CS216535B2 - Fungicide means and means for regulation of the water plants growth and method of making the active substances - Google Patents
Fungicide means and means for regulation of the water plants growth and method of making the active substances Download PDFInfo
- Publication number
- CS216535B2 CS216535B2 CS796885A CS688579A CS216535B2 CS 216535 B2 CS216535 B2 CS 216535B2 CS 796885 A CS796885 A CS 796885A CS 688579 A CS688579 A CS 688579A CS 216535 B2 CS216535 B2 CS 216535B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- methyl
- pyridyl
- carbon atoms
- alkyl
- Prior art date
Links
- 239000000417 fungicide Substances 0.000 title claims abstract description 6
- 230000000855 fungicidal effect Effects 0.000 title claims description 18
- 230000012010 growth Effects 0.000 title claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title description 43
- 239000013543 active substance Substances 0.000 title description 12
- 230000033228 biological regulation Effects 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 4
- -1 trifluoromethylphenyl Chemical group 0.000 claims abstract description 177
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 118
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 claims abstract description 84
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 claims abstract description 56
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 39
- 238000000034 method Methods 0.000 claims abstract description 37
- 238000002360 preparation method Methods 0.000 claims abstract description 23
- 239000001257 hydrogen Substances 0.000 claims abstract description 16
- 125000003944 tolyl group Chemical group 0.000 claims abstract description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 14
- 125000005059 halophenyl group Chemical group 0.000 claims abstract description 13
- 125000006277 halobenzyl group Chemical group 0.000 claims abstract description 11
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims abstract description 10
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 8
- 125000005394 methallyl group Chemical group 0.000 claims abstract description 7
- 125000006178 methyl benzyl group Chemical group 0.000 claims abstract description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052717 sulfur Chemical group 0.000 claims abstract description 6
- 239000011593 sulfur Chemical group 0.000 claims abstract description 6
- IXDRVFHZVJDSQV-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 IXDRVFHZVJDSQV-UHFFFAOYSA-N 0.000 claims abstract description 5
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 5
- 125000006501 nitrophenyl group Chemical group 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000004135 2-norbornyl group Chemical group [H]C1([H])C([H])([H])C2([H])C([H])([H])C1([H])C([H])([H])C2([H])* 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 124
- 229910052799 carbon Inorganic materials 0.000 claims description 91
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 claims description 76
- 239000000203 mixture Substances 0.000 claims description 75
- 125000004432 carbon atom Chemical group C* 0.000 claims description 44
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 39
- 239000004480 active ingredient Substances 0.000 claims description 36
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 18
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 10
- 125000005023 xylyl group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- NOLHRFLIXVQPSZ-UHFFFAOYSA-N 1,3-thiazolidin-4-one Chemical class O=C1CSCN1 NOLHRFLIXVQPSZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- BMJBELLWVIGIMS-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound C1=CC(Cl)=CC=C1N1C(=O)CSC1C1=CC=CN=C1 BMJBELLWVIGIMS-UHFFFAOYSA-N 0.000 claims description 4
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 claims description 4
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 claims description 3
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 3
- PLBVNSJJNYHVDG-UHFFFAOYSA-N 2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound N1C(=O)CSC1C1=CC=CN=C1 PLBVNSJJNYHVDG-UHFFFAOYSA-N 0.000 claims description 3
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 3
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000464 thioxo group Chemical group S=* 0.000 claims 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 2
- 125000004043 oxo group Chemical group O=* 0.000 claims 2
- OQOXNRJXDYDFMJ-UHFFFAOYSA-N 2-cyclopentyl-n-methylethanamine Chemical compound CNCCC1CCCC1 OQOXNRJXDYDFMJ-UHFFFAOYSA-N 0.000 claims 1
- LVVQHDBPUGBITE-UHFFFAOYSA-N 3-[(4-chlorophenyl)methyl]-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound C1=CC(Cl)=CC=C1CN1C(=O)CSC1C1=CC=CN=C1 LVVQHDBPUGBITE-UHFFFAOYSA-N 0.000 claims 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 claims 1
- 229940100198 alkylating agent Drugs 0.000 claims 1
- 239000002168 alkylating agent Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000002993 cycloalkylene group Chemical group 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 abstract description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 6
- 239000005648 plant growth regulator Substances 0.000 abstract description 2
- 125000004076 pyridyl group Chemical group 0.000 abstract description 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 125000000164 1,3-thiazinyl group Chemical class S1C(N=CC=C1)* 0.000 abstract 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 abstract 1
- 125000001153 fluoro group Chemical group F* 0.000 abstract 1
- 150000003548 thiazolidines Chemical class 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 description 92
- 238000012360 testing method Methods 0.000 description 84
- 241000196324 Embryophyta Species 0.000 description 60
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 45
- 239000002689 soil Substances 0.000 description 38
- 239000000243 solution Substances 0.000 description 29
- 238000004458 analytical method Methods 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 23
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 22
- 241000221785 Erysiphales Species 0.000 description 22
- 201000010099 disease Diseases 0.000 description 19
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 19
- 241000209219 Hordeum Species 0.000 description 18
- 238000005481 NMR spectroscopy Methods 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 235000007340 Hordeum vulgare Nutrition 0.000 description 16
- 241000209140 Triticum Species 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 14
- 230000000694 effects Effects 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- 240000008067 Cucumis sativus Species 0.000 description 12
- 241000233866 Fungi Species 0.000 description 12
- 235000021307 Triticum Nutrition 0.000 description 12
- 239000004033 plastic Substances 0.000 description 12
- 238000011282 treatment Methods 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- 238000009472 formulation Methods 0.000 description 11
- 238000009331 sowing Methods 0.000 description 11
- 239000011550 stock solution Substances 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000007921 spray Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 239000004094 surface-active agent Substances 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 8
- 239000003995 emulsifying agent Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 6
- 239000002270 dispersing agent Substances 0.000 description 6
- 230000009036 growth inhibition Effects 0.000 description 6
- 230000003032 phytopathogenic effect Effects 0.000 description 6
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 5
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 5
- 241001113556 Elodea Species 0.000 description 5
- 244000068988 Glycine max Species 0.000 description 5
- 235000010469 Glycine max Nutrition 0.000 description 5
- 241000498251 Hydrilla Species 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- 235000008504 concentrate Nutrition 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 5
- 229920000053 polysorbate 80 Polymers 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 229960001866 silicon dioxide Drugs 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 230000001276 controlling effect Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 4
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 3
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000895502 Blumeria graminis f. sp. tritici Species 0.000 description 3
- 235000009849 Cucumis sativus Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 239000003945 anionic surfactant Substances 0.000 description 3
- 230000000843 anti-fungal effect Effects 0.000 description 3
- 229940121375 antifungal agent Drugs 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 229910021641 deionized water Inorganic materials 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000010410 dusting Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- NXMXETCTWNXSFG-UHFFFAOYSA-N 1-methoxypropan-2-amine Chemical compound COCC(C)N NXMXETCTWNXSFG-UHFFFAOYSA-N 0.000 description 2
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 2
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 2
- IYVPAOZCDVNELF-UHFFFAOYSA-N 2-pyridin-2-yl-1,3-thiazolidin-4-one Chemical compound N1C(=O)CSC1C1=CC=CC=N1 IYVPAOZCDVNELF-UHFFFAOYSA-N 0.000 description 2
- HRHFUHGNTSSIFS-UHFFFAOYSA-N 2h-thiazine 1-oxide Chemical class O=S1NC=CC=C1 HRHFUHGNTSSIFS-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- MKARNSWMMBGSHX-UHFFFAOYSA-N 3,5-dimethylaniline Chemical compound CC1=CC(C)=CC(N)=C1 MKARNSWMMBGSHX-UHFFFAOYSA-N 0.000 description 2
- JPQKNQHNGICQEU-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1N1C(=O)CSC1C1=CC=CN=C1 JPQKNQHNGICQEU-UHFFFAOYSA-N 0.000 description 2
- DENPAKQJZNDKEL-UHFFFAOYSA-N 3-(trifluoromethylsulfanyl)aniline Chemical compound NC1=CC=CC(SC(F)(F)F)=C1 DENPAKQJZNDKEL-UHFFFAOYSA-N 0.000 description 2
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000190150 Bipolaris sorokiniana Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000254173 Coleoptera Species 0.000 description 2
- 241000371644 Curvularia ravenelii Species 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 2
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000228452 Venturia inaequalis Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 239000010445 mica Substances 0.000 description 2
- 229910052618 mica group Inorganic materials 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000003209 petroleum derivative Substances 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000026267 regulation of growth Effects 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- SJUKJZSTBBSGHF-UHFFFAOYSA-N (2,4-dichlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1Cl SJUKJZSTBBSGHF-UHFFFAOYSA-N 0.000 description 1
- LRFWYBZWRQWZIM-UHFFFAOYSA-N (2-fluorophenyl)methanamine Chemical compound NCC1=CC=CC=C1F LRFWYBZWRQWZIM-UHFFFAOYSA-N 0.000 description 1
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical compound COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 1
- HMTSWYPNXFHGEP-UHFFFAOYSA-N (4-methylphenyl)methanamine Chemical compound CC1=CC=C(CN)C=C1 HMTSWYPNXFHGEP-UHFFFAOYSA-N 0.000 description 1
- ZILSBZLQGRBMOR-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethanamine Chemical compound NCC1=CC=C2OCOC2=C1 ZILSBZLQGRBMOR-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- SLYRGJDSFOCAAI-UHFFFAOYSA-N 1,3-thiazolidin-2-one Chemical group O=C1NCCS1 SLYRGJDSFOCAAI-UHFFFAOYSA-N 0.000 description 1
- JEJKKTYNUKTPTJ-UHFFFAOYSA-N 1-cyclopentylpropan-2-amine Chemical compound CC(N)CC1CCCC1 JEJKKTYNUKTPTJ-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 1
- YGDWUQFZMXWDKE-UHFFFAOYSA-N 1-oxido-1,3-thiazole Chemical class [O-]S1=CN=C=C1 YGDWUQFZMXWDKE-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- VBLXCTYLWZJBKA-UHFFFAOYSA-N 2-(trifluoromethyl)aniline Chemical compound NC1=CC=CC=C1C(F)(F)F VBLXCTYLWZJBKA-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- PDGFEZSVXMHFFO-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-ylmethyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound C=1C=C2OCOC2=CC=1CN1C(=O)CSC1C1=CC=CN=C1 PDGFEZSVXMHFFO-UHFFFAOYSA-N 0.000 description 1
- OKNSMTRKNXCYMM-UHFFFAOYSA-N 3-(2-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound ClC1=CC=CC=C1N1C(=O)CSC1C1=CC=CN=C1 OKNSMTRKNXCYMM-UHFFFAOYSA-N 0.000 description 1
- AFVLTYGEAYPIGJ-UHFFFAOYSA-N 3-(2-fluorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound FC1=CC=CC=C1N1C(=O)CSC1C1=CC=CN=C1 AFVLTYGEAYPIGJ-UHFFFAOYSA-N 0.000 description 1
- KMIGEZOZLGPHIZ-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound ClC1=CC(Cl)=CC(N2C(CSC2C=2C=NC=CC=2)=O)=C1 KMIGEZOZLGPHIZ-UHFFFAOYSA-N 0.000 description 1
- YXBJKWGEKWIELA-UHFFFAOYSA-N 3-(3-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound ClC1=CC=CC(N2C(CSC2C=2C=NC=CC=2)=O)=C1 YXBJKWGEKWIELA-UHFFFAOYSA-N 0.000 description 1
- FOMZYQOZHAWQKK-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazinan-4-one Chemical compound C1=CC(Cl)=CC=C1N1C(=O)CCSC1C1=CC=CN=C1 FOMZYQOZHAWQKK-UHFFFAOYSA-N 0.000 description 1
- JLISADVZBVMDFV-UHFFFAOYSA-N 3-(4-chlorophenyl)-5,5-bis(methylsulfanyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(SC)(SC)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 JLISADVZBVMDFV-UHFFFAOYSA-N 0.000 description 1
- VYJNYACYBULOBN-UHFFFAOYSA-N 3-(4-chlorophenyl)-5,5-dimethyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)(C)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 VYJNYACYBULOBN-UHFFFAOYSA-N 0.000 description 1
- MNSCTHXIQASMMM-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-hexyl-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(CCCCCC)(C)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 MNSCTHXIQASMMM-UHFFFAOYSA-N 0.000 description 1
- YLUYMHGJBRQSEV-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methyl-5-propyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(CCC)(C)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 YLUYMHGJBRQSEV-UHFFFAOYSA-N 0.000 description 1
- DQIQRAHPLYCGHH-UHFFFAOYSA-N 3-(4-chlorophenyl)-5-methylsulfanyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(SC)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 DQIQRAHPLYCGHH-UHFFFAOYSA-N 0.000 description 1
- UBFHMARVNLRWKZ-UHFFFAOYSA-N 3-(4-iodophenyl)-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1C1=CC=C(I)C=C1 UBFHMARVNLRWKZ-UHFFFAOYSA-N 0.000 description 1
- GFLIYZYLRITJEV-UHFFFAOYSA-N 3-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazinan-4-one Chemical compound C1=CC(C)=CC=C1N1C(=O)CCSC1C1=CC=CN=C1 GFLIYZYLRITJEV-UHFFFAOYSA-N 0.000 description 1
- KTZBHMYUJDDTGM-UHFFFAOYSA-N 3-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound C1=CC(C)=CC=C1N1C(=O)CSC1C1=CC=CN=C1 KTZBHMYUJDDTGM-UHFFFAOYSA-N 0.000 description 1
- VYNYAURPQOMFPH-UHFFFAOYSA-N 3-(4-nitrophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C(=O)CSC1C1=CC=CN=C1 VYNYAURPQOMFPH-UHFFFAOYSA-N 0.000 description 1
- KZUZZYKBZWKJHW-UHFFFAOYSA-N 3-(cyclohexylmethyl)-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1CC1CCCCC1 KZUZZYKBZWKJHW-UHFFFAOYSA-N 0.000 description 1
- HGXITJXQFHQVPN-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound CN(C)CCN1C(=O)C(C)SC1C1=CC=CN=C1 HGXITJXQFHQVPN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- KXRQSVJXYWXLEZ-UHFFFAOYSA-N 3-cyclooctyl-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1C1CCCCCCC1 KXRQSVJXYWXLEZ-UHFFFAOYSA-N 0.000 description 1
- NKAXJUIBLVQXQQ-UHFFFAOYSA-N 3-cyclopropyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1CSC(C=2C=NC=CC=2)N1C1CC1 NKAXJUIBLVQXQQ-UHFFFAOYSA-N 0.000 description 1
- LMHIBYREWJHKNZ-UHFFFAOYSA-N 3-methylpyridine-2-carboxylic acid Chemical compound CC1=CC=CN=C1C(O)=O LMHIBYREWJHKNZ-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- SRGSUBSMKMCIPE-UHFFFAOYSA-N 3-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound S1CC(=O)N(CCCCCCCCC)C1C1=CC=CN=C1 SRGSUBSMKMCIPE-UHFFFAOYSA-N 0.000 description 1
- UITXVOXYPYEUFH-UHFFFAOYSA-N 3-phenyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1CSC(C=2C=NC=CC=2)N1C1=CC=CC=C1 UITXVOXYPYEUFH-UHFFFAOYSA-N 0.000 description 1
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 1
- MMEGELSFOYDPQW-UHFFFAOYSA-N 4-bromo-3-methylaniline Chemical compound CC1=CC(N)=CC=C1Br MMEGELSFOYDPQW-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- VLVCDUSVTXIWGW-UHFFFAOYSA-N 4-iodoaniline Chemical compound NC1=CC=C(I)C=C1 VLVCDUSVTXIWGW-UHFFFAOYSA-N 0.000 description 1
- 125000006483 4-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1I)C([H])([H])* 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- KJEMNQKJPWKBON-UHFFFAOYSA-N 4-methylsulfanylaniline;hydrochloride Chemical compound Cl.CSC1=CC=C(N)C=C1 KJEMNQKJPWKBON-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- CVJSWYDBZYHUST-UHFFFAOYSA-N 5-butyl-3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(CCCC)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 CVJSWYDBZYHUST-UHFFFAOYSA-N 0.000 description 1
- FGXBWIGUJPONTL-UHFFFAOYSA-N 5-butyl-3-(4-chlorophenyl)-5-methyl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(CCCC)(C)SC(C=2C=NC=CC=2)N1C1=CC=C(Cl)C=C1 FGXBWIGUJPONTL-UHFFFAOYSA-N 0.000 description 1
- BDNZYSSJXXIKGT-UHFFFAOYSA-N 5-methyl-1,3-thiazolidin-4-one Chemical compound CC1SCNC1=O BDNZYSSJXXIKGT-UHFFFAOYSA-N 0.000 description 1
- HRGCONXZSYTDQO-UHFFFAOYSA-N 5-methyl-3-(2-methylphenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1C1=CC=CC=C1C HRGCONXZSYTDQO-UHFFFAOYSA-N 0.000 description 1
- CQLUZCXXDGXQJK-UHFFFAOYSA-N 5-methyl-3-(oxolan-2-ylmethyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1CC1CCCO1 CQLUZCXXDGXQJK-UHFFFAOYSA-N 0.000 description 1
- KBMZILNUVIUVTH-UHFFFAOYSA-N 5-methyl-3-[(4-methylphenyl)methyl]-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound O=C1C(C)SC(C=2C=NC=CC=2)N1CC1=CC=C(C)C=C1 KBMZILNUVIUVTH-UHFFFAOYSA-N 0.000 description 1
- PERBFVKWVVOJFZ-UHFFFAOYSA-N 5-methyl-3-propan-2-yl-2-pyridin-3-yl-1,3-thiazolidin-4-one Chemical compound S1C(C)C(=O)N(C(C)C)C1C1=CC=CN=C1 PERBFVKWVVOJFZ-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 208000004998 Abdominal Pain Diseases 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241001157813 Cercospora Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000002881 Colic Diseases 0.000 description 1
- GVOUFPWUYJWQSK-UHFFFAOYSA-N Cyclofenil Chemical group C1=CC(OC(=O)C)=CC=C1C(C=1C=CC(OC(C)=O)=CC=1)=C1CCCCC1 GVOUFPWUYJWQSK-UHFFFAOYSA-N 0.000 description 1
- 241000896222 Erysiphe polygoni Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N N,N′-Dicyclohexylcarbodiimide Substances C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- KYRVNWMVYQXFEU-UHFFFAOYSA-N Nocodazole Chemical compound C1=C2NC(NC(=O)OC)=NC2=CC=C1C(=O)C1=CC=CS1 KYRVNWMVYQXFEU-UHFFFAOYSA-N 0.000 description 1
- 241001281803 Plasmopara viticola Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 241000540505 Puccinia dispersa f. sp. tritici Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241001533598 Septoria Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229940123464 Thiazolidinedione Drugs 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000003569 amebicidal effect Effects 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000012871 anti-fungal composition Substances 0.000 description 1
- 230000002365 anti-tubercular Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- JEPPYVOSGKWVSJ-UHFFFAOYSA-N bicyclo[2.2.1]heptan-3-amine Chemical compound C1CC2C(N)CC1C2 JEPPYVOSGKWVSJ-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 229960002944 cyclofenil Drugs 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000006623 cyclooctylmethyl group Chemical group 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 101150047356 dec-1 gene Proteins 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- LRCFXGAMWKDGLA-UHFFFAOYSA-N dioxosilane;hydrate Chemical compound O.O=[Si]=O LRCFXGAMWKDGLA-UHFFFAOYSA-N 0.000 description 1
- 238000011037 discontinuous sequential dilution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 239000003621 irrigation water Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- HMXVOMSRSHFEDJ-UHFFFAOYSA-N n-(4-butylphenyl)-3-(hydroxymethyl)piperidine-1-carbothioamide Chemical compound C1=CC(CCCC)=CC=C1NC(=S)N1CC(CO)CCC1 HMXVOMSRSHFEDJ-UHFFFAOYSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BMROZNZIAYCBGB-UHFFFAOYSA-N n-phenyl-1-pyridin-3-ylmethanimine Chemical compound C=1C=CN=CC=1C=NC1=CC=CC=C1 BMROZNZIAYCBGB-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- 235000005152 nicotinamide Nutrition 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- YNOGYQAEJGADFJ-UHFFFAOYSA-N oxolan-2-ylmethanamine Chemical compound NCC1CCCO1 YNOGYQAEJGADFJ-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- GPRQUTDXGQDKEQ-UHFFFAOYSA-N piperidine-3-carbaldehyde Chemical compound O=CC1CCCNC1 GPRQUTDXGQDKEQ-UHFFFAOYSA-N 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000136 polysorbate Chemical class 0.000 description 1
- 230000017363 positive regulation of growth Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000014483 powder concentrate Nutrition 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229960004029 silicic acid Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- CDMSTOYSGXMDMA-UHFFFAOYSA-N thiazin-4-one Chemical group O=C1C=CSN=C1 CDMSTOYSGXMDMA-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- VOBWLFNYOWWARN-UHFFFAOYSA-N thiophen-3-one Chemical compound O=C1CSC=C1 VOBWLFNYOWWARN-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- VSRBKQFNFZQRBM-UHFFFAOYSA-N tuaminoheptane Chemical compound CCCCCC(C)N VSRBKQFNFZQRBM-UHFFFAOYSA-N 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having no bond to a nitrogen atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
- A01N43/78—1,3-Thiazoles; Hydrogenated 1,3-thiazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/86—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms six-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS809155A CS216536B2 (cs) | 1978-10-16 | 1980-12-22 | Způsob výroby thiazinonových derivátů |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US95170878A | 1978-10-16 | 1978-10-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS216535B2 true CS216535B2 (en) | 1982-11-26 |
Family
ID=25492046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS796885A CS216535B2 (en) | 1978-10-16 | 1979-10-10 | Fungicide means and means for regulation of the water plants growth and method of making the active substances |
Country Status (28)
| Country | Link |
|---|---|
| EP (1) | EP0010420B1 (ro) |
| JP (1) | JPS5555184A (ro) |
| AR (1) | AR225154A1 (ro) |
| AT (1) | ATA670079A (ro) |
| AU (1) | AU5165479A (ro) |
| BE (1) | BE879368A (ro) |
| BR (1) | BR7906634A (ro) |
| CH (1) | CH643842A5 (ro) |
| CS (1) | CS216535B2 (ro) |
| DD (3) | DD150747A5 (ro) |
| DE (1) | DE2967188D1 (ro) |
| DK (1) | DK434779A (ro) |
| ES (2) | ES485073A1 (ro) |
| FI (1) | FI793191A7 (ro) |
| FR (1) | FR2439197B1 (ro) |
| GB (1) | GB2031892B (ro) |
| GR (1) | GR71652B (ro) |
| HU (2) | HU185844B (ro) |
| IE (1) | IE48966B1 (ro) |
| IL (1) | IL58446A (ro) |
| LU (1) | LU81779A1 (ro) |
| NZ (1) | NZ191818A (ro) |
| PH (1) | PH15765A (ro) |
| PL (2) | PL125628B1 (ro) |
| PT (2) | PT70313A (ro) |
| RO (4) | RO78232A (ro) |
| SU (1) | SU1079175A3 (ro) |
| ZA (1) | ZA795488B (ro) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4443454A (en) * | 1978-02-17 | 1984-04-17 | Imperial Chemical Industries Plc | Thiazolidinones |
| US4443455A (en) * | 1978-02-17 | 1984-04-17 | Imperial Chemical Industries Plc | Fungidical thiazolidinones |
| US4482712A (en) * | 1978-10-16 | 1984-11-13 | Eli Lilly And Company | Substituted 1-thia-3-aza-4-ones |
| GB2096993A (en) * | 1981-04-02 | 1982-10-27 | Ciba Geigy Ag | Novel thiazoline derivatives and compositions containing them and their use as pesticides |
| CA1229337A (en) * | 1982-04-02 | 1987-11-17 | Pieter T. Haken | Fungicidal heterocyclic compounds |
| JPS6061580A (ja) * | 1983-09-16 | 1985-04-09 | Zenyaku Kogyo Kk | 新規1,4−チアジン誘導体とその製造法 |
| JPS63225373A (ja) * | 1986-07-24 | 1988-09-20 | Sumitomo Pharmaceut Co Ltd | 新規チアゾリジン−4−オン誘導体およびその酸付加塩 |
| US4992455A (en) * | 1987-05-22 | 1991-02-12 | Sumitomo Pharmaceuticals Company, Limited | Thiazolidin-4-one derivatives useful for treating diseases caused by platelet activating factor |
| US5021435A (en) * | 1988-01-22 | 1991-06-04 | Sumitomo Pharmaceuticals Company, Limited | Certain pyridyl-thiazolidin-4-one having anti-ulcer activity |
| ATE154350T1 (de) * | 1990-10-17 | 1997-06-15 | Hoechst Schering Agrevo Gmbh | Pyrimidin-derivate, verfahren zu ihrer herstellung sie enthaltende mittel und ihre verwendung als fungizide |
| DE4243818A1 (de) * | 1992-12-23 | 1994-06-30 | Bayer Ag | 5-Aryl-1,3-thiazin-Derivate |
| EP1082315A1 (en) | 1998-06-05 | 2001-03-14 | Icagen, Inc. | Potassium channel inhibitors |
| US6174908B1 (en) | 1999-05-10 | 2001-01-16 | Icagen, Inc. | Potassium channel inhibitors |
| US6506751B1 (en) | 1999-11-12 | 2003-01-14 | Millennium Pharmaceuticals, Inc. | Thiazolidinone compounds useful as chemokine inhibitors |
| TWI394753B (zh) * | 2006-03-17 | 2013-05-01 | Otsuka Pharma Co Ltd | 新穎替妥牟拉(tetomilast)晶體 |
| CN117143090A (zh) * | 2023-08-14 | 2023-12-01 | 中国科学院海洋研究所 | 含呋喃杂环的4-噻唑烷酮类化合物及其制备方法与应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2910479A (en) * | 1958-01-06 | 1959-10-27 | Ciba Pharm Prod Inc | Certain 4-pyridyl thiazoline-2-ones and process |
| CH433322A (de) * | 1964-04-16 | 1967-04-15 | Dresden Arzneimittel | Verfahren zur Herstellung von peripher gefässerweiternd wirksamen Salzen des 2-(Pyridyl-(3'))-thiazolin- 2 |
| US3574841A (en) * | 1968-03-05 | 1971-04-13 | Mobil Oil Corp | Fungicidal methods using substituted nitropyridines |
| CA962269A (en) * | 1971-05-05 | 1975-02-04 | Uniroyal Ltd. | Thiazoles, and their use as insecticides |
| GB1539726A (en) * | 1974-12-31 | 1979-01-31 | Nitidandhaprabhas O | Treatment of animals suffering from mange |
| FR2356423A1 (fr) * | 1976-07-01 | 1978-01-27 | Oeriu Simion | Derives de l'acide thiazolidinecarboxylique, leur preparation et leur application comme medicaments |
| DE2965598D1 (en) * | 1978-02-17 | 1983-07-14 | Ici Plc | Thiazolidinone derivatives, their preparation, their pesticidal compositions and processes for treating plants |
-
1979
- 1979-10-10 AU AU51654/79A patent/AU5165479A/en not_active Abandoned
- 1979-10-10 NZ NZ191818A patent/NZ191818A/xx unknown
- 1979-10-10 CS CS796885A patent/CS216535B2/cs unknown
- 1979-10-11 LU LU81779A patent/LU81779A1/fr unknown
- 1979-10-11 AR AR278464A patent/AR225154A1/es active
- 1979-10-12 PH PH23161A patent/PH15765A/en unknown
- 1979-10-12 BE BE1/9563A patent/BE879368A/fr not_active IP Right Cessation
- 1979-10-14 IL IL58446A patent/IL58446A/xx unknown
- 1979-10-15 PT PT70313A patent/PT70313A/pt unknown
- 1979-10-15 RO RO7998944A patent/RO78232A/ro unknown
- 1979-10-15 RO RO79105702A patent/RO82467A/ro unknown
- 1979-10-15 GR GR60266A patent/GR71652B/el unknown
- 1979-10-15 GB GB7935748A patent/GB2031892B/en not_active Expired
- 1979-10-15 AT AT0670079A patent/ATA670079A/de not_active Application Discontinuation
- 1979-10-15 FI FI793191A patent/FI793191A7/fi not_active Application Discontinuation
- 1979-10-15 IE IE1949/79A patent/IE48966B1/en unknown
- 1979-10-15 DK DK434779A patent/DK434779A/da not_active Application Discontinuation
- 1979-10-15 HU HU79EI884A patent/HU185844B/hu unknown
- 1979-10-15 EP EP79302215A patent/EP0010420B1/en not_active Expired
- 1979-10-15 DE DE7979302215T patent/DE2967188D1/de not_active Expired
- 1979-10-15 CH CH931179A patent/CH643842A5/fr not_active IP Right Cessation
- 1979-10-15 HU HU79@@84165A patent/HU187550B/hu unknown
- 1979-10-15 BR BR7906634A patent/BR7906634A/pt unknown
- 1979-10-15 RO RO7998943A patent/RO78231A/ro unknown
- 1979-10-15 SU SU792831951A patent/SU1079175A3/ru active
- 1979-10-15 RO RO79105701A patent/RO82359A/ro unknown
- 1979-10-15 ZA ZA00795488A patent/ZA795488B/xx unknown
- 1979-10-15 PT PT70314A patent/PT70314A/pt unknown
- 1979-10-15 FR FR7925597A patent/FR2439197B1/fr not_active Expired
- 1979-10-16 PL PL1979218994A patent/PL125628B1/pl unknown
- 1979-10-16 DD DD79220572A patent/DD150747A5/de unknown
- 1979-10-16 ES ES485073A patent/ES485073A1/es not_active Expired
- 1979-10-16 JP JP13410079A patent/JPS5555184A/ja active Pending
- 1979-10-16 PL PL1979231659A patent/PL127226B1/pl unknown
- 1979-10-16 ES ES485072A patent/ES8200105A1/es not_active Expired
- 1979-10-16 DD DD79216255A patent/DD146539A5/de unknown
- 1979-10-16 DD DD79220571A patent/DD150746A5/de unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS216535B2 (en) | Fungicide means and means for regulation of the water plants growth and method of making the active substances | |
| CA1341008C (en) | A - unsaturated amines, their production and use | |
| DE60001241T2 (de) | Heterocyclisch substituierte Isoxazolidine und ihre Verwendung als Fungizide | |
| JPH0419992B2 (ro) | ||
| US6413997B1 (en) | 3-(substituted phenyl)-5-(substituted heterocyclyl)-1,2,4-triazole compounds | |
| HU205537B (en) | Fungicidal compositions comprising azole derivatives as active ingredient | |
| JPS59130287A (ja) | ピリジルイソオキサゾリジン | |
| CA1223586A (en) | Fungicidal heterocyclic amines | |
| GB2043062A (en) | N-(heterocyclyl)-acetanilide derivatives and herbicidal and plant growth regulating compositions containing them | |
| EP0352946A1 (en) | Triazole antifungal agents | |
| US4436739A (en) | Substituted 1-thia-3-aza-4-ones | |
| JPS60224689A (ja) | (1,2,4‐トリアゾル‐1‐イル)‐メチル‐カルビノール | |
| CA2076404A1 (en) | Fungicidal 2-aryl-2-cyano-2 (heterocyclylalkyl)ethyl-1,2,4- triazoles | |
| EP0002939B1 (en) | Novel carbothioamides, compositions containing them and their preparation | |
| DD242742A5 (de) | Insektizide mittel | |
| JP2001031678A (ja) | 除草剤としての置換トリアゾール、イミダゾールおよびピラゾール | |
| US4482712A (en) | Substituted 1-thia-3-aza-4-ones | |
| KR830002009B1 (ko) | 치환된 1-티아-3-아자-4-온의 제조방법 | |
| EP0002938B1 (en) | Novel heterocyclic carbothioamides, compositions containing them, their preparation and use | |
| JPH09176170A (ja) | 殺微生物剤 | |
| JPH03169872A (ja) | 植物を病気から保護するための組成物 | |
| EP0411718A2 (en) | Thiazole derivatives, their preparation and their use as fungicides | |
| AU616223B2 (en) | 2-cyano-2-aryl-1-(azole-1-yl)- ethane derivatives | |
| NL8303127A (nl) | Nieuwe chlooraceetamiden, preparaten met herbicide werking die deze verbindingen bevatten en werkwijzen voor het bereiden en toepassen van deze verbindingen. | |
| JPH07504898A (ja) | アゾオキシムエーテルおよび殺真菌剤としてのそれらの用途 |