N 0.000 description 1
- DOJXXICCKPTQFE-UHFFFAOYSA-N 1-oxo-1,4-thiazinan-4-amine Chemical compound NN1CCS(=O)CC1 DOJXXICCKPTQFE-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- JALMRIIJFAJDIO-UHFFFAOYSA-N 3-(4-methylsulfonylpiperazin-1-yl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine Chemical compound C1CN(S(=O)(=O)C)CCN1[N+]1=CC(=N)O[N-]1 JALMRIIJFAJDIO-UHFFFAOYSA-N 0.000 description 1
- NLIDVKBOLFJDGS-UHFFFAOYSA-N 3-(4-methylsulfonylpiperazin-1-yl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine;hydrochloride Chemical compound Cl.C1CN(S(=O)(=O)C)CCN1[N+]1=CC(=N)O[N-]1 NLIDVKBOLFJDGS-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HZIVJOVQLVOXHI-UHFFFAOYSA-N 4-(5-imino-1-oxa-3-azonia-2-azanidacyclopent-3-en-3-yl)-n,n-dimethylpiperazine-1-sulfonamide Chemical compound C1CN(S(=O)(=O)N(C)C)CCN1[N+]1=CC(=N)O[N-]1 HZIVJOVQLVOXHI-UHFFFAOYSA-N 0.000 description 1
- PHPROMWVLHHXQG-UHFFFAOYSA-N 4-(5-imino-1-oxa-3-azonia-2-azanidacyclopent-3-en-3-yl)-n,n-dimethylpiperazine-1-sulfonamide;hydrochloride Chemical compound Cl.C1CN(S(=O)(=O)N(C)C)CCN1[N+]1=CC(=N)O[N-]1 PHPROMWVLHHXQG-UHFFFAOYSA-N 0.000 description 1
- RAXFSLKTJBNHAQ-UHFFFAOYSA-N 4-amino-n,n-dimethylpiperazine-1-sulfonamide Chemical class CN(C)S(=O)(=O)N1CCN(N)CC1 RAXFSLKTJBNHAQ-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- JBMKAUGHUNFTOL-UHFFFAOYSA-N Aldoclor Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC=NS2(=O)=O JBMKAUGHUNFTOL-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- 241000208011 Digitalis Species 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 101100295738 Gallus gallus COR3 gene Proteins 0.000 description 1
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 238000007059 Strecker synthesis reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 125000005219 aminonitrile group Chemical group 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 229960000516 bezafibrate Drugs 0.000 description 1
- IIBYAHWJQTYFKB-UHFFFAOYSA-N bezafibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1CCNC(=O)C1=CC=C(Cl)C=C1 IIBYAHWJQTYFKB-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229960005003 carbocromen Drugs 0.000 description 1
- KLOIYEQEVSIOOO-UHFFFAOYSA-N carbocromen Chemical compound CC1=C(CCN(CC)CC)C(=O)OC2=CC(OCC(=O)OCC)=CC=C21 KLOIYEQEVSIOOO-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229960002896 clonidine Drugs 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000035487 diastolic blood pressure Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229960002877 dihydralazine Drugs 0.000 description 1
- VQKLRVZQQYVIJW-UHFFFAOYSA-N dihydralazine Chemical compound C1=CC=C2C(NN)=NN=C(NN)C2=C1 VQKLRVZQQYVIJW-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 1
- 229960002297 fenofibrate Drugs 0.000 description 1
- 230000001435 haemodynamic effect Effects 0.000 description 1
- 229960002474 hydralazine Drugs 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229960004815 meprobamate Drugs 0.000 description 1
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 description 1
- 229960002237 metoprolol Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960004027 molsidomine Drugs 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000008023 pharmaceutical filler Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- DQDAYGNAKTZFIW-UHFFFAOYSA-N phenprocoumon Chemical compound OC=1C2=CC=CC=C2OC(=O)C=1C(CC)C1=CC=CC=C1 DQDAYGNAKTZFIW-UHFFFAOYSA-N 0.000 description 1
- 229960004923 phenprocoumon Drugs 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- PHUTUTUABXHXLW-UHFFFAOYSA-N pindolol Chemical compound CC(C)NCC(O)COC1=CC=CC2=NC=C[C]12 PHUTUTUABXHXLW-UHFFFAOYSA-N 0.000 description 1
- 229960002508 pindolol Drugs 0.000 description 1
- WCTGTHKSZCFDRQ-UHFFFAOYSA-N piperazin-1-ylsulfonylmethanamine Chemical compound NCS(=O)(=O)N1CCNCC1 WCTGTHKSZCFDRQ-UHFFFAOYSA-N 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 description 1
- 229960001289 prazosin Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- IAFSUZIBZMPMPK-UHFFFAOYSA-N thiomorpholin-4-amine Chemical compound NN1CCSCC1 IAFSUZIBZMPMPK-UHFFFAOYSA-N 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/28—Nitrogen atoms
- C07D295/30—Nitrogen atoms non-acylated
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/04—1,2,3-Oxadiazoles; Hydrogenated 1,2,3-oxadiazoles
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792930736 DE2930736A1 (de) | 1979-07-28 | 1979-07-28 | Pharmakologisch wirksame, substituierte 3-amino-sydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS219287B2 true CS219287B2 (en) | 1983-03-25 |
Family
ID=6077064
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS805258A CS219287B2 (en) | 1979-07-28 | 1980-07-25 | Method of making the substituted 3-aminosydnonimine |
Country Status (24)
| Country | Link |
|---|---|
| US (3) | US4305939A (ro) |
| EP (1) | EP0023343B1 (ro) |
| JP (1) | JPS5625174A (ro) |
| AR (1) | AR230060A1 (ro) |
| AT (1) | ATE6859T1 (ro) |
| AU (1) | AU536082B2 (ro) |
| CA (1) | CA1127642A (ro) |
| CS (1) | CS219287B2 (ro) |
| DD (1) | DD152934A5 (ro) |
| DE (2) | DE2930736A1 (ro) |
| DK (1) | DK150067C (ro) |
| ES (1) | ES8104284A1 (ro) |
| FI (1) | FI75566C (ro) |
| GR (1) | GR69613B (ro) |
| HU (1) | HU182172B (ro) |
| IL (1) | IL60678A0 (ro) |
| NO (1) | NO802079L (ro) |
| NZ (1) | NZ194421A (ro) |
| PH (1) | PH17548A (ro) |
| PL (1) | PL126978B1 (ro) |
| PT (1) | PT71603A (ro) |
| RO (1) | RO79932A (ro) |
| SU (1) | SU963469A3 (ro) |
| ZA (1) | ZA804514B (ro) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3107933A1 (de) * | 1981-03-02 | 1982-09-16 | Cassella Ag, 6000 Frankfurt | Substituierte 3-amino-sydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| JPS5832870A (ja) * | 1981-08-24 | 1983-02-25 | Hiroyoshi Hidaka | 新規なシドノンイミン誘導体及びその製法 |
| GB2109123B (en) * | 1981-09-14 | 1986-03-19 | Sharp Kk | Colour liquid crystal display devices |
| JPS5859977A (ja) * | 1981-10-06 | 1983-04-09 | Banyu Pharmaceut Co Ltd | 新規なn−アシルシドノンイミン誘導体およびその製法 |
| JPS5961818A (ja) * | 1982-10-01 | 1984-04-09 | Seiko Epson Corp | 液晶表示装置 |
| DE3237323A1 (de) * | 1982-10-08 | 1984-04-12 | Robert Bosch Gmbh, 7000 Stuttgart | Anzeigevorrichtung |
| JPH0715536B2 (ja) * | 1983-01-28 | 1995-02-22 | キヤノン株式会社 | 表示パネル |
| DE3526068A1 (de) * | 1985-07-20 | 1987-01-22 | Cassella Ag | Substituierte 3-amino-sydnonimine, verfahren zu ihrer herstellung, ihre verwendung und sie enthaltende pharmazeutische praeparate |
| DE3702083A1 (de) * | 1987-01-24 | 1988-08-04 | Cassella Ag | Allylmercaptoacetyl-sydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| DE3732174A1 (de) * | 1987-09-24 | 1989-04-06 | Cassella Ag | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| US5221680A (en) * | 1988-01-14 | 1993-06-22 | Cassella Aktiengesellschaft | Substituted 3-aminosydnonimines |
| DE3820210A1 (de) * | 1988-06-14 | 1989-12-21 | Cassella Ag | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| DE4015236A1 (de) * | 1990-05-13 | 1991-11-14 | Cassella Ag | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| DE3921460A1 (de) * | 1989-06-30 | 1991-01-03 | Cassella Ag | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| DE3921796A1 (de) * | 1989-07-03 | 1991-01-17 | Cassella Ag | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| ATE90677T1 (de) * | 1989-11-30 | 1993-07-15 | Cassella Farbwerke Mainkur Ag | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung. |
| DE4031373A1 (de) * | 1990-10-04 | 1992-04-09 | Cassella Ag | 3-piperazino-sydnonimine, verfahren zu ihrer herstellung und ihre verwendung |
| EP0903346A1 (en) * | 1995-11-06 | 1999-03-24 | Chugai Seiyaku Kabushiki Kaisha | Sydnone imine derivatives |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1695897C3 (de) * | 1966-07-04 | 1979-02-15 | Takeda Chemical Industries Ltd | N-Acyl-sydnonimine, deren Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| DE1770061A1 (de) | 1968-03-26 | 1971-09-16 | Boehringer Sohn Ingelheim | Neue substituierte 3-Amino-4-bromsydnomimine |
| DE1670127A1 (de) * | 1966-08-09 | 1970-12-03 | Boehringer Sohn Ingelheim | Verfahren zur Herstellung neuer substituierter 3-Amino-sydnonimine |
| US3833580A (en) * | 1966-08-09 | 1974-09-03 | Boehringer Sohn Ingelheim | 3-morpholino-n6-cyclohexylcarbonyl sydnonimine |
| DE1942854A1 (de) * | 1969-02-25 | 1970-09-03 | Boehringer Sohn Ingelheim | Neue substituierte 3-Amino-4-halogensydnonimine |
| US3642793A (en) * | 1968-10-01 | 1972-02-15 | Takeda Chemical Industries Ltd | 3-hydrocarbon-4-tertiary amino methyl sydnones |
| DE2020299A1 (de) * | 1970-04-25 | 1971-11-11 | Bayer Ag | Perinonfarbstoffe |
| BE788052A (fr) * | 1971-08-26 | 1973-02-26 | Science Union & Cie Societe Fr | Nouveaux derives de la sydnone imine |
| US4147870A (en) * | 1976-05-19 | 1979-04-03 | Laboratorios Liade, S.A. | 1-Arylamidoethyl, 4-sulfonylpiperazines |
-
1979
- 1979-07-28 DE DE19792930736 patent/DE2930736A1/de not_active Withdrawn
-
1980
- 1980-07-07 AR AR281681A patent/AR230060A1/es active
- 1980-07-08 US US06/166,951 patent/US4305939A/en not_active Expired - Lifetime
- 1980-07-10 NO NO802079A patent/NO802079L/no unknown
- 1980-07-21 FI FI802297A patent/FI75566C/fi not_active IP Right Cessation
- 1980-07-23 EP EP80104315A patent/EP0023343B1/de not_active Expired
- 1980-07-23 AT AT80104315T patent/ATE6859T1/de not_active IP Right Cessation
- 1980-07-23 DE DE8080104315T patent/DE3067258D1/de not_active Expired
- 1980-07-23 NZ NZ194421A patent/NZ194421A/xx unknown
- 1980-07-24 RO RO80101799A patent/RO79932A/ro unknown
- 1980-07-24 PT PT71603A patent/PT71603A/pt unknown
- 1980-07-24 DD DD80222850A patent/DD152934A5/de unknown
- 1980-07-25 JP JP10140380A patent/JPS5625174A/ja active Granted
- 1980-07-25 IL IL60678A patent/IL60678A0/xx unknown
- 1980-07-25 ZA ZA00804514A patent/ZA804514B/xx unknown
- 1980-07-25 HU HU801868A patent/HU182172B/hu unknown
- 1980-07-25 AU AU60800/80A patent/AU536082B2/en not_active Ceased
- 1980-07-25 DK DK323780A patent/DK150067C/da not_active IP Right Cessation
- 1980-07-25 CS CS805258A patent/CS219287B2/cs unknown
- 1980-07-25 CA CA357,074A patent/CA1127642A/en not_active Expired
- 1980-07-25 SU SU802954167A patent/SU963469A3/ru active
- 1980-07-26 PL PL1980225899A patent/PL126978B1/pl unknown
- 1980-07-26 GR GR62555A patent/GR69613B/el unknown
- 1980-07-28 PH PH24352A patent/PH17548A/en unknown
- 1980-07-28 ES ES493774A patent/ES8104284A1/es not_active Expired
-
1981
- 1981-02-10 US US06/233,054 patent/US4332801A/en not_active Expired - Fee Related
- 1981-02-10 US US06/233,055 patent/US4452797A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| IL60678A0 (en) | 1980-09-16 |
| ES493774A0 (es) | 1981-04-01 |
| GR69613B (ro) | 1982-07-05 |
| PL126978B1 (en) | 1983-09-30 |
| RO79932A (ro) | 1982-10-11 |
| US4332801A (en) | 1982-06-01 |
| DE2930736A1 (de) | 1981-02-12 |
| EP0023343A3 (en) | 1981-04-15 |
| ES8104284A1 (es) | 1981-04-01 |
| PH17548A (en) | 1984-09-19 |
| EP0023343B1 (de) | 1984-03-28 |
| JPS5625174A (en) | 1981-03-10 |
| ZA804514B (en) | 1981-07-29 |
| DK323780A (da) | 1981-01-29 |
| CA1127642A (en) | 1982-07-13 |
| DK150067B (da) | 1986-12-01 |
| SU963469A3 (ru) | 1982-09-30 |
| US4305939A (en) | 1981-12-15 |
| DK150067C (da) | 1987-06-15 |
| FI75566B (fi) | 1988-03-31 |
| US4452797A (en) | 1984-06-05 |
| ATE6859T1 (de) | 1984-04-15 |
| DD152934A5 (de) | 1981-12-16 |
| NZ194421A (en) | 1982-05-31 |
| NO802079L (no) | 1981-01-29 |
| AR230060A1 (es) | 1984-02-29 |
| PL225899A1 (ro) | 1981-06-05 |
| DE3067258D1 (en) | 1984-05-03 |
| FI802297A7 (fi) | 1981-01-29 |
| JPH0128027B2 (ro) | 1989-05-31 |
| HU182172B (en) | 1983-12-28 |
| FI75566C (fi) | 1988-07-11 |
| EP0023343A2 (de) | 1981-02-04 |
| AU536082B2 (en) | 1984-04-19 |
| AU6080080A (en) | 1981-02-05 |
| PT71603A (de) | 1980-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS219287B2 (en) | Method of making the substituted 3-aminosydnonimine | |
| TW200300679A (en) | Substituted dipheny1 heterocycles useful for treating HCV infection | |
| US3910940A (en) | Anthelmintic 5-(heterocyclyl)-3-(isothiocyanophenyl)oxadiazoles | |
| DK164907B (da) | Piperazinderivater, deres fremstilling og farmaceutiske praeparater indeholdende dem | |
| US3312690A (en) | Sydnonimine derivatives | |
| US3419575A (en) | Novel 2-amino-5-aminoalkyl-thiadiazoles | |
| US4731383A (en) | Aminoguanidine compounds, their compositions and pharmaceutical uses | |
| DK149852B (da) | Analogifremgangsmaade til fremstilling af substituerede 3-aminosydnoniminer eller et farmakologisk acceptabelt syreadditionssalt deraf | |
| CS276993B6 (en) | Oxadiazolylalkylpurine derivatives, processes of their preparation and pharmaceuticals comprising thereof | |
| CZ325196A3 (en) | Derivatives of hydroximic acid, pharmaceutical compositions containing thereof, process of their preparation and intermediates used in the preparation process | |
| US3369022A (en) | 3-piperazinoalkyl-2-benzoxazolinones | |
| US4011220A (en) | Pyridazinium compounds and a process for their production | |
| FI79847B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara akridanon-derivat. | |
| DK162988B (da) | Substituerede 3-(4-phenyl-1-piperazinyl)ethylquinazolin-2,4-(1h,3h)dioner, fremstilling deraf samt praeparater indeholdende samme | |
| US4711889A (en) | Schistosomicidal acridanone hydrazones | |
| US3555019A (en) | (2h)-1,4-oxazine derivatives | |
| CZ329690A3 (en) | Substituted 3-aminosydnonimines, process of their preparation and their use | |
| US3892858A (en) | Method for lowering uric acid levels using 7-alkylsufonyl substituted benzothiadiazine-1,1-dioxides | |
| KR840001931B1 (ko) | 치환된 3-아미노-시드논-이민의 제조방법 | |
| US3833578A (en) | Pyrazinoylalkylbenzenesulfonylureas and process for their preparation | |
| HU194197B (en) | Process for producing 1,3,4-oxa- and -thia-diazol derivatives and pharmaceutical compositions containing them | |
| RU2157808C2 (ru) | Замещенные 6-r-1,3,4-тиадиазин-2-амины и их фармацевтическая композиция | |
| DE3921460A1 (de) | Substituierte 3-aminosydnonimine, verfahren zu ihrer herstellung und ihre verwendung | |
| US3816625A (en) | Method for lowering uric acid levels using 7-alkyl-sulfonyl substituted benzothiadiazine-1,1-dioxides | |
| CZ317790A3 (en) | Substituted 3-aminosydnonimines, process of their preparation and a pharmaceutical preparation containing thereof |