CH620916A5 - - Google Patents
Download PDFInfo
- Publication number
- CH620916A5 CH620916A5 CH355676A CH355676A CH620916A5 CH 620916 A5 CH620916 A5 CH 620916A5 CH 355676 A CH355676 A CH 355676A CH 355676 A CH355676 A CH 355676A CH 620916 A5 CH620916 A5 CH 620916A5
- Authority
- CH
- Switzerland
- Prior art keywords
- carbon atoms
- fluorine
- alkyl
- hydrogen
- radical
- Prior art date
Links
- -1 bicyclic lactone ketone Chemical class 0.000 claims description 104
- 125000004432 carbon atom Chemical group C* 0.000 claims description 56
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 35
- 150000001875 compounds Chemical class 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 31
- 229910052731 fluorine Inorganic materials 0.000 claims description 29
- 239000011737 fluorine Substances 0.000 claims description 29
- 150000003254 radicals Chemical class 0.000 claims description 27
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000001153 fluoro group Chemical group F* 0.000 claims description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 6
- 241000251730 Chondrichthyes Species 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- 235000019253 formic acid Nutrition 0.000 claims description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 125000002619 bicyclic group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229940037201 oris Drugs 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 31
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 150000003180 prostaglandins Chemical class 0.000 description 18
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 11
- PXGPLTODNUVGFL-BRIYLRKRSA-N (E,Z)-(1R,2R,3R,5S)-7-(3,5-Dihydroxy-2-((3S)-(3-hydroxy-1-octenyl))cyclopentyl)-5-heptenoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC=CCCCC(O)=O PXGPLTODNUVGFL-BRIYLRKRSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 150000001299 aldehydes Chemical class 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 8
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 5
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- FANCTJAFZSYTIS-IQUVVAJASA-N (1r,3s,5z)-5-[(2e)-2-[(1r,3as,7ar)-7a-methyl-1-[(2r)-4-(phenylsulfonimidoyl)butan-2-yl]-2,3,3a,5,6,7-hexahydro-1h-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol Chemical compound C([C@@H](C)[C@@H]1[C@]2(CCCC(/[C@@H]2CC1)=C\C=C\1C([C@@H](O)C[C@H](O)C/1)=C)C)CS(=N)(=O)C1=CC=CC=C1 FANCTJAFZSYTIS-IQUVVAJASA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- SDAXRHHPNYTELL-UHFFFAOYSA-N heptanenitrile Chemical compound CCCCCCC#N SDAXRHHPNYTELL-UHFFFAOYSA-N 0.000 description 4
- 238000001819 mass spectrum Methods 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 125000003944 tolyl group Chemical group 0.000 description 4
- HYSCFTVJBTUTBU-UHFFFAOYSA-N 2,2-dibromo-4-phenylbutanenitrile Chemical compound N#CC(Br)(Br)CCC1=CC=CC=C1 HYSCFTVJBTUTBU-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 3
- 229960002986 dinoprostone Drugs 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 3
- CUUVBTPZFVNHIE-UHFFFAOYSA-N 2,2-dibromo-3,3-dimethylheptanenitrile Chemical compound CCCCC(C)(C)C(Br)(Br)C#N CUUVBTPZFVNHIE-UHFFFAOYSA-N 0.000 description 2
- NMDYQMQITBSQBG-UHFFFAOYSA-N 2,2-dibromo-3-phenoxypropanenitrile Chemical compound N#CC(Br)(Br)COC1=CC=CC=C1 NMDYQMQITBSQBG-UHFFFAOYSA-N 0.000 description 2
- CJRJDCNXMVNDRA-UHFFFAOYSA-N 2,2-dibromo-3-phenylpropanenitrile Chemical compound N#CC(Br)(Br)CC1=CC=CC=C1 CJRJDCNXMVNDRA-UHFFFAOYSA-N 0.000 description 2
- HHTHWSPUVHINKU-UHFFFAOYSA-N 2,2-dibromo-4-(4-methoxyphenyl)butanenitrile Chemical compound COC1=CC=C(CCC(Br)(Br)C#N)C=C1 HHTHWSPUVHINKU-UHFFFAOYSA-N 0.000 description 2
- AAKAUBPKRRQJLY-UHFFFAOYSA-N 2,2-dibromoheptanenitrile Chemical compound CCCCCC(Br)(Br)C#N AAKAUBPKRRQJLY-UHFFFAOYSA-N 0.000 description 2
- DIOWAFCEDSDXFK-UHFFFAOYSA-N 2,2-dichloro-4-(4-chlorophenyl)butanenitrile Chemical compound ClC1=CC=C(CCC(Cl)(Cl)C#N)C=C1 DIOWAFCEDSDXFK-UHFFFAOYSA-N 0.000 description 2
- NRKHTFXKSSSXMO-UHFFFAOYSA-N 2,2-diiodo-3-methylhexanenitrile Chemical compound CCCC(C)C(I)(I)C#N NRKHTFXKSSSXMO-UHFFFAOYSA-N 0.000 description 2
- VWEBGASMCTUFSV-UHFFFAOYSA-N 4-(2-fluorophenyl)-2,2-diiodobutanenitrile Chemical compound FC1=CC=CC=C1CCC(I)(I)C#N VWEBGASMCTUFSV-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229940001593 sodium carbonate Drugs 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- NDFKTBCGKNOHPJ-AATRIKPKSA-N (E)-hept-2-enal Chemical compound CCCC\C=C\C=O NDFKTBCGKNOHPJ-AATRIKPKSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- KHDXQHPMIMVRCA-UHFFFAOYSA-N 2,2-dibromo-4-phenylbutanal Chemical compound O=CC(Br)(Br)CCC1=CC=CC=C1 KHDXQHPMIMVRCA-UHFFFAOYSA-N 0.000 description 1
- JJKBHDGXUZAWOI-UHFFFAOYSA-N 2,2-dibromohexanenitrile Chemical compound CCCCC(Br)(Br)C#N JJKBHDGXUZAWOI-UHFFFAOYSA-N 0.000 description 1
- VLAMLFKVAQZVEQ-UHFFFAOYSA-N 2,2-dichlorooctanenitrile Chemical compound CCCCCCC(Cl)(Cl)C#N VLAMLFKVAQZVEQ-UHFFFAOYSA-N 0.000 description 1
- 125000005810 2,5-xylyl group Chemical group [H]C1=C([H])C(=C(*)C([H])=C1C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CVFWJHHOKQSYSU-UHFFFAOYSA-N 3,3-dimethylheptanenitrile Chemical compound CCCCC(C)(C)CC#N CVFWJHHOKQSYSU-UHFFFAOYSA-N 0.000 description 1
- SXXLKZCNJHJYFL-UHFFFAOYSA-N 4,5,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridin-5-ium-3-olate Chemical compound C1CNCC2=C1ONC2=O SXXLKZCNJHJYFL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- 101000799461 Homo sapiens Thrombopoietin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 102100034195 Thrombopoietin Human genes 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- NDFKTBCGKNOHPJ-UHFFFAOYSA-N hex-2-enal Natural products CCCCC=CC=O NDFKTBCGKNOHPJ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 235000015277 pork Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002997 prostaglandinlike Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- 210000000582 semen Anatomy 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/566,356 US3974146A (en) | 1975-04-09 | 1975-04-09 | Cyanolpoxy intermediates for prostaglandins and process for preparing same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH620916A5 true CH620916A5 (cs) | 1980-12-31 |
Family
ID=24262537
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH355676A CH620916A5 (cs) | 1975-04-09 | 1976-03-22 | |
| CH1089879A CH621119A5 (cs) | 1975-04-09 | 1979-12-07 | |
| CH1089779A CH623047A5 (cs) | 1975-04-09 | 1979-12-07 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1089879A CH621119A5 (cs) | 1975-04-09 | 1979-12-07 | |
| CH1089779A CH623047A5 (cs) | 1975-04-09 | 1979-12-07 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3974146A (cs) |
| JP (3) | JPS6024104B2 (cs) |
| BE (1) | BE840597A (cs) |
| CA (1) | CA1075251A (cs) |
| CH (3) | CH620916A5 (cs) |
| DE (1) | DE2613701A1 (cs) |
| DK (1) | DK165376A (cs) |
| FR (2) | FR2319638A1 (cs) |
| GB (2) | GB1523213A (cs) |
| HU (1) | HU173022B (cs) |
| MX (1) | MX3431E (cs) |
| NL (1) | NL7603695A (cs) |
| PL (1) | PL103085B1 (cs) |
| SE (2) | SE424867B (cs) |
| ZA (1) | ZA761534B (cs) |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2070990A (en) * | 1934-06-25 | 1937-02-16 | Shell Dev | Treatment of halogenated polyhydric alcohols |
| US2772295A (en) * | 1953-02-02 | 1956-11-27 | Eastman Kodak Co | Process of manufacturing esters of 3-substituted 2-furoic acids |
| US3426046A (en) * | 1965-10-22 | 1969-02-04 | Dow Chemical Co | Synthesis of epoxides from allylic sulfonium salts |
| US3711515A (en) * | 1970-11-27 | 1973-01-16 | Upjohn Co | Tricyclic lactone alkene or alkenyne |
| US3864387A (en) * | 1973-05-21 | 1975-02-04 | Upjohn Co | 5-Oxa phenyl-and phenoxy-substituted prostaglandin F{HD 1{301 {0 {B analogs |
-
1975
- 1975-04-09 US US05/566,356 patent/US3974146A/en not_active Expired - Lifetime
-
1976
- 1976-01-12 ZA ZA761534A patent/ZA761534B/xx unknown
- 1976-02-25 SE SE7602350A patent/SE424867B/xx not_active IP Right Cessation
- 1976-03-05 CA CA247,284A patent/CA1075251A/en not_active Expired
- 1976-03-08 MX MX000049U patent/MX3431E/es unknown
- 1976-03-10 GB GB40438/77A patent/GB1523213A/en not_active Expired
- 1976-03-10 GB GB9506/76A patent/GB1523212A/en not_active Expired
- 1976-03-22 CH CH355676A patent/CH620916A5/de not_active IP Right Cessation
- 1976-03-31 DE DE19762613701 patent/DE2613701A1/de active Granted
- 1976-04-02 JP JP51036151A patent/JPS6024104B2/ja not_active Expired
- 1976-04-07 HU HU76UO00000118A patent/HU173022B/hu not_active IP Right Cessation
- 1976-04-08 DK DK165376A patent/DK165376A/da not_active IP Right Cessation
- 1976-04-08 NL NL7603695A patent/NL7603695A/xx not_active Application Discontinuation
- 1976-04-08 PL PL1976188594A patent/PL103085B1/pl unknown
- 1976-04-08 FR FR7610324A patent/FR2319638A1/fr active Granted
- 1976-04-09 BE BE166026A patent/BE840597A/xx not_active IP Right Cessation
- 1976-11-26 FR FR7635645A patent/FR2319639A1/fr active Granted
-
1979
- 1979-06-13 SE SE7905211A patent/SE435508B/sv not_active IP Right Cessation
- 1979-12-07 CH CH1089879A patent/CH621119A5/de not_active IP Right Cessation
- 1979-12-07 CH CH1089779A patent/CH623047A5/de not_active IP Right Cessation
-
1983
- 1983-12-20 JP JP58239039A patent/JPS6021992B2/ja not_active Expired
- 1983-12-20 JP JP58239040A patent/JPS6036435B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59186971A (ja) | 1984-10-23 |
| MX3431E (es) | 1980-11-24 |
| FR2319639B1 (cs) | 1980-03-07 |
| CA1075251A (en) | 1980-04-08 |
| JPS6036435B2 (ja) | 1985-08-20 |
| DE2613701A1 (de) | 1976-10-21 |
| FR2319638B1 (cs) | 1980-04-30 |
| SE424867B (sv) | 1982-08-16 |
| NL7603695A (nl) | 1976-10-12 |
| HU173022B (hu) | 1979-01-28 |
| DK165376A (da) | 1976-10-10 |
| SE7905211L (sv) | 1979-06-13 |
| CH621119A5 (cs) | 1981-01-15 |
| JPS59186978A (ja) | 1984-10-23 |
| CH623047A5 (cs) | 1981-05-15 |
| GB1523212A (en) | 1978-08-31 |
| GB1523213A (en) | 1978-08-31 |
| PL103085B1 (pl) | 1979-05-31 |
| FR2319639A1 (fr) | 1977-02-25 |
| SE7602350L (sv) | 1976-10-10 |
| JPS51122059A (en) | 1976-10-25 |
| AU1195476A (en) | 1977-09-15 |
| ZA761534B (en) | 1977-03-30 |
| JPS6024104B2 (ja) | 1985-06-11 |
| SE435508B (sv) | 1984-10-01 |
| DE2613701C2 (cs) | 1988-01-21 |
| US3974146A (en) | 1976-08-10 |
| BE840597A (fr) | 1976-10-11 |
| FR2319638A1 (fr) | 1977-02-25 |
| JPS6021992B2 (ja) | 1985-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2900352C2 (de) | Carbacyclinderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2726064C2 (de) | Verfahren zur Herstellung von 2-Phenyl-äthanol-Derivaten | |
| EP0004621A2 (de) | Verfahren zur mehrstufigen Synthese von Zeaxanthin und Alloxanthin über Cyclohexanon- und Cyclohexanolderivate; Cyclohexanon- und Cyclohexanolderivate | |
| AT367747B (de) | Verfahren zur herstellung von optisch aktiven oder racemischen prostaglandinen und ihren salzen | |
| DE2539116C2 (de) | ω-Nor-cycloalkyl-13,14-dehydro-prostaglandine, Verfahren zu ihrer Herstellung sowie sie enthaltende pharmazeutische Mittel | |
| DE2610503C2 (de) | Optisch aktive 13,14-Dehydro-11- desoxy-prostaglandine, Verfahren zu ihrer Herstellung und sie enthaltendes pharmazeutisches Mittel | |
| CH623570A5 (cs) | ||
| CH643838A5 (de) | 15-epi-prostacyclinderivate, verfahren zu ihrer herstellung und pharmazeutische praeparate. | |
| EP0112502B1 (de) | Omega,omega-Diacyloxy-2,6-dimethyl-octatriensäureester und -aldehyde, Verfahren zu ihrer Herstellung und Verwendung zur Synthese von Terpenverbindungen | |
| CH620916A5 (cs) | ||
| EP0008077B1 (de) | Neue Prostaglandinderivate in der Delta-2-PGF2 und Delta-2-PGE2-Reihe, Verfahren zu deren Herstellung und ihre Verwendung als Arzneimittel | |
| DE2519321A1 (de) | Verfahren zur herstellung von cyclopent-2-en-1-on-derivaten | |
| DE2359955A1 (de) | Neue sulfide | |
| DE2166797C2 (de) | Optisch aktive tricyclische Lactonaldehyde und Verfahren zu deren Herstellung | |
| EP0069880B1 (de) | Cyclopentanonderivate und Verfahren zu deren Isomerisierung | |
| CH617424A5 (cs) | ||
| DE2613306C2 (cs) | ||
| DE2807786C2 (cs) | ||
| CH621773A5 (en) | Process for the preparation of novel 9-oxo-15zeta-hydroxy-20-alkylideneprost-13(trans)enoic acid derivatives | |
| CH620454A5 (cs) | ||
| CH619922A5 (en) | Process for the preparation of intermediates for the preparation of prostaglandin analogues | |
| DD209617A5 (de) | Verfahren zur herstellung von optisch aktivem 1-(6-methoxy-2-naphthyl)-2-(alkoxycarbonyl)-amino-propanon sowie von dessen derivaten und halogenanalogen | |
| DE3712586C2 (cs) | ||
| AT381938B (de) | Verfahren zur herstellung von neuen spirobenzofuranonverbindungen | |
| CH500964A (de) | Verfahren zur Herstellung von 2,3-Dihydro-2,2,4-trimethyl-7-benzofuranol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |