CH619952A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619952A5 CH619952A5 CH1207875A CH1207875A CH619952A5 CH 619952 A5 CH619952 A5 CH 619952A5 CH 1207875 A CH1207875 A CH 1207875A CH 1207875 A CH1207875 A CH 1207875A CH 619952 A5 CH619952 A5 CH 619952A5
- Authority
- CH
- Switzerland
- Prior art keywords
- general formula
- acid
- compounds
- indolo
- methanol
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 13
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000007858 starting material Substances 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- 230000003287 optical effect Effects 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 6
- 239000002585 base Substances 0.000 claims description 6
- 235000019253 formic acid Nutrition 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims description 5
- 239000007868 Raney catalyst Substances 0.000 claims description 4
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229910052987 metal hydride Inorganic materials 0.000 claims description 4
- 150000004681 metal hydrides Chemical class 0.000 claims description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 81
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical group O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 230000017531 blood circulation Effects 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 7
- -1 alkaline earth metal sulfates Chemical class 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000004093 cyano group Chemical group *C#N 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 239000012300 argon atmosphere Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 5
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 210000004556 brain Anatomy 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- DBVVQINTNHWWGH-UHFFFAOYSA-N indolo[3,2-a]quinolizine Chemical class C1=CC=CC2=C3C4=CC=CC=C4N=C3C=CN21 DBVVQINTNHWWGH-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- FCGGDEKTUUSBPS-UHFFFAOYSA-M quinolizin-5-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.C1=CC=CC2=CC=CC=[N+]21 FCGGDEKTUUSBPS-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- NMDQVCDFLXXRTG-UHFFFAOYSA-N 1,2,3,4,6,7,8,12c-octahydroindolo[3,2-a]quinolizine Chemical class N1C2=CC=CC=C2C2=C1CCN1CCCCC12 NMDQVCDFLXXRTG-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 description 2
- OURDZMSSMGUMKR-UHFFFAOYSA-N 1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine Chemical compound C1=CC=C2C(CCN3CCCCC33)=C3NC2=C1 OURDZMSSMGUMKR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- DIQLGHMNRJRQPF-UHFFFAOYSA-N 4,5-dihydroquinolizin-5-ium perchlorate Chemical compound Cl(=O)(=O)(=O)O.C=1C=CCN2C=CC=CC12 DIQLGHMNRJRQPF-UHFFFAOYSA-N 0.000 description 1
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 description 1
- KPZABMIIFOQPON-UHFFFAOYSA-M 6H-indolo[2,3-a]quinolizin-5-ium perchlorate Chemical compound Cl(=O)(=O)(=O)[O-].C1=CC=C[N+]=2CC=C3C(C12)=NC1=CC=CC=C13 KPZABMIIFOQPON-UHFFFAOYSA-M 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DDNCQMVWWZOMLN-IRLDBZIGSA-N Vinpocetine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C=C(C(=O)OCC)N5C2=C1 DDNCQMVWWZOMLN-IRLDBZIGSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010719 annulation reaction Methods 0.000 description 1
- 235000019568 aromas Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229910002056 binary alloy Inorganic materials 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000008344 brain blood flow Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 210000004004 carotid artery internal Anatomy 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- OJYGBLRPYBAHRT-IPQSZEQASA-N chloralose Chemical compound O1[C@H](C(Cl)(Cl)Cl)O[C@@H]2[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]21 OJYGBLRPYBAHRT-IPQSZEQASA-N 0.000 description 1
- 229950009941 chloralose Drugs 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000004087 circulation Effects 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- JRTYPQGPARWINR-UHFFFAOYSA-N palladium platinum Chemical compound [Pd].[Pt] JRTYPQGPARWINR-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 229960002726 vincamine Drugs 0.000 description 1
- 229960000744 vinpocetine Drugs 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/733,821 US4258811A (en) | 1975-09-16 | 1976-10-19 | Electric mass and force measuring apparatus |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI545A HU169916B (cg-RX-API-DMAC7.html) | 1974-09-27 | 1974-09-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619952A5 true CH619952A5 (cg-RX-API-DMAC7.html) | 1980-10-31 |
Family
ID=11000956
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1207875A CH619952A5 (cg-RX-API-DMAC7.html) | 1974-09-27 | 1975-09-16 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4057551A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5159898A (cg-RX-API-DMAC7.html) |
| AT (1) | AT345995B (cg-RX-API-DMAC7.html) |
| BE (1) | BE833897A (cg-RX-API-DMAC7.html) |
| BG (1) | BG31503A3 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1067495A (cg-RX-API-DMAC7.html) |
| CH (1) | CH619952A5 (cg-RX-API-DMAC7.html) |
| CS (1) | CS226159B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD121942A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2541484C3 (cg-RX-API-DMAC7.html) |
| DK (1) | DK139431B (cg-RX-API-DMAC7.html) |
| FR (1) | FR2285877A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1519050A (cg-RX-API-DMAC7.html) |
| HU (1) | HU169916B (cg-RX-API-DMAC7.html) |
| IL (1) | IL48028A (cg-RX-API-DMAC7.html) |
| NL (1) | NL186383C (cg-RX-API-DMAC7.html) |
| PL (1) | PL100319B1 (cg-RX-API-DMAC7.html) |
| SE (1) | SE421208B (cg-RX-API-DMAC7.html) |
| SU (1) | SU545260A3 (cg-RX-API-DMAC7.html) |
| YU (1) | YU40972B (cg-RX-API-DMAC7.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU499923B2 (en) * | 1975-06-27 | 1979-05-03 | Richter Gedeon Vegyeszeti Gyar N | Indoloquinolizine derivatives & their production |
| HU174502B (hu) | 1976-12-30 | 1980-01-28 | Richter Gedeon Vegyeszet | Sposob poluchenija novykh proizvodnykh oktagidro-indolo/2,3-a/-khinolizina |
| ZA786426B (en) * | 1977-11-25 | 1979-10-31 | Scras | New indulo(2,3-a)quinolizidines,preparation and therapeutic use |
| HU178700B (en) * | 1978-02-10 | 1982-06-28 | Richter Gedeon Vegyeszet | Process for preparing 1,1-disubstituted octahydro-indolo/2,3-a/-quinolizines |
| US4353911A (en) * | 1979-07-20 | 1982-10-12 | Andre Buzas | Indolo(2,3-a)quinolizidines, useful in increasing femoral and vertebral blood flow |
| US5218119A (en) * | 1989-06-21 | 1993-06-08 | Richter Gedeon Vegyeszeti Gyar Rt. | Process for preparing the octahydro-indolo[2,3-a] quinolizine diester derivatives |
| CN107417595B (zh) * | 2017-03-27 | 2020-07-24 | 四川大学 | 一种基于自由基串联反应的系列单萜吲哚生物碱骨架及天然产物的合成方法 |
| JP7491514B2 (ja) | 2018-03-31 | 2024-05-28 | モレキュラー インターナショナル リサーチ, インコーポレーテッド | 予防及び治療に有効な選択的抗がん剤 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3478051A (en) * | 1967-03-17 | 1969-11-11 | Sandoz Ag | Azecino- and azonino(5,4-b)indoles |
| US3536725A (en) * | 1967-11-22 | 1970-10-27 | Miles Lab | Cyanoethylated derivatives of 2,3,4,6,7,12-hexahydroindolo(2,3-alpha)-quinolizine |
| FR2108947B1 (cg-RX-API-DMAC7.html) * | 1970-10-22 | 1974-02-01 | Men Jean Le |
-
1974
- 1974-09-27 HU HURI545A patent/HU169916B/hu not_active IP Right Cessation
-
1975
- 1975-08-28 CA CA234,413A patent/CA1067495A/en not_active Expired
- 1975-09-02 IL IL48028A patent/IL48028A/xx unknown
- 1975-09-16 CH CH1207875A patent/CH619952A5/de not_active IP Right Cessation
- 1975-09-17 DE DE2541484A patent/DE2541484C3/de not_active Expired
- 1975-09-17 US US05/614,240 patent/US4057551A/en not_active Expired - Lifetime
- 1975-09-17 AT AT711375A patent/AT345995B/de not_active IP Right Cessation
- 1975-09-23 CS CS756411A patent/CS226159B2/cs unknown
- 1975-09-23 FR FR7529072A patent/FR2285877A1/fr active Granted
- 1975-09-24 NL NLAANVRAGE7511240,A patent/NL186383C/xx not_active IP Right Cessation
- 1975-09-25 SE SE7510785A patent/SE421208B/xx not_active IP Right Cessation
- 1975-09-25 BG BG031072A patent/BG31503A3/xx unknown
- 1975-09-25 DD DD188549A patent/DD121942A5/xx unknown
- 1975-09-25 YU YU2411/75A patent/YU40972B/xx unknown
- 1975-09-26 PL PL1975183605A patent/PL100319B1/pl unknown
- 1975-09-26 DK DK433275AA patent/DK139431B/da not_active IP Right Cessation
- 1975-09-26 GB GB39507/75A patent/GB1519050A/en not_active Expired
- 1975-09-26 BE BE160441A patent/BE833897A/xx not_active IP Right Cessation
- 1975-09-26 JP JP50117085A patent/JPS5159898A/ja active Pending
- 1975-09-26 SU SU2175647A patent/SU545260A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2285877B1 (cg-RX-API-DMAC7.html) | 1979-09-14 |
| YU40972B (en) | 1986-10-31 |
| BG31503A3 (en) | 1982-01-15 |
| DE2541484B2 (de) | 1981-06-04 |
| GB1519050A (en) | 1978-07-26 |
| ATA711375A (de) | 1978-02-15 |
| CS226159B2 (en) | 1984-03-19 |
| SE421208B (sv) | 1981-12-07 |
| US4057551A (en) | 1977-11-08 |
| CA1067495A (en) | 1979-12-04 |
| JPS5159898A (cg-RX-API-DMAC7.html) | 1976-05-25 |
| NL186383B (nl) | 1990-06-18 |
| IL48028A0 (en) | 1975-11-25 |
| YU241175A (en) | 1982-02-28 |
| SE7510785L (sv) | 1976-03-29 |
| NL7511240A (nl) | 1976-03-30 |
| DD121942A5 (cg-RX-API-DMAC7.html) | 1976-09-05 |
| SU545260A3 (ru) | 1977-01-30 |
| AT345995B (de) | 1978-10-10 |
| NL186383C (nl) | 1990-11-16 |
| PL100319B1 (pl) | 1978-09-30 |
| HU169916B (cg-RX-API-DMAC7.html) | 1977-02-28 |
| FR2285877A1 (fr) | 1976-04-23 |
| DE2541484C3 (de) | 1982-04-15 |
| DK433275A (cg-RX-API-DMAC7.html) | 1976-03-28 |
| DK139431C (cg-RX-API-DMAC7.html) | 1979-07-16 |
| DK139431B (da) | 1979-02-19 |
| BE833897A (fr) | 1976-01-16 |
| AU8444575A (en) | 1977-03-10 |
| DE2541484A1 (de) | 1976-04-15 |
| IL48028A (en) | 1978-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2542881C3 (de) | Razemische oder optisch aktive Benzylalkoholderivate, Verfahren zu ihrer Herstellung und sie enthaltende therapeutische Zubereitung | |
| DE2541484C3 (de) | 1α-Alkyl-1 β-(2-cyanäthyl)- 1,2,3,4,6,7,12,12b β-octahydroindolo [2,3-a] chinolizine | |
| DE3020695C2 (cg-RX-API-DMAC7.html) | ||
| EP0155903A1 (de) | Indolophenanthridine, ihre Herstellung und Verwendung | |
| DE2757858C2 (cg-RX-API-DMAC7.html) | ||
| CH624955A5 (cg-RX-API-DMAC7.html) | ||
| DE2539867C2 (de) | 14,15-Dihydro-3β ,16α -eburnameninderivate | |
| DE2551952C3 (de) | 1,1-Disubstituierte Octahydroindolo [2,3-a] chinolizine | |
| DE2520131C3 (de) | 1,1,-Disubstituierte Octahydro-indolo[2,3-a]chinolizine und verfahren zu deren Herstellung | |
| DE2733064C3 (de) | Vincan, seine Säureadditionssalze, solche Verbindungen enthaltende Arzneimittel sowie Verfahren zur Herstellung dieser Verbindungen | |
| DD141927A5 (de) | Verfahren zur herstellung von 1,1-disubstituierten octahydroindolo eckige klammer auf 2,3-a eckige klammer zu chinolizinen | |
| DE2162563C3 (de) | l-(3',4'3'-Trimethoxybenzyl)-6-hydroxy-l,23,4-tetrahydroisochinoun | |
| DE2821226A1 (de) | Neue 5,6-dihydro-imidazo (5,1-a) isochinolin derivate und verfahren zu deren herstellung | |
| EP0180833A1 (de) | 4-Oxo-pyrido[2,3]pyrimidin-Derivate, Verfahren zur deren Herstellung und diese ethaltende Arzneimittel | |
| CH639638A5 (de) | Racemischer oder optisch aktiver alpha-(2,3,4-trimethoxyphenaethylaminomethyl)-2-hydroxybenzylalkohol und pharmazeutisch zulaessige saeureadditionssalze davon. | |
| DE2733056C2 (de) | Vincamenin und seine Säureadditionssalze, solche enthaltende Arzneimittel sowie Verfahren zur Herstellung der genannten Verbindungen | |
| DE2541485C3 (de) | 1-Alkyl-1-(2-cyanäthyl)-1,2,3,4,6,7-hexahydroindolo- [2,3-a] chinolizinderivate | |
| DE2539866C2 (de) | 3,4-Dehydro-14,15-dihydro-eburnameninderivate | |
| AT221087B (de) | Verfahren zur Herstellung neuer, basischer Indol-Derivate | |
| AT379810B (de) | Verfahren zur herstellung von neuen 3,7-diazabicyclo (3,3,1) nonanderivaten, deren stereoisomeren und physiologisch vertraeglichen saeureadditionssalzen | |
| AT214455B (de) | Verfahren zur Herstellung von neuen phosphorhaltigen Indolderivaten | |
| CH670449A5 (cg-RX-API-DMAC7.html) | ||
| DE1695222A1 (de) | Verfahren zur Herstellung von Benzazepinopyridoindolderivaten | |
| CH573437A5 (en) | 9,10-Dihydro-2'-beta-isopropyl-ergopeptin prepn. - by catalytic hydrogenation of 2'-beta-isopropyl-ergopeptin | |
| DE1807323A1 (de) | Hexahydrobenzo[b]chinolizine und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |