SU805946A3 - Способ получени производных имидазола - Google Patents
Способ получени производных имидазола Download PDFInfo
- Publication number
- SU805946A3 SU805946A3 SU782672299A SU2672299A SU805946A3 SU 805946 A3 SU805946 A3 SU 805946A3 SU 782672299 A SU782672299 A SU 782672299A SU 2672299 A SU2672299 A SU 2672299A SU 805946 A3 SU805946 A3 SU 805946A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- chloride
- ethyl
- imidazole
- dimethyl
- crystallization
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title abstract description 4
- 150000002460 imidazoles Chemical class 0.000 title abstract description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 7
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims abstract description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 6
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 40
- -1 alkali metal salt Chemical class 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- 238000010992 reflux Methods 0.000 claims description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 5
- 235000011152 sodium sulphate Nutrition 0.000 claims description 5
- LEBUFKMXQTTWDK-UHFFFAOYSA-N (3,4-dibromophenyl)methanol Chemical compound OCC1=CC=C(Br)C(Br)=C1 LEBUFKMXQTTWDK-UHFFFAOYSA-N 0.000 claims description 4
- ABAUGTVEDXFARS-UHFFFAOYSA-N 1,2-dibromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C(Br)=C1 ABAUGTVEDXFARS-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- DHMPDNLGFIBQCK-UHFFFAOYSA-N 3,4-dibromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(Br)=C1 DHMPDNLGFIBQCK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 239000008346 aqueous phase Substances 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000001816 cooling Methods 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- RATSANVPHHXDCT-UHFFFAOYSA-N 4-(trifluoromethoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(OC(F)(F)F)C=C1 RATSANVPHHXDCT-UHFFFAOYSA-N 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000007980 azole derivatives Chemical class 0.000 claims 1
- 239000000284 extract Substances 0.000 claims 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000004009 herbicide Substances 0.000 abstract 1
- 238000002844 melting Methods 0.000 description 40
- 230000008018 melting Effects 0.000 description 40
- 238000002425 crystallisation Methods 0.000 description 38
- 230000008025 crystallization Effects 0.000 description 38
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 20
- 238000009835 boiling Methods 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 12
- 239000003208 petroleum Substances 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 5
- 239000010502 orange oil Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- AJBWDFPJLDDEPQ-UHFFFAOYSA-N 1-(1-bromoethyl)-3-(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC=CC(C(F)(F)F)=C1 AJBWDFPJLDDEPQ-UHFFFAOYSA-N 0.000 description 3
- IHSYKQWWDAFVSB-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)butan-1-ol Chemical compound CCCC(O)C1=CC=C(Cl)C(Cl)=C1 IHSYKQWWDAFVSB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WQDFMIFUDQOCNK-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)heptan-1-ol Chemical compound CCCCCCC(O)C1=CC=C(Cl)C(Cl)=C1 WQDFMIFUDQOCNK-UHFFFAOYSA-N 0.000 description 2
- BJXYZJPNMFXWLM-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)nonan-1-ol Chemical compound CCCCCCCCC(O)C1=CC=C(Cl)C(Cl)=C1 BJXYZJPNMFXWLM-UHFFFAOYSA-N 0.000 description 2
- WOFALSIAGLLIEF-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)pentan-1-ol Chemical compound CCCCC(O)C1=CC=C(Cl)C(Cl)=C1 WOFALSIAGLLIEF-UHFFFAOYSA-N 0.000 description 2
- RFESEZYNEIOJHS-UHFFFAOYSA-N 1-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound CC(O)C1=CC=C(OC(F)(F)F)C=C1 RFESEZYNEIOJHS-UHFFFAOYSA-N 0.000 description 2
- SDTULEXOSNNGAW-UHFFFAOYSA-N 1-bromo-2-chloro-4-methylbenzene Chemical compound CC1=CC=C(Br)C(Cl)=C1 SDTULEXOSNNGAW-UHFFFAOYSA-N 0.000 description 2
- XCJXYTFYKPVYMK-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC(CBr)=CC=C1Br XCJXYTFYKPVYMK-UHFFFAOYSA-N 0.000 description 2
- IGIMRHMZHOJBKZ-UHFFFAOYSA-N 2-bromo-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Br IGIMRHMZHOJBKZ-UHFFFAOYSA-N 0.000 description 2
- BDAHJRSPLTZINY-UHFFFAOYSA-N 3,4-dichloro-1-phenylbutan-1-one Chemical compound ClCC(Cl)CC(=O)C1=CC=CC=C1 BDAHJRSPLTZINY-UHFFFAOYSA-N 0.000 description 2
- UZGBMCVSBCAVMY-UHFFFAOYSA-N 4-(bromomethyl)-1,2-diiodobenzene Chemical compound BrCC1=CC=C(I)C(I)=C1 UZGBMCVSBCAVMY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000003938 benzyl alcohols Chemical class 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- GNLJBJNONOOOQC-UHFFFAOYSA-N $l^{3}-carbane;magnesium Chemical compound [Mg]C GNLJBJNONOOOQC-UHFFFAOYSA-N 0.000 description 1
- KUBJTWJXBYRXFH-UHFFFAOYSA-N (3-bromo-1,1,1-trifluoropropan-2-yl)benzene Chemical compound FC(F)(F)C(CBr)C1=CC=CC=C1 KUBJTWJXBYRXFH-UHFFFAOYSA-N 0.000 description 1
- ZRBDUKUJADUIEO-UHFFFAOYSA-N (3-bromo-4-methylphenyl)methanol Chemical compound CC1=CC=C(CO)C=C1Br ZRBDUKUJADUIEO-UHFFFAOYSA-N 0.000 description 1
- SUZMKBXAFSJVRG-UHFFFAOYSA-N 1,2-dichloro-4-(1-chloroheptyl)benzene Chemical compound CCCCCCC(Cl)C1=CC=C(Cl)C(Cl)=C1 SUZMKBXAFSJVRG-UHFFFAOYSA-N 0.000 description 1
- ROEYQOPGMISNEU-UHFFFAOYSA-N 1,2-dichloro-4-(1-chloropropyl)benzene Chemical compound CCC(Cl)C1=CC=C(Cl)C(Cl)=C1 ROEYQOPGMISNEU-UHFFFAOYSA-N 0.000 description 1
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 1
- FMLVOCILLTZUSX-UHFFFAOYSA-N 1,2-diiodo-4-methylbenzene Chemical compound CC1=CC=C(I)C(I)=C1 FMLVOCILLTZUSX-UHFFFAOYSA-N 0.000 description 1
- ZFLRKAMKGYNFPH-UHFFFAOYSA-N 1,3-dichloro-5-(chloromethyl)benzene Chemical compound ClCC1=CC(Cl)=CC(Cl)=C1 ZFLRKAMKGYNFPH-UHFFFAOYSA-N 0.000 description 1
- RNXABUQTPSAAJW-UHFFFAOYSA-N 1-(1-bromoethyl)-4-(trifluoromethoxy)benzene Chemical compound CC(Br)C1=CC=C(OC(F)(F)F)C=C1 RNXABUQTPSAAJW-UHFFFAOYSA-N 0.000 description 1
- VWPMBVBOSDEYQU-UHFFFAOYSA-N 1-(1-bromoethyl)-4-(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC=C(C(F)(F)F)C=C1 VWPMBVBOSDEYQU-UHFFFAOYSA-N 0.000 description 1
- CNELHOHMJKBWBR-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)hexan-1-ol Chemical compound CCCCCC(O)C1=CC=C(Cl)C(Cl)=C1 CNELHOHMJKBWBR-UHFFFAOYSA-N 0.000 description 1
- PJYGECCAJOYJMK-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)propan-1-ol Chemical compound CCC(O)C1=CC=C(Cl)C(Cl)=C1 PJYGECCAJOYJMK-UHFFFAOYSA-N 0.000 description 1
- KWUDBZIJCVKUHM-UHFFFAOYSA-N 1-(4-iodophenyl)ethanol Chemical compound CC(O)C1=CC=C(I)C=C1 KWUDBZIJCVKUHM-UHFFFAOYSA-N 0.000 description 1
- JZJWCDQGIPQBAO-UHFFFAOYSA-N 1-(4-iodophenyl)ethanone Chemical compound CC(=O)C1=CC=C(I)C=C1 JZJWCDQGIPQBAO-UHFFFAOYSA-N 0.000 description 1
- ATLQGZVLWOURFU-UHFFFAOYSA-N 1-(bromomethyl)-3,5-bis(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(CBr)=CC(C(F)(F)F)=C1 ATLQGZVLWOURFU-UHFFFAOYSA-N 0.000 description 1
- BACZSVQZBSCWIG-UHFFFAOYSA-N 1-(bromomethyl)-3-iodobenzene Chemical compound BrCC1=CC=CC(I)=C1 BACZSVQZBSCWIG-UHFFFAOYSA-N 0.000 description 1
- BQTRMYJYYNQQGK-UHFFFAOYSA-N 1-(bromomethyl)-4-iodobenzene Chemical compound BrCC1=CC=C(I)C=C1 BQTRMYJYYNQQGK-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- XBDXMDVEZLOGMC-UHFFFAOYSA-N 1-(chloromethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CCl)=C1 XBDXMDVEZLOGMC-UHFFFAOYSA-N 0.000 description 1
- LZBOHNCMCCSTJX-UHFFFAOYSA-N 1-(chloromethyl)-3-methylbenzene Chemical compound CC1=CC=CC(CCl)=C1 LZBOHNCMCCSTJX-UHFFFAOYSA-N 0.000 description 1
- LBMKFQMJURUPKC-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCl)C=C1 LBMKFQMJURUPKC-UHFFFAOYSA-N 0.000 description 1
- MCHDHQVROPEJJT-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCl)C=C1 MCHDHQVROPEJJT-UHFFFAOYSA-N 0.000 description 1
- DUBCVXSYZVTCOC-UHFFFAOYSA-N 1-(chloromethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(CCl)C=C1 DUBCVXSYZVTCOC-UHFFFAOYSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 1
- YNVXCOKNHXMBQC-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=CC(C(F)(F)F)=C1 YNVXCOKNHXMBQC-UHFFFAOYSA-N 0.000 description 1
- UDKGXKYEWBGQCG-UHFFFAOYSA-N 1-bromo-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Br)=C1 UDKGXKYEWBGQCG-UHFFFAOYSA-N 0.000 description 1
- BSIIGUGKOPPTPZ-UHFFFAOYSA-N 1-bromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C=C1 BSIIGUGKOPPTPZ-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- UFXJPOIJORJPLO-UHFFFAOYSA-N 1-chloro-3-(2-chloroethyl)benzene Chemical compound ClCCC1=CC=CC(Cl)=C1 UFXJPOIJORJPLO-UHFFFAOYSA-N 0.000 description 1
- DDGRAFHHXYIQQR-UHFFFAOYSA-N 1-chloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1 DDGRAFHHXYIQQR-UHFFFAOYSA-N 0.000 description 1
- NOCHRVHWICTPLG-UHFFFAOYSA-N 1-chloro-4-(1-chloroethyl)benzene Chemical compound CC(Cl)C1=CC=C(Cl)C=C1 NOCHRVHWICTPLG-UHFFFAOYSA-N 0.000 description 1
- BNINSXCMJBCDPZ-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC(CCl)=CC=C1Cl BNINSXCMJBCDPZ-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- WAPNOHKVXSQRPX-UHFFFAOYSA-N 1-phenylethanol Chemical compound CC(O)C1=CC=CC=C1 WAPNOHKVXSQRPX-UHFFFAOYSA-N 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- JTMYLQKKQFLIGV-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Cl JTMYLQKKQFLIGV-UHFFFAOYSA-N 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- 125000006185 3,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZFJOMUKPDWNRFI-UHFFFAOYSA-N 3-bromo-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1Br ZFJOMUKPDWNRFI-UHFFFAOYSA-N 0.000 description 1
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- 125000006482 3-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(I)=C1[H])C([H])([H])* 0.000 description 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 1
- WJHUTGKETRBTLJ-UHFFFAOYSA-N 4-(1-bromohexyl)-1,2-dichlorobenzene Chemical compound CCCCCC(Br)C1=CC=C(Cl)C(Cl)=C1 WJHUTGKETRBTLJ-UHFFFAOYSA-N 0.000 description 1
- RIZRQBKYAVIFCA-UHFFFAOYSA-N 4-(1-bromopentyl)-1,2-dichlorobenzene Chemical compound CCCCC(Br)C1=CC=C(Cl)C(Cl)=C1 RIZRQBKYAVIFCA-UHFFFAOYSA-N 0.000 description 1
- UBQRAAXAHIKWRI-UHFFFAOYSA-N 4-(chloromethyl)-1,2-dimethylbenzene Chemical compound CC1=CC=C(CCl)C=C1C UBQRAAXAHIKWRI-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- 125000006483 4-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1I)C([H])([H])* 0.000 description 1
- 125000002528 4-isopropyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000173 4-trifluoromethoxy benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC(F)(F)F)C([H])([H])* 0.000 description 1
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 description 1
- 125000001318 4-trifluoromethylbenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(F)(F)F 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CPVUBCCQWTZZFS-UHFFFAOYSA-N C1(CCC(N1)=O)=O.[Br] Chemical compound C1(CCC(N1)=O)=O.[Br] CPVUBCCQWTZZFS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- UCVODTZQZHMTPN-UHFFFAOYSA-N heptanoyl chloride Chemical compound CCCCCCC(Cl)=O UCVODTZQZHMTPN-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- NTQYXUJLILNTFH-UHFFFAOYSA-N nonanoyl chloride Chemical compound CCCCCCCCC(Cl)=O NTQYXUJLILNTFH-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/807—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen all halogen atoms bound to the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Dentistry (AREA)
- Agronomy & Crop Science (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9277/77A GB1599032A (en) | 1977-03-04 | 1977-03-04 | Imidazole derivatives having herbicidal activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU805946A3 true SU805946A3 (ru) | 1981-02-15 |
Family
ID=9868874
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU782672299A SU805946A3 (ru) | 1977-03-04 | 1978-10-12 | Способ получени производных имидазола |
| SU802864114A SU908249A3 (ru) | 1977-03-04 | 1980-01-04 | Способ получени производных имидазола |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU802864114A SU908249A3 (ru) | 1977-03-04 | 1980-01-04 | Способ получени производных имидазола |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4185992A (enExample) |
| JP (1) | JPS53111068A (enExample) |
| AR (1) | AR223314A1 (enExample) |
| AU (1) | AU513393B2 (enExample) |
| BE (1) | BE864614A (enExample) |
| BR (1) | BR7801257A (enExample) |
| CA (1) | CA1092131A (enExample) |
| CH (1) | CH630615A5 (enExample) |
| CS (1) | CS207657B2 (enExample) |
| DD (1) | DD135346A5 (enExample) |
| DE (1) | DE2809022A1 (enExample) |
| DK (1) | DK95478A (enExample) |
| ES (2) | ES467496A1 (enExample) |
| GB (1) | GB1599032A (enExample) |
| IE (1) | IE46502B1 (enExample) |
| IT (1) | IT1095472B (enExample) |
| LU (1) | LU79162A1 (enExample) |
| NL (1) | NL7802316A (enExample) |
| NZ (1) | NZ186608A (enExample) |
| PH (1) | PH14020A (enExample) |
| PL (3) | PL115964B1 (enExample) |
| PT (1) | PT67731A (enExample) |
| SE (1) | SE7802394L (enExample) |
| SU (2) | SU805946A3 (enExample) |
| ZA (1) | ZA781229B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2640588C2 (ru) * | 2012-11-14 | 2018-01-10 | Тейдзин Фарма Лимитед | Производное пиридина |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT377514B (de) * | 1978-08-08 | 1985-03-25 | Wellcome Found | Verfahren zur herstellung von neuen imidazolderivaten und deren salzen |
| IT1207229B (it) * | 1978-08-25 | 1989-05-17 | May & Baker Ltd | Derivati immidazolici particolarmente utili quali erbicidi |
| GR73854B (enExample) * | 1980-02-05 | 1984-05-07 | May & Baker Ltd | |
| DE3217094A1 (de) * | 1982-05-07 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | 1-substituierte imidazol-5-carbonsaeurederivate, ihre herstellung sowie ihre verwendung als biozide |
| MY100938A (en) * | 1986-06-06 | 1991-05-31 | Ciba Geigy Ag | Arylkylimidazole derivatives. |
| DE3723621A1 (de) * | 1987-07-17 | 1989-02-02 | Bayer Ag | Schaedlingsbekaempfungsmittel auf basis von derivaten des 2,3-diaminomaleinsaeurenitrils |
| DE19814092A1 (de) * | 1997-04-15 | 1998-10-22 | Stefes Agro Gmbh | Pflanzenschutzmittel |
| WO2002064538A1 (en) * | 2001-02-16 | 2002-08-22 | Ube Industries, Ltd. | Process for producing 4-trifluoromethoxybenzyl halide compound |
| DE102009043862A1 (de) * | 2009-08-26 | 2011-08-04 | Karlsruher Institut für Technologie, 76131 | Acylierte Phthalocyanine |
| RU2014145806A (ru) | 2012-04-25 | 2016-06-10 | Ф. Хоффманн-Ля Рош Аг | Способы производства (3,4-дихлорфенил)-((s)-3-пропил-пирролидин-3-ил)-метанонгидрохлорида |
| CN104326939B (zh) * | 2014-09-30 | 2016-06-22 | 广东工业大学 | 一种二氨基马来腈衍生物及其制备方法和应用 |
| WO2023235376A1 (en) | 2022-06-01 | 2023-12-07 | Zoetis Services Llc | Process for preparing 1-(4-chlorobenzyl)-1h-imidazole-4,5-dicarboxamide |
| CN119707818A (zh) * | 2024-12-11 | 2025-03-28 | 河北农业大学 | 一类新型甲基吡唑丙酰胺衍生物及其制备方法和用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2897205A (en) * | 1958-06-27 | 1959-07-28 | Merck & Co Inc | 1-etherified oxyalkyl imidazole-4,5-dicarboxamides, intermediates and process |
| US3914246A (en) * | 1972-05-05 | 1975-10-21 | Merck & Co Inc | Tri-substituted imidazoles |
| JPS5320990B2 (enExample) * | 1973-02-26 | 1978-06-29 |
-
1977
- 1977-03-04 GB GB9277/77A patent/GB1599032A/en not_active Expired
-
1978
- 1978-03-01 IT IT7820800A patent/IT1095472B/it active
- 1978-03-02 CA CA298,042A patent/CA1092131A/en not_active Expired
- 1978-03-02 PL PL1978211646A patent/PL115964B1/pl unknown
- 1978-03-02 SE SE7802394A patent/SE7802394L/xx unknown
- 1978-03-02 PL PL1978211647A patent/PL115974B1/pl unknown
- 1978-03-02 CS CS781338A patent/CS207657B2/cs unknown
- 1978-03-02 AU AU33747/78A patent/AU513393B2/en not_active Expired
- 1978-03-02 AR AR271292A patent/AR223314A1/es active
- 1978-03-02 IE IE431/78A patent/IE46502B1/en unknown
- 1978-03-02 BR BR7801257A patent/BR7801257A/pt unknown
- 1978-03-02 PT PT67731A patent/PT67731A/pt unknown
- 1978-03-02 JP JP2403778A patent/JPS53111068A/ja active Granted
- 1978-03-02 US US05/882,857 patent/US4185992A/en not_active Expired - Lifetime
- 1978-03-02 ES ES467496A patent/ES467496A1/es not_active Expired
- 1978-03-02 DK DK95478A patent/DK95478A/da not_active Application Discontinuation
- 1978-03-02 ZA ZA00781229A patent/ZA781229B/xx unknown
- 1978-03-02 DE DE19782809022 patent/DE2809022A1/de not_active Withdrawn
- 1978-03-02 NL NL7802316A patent/NL7802316A/xx not_active Application Discontinuation
- 1978-03-02 DD DD78203943A patent/DD135346A5/xx unknown
- 1978-03-02 PL PL1978205025A patent/PL116646B1/pl unknown
- 1978-03-02 NZ NZ186608A patent/NZ186608A/xx unknown
- 1978-03-03 PH PH20844A patent/PH14020A/en unknown
- 1978-03-03 CH CH234478A patent/CH630615A5/fr not_active IP Right Cessation
- 1978-03-03 LU LU79162A patent/LU79162A1/xx unknown
- 1978-03-06 BE BE185709A patent/BE864614A/xx not_active IP Right Cessation
- 1978-10-12 SU SU782672299A patent/SU805946A3/ru active
- 1978-12-01 ES ES475635A patent/ES475635A1/es not_active Expired
-
1980
- 1980-01-04 SU SU802864114A patent/SU908249A3/ru active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2640588C2 (ru) * | 2012-11-14 | 2018-01-10 | Тейдзин Фарма Лимитед | Производное пиридина |
Also Published As
| Publication number | Publication date |
|---|---|
| AU513393B2 (en) | 1980-11-27 |
| US4185992A (en) | 1980-01-29 |
| CS207657B2 (en) | 1981-08-31 |
| IT1095472B (it) | 1985-08-10 |
| ES467496A1 (es) | 1979-08-01 |
| DD135346A5 (de) | 1979-05-02 |
| PT67731A (en) | 1978-04-01 |
| IE780431L (en) | 1978-09-04 |
| PL211647A1 (pl) | 1979-10-22 |
| BE864614A (fr) | 1978-09-06 |
| ES475635A1 (es) | 1979-04-16 |
| CH630615A5 (fr) | 1982-06-30 |
| PL115964B1 (en) | 1981-05-30 |
| JPS6129344B2 (enExample) | 1986-07-05 |
| IT7820800A0 (it) | 1978-03-01 |
| DE2809022A1 (de) | 1978-09-07 |
| LU79162A1 (fr) | 1979-10-29 |
| PH14020A (en) | 1980-12-08 |
| PL115974B1 (en) | 1981-05-30 |
| AR223314A1 (es) | 1981-08-14 |
| CA1092131A (en) | 1980-12-23 |
| NL7802316A (nl) | 1978-09-06 |
| SE7802394L (sv) | 1978-09-05 |
| DK95478A (da) | 1978-09-05 |
| GB1599032A (en) | 1981-09-30 |
| NZ186608A (en) | 1980-05-08 |
| PL205025A1 (pl) | 1979-04-09 |
| BR7801257A (pt) | 1979-01-02 |
| ZA781229B (en) | 1979-02-28 |
| SU908249A3 (ru) | 1982-02-23 |
| PL116646B1 (en) | 1981-06-30 |
| IE46502B1 (en) | 1983-06-29 |
| JPS53111068A (en) | 1978-09-28 |
| AU3374778A (en) | 1979-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU805946A3 (ru) | Способ получени производных имидазола | |
| Van Leusen et al. | Chemistry of sulfonylmethyl isocyanides. 12. Base-induced cycloaddition of sulfonylmethyl isocyanides to carbon, nitrogen double bonds. Synthesis of 1, 5-disubstituted and 1, 4, 5-trisubstituted imidazoles from aldimines and imidoyl chlorides | |
| US4321387A (en) | Process for the preparation of optically active nicotine analogs | |
| JP3055819B2 (ja) | 2−チエニルグリシド酸誘導体およびその製造法 | |
| EP0281283A1 (en) | Heterocyclic compounds | |
| EP0357404B1 (en) | Process for the preparation of cyclopentane derivatives | |
| EP0273528A1 (en) | Benzophenones and their preparation | |
| HU199806B (en) | Process for producing (d-cis)-1,3,4,5-tetrahydro-4-phenyl-2h-benzazepin-2-one derivatives | |
| EP0612716B1 (fr) | Procédé pour la préparation d'un aminoalcool optiquement pur | |
| US4208425A (en) | Novel diketones | |
| US5869684A (en) | Method for producing pyrazolinone compounds | |
| CH616418A5 (enExample) | ||
| US4153719A (en) | Aromatic diketones | |
| CA1149811A (en) | Indole and indoline derivatives | |
| US5922916A (en) | Process to chloroketoamines using carbamates | |
| US4510329A (en) | Process for preparing cyclopentenolones | |
| US4423225A (en) | Process for the preparation of pyrazole | |
| EP0309626B1 (en) | Process for the preparation of dibenzothiepin derivative | |
| Cooper | Stereospecific synthesis of cis-and trans-2-(3, 4, 5-trimethoxyphenyl)-cyclopropylamines | |
| US4891433A (en) | Process for the preparation of dibenzothiepin derivative | |
| US4171371A (en) | Diketones | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| CA1119179A (en) | Process for preparing n-tritylimidazole compounds | |
| US6346624B1 (en) | Process for making 5-lipoxygenase inhibitors having varied heterocyclic ring systems | |
| EP0065354B1 (en) | Process for the preparation of 1,1-bis phenyl-2-haloalkan-1-ols |