CH633779A5 - Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. - Google Patents
Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. Download PDFInfo
- Publication number
- CH633779A5 CH633779A5 CH843377A CH843377A CH633779A5 CH 633779 A5 CH633779 A5 CH 633779A5 CH 843377 A CH843377 A CH 843377A CH 843377 A CH843377 A CH 843377A CH 633779 A5 CH633779 A5 CH 633779A5
- Authority
- CH
- Switzerland
- Prior art keywords
- hydantoin
- group
- mol
- formula
- copolymer
- Prior art date
Links
- -1 VINYL ETHERS Chemical class 0.000 title claims description 22
- 229920000642 polymer Polymers 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title description 5
- 229920002554 vinyl polymer Polymers 0.000 title description 5
- 229920001577 copolymer Polymers 0.000 claims description 48
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 32
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 30
- 229940091173 hydantoin Drugs 0.000 claims description 26
- 150000001875 compounds Chemical class 0.000 claims description 23
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 claims description 18
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 claims 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 81
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 75
- 239000000243 solution Substances 0.000 description 43
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 26
- 150000003863 ammonium salts Chemical class 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 150000001408 amides Chemical class 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 229920001897 terpolymer Polymers 0.000 description 18
- 239000000047 product Substances 0.000 description 16
- 239000004342 Benzoyl peroxide Substances 0.000 description 14
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 14
- 235000019400 benzoyl peroxide Nutrition 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 150000008064 anhydrides Chemical class 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 238000007334 copolymerization reaction Methods 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 238000005160 1H NMR spectroscopy Methods 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000001228 spectrum Methods 0.000 description 6
- 230000008719 thickening Effects 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 150000005690 diesters Chemical class 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 230000032050 esterification Effects 0.000 description 5
- 238000005886 esterification reaction Methods 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 4
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 4
- REEBWSYYNPPSKV-UHFFFAOYSA-N 3-[(4-formylphenoxy)methyl]thiophene-2-carbonitrile Chemical compound C1=CC(C=O)=CC=C1OCC1=C(C#N)SC=C1 REEBWSYYNPPSKV-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- NPSGIMOZNMNEAP-UHFFFAOYSA-N 1-(2-ethenoxyethyl)-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(CCOC=C)C(=O)NC1=O NPSGIMOZNMNEAP-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 150000003949 imides Chemical class 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003973 paint Substances 0.000 description 3
- 239000002453 shampoo Substances 0.000 description 3
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 239000005968 1-Decanol Substances 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- DNJRKFKAFWSXSE-UHFFFAOYSA-N 1-chloro-2-ethenoxyethane Chemical compound ClCCOC=C DNJRKFKAFWSXSE-UHFFFAOYSA-N 0.000 description 2
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- ZUWLNOXNQWRSHI-UHFFFAOYSA-N 3-(2-ethenoxyethyl)-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)NC(=O)N(CCOC=C)C1=O ZUWLNOXNQWRSHI-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- RHYBFKMFHLPQPH-UHFFFAOYSA-N N-methylhydantoin Chemical compound CN1CC(=O)NC1=O RHYBFKMFHLPQPH-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012459 cleaning agent Substances 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 150000002169 ethanolamines Chemical class 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- DMCTVRQBJMBEDT-UHFFFAOYSA-N phenol;1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl.OC1=CC=CC=C1 DMCTVRQBJMBEDT-UHFFFAOYSA-N 0.000 description 2
- 229920002239 polyacrylonitrile Polymers 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 239000013008 thixotropic agent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- OKLWGALVQNNLCI-IWQZZHSRSA-N (e)-2-(chloromethyl)but-2-enedioic acid Chemical compound OC(=O)\C=C(\CCl)C(O)=O OKLWGALVQNNLCI-IWQZZHSRSA-N 0.000 description 1
- BGKDZDYQQWNGIR-BQYQJAHWSA-N (e)-2-bromo-3-phenylbut-2-enedioic acid Chemical compound OC(=O)C(\Br)=C(/C(O)=O)C1=CC=CC=C1 BGKDZDYQQWNGIR-BQYQJAHWSA-N 0.000 description 1
- ZQHJVIHCDHJVII-OWOJBTEDSA-N (e)-2-chlorobut-2-enedioic acid Chemical compound OC(=O)\C=C(\Cl)C(O)=O ZQHJVIHCDHJVII-OWOJBTEDSA-N 0.000 description 1
- PNNFEYPWPCDLOC-UPHRSURJSA-N (z)-2,3-dichlorobut-2-enedioic acid Chemical compound OC(=O)C(\Cl)=C(\Cl)C(O)=O PNNFEYPWPCDLOC-UPHRSURJSA-N 0.000 description 1
- QQCYMGFLVZNQQO-YPKPFQOOSA-N (z)-2,3-diphenylbut-2-enedioic acid Chemical compound C=1C=CC=CC=1/C(C(=O)O)=C(/C(O)=O)C1=CC=CC=C1 QQCYMGFLVZNQQO-YPKPFQOOSA-N 0.000 description 1
- JWPVCFSBPUPIQA-WAYWQWQTSA-N (z)-2-butylbut-2-enedioic acid Chemical compound CCCC\C(C(O)=O)=C\C(O)=O JWPVCFSBPUPIQA-WAYWQWQTSA-N 0.000 description 1
- SASYHUDIOGGZCN-ARJAWSKDSA-N (z)-2-ethylbut-2-enedioic acid Chemical compound CC\C(C(O)=O)=C\C(O)=O SASYHUDIOGGZCN-ARJAWSKDSA-N 0.000 description 1
- CQNPSIAJXGEDQS-VURMDHGXSA-N (z)-2-phenylbut-2-enedioic acid Chemical compound OC(=O)\C=C(/C(O)=O)C1=CC=CC=C1 CQNPSIAJXGEDQS-VURMDHGXSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- NERNEXMEYQFFHU-UHFFFAOYSA-N 1,3-diazaspiro[4.5]decane-2,4-dione Chemical compound N1C(=O)NC(=O)C11CCCCC1 NERNEXMEYQFFHU-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FSRLCYXRDZIJJT-UHFFFAOYSA-N 1-ethenyl-1,2,3,4-tetrahydronaphthalene Chemical compound C1=CC=C2C(C=C)CCCC2=C1 FSRLCYXRDZIJJT-UHFFFAOYSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- TURITJIWSQEMDB-UHFFFAOYSA-N 2-methyl-n-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCNC(=O)C(C)=C TURITJIWSQEMDB-UHFFFAOYSA-N 0.000 description 1
- CDVAIHNNWWJFJW-UHFFFAOYSA-N 3,5-diethoxycarbonyl-1,4-dihydrocollidine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C CDVAIHNNWWJFJW-UHFFFAOYSA-N 0.000 description 1
- RGWOGMDVEVLOLP-UHFFFAOYSA-N 3-(2-ethenoxyethyl)-1-methylimidazolidine-2,4-dione Chemical compound CN1CC(=O)N(CCOC=C)C1=O RGWOGMDVEVLOLP-UHFFFAOYSA-N 0.000 description 1
- ZYUVBLXAZMIRIJ-UHFFFAOYSA-N 3-(2-ethenoxyethyl)-5-ethyl-5-methylimidazolidine-2,4-dione Chemical compound CCC1(C)NC(=O)N(CCOC=C)C1=O ZYUVBLXAZMIRIJ-UHFFFAOYSA-N 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 1
- VSJRBQDMBFFHMC-UHFFFAOYSA-N 5-ethyl-5-methylimidazolidine-2,4-dione Chemical compound CCC1(C)NC(=O)NC1=O VSJRBQDMBFFHMC-UHFFFAOYSA-N 0.000 description 1
- RBWNDBNSJFCLBZ-UHFFFAOYSA-N 7-methyl-5,6,7,8-tetrahydro-3h-[1]benzothiolo[2,3-d]pyrimidine-4-thione Chemical compound N1=CNC(=S)C2=C1SC1=C2CCC(C)C1 RBWNDBNSJFCLBZ-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 125000004018 acid anhydride group Chemical group 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- IWLBIFVMPLUHLK-UHFFFAOYSA-N azane;formaldehyde Chemical compound N.O=C IWLBIFVMPLUHLK-UHFFFAOYSA-N 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000005670 ethenylalkyl group Chemical group 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 239000008394 flocculating agent Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 235000013675 iodine Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 229920003087 methylethyl cellulose Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012966 redox initiator Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Epoxy Resins (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (21)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH843377A CH633779A5 (de) | 1977-07-07 | 1977-07-07 | Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. |
| US05/920,301 US4206309A (en) | 1977-07-07 | 1978-06-29 | Vinyl ethers, process for their preparation, and their use for the preparation of polymers |
| DE19782829307 DE2829307A1 (de) | 1977-07-07 | 1978-07-04 | Neue vinylaether, ein verfahren zu ihrer herstellung und ihre verwendung zur herstellung von polymeren |
| LU79925A LU79925A1 (de) | 1977-07-07 | 1978-07-05 | Neue vinylaether,ein verfahren zu ihrer herstellung und ihre verwendung zur herstellung von polymeren |
| IL55084A IL55084A0 (en) | 1977-07-07 | 1978-07-05 | Hydantion vinyl ethers,their preparation and their use for the preparation of polymers |
| NL7807290A NL7807290A (nl) | 1977-07-07 | 1978-07-05 | Vinylethers, een werkwijze voor de bereiding daarvan en de toepassing daarvan ter verkrijging van polymeren. |
| AU37822/78A AU3782278A (en) | 1977-07-07 | 1978-07-06 | Hydantoin vinylethers |
| FR7820179A FR2396753A1 (fr) | 1977-07-07 | 1978-07-06 | Ethers vinyliques derivant de l'hydantoine, preparation et utilisation pour la fabrication de matieres polymeres |
| GB7828987A GB2000774B (en) | 1977-07-07 | 1978-07-06 | Vinyl ethers process for their preparation and their use for the preparation of polymers |
| IT7825414A IT7825414A0 (it) | 1977-07-07 | 1978-07-06 | Vinileteri, procedimento per laloro preparazione e loro impiego per la preparazione di polimeri. |
| BE189107A BE868782A (fr) | 1977-07-07 | 1978-07-06 | Ethers vinyliques derivant de l'hydantoine, preparation et utilisation pour la fabrication de matieres polymeres |
| ES471528A ES471528A1 (es) | 1977-07-07 | 1978-07-06 | Procedimiento para la preparacion de eteres hidantoivinili- cos |
| CA306,892A CA1115711A (en) | 1977-07-07 | 1978-07-06 | Vinyl ethers and process for their preparation |
| BR7804374A BR7804374A (pt) | 1977-07-07 | 1978-07-06 | Hidantoinovinileteres,processo para sua preparacao e processo para a preparacao de polimeros |
| NZ187788A NZ187788A (en) | 1977-07-07 | 1978-07-06 | Hydantoin vinyl ethers; polymers |
| ZA00783881A ZA783881B (en) | 1977-07-07 | 1978-07-06 | Novel vinyl ethers,process for their preparation and their use for the preparation of polymers |
| JP8281678A JPS5416473A (en) | 1977-07-07 | 1978-07-07 | Hydantoinvinylether * production thereof and production of polymer using same |
| PH21341A PH14292A (en) | 1977-07-07 | 1978-07-07 | Hydantoin derivative of vinyl ether and methylene bis-hydantoin derivative of vinyl ether |
| US06/072,493 US4256867A (en) | 1977-07-07 | 1979-09-04 | Novel vinyl ethers, process for their preparation, and their use for the preparation of polymers |
| CA000377343A CA1142294A (en) | 1977-07-07 | 1981-05-11 | Vinyl ethers, process for their preparation and their use for the preparation of polymers |
| JP61260573A JPS62174208A (ja) | 1977-07-07 | 1986-10-31 | ヒダントインビニルエ−テルを使用するポリマ−の製法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH843377A CH633779A5 (de) | 1977-07-07 | 1977-07-07 | Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH633779A5 true CH633779A5 (de) | 1982-12-31 |
Family
ID=4340268
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH843377A CH633779A5 (de) | 1977-07-07 | 1977-07-07 | Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US4206309A (cg-RX-API-DMAC10.html) |
| JP (2) | JPS5416473A (cg-RX-API-DMAC10.html) |
| AU (1) | AU3782278A (cg-RX-API-DMAC10.html) |
| BE (1) | BE868782A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7804374A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1115711A (cg-RX-API-DMAC10.html) |
| CH (1) | CH633779A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2829307A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES471528A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2396753A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2000774B (cg-RX-API-DMAC10.html) |
| LU (1) | LU79925A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7807290A (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ187788A (cg-RX-API-DMAC10.html) |
| PH (1) | PH14292A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA783881B (cg-RX-API-DMAC10.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH645652A5 (de) * | 1981-02-19 | 1984-10-15 | Ciba Geigy Ag | Verfahren zur herstellung von copolymeren aus hydantoinvinylaethern und olefinisch ungesaettigten monomeren. |
| US4486494A (en) * | 1982-12-08 | 1984-12-04 | Ciba-Geigy Corporation | Fibre composite prepregs coated with two different resins |
| US5663053A (en) * | 1992-02-11 | 1997-09-02 | Smithkline Beecham Corporation | Inhibition of inflammatory lipid mediators |
| PT626969E (pt) * | 1992-02-11 | 2000-11-30 | Smithkline Beecham Corp | Inibidores de co.a-it e de p.a.f. |
| BRPI0614146A2 (pt) * | 2005-07-26 | 2011-03-09 | Rhodia | monÈmero, polìmero e composição de cuidados pessoais |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2466177A (en) * | 1949-04-05 | Hydantoins and method fob obtaining | ||
| US3087853A (en) * | 1956-07-02 | 1963-04-30 | Gen Aniline & Film Corp | Water soluble compositions consisting essentially of iodine and a water soluble oxygen containing polymer |
| GB846601A (en) * | 1958-01-13 | 1960-08-31 | British Oxygen Res And Dev Ltd | Vinyl hydantoins |
| US3197477A (en) * | 1961-05-01 | 1965-07-27 | Sterling Drug Inc | Allylhydantoins |
| US3161538A (en) * | 1962-06-15 | 1964-12-15 | Gen Aniline & Film Corp | Method of treating textile materials |
| CH471811A (de) * | 1966-06-23 | 1969-04-30 | Ciba Geigy | Verfahren zur Herstellung von wasserlöslichen N,N'-Diglycidyl-Verbindungen |
| CH523279A (de) * | 1968-11-11 | 1972-05-31 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Diglycidylverbindungen von N-heterocyclischen Verbindungen und deren Verwendung |
| FR2032943A5 (cg-RX-API-DMAC10.html) * | 1969-02-21 | 1970-11-27 | Bayer Ag | |
| FR2148868A6 (cg-RX-API-DMAC10.html) * | 1970-10-06 | 1973-03-23 | Rhone Poulenc Sa | |
| FR2128140B1 (cg-RX-API-DMAC10.html) * | 1971-03-05 | 1976-04-16 | Alsthom Cgee | |
| US3852302A (en) * | 1971-04-16 | 1974-12-03 | Ciba Geigy Corp | Diacrylic acid ester derivatives of hydantoin compounds |
| US4024146A (en) * | 1971-04-16 | 1977-05-17 | Ciba-Geigy Corporation | Diacrylic acid ester derivatives of uracil compounds |
| CH574955A5 (cg-RX-API-DMAC10.html) * | 1972-07-12 | 1976-04-30 | Ciba Geigy Ag | |
| CH570379A5 (cg-RX-API-DMAC10.html) * | 1972-07-12 | 1975-12-15 | Ciba Geigy Ag | |
| DE2437916A1 (de) * | 1974-08-07 | 1976-02-19 | Bayer Ag | Homopolymerisate aus 3-alkylidenhydantoinen |
| DE2437917A1 (de) * | 1974-08-07 | 1976-02-19 | Bayer Ag | Copolymerisate auf acrylnitrilallylhydantoinbasis |
| US4092479A (en) * | 1976-04-05 | 1978-05-30 | Baxter Travenol Laboratories, Inc. | Labeled 5,5-diphenylhydantoin derivatives for radioimmunoassay |
| US4082635A (en) * | 1976-08-02 | 1978-04-04 | Ciba-Geigy Corporation | Ultraviolet light-curable diacrylate hydantoin adhesive compositions |
| US4091223A (en) * | 1976-08-04 | 1978-05-23 | Ciba-Geigy Corporation | Unsaturated hydantoin coagents |
-
1977
- 1977-07-07 CH CH843377A patent/CH633779A5/de not_active IP Right Cessation
-
1978
- 1978-06-29 US US05/920,301 patent/US4206309A/en not_active Expired - Lifetime
- 1978-07-04 DE DE19782829307 patent/DE2829307A1/de active Granted
- 1978-07-05 LU LU79925A patent/LU79925A1/de unknown
- 1978-07-05 NL NL7807290A patent/NL7807290A/xx not_active Application Discontinuation
- 1978-07-06 BR BR7804374A patent/BR7804374A/pt unknown
- 1978-07-06 NZ NZ187788A patent/NZ187788A/xx unknown
- 1978-07-06 AU AU37822/78A patent/AU3782278A/en active Pending
- 1978-07-06 ES ES471528A patent/ES471528A1/es not_active Expired
- 1978-07-06 GB GB7828987A patent/GB2000774B/en not_active Expired
- 1978-07-06 CA CA306,892A patent/CA1115711A/en not_active Expired
- 1978-07-06 ZA ZA00783881A patent/ZA783881B/xx unknown
- 1978-07-06 BE BE189107A patent/BE868782A/xx unknown
- 1978-07-06 FR FR7820179A patent/FR2396753A1/fr active Granted
- 1978-07-07 PH PH21341A patent/PH14292A/en unknown
- 1978-07-07 JP JP8281678A patent/JPS5416473A/ja active Granted
-
1979
- 1979-09-04 US US06/072,493 patent/US4256867A/en not_active Expired - Lifetime
-
1986
- 1986-10-31 JP JP61260573A patent/JPS62174208A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2829307C2 (cg-RX-API-DMAC10.html) | 1988-12-22 |
| LU79925A1 (de) | 1979-04-09 |
| NL7807290A (nl) | 1979-01-09 |
| US4256867A (en) | 1981-03-17 |
| ZA783881B (en) | 1979-07-25 |
| US4206309A (en) | 1980-06-03 |
| DE2829307A1 (de) | 1979-01-25 |
| FR2396753B1 (cg-RX-API-DMAC10.html) | 1981-05-22 |
| GB2000774A (en) | 1979-01-17 |
| BE868782A (fr) | 1979-01-08 |
| JPS5416473A (en) | 1979-02-07 |
| PH14292A (en) | 1981-05-04 |
| GB2000774B (en) | 1982-02-10 |
| JPS6254805B2 (cg-RX-API-DMAC10.html) | 1987-11-17 |
| NZ187788A (en) | 1981-02-11 |
| ES471528A1 (es) | 1979-10-01 |
| BR7804374A (pt) | 1979-04-03 |
| JPS6216948B2 (cg-RX-API-DMAC10.html) | 1987-04-15 |
| FR2396753A1 (fr) | 1979-02-02 |
| AU3782278A (en) | 1980-01-10 |
| CA1115711A (en) | 1982-01-05 |
| JPS62174208A (ja) | 1987-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2509237C2 (cg-RX-API-DMAC10.html) | ||
| DE1768245A1 (de) | Anhydrid-Interpolymere als Verdickungsmittel und Verfahren zu ihrer Herstellung | |
| DE1162567B (de) | Verfahren zur Herstellung von Polymeren und Mischpolymeren von Ureidoalkylvinylaethern | |
| DE1720846A1 (de) | Verfahren zur Herstellung von Ahydrid-Interpolymeren | |
| DE1543271A1 (de) | Verfahren zur Herstellung von N-Hydroxyalkylaethylencarbonsaeuremiden | |
| DE1069874B (de) | Verfahren zur Herstellung von Mischpolymeren | |
| DE2361544A1 (de) | Papierleimungsmittel | |
| DE1118970B (de) | Verfahren zur Herstellung wasserloeslicher oder leicht in Wasser dispergierbarer polymerer quaternaerer Ammoniumverbindungen | |
| EP0025979B1 (de) | Wässrige Lösung oder Dispersion eines Styrol/Maleinsäureanhydrid-Copolymers, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69311867T2 (de) | Verfahren zur Herstellung von Carboxylgruppen enthaltende vernetzte Polymere | |
| DE69011450T2 (de) | Polyacrylat-Copolymer, Polyacrylat-Dispersion enthaltend ein Polyacrylat-Copolymer und Verfahren zu seiner Herstellung. | |
| CH633779A5 (de) | Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. | |
| DE69705386T2 (de) | Feinteilige vernetzte N-Vinylamid Harze | |
| EP2410009B1 (de) | Reglermolekül | |
| DE2164888B2 (de) | Carboxyl- und hydroxylgruppenhaltige oligo- und/oder polymere sowie deren verwendung | |
| DE1720614A1 (de) | Verfahren zur Herstellung von Acrylnitrilpolymerisaten | |
| DE2434550A1 (de) | Verwendung von so-haltigen monomeren und polymeren als resorptionsvermittler | |
| CA1142294A (en) | Vinyl ethers, process for their preparation and their use for the preparation of polymers | |
| DE69010784T2 (de) | Diallyloxyessigsäure und ihre basische Additionssalze, ihre Herstellungsverfahren und Verwendung als Retikularmittel. | |
| DE912504C (de) | Verfahren zur Herstellung von Polymerisaten oder Mischpolymerisaten | |
| CH645652A5 (de) | Verfahren zur herstellung von copolymeren aus hydantoinvinylaethern und olefinisch ungesaettigten monomeren. | |
| AT234380B (de) | Verfahren zur Herstellung neuer wasserlöslicher Copolymerisate | |
| DE1795676C3 (de) | Verfahren zur Herstellung von wasserlöslichen Interpolymeren | |
| DE2112549A1 (de) | Wasserloesliche Tetrapolymere und Verfahren zu deren Herstellung | |
| DE2118225C3 (de) | Verfahren zur Herstellung von phosphorhaltigen Acrylverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |