PH14292A - Hydantoin derivative of vinyl ether and methylene bis-hydantoin derivative of vinyl ether - Google Patents
Hydantoin derivative of vinyl ether and methylene bis-hydantoin derivative of vinyl etherInfo
- Publication number
- PH14292A PH14292A PH21341A PH21341A PH14292A PH 14292 A PH14292 A PH 14292A PH 21341 A PH21341 A PH 21341A PH 21341 A PH21341 A PH 21341A PH 14292 A PH14292 A PH 14292A
- Authority
- PH
- Philippines
- Prior art keywords
- vinyl ether
- hydantoin derivative
- methylene bis
- hydantoin
- derivative
- Prior art date
Links
- AYSTZJJCRLLTAL-UHFFFAOYSA-N 1-[(2,4-dioxoimidazolidin-1-yl)methyl]imidazolidine-2,4-dione Chemical class O=C1NC(=O)CN1CN1C(=O)NC(=O)C1 AYSTZJJCRLLTAL-UHFFFAOYSA-N 0.000 title 1
- 150000001469 hydantoins Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Epoxy Resins (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH843377A CH633779A5 (de) | 1977-07-07 | 1977-07-07 | Verfahren zur herstellung neuer vinylaether und deren verwendung zur herstellung von polymeren. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH14292A true PH14292A (en) | 1981-05-04 |
Family
ID=4340268
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH21341A PH14292A (en) | 1977-07-07 | 1978-07-07 | Hydantoin derivative of vinyl ether and methylene bis-hydantoin derivative of vinyl ether |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US4206309A (cg-RX-API-DMAC10.html) |
| JP (2) | JPS5416473A (cg-RX-API-DMAC10.html) |
| AU (1) | AU3782278A (cg-RX-API-DMAC10.html) |
| BE (1) | BE868782A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7804374A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1115711A (cg-RX-API-DMAC10.html) |
| CH (1) | CH633779A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2829307A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES471528A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2396753A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2000774B (cg-RX-API-DMAC10.html) |
| LU (1) | LU79925A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7807290A (cg-RX-API-DMAC10.html) |
| NZ (1) | NZ187788A (cg-RX-API-DMAC10.html) |
| PH (1) | PH14292A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA783881B (cg-RX-API-DMAC10.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH645652A5 (de) * | 1981-02-19 | 1984-10-15 | Ciba Geigy Ag | Verfahren zur herstellung von copolymeren aus hydantoinvinylaethern und olefinisch ungesaettigten monomeren. |
| US4486494A (en) * | 1982-12-08 | 1984-12-04 | Ciba-Geigy Corporation | Fibre composite prepregs coated with two different resins |
| US5663053A (en) * | 1992-02-11 | 1997-09-02 | Smithkline Beecham Corporation | Inhibition of inflammatory lipid mediators |
| PT626969E (pt) * | 1992-02-11 | 2000-11-30 | Smithkline Beecham Corp | Inibidores de co.a-it e de p.a.f. |
| BRPI0614146A2 (pt) * | 2005-07-26 | 2011-03-09 | Rhodia | monÈmero, polìmero e composição de cuidados pessoais |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2466177A (en) * | 1949-04-05 | Hydantoins and method fob obtaining | ||
| US3087853A (en) * | 1956-07-02 | 1963-04-30 | Gen Aniline & Film Corp | Water soluble compositions consisting essentially of iodine and a water soluble oxygen containing polymer |
| GB846601A (en) * | 1958-01-13 | 1960-08-31 | British Oxygen Res And Dev Ltd | Vinyl hydantoins |
| US3197477A (en) * | 1961-05-01 | 1965-07-27 | Sterling Drug Inc | Allylhydantoins |
| US3161538A (en) * | 1962-06-15 | 1964-12-15 | Gen Aniline & Film Corp | Method of treating textile materials |
| CH471811A (de) * | 1966-06-23 | 1969-04-30 | Ciba Geigy | Verfahren zur Herstellung von wasserlöslichen N,N'-Diglycidyl-Verbindungen |
| CH523279A (de) * | 1968-11-11 | 1972-05-31 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Diglycidylverbindungen von N-heterocyclischen Verbindungen und deren Verwendung |
| FR2032943A5 (cg-RX-API-DMAC10.html) * | 1969-02-21 | 1970-11-27 | Bayer Ag | |
| FR2148868A6 (cg-RX-API-DMAC10.html) * | 1970-10-06 | 1973-03-23 | Rhone Poulenc Sa | |
| FR2128140B1 (cg-RX-API-DMAC10.html) * | 1971-03-05 | 1976-04-16 | Alsthom Cgee | |
| US3852302A (en) * | 1971-04-16 | 1974-12-03 | Ciba Geigy Corp | Diacrylic acid ester derivatives of hydantoin compounds |
| US4024146A (en) * | 1971-04-16 | 1977-05-17 | Ciba-Geigy Corporation | Diacrylic acid ester derivatives of uracil compounds |
| CH574955A5 (cg-RX-API-DMAC10.html) * | 1972-07-12 | 1976-04-30 | Ciba Geigy Ag | |
| CH570379A5 (cg-RX-API-DMAC10.html) * | 1972-07-12 | 1975-12-15 | Ciba Geigy Ag | |
| DE2437916A1 (de) * | 1974-08-07 | 1976-02-19 | Bayer Ag | Homopolymerisate aus 3-alkylidenhydantoinen |
| DE2437917A1 (de) * | 1974-08-07 | 1976-02-19 | Bayer Ag | Copolymerisate auf acrylnitrilallylhydantoinbasis |
| US4092479A (en) * | 1976-04-05 | 1978-05-30 | Baxter Travenol Laboratories, Inc. | Labeled 5,5-diphenylhydantoin derivatives for radioimmunoassay |
| US4082635A (en) * | 1976-08-02 | 1978-04-04 | Ciba-Geigy Corporation | Ultraviolet light-curable diacrylate hydantoin adhesive compositions |
| US4091223A (en) * | 1976-08-04 | 1978-05-23 | Ciba-Geigy Corporation | Unsaturated hydantoin coagents |
-
1977
- 1977-07-07 CH CH843377A patent/CH633779A5/de not_active IP Right Cessation
-
1978
- 1978-06-29 US US05/920,301 patent/US4206309A/en not_active Expired - Lifetime
- 1978-07-04 DE DE19782829307 patent/DE2829307A1/de active Granted
- 1978-07-05 LU LU79925A patent/LU79925A1/de unknown
- 1978-07-05 NL NL7807290A patent/NL7807290A/xx not_active Application Discontinuation
- 1978-07-06 BR BR7804374A patent/BR7804374A/pt unknown
- 1978-07-06 NZ NZ187788A patent/NZ187788A/xx unknown
- 1978-07-06 AU AU37822/78A patent/AU3782278A/en active Pending
- 1978-07-06 ES ES471528A patent/ES471528A1/es not_active Expired
- 1978-07-06 GB GB7828987A patent/GB2000774B/en not_active Expired
- 1978-07-06 CA CA306,892A patent/CA1115711A/en not_active Expired
- 1978-07-06 ZA ZA00783881A patent/ZA783881B/xx unknown
- 1978-07-06 BE BE189107A patent/BE868782A/xx unknown
- 1978-07-06 FR FR7820179A patent/FR2396753A1/fr active Granted
- 1978-07-07 PH PH21341A patent/PH14292A/en unknown
- 1978-07-07 JP JP8281678A patent/JPS5416473A/ja active Granted
-
1979
- 1979-09-04 US US06/072,493 patent/US4256867A/en not_active Expired - Lifetime
-
1986
- 1986-10-31 JP JP61260573A patent/JPS62174208A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2829307C2 (cg-RX-API-DMAC10.html) | 1988-12-22 |
| LU79925A1 (de) | 1979-04-09 |
| NL7807290A (nl) | 1979-01-09 |
| US4256867A (en) | 1981-03-17 |
| ZA783881B (en) | 1979-07-25 |
| US4206309A (en) | 1980-06-03 |
| DE2829307A1 (de) | 1979-01-25 |
| FR2396753B1 (cg-RX-API-DMAC10.html) | 1981-05-22 |
| GB2000774A (en) | 1979-01-17 |
| BE868782A (fr) | 1979-01-08 |
| JPS5416473A (en) | 1979-02-07 |
| GB2000774B (en) | 1982-02-10 |
| JPS6254805B2 (cg-RX-API-DMAC10.html) | 1987-11-17 |
| NZ187788A (en) | 1981-02-11 |
| ES471528A1 (es) | 1979-10-01 |
| BR7804374A (pt) | 1979-04-03 |
| CH633779A5 (de) | 1982-12-31 |
| JPS6216948B2 (cg-RX-API-DMAC10.html) | 1987-04-15 |
| FR2396753A1 (fr) | 1979-02-02 |
| AU3782278A (en) | 1980-01-10 |
| CA1115711A (en) | 1982-01-05 |
| JPS62174208A (ja) | 1987-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS54145699A (en) | 133halo and 133deoxy derivative of cc076 compound | |
| JPS53112803A (en) | Method of rectfying methanol | |
| ZA781527B (en) | Derivatives of morphine | |
| JPS53137992A (en) | Nnalkyllnnacyl derivative of thienamycine | |
| GB2006211B (en) | Selctive monoethirification of pyrocatechol | |
| JPS5446734A (en) | Manufacture of ppbenzoquinone ketal | |
| JPS54119474A (en) | Oomethylation of hydroxyaporphine | |
| PH14292A (en) | Hydantoin derivative of vinyl ether and methylene bis-hydantoin derivative of vinyl ether | |
| JPS5513293A (en) | Derivative of nntrifluoloacetyllnnphosphono methylglycinate | |
| JPS5441876A (en) | Hydroxyphenylhydantoin and manufacture of its derivative | |
| JPS53148017A (en) | Cross over putting into member of pipe | |
| JPS53130699A (en) | 44deoxyvlbba and b and 33oxidized derivative of related 11formyl compound | |
| JPS5513298A (en) | Imidazolylethoxy derivative of pyrazolopyridine methanol and its manufacture | |
| JPS53121714A (en) | Contactic production of polyhydric alcohol and derivative thereof | |
| GB2005661B (en) | Imidazole compounds methods for their production and converision of said compounds into diazepinol compounds | |
| JPS54119475A (en) | Manufacture of 11hydroxyaporphine derivative | |
| JPS5557585A (en) | Imidazolylethoxy derivative of pyridinee55methanols and quinolinee33methanols and its manufacture | |
| JPS53105468A (en) | Derivative of 22aryll66allylidenecyclohexanol and its preparation | |
| JPS5489901A (en) | Reserching of foundation condition | |
| JPS56158727A (en) | Synthesis of estrone and estrone derivatives | |
| IL56226A0 (en) | N-hydrazides of 2-benzothiazolinone | |
| JPS53141243A (en) | Derivative of cyclohexanetetraol and its preparation | |
| JPS5466681A (en) | Manufacture of 66thiatetracycline derivative | |
| GB1550233A (en) | Extruding of pipes | |
| JPS5416463A (en) | Production of ether of buphadienolide and buphatrienolide |