CH652395A5 - 2(1h)-pyridinon-derivate, ihre herstellung und sie enthaltende pharmazeutische zubereitungen. - Google Patents
2(1h)-pyridinon-derivate, ihre herstellung und sie enthaltende pharmazeutische zubereitungen. Download PDFInfo
- Publication number
- CH652395A5 CH652395A5 CH7325/81A CH732581A CH652395A5 CH 652395 A5 CH652395 A5 CH 652395A5 CH 7325/81 A CH7325/81 A CH 7325/81A CH 732581 A CH732581 A CH 732581A CH 652395 A5 CH652395 A5 CH 652395A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compounds
- phenyl
- formula
- carbon atoms
- alkyl
- Prior art date
Links
- 239000000825 pharmaceutical preparation Substances 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 4
- 150000005300 2(1H)-pyridinones Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 49
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 150000003839 salts Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 9
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 6
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- JQQHYGNDMWUCGL-UHFFFAOYSA-N 3-amino-6-methyl-5-phenyl-1h-pyridin-2-one Chemical compound N1C(=O)C(N)=CC(C=2C=CC=CC=2)=C1C JQQHYGNDMWUCGL-UHFFFAOYSA-N 0.000 claims description 3
- 230000003177 cardiotonic effect Effects 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000000496 cardiotonic agent Substances 0.000 claims description 2
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- -1 4-imidazolyl Chemical group 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 210000005240 left ventricle Anatomy 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- UORJNBVJVRLXMQ-UHFFFAOYSA-N aprobarbital Chemical compound C=CCC1(C(C)C)C(=O)NC(=O)NC1=O UORJNBVJVRLXMQ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VTSFNCCQCOEPKF-UHFFFAOYSA-N 3-amino-1h-pyridin-2-one Chemical class NC1=CC=CN=C1O VTSFNCCQCOEPKF-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JMXVESGATWXZOJ-UHFFFAOYSA-N 4-(dimethylamino)-3-phenylbut-3-en-2-one Chemical compound CN(C)C=C(C(C)=O)C1=CC=CC=C1 JMXVESGATWXZOJ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical group N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- OEKMRMSCUYJJHJ-UHFFFAOYSA-N 6-methyl-2-oxo-5-phenyl-1h-pyridine-3-carbonitrile Chemical compound N1C(=O)C(C#N)=CC(C=2C=CC=CC=2)=C1C OEKMRMSCUYJJHJ-UHFFFAOYSA-N 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000006231 channel black Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH166980 | 1980-03-03 | ||
| CH166880 | 1980-03-03 | ||
| CH571780 | 1980-07-25 | ||
| CH794780 | 1980-10-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH652395A5 true CH652395A5 (de) | 1985-11-15 |
Family
ID=27428258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH7325/81A CH652395A5 (de) | 1980-03-03 | 1981-02-27 | 2(1h)-pyridinon-derivate, ihre herstellung und sie enthaltende pharmazeutische zubereitungen. |
Country Status (16)
| Country | Link |
|---|---|
| CA (1) | CA1183533A (fr) |
| CH (1) | CH652395A5 (fr) |
| DE (1) | DE3106460A1 (fr) |
| DK (1) | DK94481A (fr) |
| ES (1) | ES499971A0 (fr) |
| FI (1) | FI810558L (fr) |
| FR (1) | FR2477148A1 (fr) |
| GB (1) | GB2070606B (fr) |
| IL (1) | IL62246A (fr) |
| IT (1) | IT1142458B (fr) |
| NL (1) | NL8100964A (fr) |
| NZ (1) | NZ196385A (fr) |
| PT (1) | PT72596B (fr) |
| SE (1) | SE8101336L (fr) |
| WO (1) | WO1981002575A1 (fr) |
| YU (1) | YU51581A (fr) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL65278A0 (en) * | 1981-03-30 | 1982-05-31 | Sterling Drug Inc | 3-amino-5-(substituted)-2(1h)-pyridinones and corresponding 3-cyano compounds,their preparation and pharmaceutical compositions containing them |
| US4515797A (en) * | 1981-09-08 | 1985-05-07 | Sterling Drug Inc. | 3-Amino-5-(hydroxy- and/or aminophenyl)-6-(lower-alkyl)-2(1H)-pyridinones and cardiotonic use thereof |
| US4465686A (en) * | 1981-09-08 | 1984-08-14 | Sterling Drug Inc. | 5-(Hydroxy- and/or amino-phenyl)-6-(lower-alkyl)-2-(1H)-pyridinones, their cardiotonic use and preparation |
| US4514400A (en) * | 1981-10-26 | 1985-04-30 | William H. Rorer, Inc. | Cardiotonic 5-heteroaryl-pyridone |
| US4593028A (en) * | 1981-10-26 | 1986-06-03 | William H. Rorer, Inc. | 5-hetero aryl-substituted-2-pyridones useful as cardiotonic agents for treatment of congestive heart failure |
| US4539321A (en) * | 1981-10-26 | 1985-09-03 | William H. Rorer, Inc. | 5-Diaza-aryl-3-substituted pyridone compounds |
| US4432979A (en) * | 1981-10-26 | 1984-02-21 | William H. Rorer, Inc. | Pyridone compounds |
| AT384021B (de) * | 1982-05-18 | 1987-09-25 | Sandoz Ag | Verfahren zur herstellung neuer 2(1h)-pyridinon- derivate und ihrer salze |
| FR2527206B1 (fr) * | 1982-05-18 | 1986-12-05 | Sandoz Sa | Nouveaux derives de la 2(1h)-pyridinone, leur preparation et leur utilisation comme medicaments |
| FR2529891A1 (fr) * | 1982-07-12 | 1984-01-13 | Nativelle Sa Ets | Derives du pyridyl-3 alcoxy-5 pyrazole, procede de preparation et application en therapeutique |
| IT8367883A0 (it) * | 1982-08-23 | 1983-08-22 | Rorer Int Overseas | Composti cardiotonici del 2 piridone 5 biciclico eteroaril sostituito e relative composizioni farmaceutiche |
| IL69407A (en) * | 1982-08-23 | 1987-10-20 | Warner Lambert Co | 2(1h)-pyridinones,their preparation and pharmaceutical compositions containing them |
| US4503061A (en) * | 1983-07-22 | 1985-03-05 | Warner-Lambert Company | Substituted phenyl-pyridinones as cardiotonic agents |
| US4517192A (en) * | 1983-01-31 | 1985-05-14 | Sterling Drug Inc. | 6-Alkyl-5-[4-(alkylsulfinyl or alkylsulfonyl)phenyl]-2(1H)-pyridinones and their use as cardiatonics |
| ES8600746A1 (es) * | 1983-04-20 | 1985-10-16 | Quimicos Y Farmaceuticos Abel | Un nuevo procedimiento para la preparacion de 5-azinil-1,2-dihidroazin-2-onas. |
| US4568751A (en) * | 1983-04-29 | 1986-02-04 | Merrell Dow Pharmaceuticals Inc. | 5-Acyl-2-(1H)-pyridinones |
| DE3406329A1 (de) * | 1984-02-22 | 1985-08-22 | Merck Patent Gmbh, 6100 Darmstadt | Pyridone |
| ATE77817T1 (de) | 1985-04-30 | 1992-07-15 | Dresden Arzneimittel | 3-cyan-pyridine, verfahren zu ihrer herstellung und ihre pharmazeutische verwendung. |
| US4666913A (en) * | 1985-11-22 | 1987-05-19 | William H. Rorer, Inc. | Hydroxy and aminothiazolyl-benzodiazinone compounds, cardiotonic compositions including the same, and their uses |
| US4785005A (en) * | 1986-06-25 | 1988-11-15 | Rorer Pharmaceutical Corporation | 6-(6-alkylpyridone)-carbostyril compounds and their cardiotonic uses |
| US5254571A (en) * | 1988-04-21 | 1993-10-19 | Smith Kline & French Laboratories Ltd. | Chemical compounds |
| GB8809481D0 (en) * | 1988-04-21 | 1988-05-25 | Smith Kline French Lab | Chemical compounds |
| GB8923131D0 (en) * | 1989-10-13 | 1989-11-29 | Smith Kline French Lab | Chemical compounds |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3355278A (en) * | 1961-03-13 | 1967-11-28 | Hooker Chemical Corp | Herbicidal composition and method |
| NL6816241A (fr) * | 1967-12-01 | 1969-06-03 | ||
| FR2050940A5 (fr) * | 1969-06-30 | 1971-04-02 | Rhone Poulenc Sa | |
| US3666765A (en) * | 1969-10-27 | 1972-05-30 | Union Carbide Corp | Synthesis of 2-pyridones and derivatives thereof |
| US3721676A (en) * | 1969-11-12 | 1973-03-20 | Merck & Co Inc | Certain 3-amino-2(1h)pyridones |
| BE758759A (fr) * | 1969-11-12 | 1971-05-10 | Merck & Co Inc | Pyridones anti-inflammatoires |
| US4038396A (en) * | 1975-02-24 | 1977-07-26 | Merck & Co., Inc. | Anti-inflammatory oxazole[4,5-b]pyridines |
| US4072746A (en) * | 1975-10-14 | 1978-02-07 | Sterling Drug Inc. | 3-Amino-5-(pyridinyl)-2(1H)-pyridinones |
-
1981
- 1981-02-21 DE DE19813106460 patent/DE3106460A1/de not_active Withdrawn
- 1981-02-24 FI FI810558A patent/FI810558L/fi not_active Application Discontinuation
- 1981-02-27 WO PCT/CH1981/000023 patent/WO1981002575A1/fr unknown
- 1981-02-27 NL NL8100964A patent/NL8100964A/nl not_active Application Discontinuation
- 1981-02-27 GB GB8106335A patent/GB2070606B/en not_active Expired
- 1981-02-27 FR FR8104152A patent/FR2477148A1/fr active Granted
- 1981-02-27 CH CH7325/81A patent/CH652395A5/de not_active IP Right Cessation
- 1981-03-02 YU YU00515/81A patent/YU51581A/xx unknown
- 1981-03-02 DK DK94481A patent/DK94481A/da not_active Application Discontinuation
- 1981-03-02 SE SE8101336A patent/SE8101336L/xx not_active Application Discontinuation
- 1981-03-02 NZ NZ196385A patent/NZ196385A/xx unknown
- 1981-03-02 PT PT72596A patent/PT72596B/pt unknown
- 1981-03-02 CA CA000372050A patent/CA1183533A/fr not_active Expired
- 1981-03-02 ES ES499971A patent/ES499971A0/es active Granted
- 1981-03-02 IL IL62246A patent/IL62246A/xx unknown
- 1981-03-02 IT IT47920/81A patent/IT1142458B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| WO1981002575A1 (fr) | 1981-09-17 |
| CA1183533A (fr) | 1985-03-05 |
| FI810558L (fi) | 1981-09-04 |
| ES8301469A1 (es) | 1982-12-01 |
| SE8101336L (sv) | 1981-09-04 |
| DK94481A (da) | 1981-09-04 |
| YU51581A (en) | 1983-12-31 |
| IT8147920A0 (it) | 1981-03-02 |
| IT1142458B (it) | 1986-10-08 |
| DE3106460A1 (de) | 1982-01-28 |
| IL62246A0 (en) | 1981-05-20 |
| IL62246A (en) | 1984-09-30 |
| FR2477148A1 (fr) | 1981-09-04 |
| ES499971A0 (es) | 1982-12-01 |
| FR2477148B1 (fr) | 1983-09-02 |
| GB2070606A (en) | 1981-09-09 |
| PT72596B (en) | 1982-07-13 |
| NL8100964A (nl) | 1981-10-01 |
| PT72596A (en) | 1981-04-01 |
| GB2070606B (en) | 1984-02-29 |
| NZ196385A (en) | 1983-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH652395A5 (de) | 2(1h)-pyridinon-derivate, ihre herstellung und sie enthaltende pharmazeutische zubereitungen. | |
| DE69014351T2 (de) | Pyridincarbonsäureamid-Derivate und diese enthaltende pharmazeutische Zusammensetzungen. | |
| DE2556110C3 (de) | 2-(3-Alkylamino-2-hydroxypropoxy)-3cyanpyridine, ihre Herstellung und pharmazeutische Verwendung | |
| DE60111498T2 (de) | Kondensierte imidazolderivate | |
| DE2658544A1 (de) | Carbostyrilderivate, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3445377A1 (de) | Carbocylische und heterocyclische carbonsaeureester und -amide von ueberbrueckten und nicht ueberbrueckten cyclischen stickstoffhaltigen aminen oder alkoholen | |
| DE2458965B2 (de) | 3-Amino-indazol-N-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel | |
| DD205904A5 (de) | Verfahren zur herstellung von imidazo (4,5-c) pyridin-derivaten | |
| DE2706977A1 (de) | Benzoesaeuren und deren derivate sowie verfahren zu ihrer herstellung | |
| DE2847622A1 (de) | Neue chinazolin-derivate, verfahren zu ihrer herstellung und diese derivate enthaltende arzneimittel | |
| DD202293A5 (de) | Verfahren zur herstellung von 2-guanidino-4-heteroarylthiazolen | |
| DD262023A5 (de) | Verfahren zur herstellung von dihydropyridinen | |
| AT391317B (de) | Verfahren zur herstellung von neuen 8alpha-acylaminoergolinen | |
| DE2617205A1 (de) | Anorektische verbindungen | |
| WO1983004024A1 (fr) | Derives de 2(1h) pyridone, leur preparation et composition les renfermant | |
| DD209828A5 (de) | Verfahren zur herstellung von 2-guanidino-4-(2-subst.-amino-4-imidazolyl)thiazolen | |
| DE2921660A1 (de) | 5-nitroimidazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende antiprotozoen-mittel | |
| DE2800316A1 (de) | Oximether enthaltende arzneimittel zur bekaempfung von ulcera, oximether und verfahren zu ihrer herstellung | |
| DD236928A5 (de) | Verfahren zur herstellung neuer 1,2,4-triazolo-carbamate | |
| DE2410938A1 (de) | Chinazolinderivate und diese enthaltende arzneimittel | |
| DE2313256C3 (de) | l^-Benzisoxazol-3-acetamidoxim, seine Salze, Verfahren zu seiner Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0519291B1 (fr) | 2,3-Dihydropyrano (2,3-b) pyridines amino-méthyl-substituées, procédé pour leur préparation et leur utilisation en tant que médicaments | |
| DD154487A5 (de) | Verfahren zur herstellung von 1-benzoxepin-5(2h)-on-derivaten | |
| DE2134880C3 (de) | Thieno-pyrimidine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DD296683A5 (de) | Verfahren zur herstellung von enantiomerenreinen dihydrophyridinamiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |