CH626535A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626535A5 CH626535A5 CH504776A CH504776A CH626535A5 CH 626535 A5 CH626535 A5 CH 626535A5 CH 504776 A CH504776 A CH 504776A CH 504776 A CH504776 A CH 504776A CH 626535 A5 CH626535 A5 CH 626535A5
- Authority
- CH
- Switzerland
- Prior art keywords
- ascorbic acid
- reagent
- acid
- added
- technetium
- Prior art date
Links
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims description 100
- 239000003153 chemical reaction reagent Substances 0.000 claims description 60
- 235000010323 ascorbic acid Nutrition 0.000 claims description 42
- 229960005070 ascorbic acid Drugs 0.000 claims description 42
- 239000011668 ascorbic acid Substances 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 26
- CIWBSHSKHKDKBQ-DUZGATOHSA-N D-isoascorbic acid Chemical compound OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-DUZGATOHSA-N 0.000 claims description 16
- 235000010350 erythorbic acid Nutrition 0.000 claims description 16
- 229940026239 isoascorbic acid Drugs 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 15
- 239000000126 substance Substances 0.000 claims description 15
- 230000000087 stabilizing effect Effects 0.000 claims description 13
- 239000002738 chelating agent Substances 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 10
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 claims description 8
- -1 tin (II) ions Chemical class 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229920000388 Polyphosphate Polymers 0.000 claims description 4
- 239000001205 polyphosphate Substances 0.000 claims description 4
- 235000011176 polyphosphates Nutrition 0.000 claims description 4
- 239000000032 diagnostic agent Substances 0.000 claims description 3
- 229940039227 diagnostic agent Drugs 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- ACTRVOBWPAIOHC-UHFFFAOYSA-N succimer Chemical compound OC(=O)C(S)C(S)C(O)=O ACTRVOBWPAIOHC-UHFFFAOYSA-N 0.000 claims description 3
- JTMBCYAUSCBSEY-UHFFFAOYSA-N 2-methyl-2-sulfanylpropanoic acid Chemical compound CC(C)(S)C(O)=O JTMBCYAUSCBSEY-UHFFFAOYSA-N 0.000 claims description 2
- 102000008100 Human Serum Albumin Human genes 0.000 claims description 2
- 108091006905 Human Serum Albumin Proteins 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- GKLVYJBZJHMRIY-OUBTZVSYSA-N Technetium-99 Chemical compound [99Tc] GKLVYJBZJHMRIY-OUBTZVSYSA-N 0.000 description 18
- 230000000694 effects Effects 0.000 description 18
- 229940056501 technetium 99m Drugs 0.000 description 18
- 238000011534 incubation Methods 0.000 description 15
- 239000013522 chelant Substances 0.000 description 11
- 238000009826 distribution Methods 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 241000700159 Rattus Species 0.000 description 8
- 210000000988 bone and bone Anatomy 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 7
- 210000003734 kidney Anatomy 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 229910052713 technetium Inorganic materials 0.000 description 7
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 7
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 235000011150 stannous chloride Nutrition 0.000 description 6
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 230000002035 prolonged effect Effects 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- 230000009920 chelation Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000004807 localization Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000002559 palpation Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000012217 radiopharmaceutical Substances 0.000 description 1
- 229940121896 radiopharmaceutical Drugs 0.000 description 1
- 230000002799 radiopharmaceutical effect Effects 0.000 description 1
- 210000005000 reproductive tract Anatomy 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- ACTRVOBWPAIOHC-XIXRPRMCSA-N succimer Chemical compound OC(=O)[C@@H](S)[C@@H](S)C(O)=O ACTRVOBWPAIOHC-XIXRPRMCSA-N 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/12—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by a special physical form, e.g. emulsion, microcapsules, liposomes, characterized by a special physical form, e.g. emulsions, dispersions, microcapsules
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2123/00—Preparations for testing in vivo
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Optics & Photonics (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Dispersion Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/573,297 US4364920A (en) | 1975-04-30 | 1975-04-30 | Stable diagnostic reagents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626535A5 true CH626535A5 (enExample) | 1981-11-30 |
Family
ID=24291411
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH504776A CH626535A5 (enExample) | 1975-04-30 | 1976-04-22 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4364920A (enExample) |
| JP (1) | JPS51148038A (enExample) |
| BE (1) | BE841261A (enExample) |
| CA (1) | CA1114291A (enExample) |
| CH (1) | CH626535A5 (enExample) |
| DE (1) | DE2619382A1 (enExample) |
| DK (1) | DK156540C (enExample) |
| FR (1) | FR2309215A1 (enExample) |
| GB (1) | GB1489330A (enExample) |
| NL (1) | NL189336C (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4075314A (en) * | 1976-04-29 | 1978-02-21 | Mallinckrodt, Inc. | Stannous pyrophosphate technetium-99m compositions |
| US4247534A (en) * | 1978-07-31 | 1981-01-27 | The Procter & Gamble Company | Radiographic scanning agent |
| JPS55180577U (enExample) * | 1979-06-15 | 1980-12-25 | ||
| JPS5750928A (en) * | 1980-09-13 | 1982-03-25 | Nippon Mejifuijitsukusu Kk | Diagnostic agent for scanning bone |
| EP0078642B1 (en) * | 1981-10-30 | 1986-12-10 | AMERSHAM INTERNATIONAL plc | Radiopharmaceutical composition based on technetium-99m and reagent for making it |
| JPS5896031A (ja) * | 1981-12-03 | 1983-06-07 | Nippon Mejifuijitsukusu Kk | 放射性診断剤およびその製造用組成物 |
| US4472509A (en) * | 1982-06-07 | 1984-09-18 | Gansow Otto A | Metal chelate conjugated monoclonal antibodies |
| US4454106A (en) * | 1982-06-07 | 1984-06-12 | Gansow Otto A | Use of metal chelate conjugated monoclonal antibodies |
| US4504462A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| EP0096934B1 (en) * | 1982-06-10 | 1986-11-26 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| EP0096931B1 (en) * | 1982-06-10 | 1987-03-25 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| US4504463A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| US4440738A (en) * | 1982-06-10 | 1984-04-03 | Mallinckrodt, Inc. | Stable radiographic imaging agents |
| US4707353A (en) * | 1982-12-08 | 1987-11-17 | Mallinckrodt, Inc. | Radiographic imaging agents |
| EP0111414A3 (en) * | 1982-12-08 | 1985-05-02 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| US4510125A (en) * | 1982-12-08 | 1985-04-09 | Mallinckrodt, Inc. | Process for making lyophilized radiographic imaging kit |
| JPS59199636A (ja) * | 1983-04-26 | 1984-11-12 | Nippon Mejifuijitsukusu Kk | 放射性診断剤 |
| US4574079A (en) * | 1983-05-27 | 1986-03-04 | Gavras Haralambos P | Radiolabeled angiotensin converting enzyme inhibitors for radiolabeling mammalian organ sites |
| US4647445A (en) * | 1984-03-28 | 1987-03-03 | Massachusetts Institute Of Technology | Radiolabelled lipoproteins and method for making same |
| JPS61103841A (ja) * | 1984-10-26 | 1986-05-22 | Nippon Mejifuijitsukusu Kk | 放射性テクネチウム標識に供する安定な塩化第一スズ組成物 |
| US4897255A (en) * | 1985-01-14 | 1990-01-30 | Neorx Corporation | Metal radionuclide labeled proteins for diagnosis and therapy |
| US5393512A (en) * | 1985-01-14 | 1995-02-28 | Vanderheyden; Jean-Luc | Stable therapeutic radionuclide compositions and methods for preparation thereof |
| DE3621570A1 (de) * | 1986-06-27 | 1988-01-07 | Hoechst Ag | Diagnostikum zur szintigraphischen darstellung von boesartigen tumoren |
| US4880615A (en) * | 1988-11-25 | 1989-11-14 | Merck & Co., Inc. | Stabilized radiopharmaceutical compositions |
| EP0493526A4 (en) * | 1989-09-22 | 1992-08-26 | Neorx Corporation | Stable therapeutic radionuclide compositions and methods for preparation thereof |
| US5306482A (en) * | 1991-04-09 | 1994-04-26 | Merck Frosst Canada, Inc. | Radiopharmaceutical bacteriostats |
| WO1993002652A2 (en) * | 1991-08-01 | 1993-02-18 | Hybritech Incorporated | Modified haptens useful as imaging and therapeutic agents |
| DE4332479A1 (de) * | 1993-09-24 | 1995-03-30 | Theodor Prasso | Wasserkraftanlage zur Ausnutzung von Kleingefälle |
| US6027710A (en) * | 1996-09-18 | 2000-02-22 | Nihon Medi-Physiscs Co., Ltd. | Radiation-protecting agent |
| US6231832B1 (en) | 1998-03-23 | 2001-05-15 | Brookhaven Science Associates | Radiopharmaceutical stannic Sn-117m chelate compositions and methods of use |
| WO1999051276A1 (en) * | 1998-04-01 | 1999-10-14 | Australian Nuclear Science & Technology Organisation | Tin-free rhenium(v) complexes and methods for their preparation |
| GB0031592D0 (en) * | 2000-12-28 | 2001-02-07 | Nycomed Amersham Plc | Stabilised radiopharmaceutical compositions |
| EP1503804A4 (en) * | 2002-05-03 | 2009-03-18 | Bracco Imaging Spa | RADIOPHARMACEUTICAL FORMULATIONS |
| EP1444990A1 (en) * | 2003-02-07 | 2004-08-11 | Amersham plc | Improved Radiometal Complex Compositions |
| KR101106533B1 (ko) * | 2003-07-24 | 2012-01-20 | 브라코 이미징 에스.피.에이. | 안정한 방사성의약 조성물 및 제조 방법 |
| GB0718386D0 (en) * | 2007-09-21 | 2007-10-31 | Ge Healthcare As | Improved radiopharmaceutical formulation |
| US20100196272A1 (en) * | 2009-01-30 | 2010-08-05 | Neoprobe Corporation | Compositions for radiolabeling diethylenetriaminepentaacetic acid (dtpa)-dextran |
| FR2967671A1 (fr) * | 2010-11-24 | 2012-05-25 | Pf Medicament | Complexe de technetium 99m en tant qu'outil de diagnostic in vivo des tumeurs cancereuses |
| FR3152498B1 (fr) | 2023-09-01 | 2025-08-01 | Ascendance Flight Tech | Dispositif de contrôle de recharge en vol pour aéronef hybride |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2088149B1 (enExample) * | 1970-05-22 | 1974-05-24 | Philips France | |
| US3740418A (en) * | 1970-07-01 | 1973-06-19 | Squibb & Sons Inc | Radioactive scanning preparation |
| US3725295A (en) * | 1971-07-20 | 1973-04-03 | Atomic Energy Commission | Technetium labeling |
| US3902849A (en) * | 1971-08-19 | 1975-09-02 | Medi Physics Inc | Radioisotope and radiopharmaceutical generators |
| CH566138A5 (en) * | 1972-05-08 | 1975-09-15 | Benes Ivan | Diagnostic solns contg technetium 99 or indium 113 - from solns of low concn |
| HU167378B (enExample) * | 1972-05-08 | 1975-09-27 | ||
| US3735001A (en) * | 1972-05-24 | 1973-05-22 | Atomic Energy Commission | Technetium bone scanning medium |
| ZA743158B (en) * | 1973-05-23 | 1975-05-28 | Procter & Gamble | Radiographic scanning |
-
1975
- 1975-04-30 US US05/573,297 patent/US4364920A/en not_active Expired - Lifetime
-
1976
- 1976-03-31 DK DK156976A patent/DK156540C/da not_active IP Right Cessation
- 1976-04-02 CA CA249,454A patent/CA1114291A/en not_active Expired
- 1976-04-22 CH CH504776A patent/CH626535A5/de not_active IP Right Cessation
- 1976-04-27 NL NLAANVRAGE7604475,A patent/NL189336C/xx not_active IP Right Cessation
- 1976-04-27 JP JP51047342A patent/JPS51148038A/ja active Granted
- 1976-04-28 FR FR7612560A patent/FR2309215A1/fr active Granted
- 1976-04-29 GB GB17496/76A patent/GB1489330A/en not_active Expired
- 1976-04-29 BE BE166552A patent/BE841261A/xx not_active IP Right Cessation
- 1976-04-30 DE DE19762619382 patent/DE2619382A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS576409B2 (enExample) | 1982-02-04 |
| GB1489330A (en) | 1977-10-19 |
| DE2619382C2 (enExample) | 1988-09-01 |
| NL7604475A (nl) | 1976-11-02 |
| JPS51148038A (en) | 1976-12-18 |
| NL189336B (nl) | 1992-10-16 |
| DK156540B (da) | 1989-09-11 |
| US4364920A (en) | 1982-12-21 |
| FR2309215A1 (fr) | 1976-11-26 |
| FR2309215B1 (enExample) | 1979-09-28 |
| NL189336C (nl) | 1993-03-16 |
| DK156976A (da) | 1976-10-31 |
| BE841261A (fr) | 1976-10-29 |
| DE2619382A1 (de) | 1976-11-11 |
| CA1114291A (en) | 1981-12-15 |
| DK156540C (da) | 1990-02-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH626535A5 (enExample) | ||
| DE2543350C2 (de) | Präparate zur Herstellung von ↑9↑↑9↑↑m↑ Technetium-Radiodiagnostika | |
| DE2538388A1 (de) | Verfahren zur herstellung eines stabilen, nicht-radioaktiven traegermaterials und seine verwendung zur herstellung von tc-99m-markierten diagnosemitteln | |
| DE2543349A1 (de) | Praeparate zur herstellung von hoch 99m technetium-radiodiagnostika | |
| DE3237573A1 (de) | Technetium-99m-tri- und tetraphosphonate zur szintigraphischen dastellung res-haltiger organe und der lymphgefaesse und verfahren zu deren herstellung | |
| DE2723605C2 (de) | Radioaktive Technetiumkomplexe, Verfahren zu deren Herstellung und deren Verwendung zur szintigraphischen Darstellung des hepatobilären Systems | |
| DE2737932A1 (de) | Mittel zur herstellung einer radiodiagnostischen loesung | |
| DE2423167C2 (de) | Radiodiagnostikum, Verfahren zu dessen Herstellung und dessen Verwendung als intravenöse Injektionslösung | |
| DE69718406T2 (de) | Strahlungsschutzmittel geignet zur Verwendung mit Radiopharmazeutika enthaltend reduzierbare aktive Inhaltsstoffe | |
| DE2710728C2 (de) | Reagens für die radiologische Abtastung von Organen, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE2456693A1 (de) | Verfahren zum stabilisieren von calcium-hydrogenphosphat-anhydrid gegen die umsetzung mit fluorionen | |
| EP0141100B1 (de) | N-(4-Aminobenzoyl)-aminodicarbonsäuren zur Stabilisierung von Technetium-99m-Präparaten, stabilisierte Injektionspräparate und Verfahren zu ihrer Herstellung | |
| DE69414865T2 (de) | Calcium-fluoride-komplex aufweisende mundspuelungen, zahnpasten, sowie kautabletten | |
| DE2424496C3 (de) | Zusammensetzung zur Herstellung eines Mittels zur scintigraphischen Knochenabtastung | |
| DE2838753A1 (de) | Verfahren und ampulle zur herstellung von radiopharmazeutika | |
| DE1932231A1 (de) | Diagnostisches und therapeutisches Praeparat auf der Basis eines chelatgebundenen Radio-Nuclids | |
| DE2800538A1 (de) | Technetium-99m-markiertes diagnostikum zur untersuchung des res | |
| DE2602981A1 (de) | Mittel zur dentalen prophylaxe | |
| DE3221579A1 (de) | Solubilisierung von in wasser schwerloeslichen wirkstoffen in waessrige loesung unter verwendung eines gemisches von cholinphosphorsaeureglycerindiester (cholin-lecithin) und natriumdesoxycholat als loesungsvermittler und die therapeutische verwendung der so erhaltenen waessrigen loesungen | |
| DE2755874A1 (de) | Zinnhaltige markierungsbestecke, verfahren zu ihrer herstellung und praeparate zur skelettdarstellung | |
| DE2920909C2 (de) | Dentalpräparat zur Verhütung und Hemmung der Zahnkaries | |
| EP0335296B1 (de) | Tc-99m-w-Alkylphosphinico-1-hydroxyalkan-1,1-diphosphonate enthaltende Präparate zur Knochenszintigraphie sowie Verfahren zur Herstellung dieser Präparate | |
| AT255655B (de) | Verfahren zur Herstellung eines Zahnpflegemittels | |
| DE2654298A1 (de) | Stabiles, nicht-radioaktives traegermaterial, verfahren zu seiner herstellung und dieses traegermaterial enthaltende mittel | |
| CH481649A (de) | Zahnsteinlösendes Zahnputzmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: F. HOFFMANN-LA ROCHE AG |
|
| PUE | Assignment |
Owner name: AMERSHAM INTERNATIONAL PLC |
|
| PL | Patent ceased |