CS207657B2 - Herbicide means and method of making the active substances - Google Patents
Herbicide means and method of making the active substances Download PDFInfo
- Publication number
- CS207657B2 CS207657B2 CS781338A CS133878A CS207657B2 CS 207657 B2 CS207657 B2 CS 207657B2 CS 781338 A CS781338 A CS 781338A CS 133878 A CS133878 A CS 133878A CS 207657 B2 CS207657 B2 CS 207657B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- imidazole
- formula
- dimethyl
- ethyl
- compounds
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 22
- 239000004009 herbicide Substances 0.000 title abstract description 8
- 239000013543 active substance Substances 0.000 title description 12
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 103
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 37
- 150000002460 imidazoles Chemical class 0.000 claims abstract description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 6
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 3
- 125000003342 alkenyl group Chemical group 0.000 claims abstract 2
- -1 hydrogen halogen Chemical class 0.000 claims description 69
- 239000000203 mixture Substances 0.000 claims description 61
- 239000002253 acid Substances 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 21
- 239000003085 diluting agent Substances 0.000 claims description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 12
- 239000000969 carrier Substances 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 9
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 230000037406 food intake Effects 0.000 claims 1
- 239000002435 venom Substances 0.000 claims 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 abstract description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 abstract description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 abstract description 4
- 125000005843 halogen group Chemical group 0.000 abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 228
- 241000196324 Embryophyta Species 0.000 description 94
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 84
- 238000002844 melting Methods 0.000 description 60
- 230000008018 melting Effects 0.000 description 60
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 50
- 238000002425 crystallisation Methods 0.000 description 44
- 230000008025 crystallization Effects 0.000 description 41
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 37
- 230000012010 growth Effects 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 26
- 239000003921 oil Substances 0.000 description 25
- 235000019198 oils Nutrition 0.000 description 25
- 239000012141 concentrate Substances 0.000 description 19
- 235000008504 concentrate Nutrition 0.000 description 19
- 239000007788 liquid Substances 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- 238000012360 testing method Methods 0.000 description 17
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 16
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000009835 boiling Methods 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 238000005507 spraying Methods 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 13
- 244000038559 crop plants Species 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- 239000007921 spray Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 150000002825 nitriles Chemical class 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000002689 soil Substances 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 8
- JATMVOZCTXZUMT-UHFFFAOYSA-N CC(C1=CC=C(C=C1)I)N2C=NC(=C2C(=O)O)C(=O)O Chemical compound CC(C1=CC=C(C=C1)I)N2C=NC(=C2C(=O)O)C(=O)O JATMVOZCTXZUMT-UHFFFAOYSA-N 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 8
- 239000004615 ingredient Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- ZEVWQFWTGHFIDH-UHFFFAOYSA-N 1h-imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C=1N=CNC=1C(O)=O ZEVWQFWTGHFIDH-UHFFFAOYSA-N 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- FROZNGWBPQFKEK-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(Cl)C(Cl)=C1 FROZNGWBPQFKEK-UHFFFAOYSA-N 0.000 description 6
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 241000209761 Avena Species 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- 241001148683 Zostera marina Species 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- UEIJPSVZLULBMX-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Cl)C(Cl)=C1 UEIJPSVZLULBMX-UHFFFAOYSA-N 0.000 description 5
- 125000006185 3,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])[H])C([H])([H])* 0.000 description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 230000006978 adaptation Effects 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 5
- 239000007900 aqueous suspension Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000004495 emulsifiable concentrate Substances 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- 238000000227 grinding Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- LEBUFKMXQTTWDK-UHFFFAOYSA-N (3,4-dibromophenyl)methanol Chemical compound OCC1=CC=C(Br)C(Br)=C1 LEBUFKMXQTTWDK-UHFFFAOYSA-N 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 4
- 125000006482 3-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(I)=C1[H])C([H])([H])* 0.000 description 4
- 235000007320 Avena fatua Nutrition 0.000 description 4
- 241000209764 Avena fatua Species 0.000 description 4
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 4
- 235000008427 Brassica arvensis Nutrition 0.000 description 4
- 244000024671 Brassica kaber Species 0.000 description 4
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 235000010469 Glycine max Nutrition 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 240000006694 Stellaria media Species 0.000 description 4
- 235000021536 Sugar beet Nutrition 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000003337 fertilizer Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 235000009973 maize Nutrition 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- DHMPDNLGFIBQCK-UHFFFAOYSA-N 3,4-dibromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(Br)=C1 DHMPDNLGFIBQCK-UHFFFAOYSA-N 0.000 description 3
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 3
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 3
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 3
- 125000006483 4-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1I)C([H])([H])* 0.000 description 3
- 244000291564 Allium cepa Species 0.000 description 3
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 3
- 241000743985 Alopecurus Species 0.000 description 3
- 241000219312 Chenopodium Species 0.000 description 3
- 240000006122 Chenopodium album Species 0.000 description 3
- 235000009344 Chenopodium album Nutrition 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 3
- 241000192043 Echinochloa Species 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 3
- 241000520028 Lamium Species 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- 235000007238 Secale cereale Nutrition 0.000 description 3
- 244000082988 Secale cereale Species 0.000 description 3
- 241000220261 Sinapis Species 0.000 description 3
- 240000003829 Sorghum propinquum Species 0.000 description 3
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 3
- 241000862969 Stella Species 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- UOUIDNHNSLAJDQ-UHFFFAOYSA-N diethyl 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C(=O)OCC)N=CN1CC1=CC=C(Cl)C(Cl)=C1 UOUIDNHNSLAJDQ-UHFFFAOYSA-N 0.000 description 3
- 239000004491 dispersible concentrate Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 2
- ABAUGTVEDXFARS-UHFFFAOYSA-N 1,2-dibromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C(Br)=C1 ABAUGTVEDXFARS-UHFFFAOYSA-N 0.000 description 2
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- BQTRMYJYYNQQGK-UHFFFAOYSA-N 1-(bromomethyl)-4-iodobenzene Chemical compound BrCC1=CC=C(I)C=C1 BQTRMYJYYNQQGK-UHFFFAOYSA-N 0.000 description 2
- HWQGXBCAMFVSPB-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(Cl)=CC=C1CN1C(C#N)=C(C#N)N=C1 HWQGXBCAMFVSPB-UHFFFAOYSA-N 0.000 description 2
- WWUJIGWQPQFRGS-UHFFFAOYSA-N 1-[(3,5-dichlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound ClC1=CC(Cl)=CC(CN2C(=C(C#N)N=C2)C#N)=C1 WWUJIGWQPQFRGS-UHFFFAOYSA-N 0.000 description 2
- XJQTWIQFBGQRBN-UHFFFAOYSA-N 1-[(3-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound CC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 XJQTWIQFBGQRBN-UHFFFAOYSA-N 0.000 description 2
- QFMDFTQOJHFVNR-UHFFFAOYSA-N 1-[2,2-dichloro-1-(4-ethylphenyl)ethyl]-4-ethylbenzene Chemical compound C1=CC(CC)=CC=C1C(C(Cl)Cl)C1=CC=C(CC)C=C1 QFMDFTQOJHFVNR-UHFFFAOYSA-N 0.000 description 2
- MSSYHCXUGVOREX-UHFFFAOYSA-N 1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarbonitrile Chemical compound FC(F)(F)C1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 MSSYHCXUGVOREX-UHFFFAOYSA-N 0.000 description 2
- VFZGUIRCBMCSKT-UHFFFAOYSA-N 1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(C(F)(F)F)=C1 VFZGUIRCBMCSKT-UHFFFAOYSA-N 0.000 description 2
- BHAAQCPWCCKULK-UHFFFAOYSA-N 2-benzyl-1h-imidazole-4,5-dicarbonitrile Chemical compound N1C(C#N)=C(C#N)N=C1CC1=CC=CC=C1 BHAAQCPWCCKULK-UHFFFAOYSA-N 0.000 description 2
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000002528 4-isopropyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 2
- 241000219144 Abutilon Species 0.000 description 2
- 240000006995 Abutilon theophrasti Species 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 235000021537 Beetroot Nutrition 0.000 description 2
- 235000016068 Berberis vulgaris Nutrition 0.000 description 2
- 241000335053 Beta vulgaris Species 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 235000009849 Cucumis sativus Nutrition 0.000 description 2
- 235000017896 Digitaria Nutrition 0.000 description 2
- 241001303487 Digitaria <clam> Species 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 241000508725 Elymus repens Species 0.000 description 2
- 241001289540 Fallopia convolvulus Species 0.000 description 2
- 241000816457 Galeopsis Species 0.000 description 2
- 206010053759 Growth retardation Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000207890 Ipomoea purpurea Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 244000292693 Poa annua Species 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- 235000001855 Portulaca oleracea Nutrition 0.000 description 2
- 244000234609 Portulaca oleracea Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000000111 Saccharum officinarum Species 0.000 description 2
- 235000007201 Saccharum officinarum Nutrition 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 240000003728 Spergula arvensis Species 0.000 description 2
- RCTGMCJBQGBLKT-UHFFFAOYSA-N Sudan IV Chemical compound CC1=CC=CC=C1N=NC(C=C1C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 RCTGMCJBQGBLKT-UHFFFAOYSA-N 0.000 description 2
- 240000000377 Tussilago farfara Species 0.000 description 2
- 235000004869 Tussilago farfara Nutrition 0.000 description 2
- 235000009108 Urtica dioica Nutrition 0.000 description 2
- 240000005592 Veronica officinalis Species 0.000 description 2
- 241000394440 Viola arvensis Species 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 229940037003 alum Drugs 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- 150000003938 benzyl alcohols Chemical class 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 description 2
- 235000019792 magnesium silicate Nutrition 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- HRRDCWDFRIJIQZ-UHFFFAOYSA-N naphthalene-1,8-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C(=O)O)=CC=CC2=C1 HRRDCWDFRIJIQZ-UHFFFAOYSA-N 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 238000009333 weeding Methods 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- ZRBDUKUJADUIEO-UHFFFAOYSA-N (3-bromo-4-methylphenyl)methanol Chemical compound CC1=CC=C(CO)C=C1Br ZRBDUKUJADUIEO-UHFFFAOYSA-N 0.000 description 1
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- MRRBAEJGLOLWCX-UPHRSURJSA-N (z)-2,3-diaminobut-2-enedioic acid Chemical compound OC(=O)C(/N)=C(/N)C(O)=O MRRBAEJGLOLWCX-UPHRSURJSA-N 0.000 description 1
- ZFLRKAMKGYNFPH-UHFFFAOYSA-N 1,3-dichloro-5-(chloromethyl)benzene Chemical compound ClCC1=CC(Cl)=CC(Cl)=C1 ZFLRKAMKGYNFPH-UHFFFAOYSA-N 0.000 description 1
- DAQIQOIKLVJWKH-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)pentan-1-one Chemical compound CCCCC(=O)C1=CC=C(Cl)C(Cl)=C1 DAQIQOIKLVJWKH-UHFFFAOYSA-N 0.000 description 1
- JZJWCDQGIPQBAO-UHFFFAOYSA-N 1-(4-iodophenyl)ethanone Chemical compound CC(=O)C1=CC=C(I)C=C1 JZJWCDQGIPQBAO-UHFFFAOYSA-N 0.000 description 1
- BACZSVQZBSCWIG-UHFFFAOYSA-N 1-(bromomethyl)-3-iodobenzene Chemical compound BrCC1=CC=CC(I)=C1 BACZSVQZBSCWIG-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- LZBOHNCMCCSTJX-UHFFFAOYSA-N 1-(chloromethyl)-3-methylbenzene Chemical compound CC1=CC=CC(CCl)=C1 LZBOHNCMCCSTJX-UHFFFAOYSA-N 0.000 description 1
- LBMKFQMJURUPKC-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCl)C=C1 LBMKFQMJURUPKC-UHFFFAOYSA-N 0.000 description 1
- MCHDHQVROPEJJT-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCl)C=C1 MCHDHQVROPEJJT-UHFFFAOYSA-N 0.000 description 1
- DUBCVXSYZVTCOC-UHFFFAOYSA-N 1-(chloromethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(CCl)C=C1 DUBCVXSYZVTCOC-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N 1-Pyrroline Chemical compound C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- SDQKLNLLDUWPRM-UHFFFAOYSA-N 1-[(3,4-dibromophenyl)methyl]imidazole Chemical compound BrC=1C=C(CN2C=NC=C2)C=CC=1Br SDQKLNLLDUWPRM-UHFFFAOYSA-N 0.000 description 1
- OAEZHYFDCHQVEG-UHFFFAOYSA-N 1-[(3,4-dimethylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(C)C(C)=CC=C1CN1C(C#N)=C(C#N)N=C1 OAEZHYFDCHQVEG-UHFFFAOYSA-N 0.000 description 1
- RNVCIUBPHQDEID-UHFFFAOYSA-N 1-[(3,5-dichlorophenyl)methyl]imidazole Chemical compound ClC1=CC(Cl)=CC(CN2C=NC=C2)=C1 RNVCIUBPHQDEID-UHFFFAOYSA-N 0.000 description 1
- RQLHDIWUIMTHRZ-UHFFFAOYSA-N 1-[(3,5-dichlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC(Cl)=CC(Cl)=C1 RQLHDIWUIMTHRZ-UHFFFAOYSA-N 0.000 description 1
- VMAWTAARMCGBOW-UHFFFAOYSA-N 1-[(3-bromo-4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Br)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VMAWTAARMCGBOW-UHFFFAOYSA-N 0.000 description 1
- DISBIUPTUVSAAX-UHFFFAOYSA-N 1-[(3-bromophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound BrC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 DISBIUPTUVSAAX-UHFFFAOYSA-N 0.000 description 1
- PMVHCGDDEOTPIA-UHFFFAOYSA-N 1-[(3-bromophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(Br)=C1 PMVHCGDDEOTPIA-UHFFFAOYSA-N 0.000 description 1
- NKKZAXBEEMWFTP-UHFFFAOYSA-N 1-[(3-chloro-4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(OC)=CC=C1CN1C(C#N)=C(C#N)N=C1 NKKZAXBEEMWFTP-UHFFFAOYSA-N 0.000 description 1
- VPDODNZBDFMTQW-UHFFFAOYSA-N 1-[(3-chloro-4-methoxyphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(OC)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VPDODNZBDFMTQW-UHFFFAOYSA-N 0.000 description 1
- MKRDSPFEMSOAGL-UHFFFAOYSA-N 1-[(3-chloro-4-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(C)=CC=C1CN1C(C#N)=C(C#N)N=C1 MKRDSPFEMSOAGL-UHFFFAOYSA-N 0.000 description 1
- IGOXWALFLCBKOO-UHFFFAOYSA-N 1-[(3-chloro-4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 IGOXWALFLCBKOO-UHFFFAOYSA-N 0.000 description 1
- TVKRDBQEICMHMX-UHFFFAOYSA-N 1-[(3-fluorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound FC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 TVKRDBQEICMHMX-UHFFFAOYSA-N 0.000 description 1
- RBIAKJQZUGGWLM-UHFFFAOYSA-N 1-[(3-fluorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(F)=C1 RBIAKJQZUGGWLM-UHFFFAOYSA-N 0.000 description 1
- GYHILZITVAFLFU-UHFFFAOYSA-N 1-[(3-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound CC1=CC=CC(CN2C(=C(C(O)=O)N=C2)C(O)=O)=C1 GYHILZITVAFLFU-UHFFFAOYSA-N 0.000 description 1
- SZYMEXCJWRBUFL-UHFFFAOYSA-N 1-[(4-bromo-3-chlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Br)C(Cl)=C1 SZYMEXCJWRBUFL-UHFFFAOYSA-N 0.000 description 1
- MZJSYLIOMLCYIS-UHFFFAOYSA-N 1-[(4-bromophenyl)methyl]imidazole Chemical compound C1=CC(Br)=CC=C1CN1C=NC=C1 MZJSYLIOMLCYIS-UHFFFAOYSA-N 0.000 description 1
- ZWYQKKKJTIPGMO-UHFFFAOYSA-N 1-[(4-bromophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(Br)=CC=C1CN1C(C#N)=C(C#N)N=C1 ZWYQKKKJTIPGMO-UHFFFAOYSA-N 0.000 description 1
- NFJGFKYUTHTGAJ-UHFFFAOYSA-N 1-[(4-chloro-3-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(C)=CC(CN2C(=C(C(O)=O)N=C2)C(O)=O)=C1 NFJGFKYUTHTGAJ-UHFFFAOYSA-N 0.000 description 1
- AVSZPRGTJSEOLP-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(Cl)=CC=C1CN1C(C#N)=C(C#N)N=C1 AVSZPRGTJSEOLP-UHFFFAOYSA-N 0.000 description 1
- LRMGCOXBSJJZGZ-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Cl)C=C1 LRMGCOXBSJJZGZ-UHFFFAOYSA-N 0.000 description 1
- JFKFTPHLKKEDPS-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(F)C=C1 JFKFTPHLKKEDPS-UHFFFAOYSA-N 0.000 description 1
- AYPWALVHPDEFFW-UHFFFAOYSA-N 1-[(4-propan-2-ylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(C(C)C)=CC=C1CN1C(C#N)=C(C#N)N=C1 AYPWALVHPDEFFW-UHFFFAOYSA-N 0.000 description 1
- VFXFJYMBGGFVAS-UHFFFAOYSA-N 1-[(4-propan-2-ylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=CC(C(C)C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VFXFJYMBGGFVAS-UHFFFAOYSA-N 0.000 description 1
- ZDTBFCFVANNUPR-UHFFFAOYSA-N 1-[[4-(trifluoromethoxy)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(OC(F)(F)F)C=C1 ZDTBFCFVANNUPR-UHFFFAOYSA-N 0.000 description 1
- ZAOHROFKPPVHIV-UHFFFAOYSA-N 1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(C(F)(F)F)=CC=C1CN1C(C#N)=C(C#N)N=C1 ZAOHROFKPPVHIV-UHFFFAOYSA-N 0.000 description 1
- NDVMXJKODFZPSW-UHFFFAOYSA-N 1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(C(F)(F)F)C=C1 NDVMXJKODFZPSW-UHFFFAOYSA-N 0.000 description 1
- KKKDZZRICRFGSD-UHFFFAOYSA-N 1-benzylimidazole Chemical class C1=CN=CN1CC1=CC=CC=C1 KKKDZZRICRFGSD-UHFFFAOYSA-N 0.000 description 1
- SDTULEXOSNNGAW-UHFFFAOYSA-N 1-bromo-2-chloro-4-methylbenzene Chemical compound CC1=CC=C(Br)C(Cl)=C1 SDTULEXOSNNGAW-UHFFFAOYSA-N 0.000 description 1
- XCJXYTFYKPVYMK-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC(CBr)=CC=C1Br XCJXYTFYKPVYMK-UHFFFAOYSA-N 0.000 description 1
- BSIIGUGKOPPTPZ-UHFFFAOYSA-N 1-bromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C=C1 BSIIGUGKOPPTPZ-UHFFFAOYSA-N 0.000 description 1
- BNINSXCMJBCDPZ-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC(CCl)=CC=C1Cl BNINSXCMJBCDPZ-UHFFFAOYSA-N 0.000 description 1
- JMTFLSQHQSFNTE-UHFFFAOYSA-N 1-dodecylimidazole Chemical compound CCCCCCCCCCCCN1C=CN=C1 JMTFLSQHQSFNTE-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- 239000002794 2,4-DB Substances 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- JNPGXYPTTMKNJS-UHFFFAOYSA-N 2-benzyl-1h-imidazole-4,5-dicarboxylic acid Chemical class N1C(C(O)=O)=C(C(=O)O)N=C1CC1=CC=CC=C1 JNPGXYPTTMKNJS-UHFFFAOYSA-N 0.000 description 1
- JAXSPAXDDROBLQ-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1Cl JAXSPAXDDROBLQ-UHFFFAOYSA-N 0.000 description 1
- JTMYLQKKQFLIGV-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Cl JTMYLQKKQFLIGV-UHFFFAOYSA-N 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- KFTHUBZIEMOORC-UHFFFAOYSA-N 2-methylbut-2-enamide Chemical compound CC=C(C)C(N)=O KFTHUBZIEMOORC-UHFFFAOYSA-N 0.000 description 1
- BDAHJRSPLTZINY-UHFFFAOYSA-N 3,4-dichloro-1-phenylbutan-1-one Chemical compound ClCC(Cl)CC(=O)C1=CC=CC=C1 BDAHJRSPLTZINY-UHFFFAOYSA-N 0.000 description 1
- XRZPMHVRPUGCAY-UHFFFAOYSA-N 3,4-dichloro-1-phenylpentan-1-one Chemical compound CC(Cl)C(Cl)CC(=O)C1=CC=CC=C1 XRZPMHVRPUGCAY-UHFFFAOYSA-N 0.000 description 1
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical group ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 1
- 125000006509 3,4-difluorobenzyl group Chemical group [H]C1=C(F)C(F)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- ZFJOMUKPDWNRFI-UHFFFAOYSA-N 3-bromo-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1Br ZFJOMUKPDWNRFI-UHFFFAOYSA-N 0.000 description 1
- 125000006291 3-hydroxybenzyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- DXBQEHHOGRVYFF-UHFFFAOYSA-N 3-pyridin-4-ylpentane-2,4-dione Chemical group CC(=O)C(C(C)=O)C1=CC=NC=C1 DXBQEHHOGRVYFF-UHFFFAOYSA-N 0.000 description 1
- RAXXELZNTBOGNW-QDNHWIQGSA-N 4,5-dideuterio-1h-imidazole Chemical compound [2H]C=1N=CNC=1[2H] RAXXELZNTBOGNW-QDNHWIQGSA-N 0.000 description 1
- UBQRAAXAHIKWRI-UHFFFAOYSA-N 4-(chloromethyl)-1,2-dimethylbenzene Chemical compound CC1=CC=C(CCl)C=C1C UBQRAAXAHIKWRI-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- RATSANVPHHXDCT-UHFFFAOYSA-N 4-(trifluoromethoxy)benzoic acid Chemical class OC(=O)C1=CC=C(OC(F)(F)F)C=C1 RATSANVPHHXDCT-UHFFFAOYSA-N 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000173 4-trifluoromethoxy benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC(F)(F)F)C([H])([H])* 0.000 description 1
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 235000006760 Acer pensylvanicum Nutrition 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- 240000007241 Agrostis stolonifera Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000004135 Amaranthus viridis Nutrition 0.000 description 1
- 241000208477 Anagallis Species 0.000 description 1
- 241000208479 Anagallis arvensis Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 241000252073 Anguilliformes Species 0.000 description 1
- 241000205585 Aquilegia canadensis Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241001453169 Asplenium Species 0.000 description 1
- 241000238017 Astacoidea Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241001388466 Bruchus rufimanus Species 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- JVOPEIKSDLWIMJ-UHFFFAOYSA-N C1=CC(=C(C=C1CN2C=NC(=C2C(=O)O)C(=O)O)I)I Chemical compound C1=CC(=C(C=C1CN2C=NC(=C2C(=O)O)C(=O)O)I)I JVOPEIKSDLWIMJ-UHFFFAOYSA-N 0.000 description 1
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000011305 Capsella bursa pastoris Nutrition 0.000 description 1
- 240000008867 Capsella bursa-pastoris Species 0.000 description 1
- 239000005490 Carbetamide Substances 0.000 description 1
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 1
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 1
- 241000723353 Chrysanthemum Species 0.000 description 1
- 235000005633 Chrysanthemum balsamita Nutrition 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 244000144786 Chrysanthemum segetum Species 0.000 description 1
- 235000005470 Chrysanthemum segetum Nutrition 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000005918 Cirsium arvense Nutrition 0.000 description 1
- 240000001579 Cirsium arvense Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- QJPMFNHHYLJCCK-UHFFFAOYSA-N ClC=1C=C(CC=2NC=CN=2)C=CC=1C Chemical compound ClC=1C=C(CC=2NC=CN=2)C=CC=1C QJPMFNHHYLJCCK-UHFFFAOYSA-N 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 206010011878 Deafness Diseases 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- 235000008497 Drosera rotundifolia Nutrition 0.000 description 1
- 241000208711 Droseraceae Species 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241001113556 Elodea Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 241000289659 Erinaceidae Species 0.000 description 1
- 241000919496 Erysimum Species 0.000 description 1
- 239000005512 Ethofumesate Substances 0.000 description 1
- 244000192024 Euphorbia helioscopia Species 0.000 description 1
- 235000012043 Euphorbia helioscopia Nutrition 0.000 description 1
- 240000002989 Euphorbia neriifolia Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 241001456088 Hesperocnide Species 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 241001118108 Isatis quadrialata Species 0.000 description 1
- YQEZLKZALYSWHR-UHFFFAOYSA-N Ketamine Chemical compound C=1C=CC=C(Cl)C=1C1(NC)CCCCC1=O YQEZLKZALYSWHR-UHFFFAOYSA-N 0.000 description 1
- 235000009193 Lamium purpureum Nutrition 0.000 description 1
- 240000006503 Lamium purpureum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- DIWRORZWFLOCLC-UHFFFAOYSA-N Lorazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1Cl DIWRORZWFLOCLC-UHFFFAOYSA-N 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 239000005575 MCPB Substances 0.000 description 1
- 101150039283 MCPB gene Proteins 0.000 description 1
- 241001508691 Martes zibellina Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 235000003990 Monochoria hastata Nutrition 0.000 description 1
- 240000000178 Monochoria vaginalis Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 241001442135 Myosotis arvensis Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000007846 Papaver rhoeas Nutrition 0.000 description 1
- 240000004674 Papaver rhoeas Species 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 235000008753 Papaver somniferum Nutrition 0.000 description 1
- 244000037751 Persicaria maculosa Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209049 Poa pratensis Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 235000004442 Polygonum persicaria Nutrition 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 235000000903 Ranunculus bulbosus Nutrition 0.000 description 1
- 241000220259 Raphanus Species 0.000 description 1
- 244000286177 Raphanus raphanistrum Species 0.000 description 1
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- 235000016954 Ribes hudsonianum Nutrition 0.000 description 1
- 240000001890 Ribes hudsonianum Species 0.000 description 1
- 235000001466 Ribes nigrum Nutrition 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 235000016911 Ribes sativum Nutrition 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 235000016897 Ribes triste Nutrition 0.000 description 1
- 244000155504 Rotala indica Species 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- 241001373037 Rumex hypogaeus Species 0.000 description 1
- 235000009422 Rumex obtusifolius Nutrition 0.000 description 1
- 240000007113 Rumex obtusifolius Species 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 241000592344 Spermatophyta Species 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000005545 Veronica americana Nutrition 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 1
- 244000047670 Viola x wittrockiana Species 0.000 description 1
- 235000004031 Viola x wittrockiana Nutrition 0.000 description 1
- 241000282485 Vulpes vulpes Species 0.000 description 1
- 244000067505 Xanthium strumarium Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- MCRWZBYTLVCCJJ-DKALBXGISA-N [(1s,3r)-3-[[(3s,4s)-3-methoxyoxan-4-yl]amino]-1-propan-2-ylcyclopentyl]-[(1s,4s)-5-[6-(trifluoromethyl)pyrimidin-4-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone Chemical compound C([C@]1(N(C[C@]2([H])C1)C(=O)[C@@]1(C[C@@H](CC1)N[C@@H]1[C@@H](COCC1)OC)C(C)C)[H])N2C1=CC(C(F)(F)F)=NC=N1 MCRWZBYTLVCCJJ-DKALBXGISA-N 0.000 description 1
- AMRQXHFXNZFDCH-SECBINFHSA-N [(2r)-1-(ethylamino)-1-oxopropan-2-yl] n-phenylcarbamate Chemical compound CCNC(=O)[C@@H](C)OC(=O)NC1=CC=CC=C1 AMRQXHFXNZFDCH-SECBINFHSA-N 0.000 description 1
- YEDTWOLJNQYBPU-UHFFFAOYSA-N [Na].[Na].[Na] Chemical compound [Na].[Na].[Na] YEDTWOLJNQYBPU-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002152 aqueous-organic solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- RAJISUUPOAJLEQ-UHFFFAOYSA-N chloromethanamine Chemical compound NCCl RAJISUUPOAJLEQ-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 238000009264 composting Methods 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- NQKKUSLBNWTXQI-UHFFFAOYSA-N diethyl 1h-imidazole-4,5-dicarboxylate Chemical compound CCOC(=O)C=1N=CNC=1C(=O)OCC NQKKUSLBNWTXQI-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- NPAWAMRXPHRVQY-WTVBWJGASA-L disodium;5-acetamido-2-[(e)-2-(4-isothiocyanato-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC(NC(=O)C)=CC=C1\C=C\C1=CC=C(N=C=S)C=C1S([O-])(=O)=O NPAWAMRXPHRVQY-WTVBWJGASA-L 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 229940107029 ferrous sulfate,dried Drugs 0.000 description 1
- 244000037666 field crops Species 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- BAGYLPGIFASWHP-UHFFFAOYSA-N imidazol-1-yl-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)N1C=NC=C1 BAGYLPGIFASWHP-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229960003299 ketamine Drugs 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 201000002266 mite infestation Diseases 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- NTQYXUJLILNTFH-UHFFFAOYSA-N nonanoyl chloride Chemical compound CCCCCCCCC(Cl)=O NTQYXUJLILNTFH-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- MSHFRERJPWKJFX-UHFFFAOYSA-N para-methoxybenzyl alcohol Natural products COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- XVNKRRXASPPECQ-UHFFFAOYSA-N phenyl n-phenylcarbamate Chemical compound C=1C=CC=CC=1OC(=O)NC1=CC=CC=C1 XVNKRRXASPPECQ-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- XYWJNTOURDMTPI-UHFFFAOYSA-N procodazole Chemical compound C1=CC=C2NC(CCC(=O)O)=NC2=C1 XYWJNTOURDMTPI-UHFFFAOYSA-N 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical group [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical class OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229960003495 thiamine Drugs 0.000 description 1
- 239000011721 thiamine Substances 0.000 description 1
- RSPCKAHMRANGJZ-UHFFFAOYSA-N thiohydroxylamine Chemical compound SN RSPCKAHMRANGJZ-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/807—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen all halogen atoms bound to the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS791944A CS207658B2 (cs) | 1977-03-04 | 1979-03-23 | Způsob výroby derivátů imidazolu |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9277/77A GB1599032A (en) | 1977-03-04 | 1977-03-04 | Imidazole derivatives having herbicidal activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207657B2 true CS207657B2 (en) | 1981-08-31 |
Family
ID=9868874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS781338A CS207657B2 (en) | 1977-03-04 | 1978-03-02 | Herbicide means and method of making the active substances |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4185992A (enExample) |
| JP (1) | JPS53111068A (enExample) |
| AR (1) | AR223314A1 (enExample) |
| AU (1) | AU513393B2 (enExample) |
| BE (1) | BE864614A (enExample) |
| BR (1) | BR7801257A (enExample) |
| CA (1) | CA1092131A (enExample) |
| CH (1) | CH630615A5 (enExample) |
| CS (1) | CS207657B2 (enExample) |
| DD (1) | DD135346A5 (enExample) |
| DE (1) | DE2809022A1 (enExample) |
| DK (1) | DK95478A (enExample) |
| ES (2) | ES467496A1 (enExample) |
| GB (1) | GB1599032A (enExample) |
| IE (1) | IE46502B1 (enExample) |
| IT (1) | IT1095472B (enExample) |
| LU (1) | LU79162A1 (enExample) |
| NL (1) | NL7802316A (enExample) |
| NZ (1) | NZ186608A (enExample) |
| PH (1) | PH14020A (enExample) |
| PL (3) | PL115964B1 (enExample) |
| PT (1) | PT67731A (enExample) |
| SE (1) | SE7802394L (enExample) |
| SU (2) | SU805946A3 (enExample) |
| ZA (1) | ZA781229B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT377514B (de) * | 1978-08-08 | 1985-03-25 | Wellcome Found | Verfahren zur herstellung von neuen imidazolderivaten und deren salzen |
| IT1207229B (it) * | 1978-08-25 | 1989-05-17 | May & Baker Ltd | Derivati immidazolici particolarmente utili quali erbicidi |
| DK45381A (da) * | 1980-02-05 | 1981-08-06 | May & Baker Ltd | Herbicide midler omfattende 1-(3,4-dichlorbenzyl)-imidazol-n,n!-dimethyl-4,5-dicarboxamid |
| DE3217094A1 (de) * | 1982-05-07 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | 1-substituierte imidazol-5-carbonsaeurederivate, ihre herstellung sowie ihre verwendung als biozide |
| MY100938A (en) * | 1986-06-06 | 1991-05-31 | Ciba Geigy Ag | Arylkylimidazole derivatives. |
| DE3723621A1 (de) * | 1987-07-17 | 1989-02-02 | Bayer Ag | Schaedlingsbekaempfungsmittel auf basis von derivaten des 2,3-diaminomaleinsaeurenitrils |
| DE19814092A1 (de) * | 1997-04-15 | 1998-10-22 | Stefes Agro Gmbh | Pflanzenschutzmittel |
| WO2002064538A1 (en) * | 2001-02-16 | 2002-08-22 | Ube Industries, Ltd. | Process for producing 4-trifluoromethoxybenzyl halide compound |
| DE102009043862A1 (de) * | 2009-08-26 | 2011-08-04 | Karlsruher Institut für Technologie, 76131 | Acylierte Phthalocyanine |
| KR20150013137A (ko) | 2012-04-25 | 2015-02-04 | 에프. 호프만-라 로슈 아게 | (3,4-다이클로로-페닐)-((s)-3-프로필-피롤리딘-3-일)-메탄온 하이드로클로라이드 및 제조 방법 |
| HUE037736T2 (hu) * | 2012-11-14 | 2018-09-28 | Teijin Pharma Ltd | Piridin származékok |
| CN104326939B (zh) * | 2014-09-30 | 2016-06-22 | 广东工业大学 | 一种二氨基马来腈衍生物及其制备方法和应用 |
| WO2023235376A1 (en) | 2022-06-01 | 2023-12-07 | Zoetis Services Llc | Process for preparing 1-(4-chlorobenzyl)-1h-imidazole-4,5-dicarboxamide |
| CN119707818A (zh) * | 2024-12-11 | 2025-03-28 | 河北农业大学 | 一类新型甲基吡唑丙酰胺衍生物及其制备方法和用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2897205A (en) * | 1958-06-27 | 1959-07-28 | Merck & Co Inc | 1-etherified oxyalkyl imidazole-4,5-dicarboxamides, intermediates and process |
| US3914246A (en) * | 1972-05-05 | 1975-10-21 | Merck & Co Inc | Tri-substituted imidazoles |
| JPS5320990B2 (enExample) * | 1973-02-26 | 1978-06-29 |
-
1977
- 1977-03-04 GB GB9277/77A patent/GB1599032A/en not_active Expired
-
1978
- 1978-03-01 IT IT7820800A patent/IT1095472B/it active
- 1978-03-02 PL PL1978211646A patent/PL115964B1/pl unknown
- 1978-03-02 CS CS781338A patent/CS207657B2/cs unknown
- 1978-03-02 SE SE7802394A patent/SE7802394L/xx unknown
- 1978-03-02 CA CA298,042A patent/CA1092131A/en not_active Expired
- 1978-03-02 IE IE431/78A patent/IE46502B1/en unknown
- 1978-03-02 ZA ZA00781229A patent/ZA781229B/xx unknown
- 1978-03-02 ES ES467496A patent/ES467496A1/es not_active Expired
- 1978-03-02 AR AR271292A patent/AR223314A1/es active
- 1978-03-02 JP JP2403778A patent/JPS53111068A/ja active Granted
- 1978-03-02 US US05/882,857 patent/US4185992A/en not_active Expired - Lifetime
- 1978-03-02 PL PL1978205025A patent/PL116646B1/pl unknown
- 1978-03-02 PL PL1978211647A patent/PL115974B1/pl unknown
- 1978-03-02 DD DD78203943A patent/DD135346A5/xx unknown
- 1978-03-02 NL NL7802316A patent/NL7802316A/xx not_active Application Discontinuation
- 1978-03-02 NZ NZ186608A patent/NZ186608A/xx unknown
- 1978-03-02 AU AU33747/78A patent/AU513393B2/en not_active Expired
- 1978-03-02 DE DE19782809022 patent/DE2809022A1/de not_active Withdrawn
- 1978-03-02 BR BR7801257A patent/BR7801257A/pt unknown
- 1978-03-02 PT PT67731A patent/PT67731A/pt unknown
- 1978-03-02 DK DK95478A patent/DK95478A/da not_active Application Discontinuation
- 1978-03-03 LU LU79162A patent/LU79162A1/xx unknown
- 1978-03-03 CH CH234478A patent/CH630615A5/fr not_active IP Right Cessation
- 1978-03-03 PH PH20844A patent/PH14020A/en unknown
- 1978-03-06 BE BE185709A patent/BE864614A/xx not_active IP Right Cessation
- 1978-10-12 SU SU782672299A patent/SU805946A3/ru active
- 1978-12-01 ES ES475635A patent/ES475635A1/es not_active Expired
-
1980
- 1980-01-04 SU SU802864114A patent/SU908249A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| PT67731A (en) | 1978-04-01 |
| PL205025A1 (pl) | 1979-04-09 |
| PL115964B1 (en) | 1981-05-30 |
| ZA781229B (en) | 1979-02-28 |
| DD135346A5 (de) | 1979-05-02 |
| BR7801257A (pt) | 1979-01-02 |
| NZ186608A (en) | 1980-05-08 |
| SE7802394L (sv) | 1978-09-05 |
| CH630615A5 (fr) | 1982-06-30 |
| LU79162A1 (fr) | 1979-10-29 |
| DK95478A (da) | 1978-09-05 |
| DE2809022A1 (de) | 1978-09-07 |
| ES467496A1 (es) | 1979-08-01 |
| JPS53111068A (en) | 1978-09-28 |
| NL7802316A (nl) | 1978-09-06 |
| SU908249A3 (ru) | 1982-02-23 |
| PL115974B1 (en) | 1981-05-30 |
| SU805946A3 (ru) | 1981-02-15 |
| IE780431L (en) | 1978-09-04 |
| IT1095472B (it) | 1985-08-10 |
| IE46502B1 (en) | 1983-06-29 |
| GB1599032A (en) | 1981-09-30 |
| PL116646B1 (en) | 1981-06-30 |
| ES475635A1 (es) | 1979-04-16 |
| CA1092131A (en) | 1980-12-23 |
| PL211647A1 (pl) | 1979-10-22 |
| AU3374778A (en) | 1979-09-06 |
| BE864614A (fr) | 1978-09-06 |
| AR223314A1 (es) | 1981-08-14 |
| AU513393B2 (en) | 1980-11-27 |
| PH14020A (en) | 1980-12-08 |
| US4185992A (en) | 1980-01-29 |
| IT7820800A0 (it) | 1978-03-01 |
| JPS6129344B2 (enExample) | 1986-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4744815A (en) | 4-benzoyl-1-alkyl (alkenyl) - pyrazoles, composition containing them, herbicidal method of using them, and intermediate in their preparation | |
| RU2112774C1 (ru) | Производное пиколиновой кислоты и гербицидная композиция | |
| SK439090A3 (en) | Isoxazoles herbicides, process for their preparation, intermediates for their preparation, herbicidal composition them containing, and their use | |
| DD202612A5 (de) | Herbizidformulierungen | |
| DD200969A5 (de) | Herbizide mittel | |
| EP0353187A2 (de) | Neue Herbizide | |
| JPWO1998038176A1 (ja) | 1−置換−4−カルバモイル−1,2,4−トリアゾール−5−オン誘導体及び除草剤 | |
| CS207657B2 (en) | Herbicide means and method of making the active substances | |
| HU187320B (en) | Herbicides consisting of n-phenyl derivates and process for production of n-phenyl-pirasole derivates | |
| DE3935277A1 (de) | Sulfonierte heterocyclische carboxamide, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung als herbizide oder wachstumsregulatoren | |
| US4496390A (en) | N-Phenylpyrazole derivatives | |
| LU84914A1 (fr) | Alcoylamino n-phenyl pyrazole et n-phenyl pyrazole lactames herbicides | |
| CA1228859A (en) | N-phenylpyrazole derivatives | |
| WO1994004511A1 (en) | Pyrimidine derivative and weedkiller | |
| WO2001068613A1 (en) | Pyrimidinone derivatives and herbicides | |
| EP0439243A1 (en) | Substituted beta-pyrimidinyloxy-(thio)- and beta-triazinyloxy(thio)-cycloalkanecarboxylic acid derivatives, processes for their preparation, and their use as herbicides, fungicides and plant growth regulators | |
| DE2701467A1 (de) | Substituierte cycloalkanapyrazole, sie enthaltende herbizide und verfahren zur kontrolle von unerwuenschter vegetation | |
| CS195736B2 (en) | Herbicide and process for preparing effective compound thereof | |
| US5089044A (en) | Substituted pyrimidinyloxy(thio)- and triazinyloxy (thio)acrylic acid derivatives, processes for their preparation and their use as herbicides, fungicides and plant growth regulators | |
| DE10144529A1 (de) | 3-Aminocarbonyl substituierte Benzoylcyclohexandione | |
| US4564386A (en) | Trifluoromethanesulfonanilides, and their production and use | |
| JPH11140055A (ja) | 6−ハロアルキル−3−置換フェニル−2(1h)−ピリジノン誘導体及び除草剤 | |
| CS237333B2 (en) | Herbicide agent | |
| JPS6160684A (ja) | アミジノアゾール | |
| JP2001288173A (ja) | ジヒドロピリダジノン化合物および除草剤 |