CH616150A5 - - Google Patents
Download PDFInfo
- Publication number
- CH616150A5 CH616150A5 CH122476A CH122476A CH616150A5 CH 616150 A5 CH616150 A5 CH 616150A5 CH 122476 A CH122476 A CH 122476A CH 122476 A CH122476 A CH 122476A CH 616150 A5 CH616150 A5 CH 616150A5
- Authority
- CH
- Switzerland
- Prior art keywords
- chlorine
- hydrogen
- fluorine
- formula
- methyl
- Prior art date
Links
- 239000000460 chlorine Substances 0.000 claims description 89
- 229910052801 chlorine Inorganic materials 0.000 claims description 39
- 239000001257 hydrogen Substances 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 38
- 229910052731 fluorine Inorganic materials 0.000 claims description 25
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 24
- 239000011737 fluorine Substances 0.000 claims description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 17
- 150000002431 hydrogen Chemical class 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 239000004480 active ingredient Substances 0.000 claims description 13
- -1 benzoylureido diphenyl ethers Chemical class 0.000 claims description 13
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 230000000749 insecticidal effect Effects 0.000 claims description 6
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical class O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 claims description 5
- 229940054066 benzamide antipsychotics Drugs 0.000 claims description 4
- 150000003936 benzamides Chemical class 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical class C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 60
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000013543 active substance Substances 0.000 description 9
- 150000002170 ethers Chemical class 0.000 description 9
- 239000003995 emulsifying agent Substances 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 241000255925 Diptera Species 0.000 description 7
- 241000238631 Hexapoda Species 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 240000007124 Brassica oleracea Species 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical group CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 2-chlorobenzoyl isocyanate Chemical compound ClC1=CC=CC=C1C(=O)N=C=O ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 0.000 description 4
- 241000238876 Acari Species 0.000 description 4
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 4
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 4
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 4
- 241000254173 Coleoptera Species 0.000 description 4
- 125000002877 alkyl aryl group Chemical group 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- AVRQBXVUUXHRMY-UHFFFAOYSA-N 2,6-difluorobenzamide Chemical compound NC(=O)C1=C(F)C=CC=C1F AVRQBXVUUXHRMY-UHFFFAOYSA-N 0.000 description 3
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 3
- AKWVJIZRAWAXOU-UHFFFAOYSA-N 4-[2-chloro-4-(trifluoromethyl)phenoxy]aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl AKWVJIZRAWAXOU-UHFFFAOYSA-N 0.000 description 3
- 241001674044 Blattodea Species 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 2
- ZRJSABISRHPRSB-UHFFFAOYSA-N 2,6-difluorobenzoyl isocyanate Chemical compound FC1=CC=CC(F)=C1C(=O)N=C=O ZRJSABISRHPRSB-UHFFFAOYSA-N 0.000 description 2
- PCYUQEVKVCLHDL-UHFFFAOYSA-N 4-(2-chloro-4-nitrophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1Cl PCYUQEVKVCLHDL-UHFFFAOYSA-N 0.000 description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 2
- 241000218475 Agrotis segetum Species 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- 240000003291 Armoracia rusticana Species 0.000 description 2
- 235000011330 Armoracia rusticana Nutrition 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 241001510109 Blaberus giganteus Species 0.000 description 2
- 235000011303 Brassica alboglabra Nutrition 0.000 description 2
- 235000011302 Brassica oleracea Nutrition 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241001465977 Coccoidea Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000257303 Hymenoptera Species 0.000 description 2
- 241000254099 Melolontha melolontha Species 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 241000721621 Myzus persicae Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241000488583 Panonychus ulmi Species 0.000 description 2
- 241001608568 Phaedon Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 241001396980 Phytonemus pallidus Species 0.000 description 2
- 241000255969 Pieris brassicae Species 0.000 description 2
- 241000500439 Plutella Species 0.000 description 2
- 241000500437 Plutella xylostella Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 235000001537 Ribes X gardonianum Nutrition 0.000 description 2
- 235000001535 Ribes X utile Nutrition 0.000 description 2
- 235000016919 Ribes petraeum Nutrition 0.000 description 2
- 244000281247 Ribes rubrum Species 0.000 description 2
- 235000002355 Ribes spicatum Nutrition 0.000 description 2
- 241000254179 Sitophilus granarius Species 0.000 description 2
- 241000254154 Sitophilus zeamais Species 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- 241000256248 Spodoptera Species 0.000 description 2
- 241001454295 Tetranychidae Species 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- XILPLWOGHPSJBK-UHFFFAOYSA-N 1,2-dichloro-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(Cl)C(Cl)=C1 XILPLWOGHPSJBK-UHFFFAOYSA-N 0.000 description 1
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- INIVYDSGGMQPQA-UHFFFAOYSA-N 2,6-dichloro-2,6-difluorocyclohex-3-ene-1-carbonyl isocyanate Chemical compound ClC1(C(C(=O)N=C=O)C(C=CC1)(F)Cl)F INIVYDSGGMQPQA-UHFFFAOYSA-N 0.000 description 1
- KNCIUSMNVDHIJH-UHFFFAOYSA-N 2,6-dichloro-2,6-difluorocyclohex-3-ene-1-carboxamide Chemical compound ClC1(C(C(=O)N)C(C=CC1)(F)Cl)F KNCIUSMNVDHIJH-UHFFFAOYSA-N 0.000 description 1
- IFVRIFGLOAISRU-UHFFFAOYSA-N 2-chloro-4-(2-chloro-4-nitrophenoxy)aniline Chemical compound C1=C(Cl)C(N)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1Cl IFVRIFGLOAISRU-UHFFFAOYSA-N 0.000 description 1
- RZMVHCYCUAKRMM-UHFFFAOYSA-N 2-methylbenzoyl isocyanate Chemical compound CC1=CC=CC=C1C(=O)N=C=O RZMVHCYCUAKRMM-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- UZBSPHJWFIHHQA-UHFFFAOYSA-N 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)aniline Chemical compound ClC1=CC(N)=CC(Cl)=C1OC1=CC=C([N+]([O-])=O)C=C1Cl UZBSPHJWFIHHQA-UHFFFAOYSA-N 0.000 description 1
- RUIMHMXPUXSECT-UHFFFAOYSA-N 3-chloro-4-(2-chloro-4-nitrophenoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1Cl RUIMHMXPUXSECT-UHFFFAOYSA-N 0.000 description 1
- XMJXVWMYVSYRKN-UHFFFAOYSA-N 4-(2-chloro-4-nitrophenoxy)-2-methylaniline Chemical compound C1=C(N)C(C)=CC(OC=2C(=CC(=CC=2)[N+]([O-])=O)Cl)=C1 XMJXVWMYVSYRKN-UHFFFAOYSA-N 0.000 description 1
- 241001143309 Acanthoscelides obtectus Species 0.000 description 1
- 241000238818 Acheta domesticus Species 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- 241001136265 Agriotes Species 0.000 description 1
- 241000600972 Agriotes fuscicollis Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000489242 Amphitetranychus viennensis Species 0.000 description 1
- 241001414900 Anopheles stephensi Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 241000387321 Aspidiotus nerii Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000238788 Blaberus craniifer Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241001444260 Brassicogethes aeneus Species 0.000 description 1
- 241000907225 Bruchidius Species 0.000 description 1
- 241001664260 Byturus tomentosus Species 0.000 description 1
- 241000257163 Calliphora vicina Species 0.000 description 1
- 241001107116 Castanospermum australe Species 0.000 description 1
- 241001221118 Cecidophyopsis ribis Species 0.000 description 1
- 241000255579 Ceratitis capitata Species 0.000 description 1
- 241001124134 Chrysomelidae Species 0.000 description 1
- 241000254137 Cicadidae Species 0.000 description 1
- 241001414836 Cimex Species 0.000 description 1
- 241001479447 Coccus hesperidum Species 0.000 description 1
- 241001094913 Cryptomyzus Species 0.000 description 1
- 241000256059 Culex pipiens Species 0.000 description 1
- 241000328422 Culiseta annulata Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241001641895 Dermestes Species 0.000 description 1
- 241000255601 Drosophila melanogaster Species 0.000 description 1
- 241001425477 Dysdercus Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000630736 Ephestia Species 0.000 description 1
- 241001221110 Eriophyidae Species 0.000 description 1
- 241001331999 Euproctis Species 0.000 description 1
- 241000416536 Euproctis pseudoconspersa Species 0.000 description 1
- 241000953886 Fannia canicularis Species 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241001675057 Gastrophysa viridula Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- 241000652697 Henschoutedenia flexivitta Species 0.000 description 1
- 241001659688 Hercinothrips femoralis Species 0.000 description 1
- 241001251909 Hyalopterus pruni Species 0.000 description 1
- 241000256602 Isoptera Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001631692 Lasiocampa quercus Species 0.000 description 1
- 241000948337 Lasius niger Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 241000721703 Lymantria dispar Species 0.000 description 1
- 241000721715 Macrosiphum Species 0.000 description 1
- 241000721714 Macrosiphum euphorbiae Species 0.000 description 1
- 241000255685 Malacosoma neustria Species 0.000 description 1
- 241000555303 Mamestra brassicae Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000332345 Myzus cerasi Species 0.000 description 1
- 241000961933 Nephotettix virescens Species 0.000 description 1
- 241001491877 Operophtera brumata Species 0.000 description 1
- 241000238887 Ornithodoros Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241000238675 Periplaneta americana Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241000257186 Phormia regina Species 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- 241000952063 Polyphagotarsonemus latus Species 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 235000005805 Prunus cerasus Nutrition 0.000 description 1
- 235000014441 Prunus serotina Nutrition 0.000 description 1
- 241000722238 Pseudococcus maritimus Species 0.000 description 1
- 241001509967 Reticulitermes flavipes Species 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- 241000125167 Rhopalosiphum padi Species 0.000 description 1
- 241001510241 Rhyparobia Species 0.000 description 1
- 241001510236 Rhyparobia maderae Species 0.000 description 1
- 241001412173 Rubus canescens Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 244000235659 Rubus idaeus Species 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- 241001402072 Sappaphis Species 0.000 description 1
- 241000256247 Spodoptera exigua Species 0.000 description 1
- 241000256251 Spodoptera frugiperda Species 0.000 description 1
- 241000256250 Spodoptera littoralis Species 0.000 description 1
- 241000985245 Spodoptera litura Species 0.000 description 1
- 241001177161 Stegobium paniceum Species 0.000 description 1
- 241001494115 Stomoxys calcitrans Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241000254109 Tenebrio molitor Species 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241001238451 Tortrix viridana Species 0.000 description 1
- 241001414833 Triatoma Species 0.000 description 1
- 241000254113 Tribolium castaneum Species 0.000 description 1
- 241000267822 Trogoderma granarium Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 208000003152 Yellow Fever Diseases 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 241001466337 Yponomeuta Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 235000015241 bacon Nutrition 0.000 description 1
- 150000008047 benzoylureas Chemical class 0.000 description 1
- 235000021279 black bean Nutrition 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- YYJNOYZRYGDPNH-MFKUBSTISA-N fenpyroximate Chemical compound C=1C=C(C(=O)OC(C)(C)C)C=CC=1CO/N=C/C=1C(C)=NN(C)C=1OC1=CC=CC=C1 YYJNOYZRYGDPNH-MFKUBSTISA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000020044 madeira Nutrition 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N methyl iso-propyl ketone Natural products CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/54—Y being a carbon atom of a six-membered aromatic ring, e.g. benzoylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752504984 DE2504984C2 (de) | 1975-02-06 | 1975-02-06 | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2504982A DE2504982C2 (de) | 1975-02-06 | 1975-02-06 | 4-Trifluormethyl-4'-benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Insekten |
| DE19752528917 DE2528917C2 (de) | 1975-06-28 | 1975-06-28 | 2-Chlor-4-nitro-4'-benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE19752537413 DE2537413C2 (de) | 1975-08-22 | 1975-08-22 | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und diese enthaltende insektizide Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH616150A5 true CH616150A5 (enExample) | 1980-03-14 |
Family
ID=27431952
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH122476A CH616150A5 (enExample) | 1975-02-06 | 1976-02-02 |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US4005223A (enExample) |
| JP (1) | JPS598274B2 (enExample) |
| AR (1) | AR209344A1 (enExample) |
| AT (1) | AT345035B (enExample) |
| BE (1) | BE838286A (enExample) |
| BG (1) | BG26505A3 (enExample) |
| BR (1) | BR7600714A (enExample) |
| CA (1) | CA1057772A (enExample) |
| CH (1) | CH616150A5 (enExample) |
| CS (1) | CS186238B2 (enExample) |
| DD (1) | DD124946A5 (enExample) |
| DK (1) | DK47476A (enExample) |
| ES (1) | ES444935A1 (enExample) |
| FI (1) | FI62825C (enExample) |
| FR (1) | FR2300076A1 (enExample) |
| GB (1) | GB1460419A (enExample) |
| HU (1) | HU175569B (enExample) |
| IE (1) | IE42473B1 (enExample) |
| IL (1) | IL48962A (enExample) |
| IT (1) | IT1055102B (enExample) |
| KE (1) | KE2750A (enExample) |
| LU (1) | LU74308A1 (enExample) |
| NL (1) | NL7601083A (enExample) |
| NO (1) | NO149172C (enExample) |
| PH (1) | PH12968A (enExample) |
| PT (1) | PT64770B (enExample) |
| SE (1) | SE421308B (enExample) |
| TR (1) | TR18799A (enExample) |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531202C2 (de) * | 1975-07-12 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2601780B2 (de) * | 1976-01-20 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| US4173637A (en) * | 1976-10-29 | 1979-11-06 | Ishihara Sangyo Kaisha Ltd. | N-Benzoyl-N'-pyridyloxy phenyl urea and insecticidal compositions thereof |
| JPS5840946B2 (ja) * | 1976-10-29 | 1983-09-08 | 石原産業株式会社 | N−ベンゾイル−n′−ピリジルオキシフエニルウレア系化合物、それらの製造方法及びそれらを含有する殺虫剤 |
| ES465882A1 (es) * | 1977-01-12 | 1979-01-01 | Ciba Geigy | Procedimiento para la preparacion de carbimido-carbonil fe- nil formamidinas |
| US4089975A (en) * | 1977-05-13 | 1978-05-16 | The Dow Chemical Company | Method of controlling manure-breeding insects |
| US4117009A (en) * | 1977-06-09 | 1978-09-26 | Gaf Corporation | Method of making N-[4-chlorophenyl)amino]carbonyl)-2,6-difluorobenzamide |
| DE2860137D1 (en) * | 1977-07-28 | 1980-12-11 | Ciba Geigy Ag | N-phenyl-n'-benzoyl ureas, process for their preparation, substances containing them, and their use as pesticides |
| NL189293C (nl) * | 1978-02-06 | 1993-03-01 | Ishihara Sangyo Kaisha | Insecticide n-benzoyl-n'-fenylureumverbindingen en insecticide samenstelling op basis van een dergelijke verbinding. |
| US4293552A (en) * | 1978-02-27 | 1981-10-06 | Eli Lilly And Company | Novel 1-(mono-o-substituted benzoyl)-3-(substituted pyrazinyl) ureas |
| ZA793186B (en) * | 1978-07-06 | 1981-02-25 | Duphar Int Res | New urea and thiourea compounds, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds |
| GR73690B (enExample) * | 1979-01-15 | 1984-04-02 | Celamerck Gmbh & Co Kg | |
| US4310548A (en) * | 1979-02-01 | 1982-01-12 | Ciba-Geigy Corporation | Pesticidal N-tetrafluorophenyl-N'-benzoyl ureas |
| US4505931A (en) * | 1979-02-01 | 1985-03-19 | Ciba-Geigy Corporation | Pesticidal N-(4-alkenylthio)-phenyl-N'-benzoylureas |
| US4339460A (en) * | 1979-02-01 | 1982-07-13 | Ciba-Geigy Corporation | Pesticidal N-[4-(3'-bromoallyloxy)-phenyl]-N'-benzoyl ureas |
| JPS5640667A (en) * | 1979-09-11 | 1981-04-16 | Ishihara Sangyo Kaisha Ltd | Urea derivative |
| DE3041947A1 (de) * | 1979-11-09 | 1981-05-21 | CIBA-GEIGY AG, 4002 Basel | Phenoxyphenylharnstoffe |
| US4399152A (en) * | 1980-04-03 | 1983-08-16 | Duphar International B.V. | Substituted benzoyl ureas as insecticides |
| ATE9131T1 (de) * | 1980-05-14 | 1984-09-15 | Ciba-Geigy Ag | Phenylbenzoylharnstoffe. |
| DE3026825A1 (de) * | 1980-07-16 | 1982-02-18 | Basf Ag, 6700 Ludwigshafen | Substituierte n-benzoyl-n'-phenoxyphenylharnstoffe, ihre herstellung, ihre verwendung zur bekaempfung von bekaempfung von insekten und mittel dafuer |
| DE3217619A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,4-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4880838A (en) * | 1982-06-30 | 1989-11-14 | Rhone-Poulenc | Pesticidal 1-(4-Phenoxyphenyl)-5-Benzoyl urea compounds and process for preparation |
| CA1205483A (en) * | 1982-06-30 | 1986-06-03 | David T. Chou | Pesticidal 1-(alkyl phenoxyaryl)-3-benzoyl ureas and process for preparation |
| US4868215A (en) * | 1982-07-26 | 1989-09-19 | The Dow Chemical Company | Substituted N-aroyl N'-phenyl urea compounds |
| US4529819A (en) * | 1982-08-02 | 1985-07-16 | The Dow Chemical Company | Method for making benzoylphenylureas |
| DE3232265A1 (de) * | 1982-08-31 | 1984-03-01 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| US5166179A (en) * | 1982-08-31 | 1992-11-24 | Arno Lange | N-benzoyl-N'-phenoxyphenylureas, their preparation and their use for controlling pests |
| ZA835661B (en) * | 1982-09-16 | 1984-04-25 | Shell Res Ltd | Pesticidal benzoylurea compounds |
| US4659724A (en) * | 1982-12-30 | 1987-04-21 | Union Carbide Corporation | Certain 1-[4-(5-cyano-2-pyridyloxy)phenyl-benzoyl ureas having pesticidal properties |
| AU572563B2 (en) * | 1983-02-09 | 1988-05-12 | Sumitomo Chemical Company, Limited | Benzoylureas |
| DK147084A (da) * | 1983-03-19 | 1984-09-20 | Bayer Ag | 1-phenyl-3-benzoyl-(thio)-urinstoffer, deres fremstilling og anvendelse som skadedyrsbekaempelsesmidler |
| US4873264A (en) * | 1983-05-20 | 1989-10-10 | Rhone-Poulenc Nederlands B.V. | Novel pesticidal 1-(alkyl-phenoxy-aryl)-3-benzoyl ureas and process for preparation |
| JPS6097949A (ja) * | 1983-10-31 | 1985-05-31 | Sumitomo Chem Co Ltd | ベンゾイル尿素誘導体,その製造法およびそれを有効成分として含有する殺虫剤 |
| CA1339745C (en) * | 1984-04-10 | 1998-03-17 | Martin Anderson | Pesticidal benzoylurea compounds |
| US4623658A (en) * | 1984-04-10 | 1986-11-18 | Shell Oil Company | Pesticidal benzoylurea compounds |
| US4638088A (en) * | 1984-11-15 | 1987-01-20 | Union Carbide Corporation | Pesticidal biphenylyloxy and biphenylylalkoxy aryl acyl urea compounds |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| US4918227A (en) * | 1985-03-14 | 1990-04-17 | Shell Internationale Research Naatschappy B.V. | Process for the preparation of benzoyl ureas |
| DE3661195D1 (en) * | 1985-03-29 | 1988-12-22 | Union Carbide Corp | Pesticidal 1-(4-phenoxyphenyl)-3-benzoyl urea compounds and process for preparation |
| US4734404A (en) * | 1986-06-06 | 1988-03-29 | Rhone-Poulenc Nederland B.V. | Pesticidal benzoylureidoaryl phosphate compounds |
| NZ221964A (en) * | 1986-10-03 | 1990-03-27 | Ishihara Sangyo Kaisha | Benzoylurea compounds and insecticidal compositions |
| GB8700838D0 (en) * | 1987-01-15 | 1987-02-18 | Shell Int Research | Termiticides |
| AU602060B2 (en) * | 1987-04-03 | 1990-09-27 | Sumitomo Chemical Company, Limited | A benzoylurea derivative and its production and use, and aniline intermediates therefor |
| DE3741062A1 (de) * | 1987-12-04 | 1989-08-31 | Hoechst Ag | (thio)benzoylharnstoffe und deren funktionelle derivate, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung als schaedlingsbekaempfungsmittel |
| GB8829817D0 (en) * | 1988-12-21 | 1989-02-15 | Shell Int Research | Benzamide compounds,their preparation and their use as pesticides |
| EP0449885A1 (en) * | 1988-12-21 | 1991-10-09 | E.I. Du Pont De Nemours And Company | Insecticidal use of a benzoylurea |
| WO1992012707A1 (en) * | 1991-01-22 | 1992-08-06 | E.I. Du Pont De Nemours And Company | A benzoylurea-containing composition for parasite control in animals |
| FR2812633A1 (fr) * | 2000-08-04 | 2002-02-08 | Aventis Cropscience Sa | Derives de phenyl(thio)urees et phenyl(thio)carbamates fongicides |
-
1975
- 1975-10-21 GB GB4310875A patent/GB1460419A/en not_active Expired
-
1976
- 1976-01-22 NO NO760196A patent/NO149172C/no unknown
- 1976-02-02 CS CS643/76A patent/CS186238B2/cs unknown
- 1976-02-02 BG BG032254A patent/BG26505A3/xx unknown
- 1976-02-02 CH CH122476A patent/CH616150A5/de not_active IP Right Cessation
- 1976-02-03 IL IL48962A patent/IL48962A/xx unknown
- 1976-02-03 NL NL7601083A patent/NL7601083A/xx unknown
- 1976-02-03 PT PT64770A patent/PT64770B/pt unknown
- 1976-02-03 US US05/654,835 patent/US4005223A/en not_active Expired - Lifetime
- 1976-02-03 PH PH18040A patent/PH12968A/en unknown
- 1976-02-04 DD DD191098A patent/DD124946A5/xx unknown
- 1976-02-04 TR TR18799A patent/TR18799A/xx unknown
- 1976-02-04 IT IT19893/76A patent/IT1055102B/it active
- 1976-02-04 AT AT77576A patent/AT345035B/de not_active IP Right Cessation
- 1976-02-04 FI FI760264A patent/FI62825C/fi not_active IP Right Cessation
- 1976-02-04 LU LU74308A patent/LU74308A1/xx unknown
- 1976-02-05 ES ES444935A patent/ES444935A1/es not_active Expired
- 1976-02-05 CA CA245,114A patent/CA1057772A/en not_active Expired
- 1976-02-05 SE SE7601257A patent/SE421308B/xx unknown
- 1976-02-05 DK DK47476*#A patent/DK47476A/da not_active Application Discontinuation
- 1976-02-05 BR BR7600714A patent/BR7600714A/pt unknown
- 1976-02-05 IE IE233/76A patent/IE42473B1/en unknown
- 1976-02-05 BE BE164105A patent/BE838286A/xx not_active IP Right Cessation
- 1976-02-05 JP JP51010908A patent/JPS598274B2/ja not_active Expired
- 1976-02-06 HU HU76BA3368A patent/HU175569B/hu unknown
- 1976-02-06 FR FR7603316A patent/FR2300076A1/fr active Granted
- 1976-02-06 AR AR262175A patent/AR209344A1/es active
-
1977
- 1977-06-29 KE KE2750A patent/KE2750A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2438747C2 (de) | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| DE2531202C2 (de) | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| CH616150A5 (enExample) | ||
| DE2531279C2 (de) | N-(3-Trifluormethyl-4-halogen-phenyl)- N'-benzoyl-harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| DE2531743C2 (de) | 2',3,6'-Trichlor-4-cyano-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwenung als Insektizide | |
| DE2322434A1 (de) | 2-trifluormethylimino-1,3-dithioloeckige klammer auf 4,5-b eckige klammer zu -chinoxaline, verfahren zu ihrer herstellung, sowie ihre verwendung als insektizide, akarizide und fungizide | |
| DE2537413C2 (de) | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und diese enthaltende insektizide Mittel | |
| DE2308660A1 (de) | N-sulfenylierte n-methylcarbamidoxime, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide, akarizide und fungizide | |
| DE2409463A1 (de) | N-sulfenylierte oximcarbamate, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide, akarizide und nematizide | |
| DE2420360A1 (de) | N,n-dimethyl-0- eckige klammer auf 1-methyl-3-n-methyl-carbaminyl-methyl-pyrazol(5)yl eckige klammer zu -carbaminsaeureester, verfahren zu seiner herstellung und seine verwendung als insektizid | |
| US4006244A (en) | Benzo-1,3-dioxolan-4-yl N-methyl-N-phenylmercapto-carbamates | |
| DE2528917C2 (de) | 2-Chlor-4-nitro-4'-benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| DE2431849A1 (de) | N-dithiophosphoryl-carbaminsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide | |
| DE2357930A1 (de) | N-sulfenylierte n-methyl-carbamate, verfahren zu ihrer herstellung und ihre insektizide und akarizide verwendung | |
| DE2360548C3 (de) | 2-Cyanophenyldithiophosphorsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide und Akarizide | |
| DE2225873A1 (de) | Isocyandiphenylaether | |
| DE2117464A1 (de) | N-Carbamoyl- bzw. N-Thiocarbamoyl-4, 5,6,7-tetrahydrobenztriazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Insektizide und Akarizide | |
| DE2531340A1 (de) | O-aethyl-o-pyridazinylthionobenzolphosphonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide | |
| DE2106303A1 (de) | N,N-Dimethyl-O- eckige Klammer auf 1alkyl-4-cyano-5-alkoxypyrazol(3)yl eckige Klammer zu -carbaminsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Insektizide und Akarizide: | |
| DE2403711C2 (de) | O-Triazolylthionophosphor(phosphon)-säureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide und Akarizide | |
| DE2330242A1 (de) | Fluorhaltige n-phenylcarbamate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide | |
| DE2403224A1 (de) | Bistrifluormethylimino-imidazolone, verfahren zu ihrer herstellung und ihre akarizide, insektizide und fungizide verwendung | |
| DE2306277A1 (de) | Alpha-cyan-oximcarbamate, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide und akarizide | |
| DE2420068A1 (de) | N,n-dimethyl-0- eckige klammer auf 1-isopropyl-5-n,n-dimethylcarbaminylthio1,2,4-triazol(3)yl eckige klammer zu -carbaminsaeureester, verfahren zu seiner herstellung und seine verwendung als insektizide | |
| DE2158580A1 (de) | N-sulfenylierte n-methylcarbamate, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |