CH674359A5 - - Google Patents
Download PDFInfo
- Publication number
- CH674359A5 CH674359A5 CH1961/88A CH196188A CH674359A5 CH 674359 A5 CH674359 A5 CH 674359A5 CH 1961/88 A CH1961/88 A CH 1961/88A CH 196188 A CH196188 A CH 196188A CH 674359 A5 CH674359 A5 CH 674359A5
- Authority
- CH
- Switzerland
- Prior art keywords
- zinc
- manganese
- salt
- alpha
- amino acid
- Prior art date
Links
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 26
- 235000008206 alpha-amino acids Nutrition 0.000 claims description 23
- 239000011701 zinc Substances 0.000 claims description 17
- 229910052725 zinc Inorganic materials 0.000 claims description 17
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 claims description 14
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 claims description 13
- 229930182817 methionine Natural products 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 11
- 150000001371 alpha-amino acids Chemical class 0.000 claims description 9
- -1 iron (III) ions Chemical class 0.000 claims description 9
- 150000002696 manganese Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 229940099596 manganese sulfate Drugs 0.000 claims description 6
- 235000007079 manganese sulphate Nutrition 0.000 claims description 6
- 239000011702 manganese sulphate Substances 0.000 claims description 6
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 229960001763 zinc sulfate Drugs 0.000 claims description 5
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 claims description 4
- 150000003751 zinc Chemical class 0.000 claims description 4
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 claims description 3
- 229910000368 zinc sulfate Inorganic materials 0.000 claims description 3
- BZVFZBYIWNIHHL-WCCKRBBISA-N (2s)-2-amino-4-methylsulfanylbutanoic acid;manganese Chemical compound [Mn].CSCC[C@H](N)C(O)=O BZVFZBYIWNIHHL-WCCKRBBISA-N 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 239000000243 solution Substances 0.000 claims 2
- 239000007864 aqueous solution Substances 0.000 claims 1
- 238000010668 complexation reaction Methods 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000011572 manganese Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 7
- 229910052748 manganese Inorganic materials 0.000 description 7
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 229940024606 amino acid Drugs 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 4
- RUTXIHLAWFEWGM-UHFFFAOYSA-H iron(3+) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 description 4
- 229910000360 iron(III) sulfate Inorganic materials 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 235000020776 essential amino acid Nutrition 0.000 description 3
- 239000003797 essential amino acid Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 3
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 2
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008570 general process Effects 0.000 description 2
- 235000011868 grain product Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229940099607 manganese chloride Drugs 0.000 description 2
- 235000002867 manganese chloride Nutrition 0.000 description 2
- 239000011565 manganese chloride Substances 0.000 description 2
- 229910001437 manganese ion Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 238000005063 solubilization Methods 0.000 description 2
- 230000007928 solubilization Effects 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- CNMFGFBWPBBGKX-SCGRZTRASA-L zinc;(2s)-2-amino-4-methylsulfanylbutanoate Chemical class [Zn+2].CSCC[C@H](N)C([O-])=O.CSCC[C@H](N)C([O-])=O CNMFGFBWPBBGKX-SCGRZTRASA-L 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 1
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000015872 dietary supplement Nutrition 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- WBJZTOZJJYAKHQ-UHFFFAOYSA-K iron(3+) phosphate Chemical compound [Fe+3].[O-]P([O-])([O-])=O WBJZTOZJJYAKHQ-UHFFFAOYSA-K 0.000 description 1
- PVFSDGKDKFSOTB-UHFFFAOYSA-K iron(3+);triacetate Chemical compound [Fe+3].CC([O-])=O.CC([O-])=O.CC([O-])=O PVFSDGKDKFSOTB-UHFFFAOYSA-K 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 229910000399 iron(III) phosphate Inorganic materials 0.000 description 1
- 229960000310 isoleucine Drugs 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002741 methionine derivatives Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000004445 quantitative analysis Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000000954 titration curve Methods 0.000 description 1
- 239000004474 valine Substances 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 229940110280 zinc methionine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F13/00—Compounds containing elements of Groups 7 or 17 of the Periodic Table
- C07F13/005—Compounds without a metal-carbon linkage
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/003—Compounds containing elements of Groups 2 or 12 of the Periodic Table without C-Metal linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/091,391 US4764633A (en) | 1987-08-31 | 1987-08-31 | Ferric ion catalyzed complexation of zinc and/or manganese with alpha amino acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH674359A5 true CH674359A5 (enExample) | 1990-05-31 |
Family
ID=22227539
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1961/88A CH674359A5 (enExample) | 1987-08-31 | 1988-05-24 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4764633A (enExample) |
| JP (1) | JPS6468383A (enExample) |
| BE (1) | BE1002044A3 (enExample) |
| CA (1) | CA1301772C (enExample) |
| CH (1) | CH674359A5 (enExample) |
| DE (1) | DE3812653A1 (enExample) |
| FR (1) | FR2619812B1 (enExample) |
| GB (1) | GB2209160B (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5061815A (en) * | 1988-07-06 | 1991-10-29 | Zinpro Corporation | Metal lysine complexes and method for producing metal lysine complexes |
| US4900561A (en) * | 1989-01-03 | 1990-02-13 | Zinpro Corporation | Copper complexes of alpha-amino acids that contain terminal amino groups, and their use as nutritional supplements |
| US4948594A (en) * | 1989-01-03 | 1990-08-14 | Zinpro Corporation | Copper complexes of alpha-amino acids that contain terminal amino groups, and their use as nutritional supplements |
| US5278329A (en) * | 1992-02-21 | 1994-01-11 | Zinpro Corporation | L-form 1:1 metal methionine complexes |
| US5631031A (en) * | 1994-06-13 | 1997-05-20 | Meade; Thomas L. | Water-insoluble amino acid salt |
| US5430164A (en) * | 1994-10-18 | 1995-07-04 | Zinpro Corporation | Enhanced solubilization of zinc and manganese methionine complex salts by addition of ferric ion |
| DE19510274A1 (de) * | 1995-03-21 | 1996-10-02 | Ciba Geigy Ag | Verfahren zur Herstellung von Granulaten |
| US5583243A (en) * | 1995-05-19 | 1996-12-10 | Zinpro Corporation | Salts of alpha-hydroxy aliphatic carboxylic acids and uses thereof |
| US5702718A (en) * | 1995-07-25 | 1997-12-30 | K.E.R. Associates, Inc. | Method for applying metal-amino acid complexes as supplements to feed |
| TW425270B (en) * | 1995-12-28 | 2001-03-11 | Ajinomoto Kk | Feed additive composition for raising aquatic animal containing new phosphoric acid-amino acid-polyvalent metal complex salt |
| US5846581A (en) * | 1997-01-31 | 1998-12-08 | Catron; Douglas Howard | Chromium (III) salts of short chain fatty acids composition for use in animal feeds |
| US5885610A (en) * | 1997-03-04 | 1999-03-23 | Zinpro Corporation | By-pass rumen product |
| JP2001220348A (ja) * | 1999-11-30 | 2001-08-14 | Japan Science & Technology Corp | 亜鉛(ii)有機錯体からなる血糖降下剤 |
| US7164035B2 (en) * | 2000-01-07 | 2007-01-16 | Newsome David A | Zinc-monocysteine complex and method of using zinc-cysteine complexes |
| US6166071A (en) * | 2000-03-13 | 2000-12-26 | Albion International, Inc. | Zinc amino acid chelates having ligands comprised of glycine and a sulfur-containing amino acids |
| JP4655174B2 (ja) * | 2000-08-17 | 2011-03-23 | 謙治 藤井 | アミノ酸金属リン酸塩の製造法 |
| US6579904B1 (en) | 2000-09-22 | 2003-06-17 | K.E.R. Associates, Inc. | Process for making betaine transition metal complexes for use in animal feed supplements and compositions thereof |
| US7247328B2 (en) * | 2002-05-31 | 2007-07-24 | Zinpro Corporation | Chromium (III) alpha amino acid complexes |
| US7129375B2 (en) | 2002-10-16 | 2006-10-31 | Zinpro Corporation | Metal complexes of α amino dicarboxylic acids |
| DE10352129A1 (de) | 2003-11-04 | 2005-06-16 | Grillo Zinkoxid Gmbh | Verfahren zur Herstellung einer Organozinkverbindung und deren Verwendung in einer zinkhaltigen Zusammensetzung für die Nahrungsergänzung |
| KR100481326B1 (ko) * | 2004-06-22 | 2005-04-07 | 주식회사 동암비티 | 유기태 킬레이트의 제조방법 |
| KR101164711B1 (ko) * | 2009-02-27 | 2012-07-11 | 씨제이제일제당 (주) | 미네랄 첨가와 산처리를 이용하여 메치오닌의 용해도를 증가시키는 방법 |
| CN106414460B (zh) | 2014-06-18 | 2019-07-16 | 高露洁-棕榄公司 | 从氯化锌合成锌-赖氨酸络合物 |
| CN107751577A (zh) * | 2017-11-21 | 2018-03-06 | 天峨县宏昌农机专业合作社 | 一种二次络合锌的络合物及其用途 |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB190713986A (en) * | 1907-06-17 | 1907-10-10 | Herbert John Haddan | Improvements in the Manufacture of Metallic Filaments for Electric Glow Lamps. |
| GB252393A (en) * | 1925-05-23 | 1926-07-15 | British Thomson Houston Co Ltd | Improvements in and relating to centrifugal machines such as pumps and compressors |
| US1663998A (en) * | 1925-05-28 | 1928-03-27 | Westinghouse Electric & Mfg Co | Means for minimizing fluid pulsations |
| FR855124A (fr) * | 1939-05-22 | 1940-05-03 | Perfectionnements aux souffleurs et pompes centrifuges à boîtier hélicoïdal | |
| GB554166A (en) * | 1941-12-19 | 1943-06-23 | Robert William Corbitt | Improvements in or relating to centrifugal pumps and compressors |
| US2840587A (en) * | 1954-07-07 | 1958-06-24 | Dow Chemical Co | Process for producing ethionine and its salts |
| US2745859A (en) * | 1954-07-07 | 1956-05-15 | Dow Chemical Co | Method for the preparation of zinc ethionate |
| US2872469A (en) * | 1956-01-23 | 1959-02-03 | Dow Chemical Co | Metal salts of ethionine |
| US3463858A (en) * | 1965-05-06 | 1969-08-26 | Dean R Anderson | Organic zinc feed additive and method of making same |
| FR1486168A (fr) * | 1966-07-08 | 1967-06-23 | Caterpillar Tractor Co | Diffuseur sans aubes plus particulièrement de compresseur centrifuge |
| US3658437A (en) * | 1970-03-27 | 1972-04-25 | Caterpillar Tractor Co | Diffuser including vaneless and vaned sections |
| DE2209118C3 (de) * | 1972-02-26 | 1975-04-30 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Gehäuse für einen Radiallüfter |
| JPS5518688B2 (enExample) * | 1972-12-02 | 1980-05-21 | ||
| US4021569A (en) * | 1973-08-20 | 1977-05-03 | Zinpro Corporation | Method of nutritional supplementation for zinc and methionine by ingesting 1:1 zinc methionine complexes |
| US3941818A (en) * | 1973-08-20 | 1976-03-02 | Zinpro Corporation | 1:1 Zinc methionine complexes |
| US4039681A (en) * | 1973-08-20 | 1977-08-02 | Zinpro Corporation | Zinc methionine complex for acne treatment |
| US3925433A (en) * | 1973-09-10 | 1975-12-09 | Zinpro Corp | 1:1 And 2:1 chromium, alpha amino acid complex salts |
| US3950372A (en) * | 1974-07-03 | 1976-04-13 | Zinpro Corporation | 1:1 Manganese alpha amino acid complexes |
| US4067994A (en) * | 1976-03-26 | 1978-01-10 | Zinpro Corporation | Iron methionine complex salts |
| US4172072A (en) * | 1977-10-20 | 1979-10-23 | Ashmead H H | Buffered enzymatically produced metal proteinates |
| US4216143A (en) * | 1977-10-20 | 1980-08-05 | Ashmead H H | Soluble non-ferrous metal proteinates |
| JPS54104007A (en) * | 1978-02-01 | 1979-08-15 | Hitachi Ltd | Diffuser for centrifugal compressor |
| JPS5520607U (enExample) * | 1978-07-26 | 1980-02-08 | ||
| JPS5893997A (ja) * | 1981-11-30 | 1983-06-03 | Hitachi Ltd | 電動送風機 |
| DE3238118A1 (de) * | 1982-10-14 | 1984-04-19 | Verla-Pharm, Arzneimittelfabrik Apotheker H.J. v. Ehrlich GmbH & Co KG, 8132 Tutzing | Verfahren zur herstellung von komplexverbindungen aus aminodicarbonsaeuren, zweiwertigen metallionen und halogenidionen |
| ES524820A0 (es) * | 1983-08-08 | 1985-02-01 | Vinas Lab | Procedimiento para la obtencion de un nuevo derivado de carbocisteina |
| US4599152A (en) * | 1985-05-24 | 1986-07-08 | Albion Laboratories | Pure amino acid chelates |
-
1987
- 1987-08-31 US US07/091,391 patent/US4764633A/en not_active Expired - Lifetime
-
1988
- 1988-04-11 CA CA000563806A patent/CA1301772C/en not_active Expired - Lifetime
- 1988-04-13 GB GB8808709A patent/GB2209160B/en not_active Expired - Lifetime
- 1988-04-15 DE DE3812653A patent/DE3812653A1/de active Granted
- 1988-04-26 JP JP63101526A patent/JPS6468383A/ja active Granted
- 1988-05-04 BE BE8800500A patent/BE1002044A3/fr not_active IP Right Cessation
- 1988-05-09 FR FR888806219A patent/FR2619812B1/fr not_active Expired - Lifetime
- 1988-05-24 CH CH1961/88A patent/CH674359A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0437068B2 (enExample) | 1992-06-18 |
| CA1301772C (en) | 1992-05-26 |
| GB2209160A (en) | 1989-05-04 |
| US4764633A (en) | 1988-08-16 |
| FR2619812A1 (fr) | 1989-03-03 |
| JPS6468383A (en) | 1989-03-14 |
| DE3812653C2 (enExample) | 1993-06-24 |
| GB2209160B (en) | 1992-07-22 |
| GB8808709D0 (en) | 1988-05-18 |
| BE1002044A3 (fr) | 1990-06-05 |
| FR2619812B1 (fr) | 1990-11-16 |
| DE3812653A1 (de) | 1989-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH674359A5 (enExample) | ||
| DE2436946A1 (de) | Zink/methionin-komplex-salze, verfahren zu ihrer herstellung und ihre verwendung in nahrungsmitteln | |
| DE69321826T2 (de) | Verfahren zur versehung eines nahrungsmittel mit selenium | |
| DE69829339T2 (de) | Tierfutter enthaltend chrom(iii)- und mangan(ii)-salze kurzkettiger fettsäuren | |
| DE2504374C3 (de) | Mittel zum Aromatisieren von Lebensmitteln und Getränken mit einem Gehalt an einem wasserunlöslichen Magnesium- oder Calcium-Isohumulon-Komplex und seine Verwendung | |
| DD283326A5 (de) | Verfahren zur herstellung von gelatine aus knochenmehl | |
| DE2431483C3 (de) | Verfahren zur Herstellung von Alkali- oder Ammoniumsalzen von Insulin | |
| EP0413981B1 (de) | Dinatriumsalz des Trimercapto-s-triazin-hexahydrats, Verfahren zu seiner Herstellung und Verwendung | |
| DE4129872C2 (de) | Verfahren zur Herstellung von Huminsäure-Metall-Verbindungen, deren Verwendung als Adsorptions- und/oder Entgiftungsmittel bzw. als Spurenelementquelle | |
| EP0100974A1 (de) | Teilchenförmiges Futterzusatzmittel für Wiederkäuer | |
| DE69506903T2 (de) | Erhöhte solubiliierung von komplexsalzen von methionin mit zink und mangan durch zusatz von ferriionen | |
| DE4232157A1 (de) | Verfahren zur Herstellung von reinen wäßrigen Betainlösungen | |
| DE2316896B2 (de) | Verfahren zur Herstellung eines Aromatisierungsmittels mit Fleischaroma | |
| DE60200741T2 (de) | Herstellung von Metallkomplexen von Aminosäuren, hergestellt durch Hydrolyse von Sojaprotein | |
| DE2263427A1 (de) | Herstellung von katalysatoren fuer die oxidation von so tief 2-gasen | |
| DE2758306B2 (de) | Verfahren zur Herstellung von N-SuIf oalkanaminoalkanphosphonsäuren bzw. deren Alkalisalze | |
| DE1792109B2 (de) | Verwendung von Calcium-Natrium-Phosphat als mineralisches Beifuttermittel | |
| DE1933692A1 (de) | Verfahren zur Herstellung von Phosphorsaeure | |
| DE3429885C2 (de) | Verfahren zur Herstellung eines Düngemittels durch Naßaufschluß von Phosphatgesteinskonzentrat mit Ammoniumsulfat und Schwefelsäure | |
| DE2228101A1 (de) | Verfahren zur herstellung von komplexen verbindungen von aminodicarbonsaeuren mit magnesium und halogenen | |
| DE915453C (de) | Verfahren zur Herstellung von Mischduengern | |
| DE3246885C2 (de) | Verfahren zur Herstellung von Calciumhydrogenphosphatdihydrat | |
| DE1667510C3 (de) | Verfahren zur Herstellung von MagnesiumhexafluorosNicat | |
| AT262285B (de) | Verfahren zur Abtrennung und Isolierung einer 4,4'-Dipyridyliumverbindung und zur Herstellung einer gereinigten Lösung eines 4,4'-Dipyridyliumsalzes aus der 4,4'-Dipyridyliumverbindung | |
| DE2343477C2 (de) | Verfahren zur Herstellung von pulverförmigen Futterzusätzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |