CH494766A - Verfahren zur Herstellung von Azaspiroalkandionen - Google Patents
Verfahren zur Herstellung von AzaspiroalkandionenInfo
- Publication number
- CH494766A CH494766A CH148267A CH148267A CH494766A CH 494766 A CH494766 A CH 494766A CH 148267 A CH148267 A CH 148267A CH 148267 A CH148267 A CH 148267A CH 494766 A CH494766 A CH 494766A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- carbon atoms
- groups
- formula
- atoms
- Prior art date
Links
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 title abstract description 6
- 230000000202 analgesic effect Effects 0.000 title abstract 2
- 230000000506 psychotropic effect Effects 0.000 title abstract 2
- -1 amino- Chemical class 0.000 claims abstract description 17
- 238000006243 chemical reaction Methods 0.000 claims abstract description 14
- 150000003839 salts Chemical class 0.000 claims abstract description 12
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 3
- 150000001412 amines Chemical class 0.000 claims abstract description 3
- 239000012442 inert solvent Substances 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 38
- 238000000034 method Methods 0.000 claims description 28
- 239000000047 product Substances 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 14
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- 238000009835 boiling Methods 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000006227 byproduct Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000005422 alkyl sulfonamido group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 2
- GTFMAONWNTUZEW-UHFFFAOYSA-N glutaramic acid Chemical compound NC(=O)CCCC(O)=O GTFMAONWNTUZEW-UHFFFAOYSA-N 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical class O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 abstract description 5
- 229910019142 PO4 Inorganic materials 0.000 abstract description 2
- 230000003266 anti-allergic effect Effects 0.000 abstract description 2
- 239000010452 phosphate Substances 0.000 abstract description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 1
- 125000005702 oxyalkylene group Chemical group 0.000 abstract 1
- 229910021653 sulphate ion Inorganic materials 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- 241001465754 Metazoa Species 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 17
- 238000012360 testing method Methods 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 206010030113 Oedema Diseases 0.000 description 12
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 229940079593 drug Drugs 0.000 description 9
- 239000003814 drug Substances 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 239000002585 base Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 239000003204 tranquilizing agent Substances 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000005192 partition Methods 0.000 description 6
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 229940025084 amphetamine Drugs 0.000 description 5
- 230000035939 shock Effects 0.000 description 5
- 230000002936 tranquilizing effect Effects 0.000 description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 210000003414 extremity Anatomy 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 3
- AKUVRZKNLXYTJX-UHFFFAOYSA-N 3-benzylazetidine Chemical compound C=1C=CC=CC=1CC1CNC1 AKUVRZKNLXYTJX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 229960001657 chlorpromazine hydrochloride Drugs 0.000 description 3
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- PYHRZPFZZDCOPH-UHFFFAOYSA-N amphetamine sulfate Chemical compound OS(O)(=O)=O.CC(N)CC1=CC=CC=C1.CC(N)CC1=CC=CC=C1 PYHRZPFZZDCOPH-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 231100000171 higher toxicity Toxicity 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 229960004815 meprobamate Drugs 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- BCXHDORHMMZBBZ-DORFAMGDSA-N (4r,4ar,7s,7ar,12bs)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol;sulfuric acid Chemical compound OS(O)(=O)=O.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC BCXHDORHMMZBBZ-DORFAMGDSA-N 0.000 description 1
- HUQLEPZQYCQYCF-UHFFFAOYSA-N 1-(2,5-diethoxyphenyl)piperazine Chemical compound CCOC1=CC=C(OCC)C(N2CCNCC2)=C1 HUQLEPZQYCQYCF-UHFFFAOYSA-N 0.000 description 1
- YRIFWVMRUFKWLM-UHFFFAOYSA-N 1-(2,5-dimethylphenyl)piperazine Chemical compound CC1=CC=C(C)C(N2CCNCC2)=C1 YRIFWVMRUFKWLM-UHFFFAOYSA-N 0.000 description 1
- JVTRURBMYILQDA-UHFFFAOYSA-N 1-(2-bromophenyl)piperazine Chemical compound BrC1=CC=CC=C1N1CCNCC1 JVTRURBMYILQDA-UHFFFAOYSA-N 0.000 description 1
- YNPHKRWUIFAKLL-UHFFFAOYSA-N 1-(2-butoxyphenyl)piperazine Chemical compound CCCCOC1=CC=CC=C1N1CCNCC1 YNPHKRWUIFAKLL-UHFFFAOYSA-N 0.000 description 1
- LLRASTFXRZBMKP-UHFFFAOYSA-N 1-(2-chloro-6-methylphenyl)piperazine Chemical compound CC1=CC=CC(Cl)=C1N1CCNCC1 LLRASTFXRZBMKP-UHFFFAOYSA-N 0.000 description 1
- LMQFWBCKQMNEEH-UHFFFAOYSA-N 1-(2-ethylphenyl)piperazine Chemical compound CCC1=CC=CC=C1N1CCNCC1 LMQFWBCKQMNEEH-UHFFFAOYSA-N 0.000 description 1
- VNZLQLYBRIOLFZ-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCNCC1 VNZLQLYBRIOLFZ-UHFFFAOYSA-N 0.000 description 1
- RXJURXTXLCOIDY-UHFFFAOYSA-N 1-(2-methylsulfanylphenyl)piperazine Chemical compound CSC1=CC=CC=C1N1CCNCC1 RXJURXTXLCOIDY-UHFFFAOYSA-N 0.000 description 1
- CEKPSZQAYKRKMO-UHFFFAOYSA-N 1-(2-propylsulfanylphenyl)piperazine Chemical compound CCCSC1=CC=CC=C1N1CCNCC1 CEKPSZQAYKRKMO-UHFFFAOYSA-N 0.000 description 1
- RBSSPJDOINFUCR-UHFFFAOYSA-N 1-(3,5-dimethylphenyl)piperazine Chemical compound CC1=CC(C)=CC(N2CCNCC2)=C1 RBSSPJDOINFUCR-UHFFFAOYSA-N 0.000 description 1
- KKIMDKMETPPURN-UHFFFAOYSA-N 1-(3-(trifluoromethyl)phenyl)piperazine Chemical compound FC(F)(F)C1=CC=CC(N2CCNCC2)=C1 KKIMDKMETPPURN-UHFFFAOYSA-N 0.000 description 1
- DKARAITZJPYRKU-UHFFFAOYSA-N 1-(3-bromo-2,4-dimethylphenyl)piperazine Chemical compound CC1=C(Br)C(C)=CC=C1N1CCNCC1 DKARAITZJPYRKU-UHFFFAOYSA-N 0.000 description 1
- CHDVOOZDIDICTA-UHFFFAOYSA-N 1-(3-chloro-2,4-dimethylphenyl)piperazine Chemical compound CC1=C(Cl)C(C)=CC=C1N1CCNCC1 CHDVOOZDIDICTA-UHFFFAOYSA-N 0.000 description 1
- VWOJSRICSKDKAW-UHFFFAOYSA-N 1-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCNCC1 VWOJSRICSKDKAW-UHFFFAOYSA-N 0.000 description 1
- RZQLFFBRLLFWTP-UHFFFAOYSA-N 1-(5-chloro-2-ethylsulfanylphenyl)piperazine Chemical compound CCSC1=CC=C(Cl)C=C1N1CCNCC1 RZQLFFBRLLFWTP-UHFFFAOYSA-N 0.000 description 1
- FCZBQMUDGBEIHG-UHFFFAOYSA-N 1-(5-chloro-2-methoxyphenyl)piperazine Chemical compound COC1=CC=C(Cl)C=C1N1CCNCC1 FCZBQMUDGBEIHG-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- UDQMXYJSNNCRAS-UHFFFAOYSA-N 2,3-dichlorophenylpiperazine Chemical compound ClC1=CC=CC(N2CCNCC2)=C1Cl UDQMXYJSNNCRAS-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- HLNMXIRDXNHGRY-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]propanenitrile Chemical compound COC1=CC=CC=C1N1CCN(CCC#N)CC1 HLNMXIRDXNHGRY-UHFFFAOYSA-N 0.000 description 1
- JIIPBQOPTKJDJN-UHFFFAOYSA-N 3-chloro-2-methylbutanenitrile Chemical compound CC(Cl)C(C)C#N JIIPBQOPTKJDJN-UHFFFAOYSA-N 0.000 description 1
- GNHMRTZZNHZDDM-UHFFFAOYSA-N 3-chloropropionitrile Chemical compound ClCCC#N GNHMRTZZNHZDDM-UHFFFAOYSA-N 0.000 description 1
- SFWZEMBNNRUEHM-UHFFFAOYSA-N 3-methyl-1-phenylpiperazine Chemical compound C1CNC(C)CN1C1=CC=CC=C1 SFWZEMBNNRUEHM-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- GFWLMILMVMCJDI-UHFFFAOYSA-N 8-oxaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)OC(=O)CC11CCCC1 GFWLMILMVMCJDI-UHFFFAOYSA-N 0.000 description 1
- PSFYTQQKPKMRLG-UHFFFAOYSA-N 8-prop-2-ynyl-8-azaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)N(CC#C)C(=O)CC11CCCC1 PSFYTQQKPKMRLG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 241001471112 Artocarpus tamaran Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- GTWVVZNFGAHYLP-UHFFFAOYSA-N CC(C=C(C(N1CCNCC1)=C1)Cl)=C1[N+]([O-])=O Chemical compound CC(C=C(C(N1CCNCC1)=C1)Cl)=C1[N+]([O-])=O GTWVVZNFGAHYLP-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 235000006481 Colocasia esculenta Nutrition 0.000 description 1
- 244000205754 Colocasia esculenta Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920002253 Tannate Polymers 0.000 description 1
- BMDFKRNKFIWLGH-UHFFFAOYSA-N [N]N1CCNCC1 Chemical group [N]N1CCNCC1 BMDFKRNKFIWLGH-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- YRTHJMQKDCXPAY-UHFFFAOYSA-N azaspirodecanedione Chemical compound C1C(=O)NC(=O)CC11CCCC1 YRTHJMQKDCXPAY-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229960001076 chlorpromazine Drugs 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229960003871 codeine sulfate Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- AEHJDQSLTMFLQO-UHFFFAOYSA-N hexane-1-sulfonyl chloride Chemical compound CCCCCCS(Cl)(=O)=O AEHJDQSLTMFLQO-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 239000005554 hypnotics and sedatives Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000009191 jumping Effects 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- FBBDOOHMGLLEGJ-UHFFFAOYSA-N methane;hydrochloride Chemical compound C.Cl FBBDOOHMGLLEGJ-UHFFFAOYSA-N 0.000 description 1
- HTMIBDQKFHUPSX-UHFFFAOYSA-N methdilazine Chemical compound C1N(C)CCC1CN1C2=CC=CC=C2SC2=CC=CC=C21 HTMIBDQKFHUPSX-UHFFFAOYSA-N 0.000 description 1
- 229960004056 methdilazine Drugs 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HUAUNKAZQWMVFY-UHFFFAOYSA-M sodium;oxocalcium;hydroxide Chemical compound [OH-].[Na+].[Ca]=O HUAUNKAZQWMVFY-UHFFFAOYSA-M 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229940125725 tranquilizer Drugs 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/20—Spiro-condensed ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Emergency Lowering Means (AREA)
- Hydrogenated Pyridines (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1663269A CH495368A (de) | 1966-02-01 | 1967-02-01 | Verfahren zur Herstellung von Azaspiroalkandionen |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52394566A | 1966-02-01 | 1966-02-01 | |
| US607908A US3398151A (en) | 1966-02-01 | 1967-01-09 | Azaspirodecanediones and azaspiroundecanediones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH494766A true CH494766A (de) | 1970-08-15 |
Family
ID=27061323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH148267A CH494766A (de) | 1966-02-01 | 1967-02-01 | Verfahren zur Herstellung von Azaspiroalkandionen |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3398151A (enExample) |
| AT (1) | AT278806B (enExample) |
| BE (1) | BE693497A (enExample) |
| CH (1) | CH494766A (enExample) |
| DE (1) | DE1695390B2 (enExample) |
| DK (1) | DK120750B (enExample) |
| ES (1) | ES336256A1 (enExample) |
| FI (1) | FI48590C (enExample) |
| FR (1) | FR6687M (enExample) |
| GB (1) | GB1164503A (enExample) |
| IL (1) | IL27284A (enExample) |
| NL (1) | NL6701538A (enExample) |
| NO (1) | NO121156B (enExample) |
| SE (1) | SE332177B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE759371A (fr) * | 1969-11-24 | 1971-05-24 | Bristol Myers Co | Azaspirodecanediones heterocycliques et procedes pour leur preparation |
| US3976776A (en) * | 1972-12-06 | 1976-08-24 | Mead Johnson & Company | Tranquilizer process employing N-(heteroarcyclic)piperazinylalkylazaspiroalkanediones |
| US4123538A (en) * | 1977-08-30 | 1978-10-31 | Mcneil Laboratories, Incorporated | (2-Amino-2-oxoethoxy)acetic acid compounds, compositions and methods |
| US4309541A (en) * | 1978-09-20 | 1982-01-05 | Ciba-Geigy Corporation | Piperidinyl-lactams |
| US4305944A (en) * | 1980-09-08 | 1981-12-15 | Mead Johnson & Company | N-[(4-[3-cyano substituted pyridyl]piperazino)alkyl]-azaspirodecanediones |
| US4320131A (en) * | 1981-03-16 | 1982-03-16 | Mead Johnson & Company | N-[(4-Phenyl-1,2,3,6-tetrahydropyridin-1-yl)alkylene]azaspiroalkanediones and N-[(4-hydroxy-4-phenylpiperidin-1-yl)alkylene]azaspiroalkanediones |
| US4456756A (en) * | 1981-08-03 | 1984-06-26 | Mead Johnson & Company | Spirothiazolidinyl piperazine derivatives |
| US4367335A (en) * | 1981-08-03 | 1983-01-04 | Mead Johnson & Company | Thiazolidinylalkylene piperazine derivatives |
| US4411901A (en) * | 1981-12-23 | 1983-10-25 | Mead Johnson & Company | Benzisothiazole and benzisoxazole piperazine derivatives |
| US4507303A (en) * | 1981-12-22 | 1985-03-26 | Sumitomo Chemical Company, Limited | Succinimide derivatives, compositions and method of use |
| US4452799A (en) * | 1981-12-23 | 1984-06-05 | Mead Johnson & Company | Benzisothiazole and benzisoxazole piperazine derivatives |
| US4361565A (en) * | 1981-12-28 | 1982-11-30 | Mead Johnson & Company | 2-[4-[(4,4-Dialkyl-2,6-piperidinedion-1-yl)butyl]-1-piperazinyl]pyridines |
| US4423049A (en) * | 1981-12-28 | 1983-12-27 | Mead Johnson & Company | 2-[4-[(4,4-Dialkyl-2,6-piperidinedion-1-yl)butyl]-1-piperazinyl]pyrimidines |
| US4515947A (en) * | 1982-08-11 | 1985-05-07 | Eastman Kodak Company | Cyanoalkylpiperazines and methods for their preparation and use |
| US4620002A (en) * | 1982-08-11 | 1986-10-28 | Eastman Kodak Company | 2-pyrimidyl alkanesulfonates |
| US4620006A (en) * | 1982-08-11 | 1986-10-28 | Eastman Kodak Company | Acid salts of 1-(cyanoalkyl)-4-guanylpiperazines |
| JPS5976059A (ja) * | 1982-10-21 | 1984-04-28 | Sumitomo Chem Co Ltd | 環状イミド誘導体及びその酸付加塩 |
| US4581357A (en) * | 1983-02-07 | 1986-04-08 | Mead Johnson & Company | Antipsychotic 5-fluoro-pyrimidin-2-yl piperazine compound |
| JPS59148780A (ja) * | 1983-02-07 | 1984-08-25 | ブリストル―マイヤーズ スクイブ カンパニー | 精神病治療性5−フルオロ−ピリミジン−2−イルピペラジン化合物 |
| US4524206A (en) * | 1983-09-12 | 1985-06-18 | Mead Johnson & Company | 1-Heteroaryl-4-(2,5-pyrrolidinedion-1-yl)alkyl)piperazine derivatives |
| JPH0625181B2 (ja) * | 1985-03-27 | 1994-04-06 | 住友製薬株式会社 | 新規なイミド誘導体 |
| AR242678A1 (es) * | 1986-03-05 | 1993-04-30 | Gonzalez Jorge Alberto | Mejoras en instrumentos musicales de cuerda de arco. |
| ZA871449B (en) * | 1986-03-05 | 1987-08-20 | Merrell Dow Pharmaceutical Inc. | Aromatic omega-alkylimino-tetrahydro-6h-1,3-thiazin-6-one derivatives |
| JP2660407B2 (ja) * | 1986-09-26 | 1997-10-08 | 住友製薬株式会社 | 新規なイミド誘導体 |
| FR2608157B1 (fr) * | 1986-12-11 | 1989-09-08 | Roussel Uclaf | Nouveaux derives de l'azaspirodecane, leurs sels, procede de preparation, application a titre de medicaments et compositions les renfermant et intermediaires |
| FR2621586B1 (fr) * | 1987-10-08 | 1990-02-02 | Roussel Uclaf | Nouveaux derives de l'azapirodecane, leur procede de preparation et leur application comme medicaments |
| IE62890B1 (en) * | 1988-12-06 | 1995-03-08 | Hafslund Nycomed Pharma | New piperazinylalkyl-3(2h)-pyridazinones process for the preparation thereof and the use thereof as agents lowering blood pressure |
| US5162321A (en) * | 1989-12-20 | 1992-11-10 | Adir Et Compagnie | 1-naphthyl piperazines useful as 5-HT1A receptor ligands |
| ES2019228A6 (es) * | 1990-02-13 | 1991-06-01 | Espanola Prod Quimicos | Procedimiento de obtencion de nuevos derivados de azaspiro (4.5) decano-7, 9-diona. |
| US5098904A (en) * | 1990-06-27 | 1992-03-24 | Bristol-Myers Squibb Company | Cerebral function enhancing pyrimidinyl derivatives |
| US5130315A (en) * | 1991-01-10 | 1992-07-14 | Raymond R. Wittekind | 1-piperazinyl-2-butenes and -2-butynes |
| US5137894A (en) * | 1991-12-05 | 1992-08-11 | New James S | 4-(4-Piperidinyl-thieno[3,2-c]pyridine derivatives of n-alkylglutarimides |
| SE9201138D0 (sv) * | 1992-04-09 | 1992-04-09 | Astra Ab | Novel phthalimidoalkylpiperazines |
| AU770339B2 (en) | 1998-07-17 | 2004-02-19 | H. Lundbeck A/S | Compounds specific for the human alpha1d adrenergic receptor and uses thereof |
| US20040106623A1 (en) * | 1999-07-16 | 2004-06-03 | Synaptic Pharmaceutical Corporation | Compounds specific for the human alpha1d adrenergic receptor and uses thereof |
| DE10210190A1 (de) * | 2002-03-07 | 2003-09-25 | Sanol Arznei Schwarz Gmbh | Aza-Spiroverbindungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3030366A (en) * | 1961-01-25 | 1962-04-17 | Lakeside Lab Inc | Piperazinoalkyl glycolamides |
-
1967
- 1967-01-09 US US607908A patent/US3398151A/en not_active Expired - Lifetime
- 1967-01-18 NO NO166456A patent/NO121156B/no unknown
- 1967-01-18 SE SE00719/67A patent/SE332177B/xx unknown
- 1967-01-20 IL IL27284A patent/IL27284A/en unknown
- 1967-01-21 ES ES336256A patent/ES336256A1/es not_active Expired
- 1967-01-26 GB GB4000/67A patent/GB1164503A/en not_active Expired
- 1967-01-31 FR FR93227A patent/FR6687M/fr not_active Expired
- 1967-01-31 AT AT91367A patent/AT278806B/de not_active IP Right Cessation
- 1967-01-31 DK DK54567AA patent/DK120750B/da unknown
- 1967-01-31 DE DE1967M0072597 patent/DE1695390B2/de active Granted
- 1967-02-01 FI FI670290A patent/FI48590C/fi active
- 1967-02-01 BE BE693497D patent/BE693497A/xx unknown
- 1967-02-01 CH CH148267A patent/CH494766A/de not_active IP Right Cessation
- 1967-02-01 NL NL6701538A patent/NL6701538A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6701538A (enExample) | 1967-08-02 |
| SE332177B (enExample) | 1971-02-01 |
| ES336256A1 (es) | 1968-06-01 |
| NO121156B (enExample) | 1971-01-25 |
| DK120750B (da) | 1971-07-12 |
| GB1164503A (en) | 1969-09-17 |
| FR6687M (enExample) | 1969-02-10 |
| DE1695390A1 (de) | 1972-02-24 |
| AT278806B (de) | 1970-02-10 |
| US3398151A (en) | 1968-08-20 |
| FI48590C (fi) | 1974-11-11 |
| IL27284A (en) | 1971-08-25 |
| BE693497A (enExample) | 1967-08-01 |
| FI48590B (enExample) | 1974-07-31 |
| DE1695390B2 (de) | 1976-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH494766A (de) | Verfahren zur Herstellung von Azaspiroalkandionen | |
| DE2941880C2 (enExample) | ||
| DD227963A5 (de) | Verfahren zur herstellung von 1-benzyl-aminoalkyl-pyrrolidinone | |
| EP0047923A1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2807569A1 (de) | Dibenzodiazepine | |
| EP0105210B1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE2237592C2 (de) | 6-(o-Chlorphenyl)-8-chlor-4H-imidazo-[1,2-a] [1,4]-benzodiazepine und Verfahren zu ihrer Herstellung | |
| DD236928A5 (de) | Verfahren zur herstellung neuer 1,2,4-triazolo-carbamate | |
| DE1670305C3 (de) | 5-Phenyl-2,4-dioxo-1,2,3,4-tetrahydro-3H-1,5-benzodiazepine und Verfahren zu ihrer Herstellung | |
| DE1807218A1 (de) | Oxotremorin-Antagonisten und Verfahren zu deren Herstellung | |
| DE2945701A1 (de) | S-triazinone und s-triazinthione, verfahren zu deren herstellung und diese verbindungen enthaltende therapeutische zubereitungen | |
| DE2707270A1 (de) | Pyrazolo-diazepine und verfahren zu ihrer herstellung | |
| DE2107871C3 (enExample) | ||
| CH512436A (de) | Verfahren zur Herstellung basisch substituierter Amide von N-substituierten Anthranilsäuren und ihrer Salze | |
| CH480350A (de) | Verfahren zur Herstellung von neuen, kondensierten heterocyclischen Verbindungen | |
| DE1076691B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| DE2609397A1 (de) | 8-aminotheophyllinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittelzubereitungen | |
| DE1695390C3 (de) | 8-Azaspiro [4,5 ] decan-7,9-dionderivate | |
| DE2039723C3 (de) | Neue Imidazolidinonderivate | |
| CH626056A5 (enExample) | ||
| CH495368A (de) | Verfahren zur Herstellung von Azaspiroalkandionen | |
| AT262289B (de) | Verfahren zur Herstellung von neuen Acridanderivaten und ihren Additionssalzen mit anorganischen und organischen Säuren | |
| DE2158959A1 (de) | Neue Imidazohdinonderivate und Verfahren zu ihrer Herstellung | |
| AT363943B (de) | Verfahren zur herstellung von neuen aminoalkylheterocyclen und ihren saeureadditionssalzen | |
| DE2063173C3 (de) | 3- (5- Bromph enyl-2-tetr az olyl) propionylamide, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |