CH463494A - Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo(a,d)cycloheptenen - Google Patents
Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo(a,d)cycloheptenenInfo
- Publication number
- CH463494A CH463494A CH184767A CH184767A CH463494A CH 463494 A CH463494 A CH 463494A CH 184767 A CH184767 A CH 184767A CH 184767 A CH184767 A CH 184767A CH 463494 A CH463494 A CH 463494A
- Authority
- CH
- Switzerland
- Prior art keywords
- dihydro
- dibenzo
- compound
- formula
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 6
- PJQCANLCUDUPRF-UHFFFAOYSA-N dibenzocycloheptene Chemical class C1CC2=CC=CC=C2CC2=CC=CC=C12 PJQCANLCUDUPRF-UHFFFAOYSA-N 0.000 title description 3
- -1 1-piperidyl Chemical group 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 15
- 239000007818 Grignard reagent Substances 0.000 claims description 7
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 claims description 7
- 150000004795 grignard reagents Chemical class 0.000 claims description 7
- 150000002576 ketones Chemical group 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical group [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- VBMVFJIFEVLDGP-UHFFFAOYSA-N n,n-dimethyl-11-oxo-5,6-dihydrodibenzo[3,1-[7]annulene-2-sulfonamide Chemical compound C1CC2=CC=CC=C2C(=O)C2=CC(S(=O)(=O)N(C)C)=CC=C21 VBMVFJIFEVLDGP-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DBFNDEWHJVIKBJ-UHFFFAOYSA-N 2-[3-(dimethylamino)propylidene]-N,N-dimethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-sulfonamide Chemical compound CN(CCC=C1C2=C(CCC3=C1C=C(C=C3)S(N(C)C)(=O)=O)C=CC=C2)C DBFNDEWHJVIKBJ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000001933 cycloheptenes Chemical class 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 125000005265 dialkylamine group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- SFHGZGMYSAGHBK-UHFFFAOYSA-N 2-bromo-11-oxo-5,6-dihydrodibenzo[3,1-b:3',1'-f][7]annulene-9-sulfonyl fluoride Chemical compound C1CC2=CC=C(Br)C=C2C(=O)C2=CC(S(=O)(=O)F)=CC=C21 SFHGZGMYSAGHBK-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- HUHXUISXWIZBMQ-UHFFFAOYSA-N IC=1C=CC2=C(C(C3=C(CC2)C=CC=C3)=O)C=1 Chemical compound IC=1C=CC2=C(C(C3=C(CC2)C=CC=C3)=O)C=1 HUHXUISXWIZBMQ-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 101100334476 Mus musculus Fbrs gene Proteins 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- XHRNQDMNINGCES-UHFFFAOYSA-N cyclohept-4-en-1-one Chemical compound O=C1CCC=CCC1 XHRNQDMNINGCES-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002221 fluorine Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- NRTLTGGGUQIRRT-UHFFFAOYSA-N triethylazanium;bromide Chemical compound [Br-].CC[NH+](CC)CC NRTLTGGGUQIRRT-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/78—Halides of sulfonic acids
- C07C309/86—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/09—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton the carbon skeleton being further substituted by at least two halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/20—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a ring other than a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/37—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Moulds For Moulding Plastics Or The Like (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US225864A US3306934A (en) | 1962-09-24 | 1962-09-24 | 5-(aminopropylidene)-and 5-hydroxy-5-(aminopropyl)-3-dialkylsulfamoyl-5h-dibenzo[a,d] cycloheptenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH463494A true CH463494A (de) | 1968-10-15 |
Family
ID=22846564
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH184767A CH463494A (de) | 1962-09-24 | 1963-09-24 | Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo(a,d)cycloheptenen |
| CH1176163A CH456578A (de) | 1962-09-24 | 1963-09-24 | Verfahren zur Herstellung von 5H-Dibenzo(a,d)cycloheptenen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1176163A CH456578A (de) | 1962-09-24 | 1963-09-24 | Verfahren zur Herstellung von 5H-Dibenzo(a,d)cycloheptenen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3306934A (Direct) |
| AT (1) | AT260203B (Direct) |
| CH (2) | CH463494A (Direct) |
| DE (1) | DE1468283A1 (Direct) |
| DK (1) | DK119354B (Direct) |
| ES (1) | ES292187A1 (Direct) |
| FR (1) | FR3193M (Direct) |
| GB (4) | GB1063524A (Direct) |
| NL (2) | NL147726B (Direct) |
| NO (1) | NO115799B (Direct) |
| SE (2) | SE318271B (Direct) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3458516A (en) * | 1968-02-16 | 1969-07-29 | American Cyanamid Co | 11-(piperazinyl)dibenz(b,f)(1,4)oxazepines and analogous thiazepines |
| US3903301A (en) * | 1973-02-28 | 1975-09-02 | Merck & Co Inc | Methods of treating muscular disorders |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2686202A (en) * | 1951-03-19 | 1954-08-10 | Pennsylvania Salt Mfg Co | Production of aromatic sulfonyl fluorides |
| US2726265A (en) * | 1954-05-27 | 1955-12-06 | Du Pont | N-2-hydroxy-1-(p-sulfamylbenzoyl) ethylacylamides |
| FR1212723A (fr) * | 1958-01-09 | 1960-03-25 | Rhone Poulenc Sa | Nouveaux dérivés de la phénothiazine à chaîne carbamoylpipérazine et leur préparation |
| US3055890A (en) * | 1958-01-24 | 1962-09-25 | Rhone Poulenc Sa | Phenthiazine derivatives |
| NL240007A (Direct) * | 1958-06-10 | |||
| US3073847A (en) * | 1959-02-12 | 1963-01-15 | Hoffmann La Roche | 9-(3-amino-1-propynyl) derivatives of 9-xanthenols and 9-thioxanthenols and a process for their preparation |
| NL251370A (Direct) * | 1959-05-08 | |||
| US3082210A (en) * | 1959-10-29 | 1963-03-19 | Rhone Poulenc Sa | New 10-(azetidinyl-alkyl)phenthiazines |
-
0
- NL NL298304D patent/NL298304A/xx unknown
-
1962
- 1962-09-24 US US225864A patent/US3306934A/en not_active Expired - Lifetime
-
1963
- 1963-09-17 DE DE19631468283 patent/DE1468283A1/de active Granted
- 1963-09-18 AT AT751663A patent/AT260203B/de active
- 1963-09-20 GB GB5915/66A patent/GB1063524A/en not_active Expired
- 1963-09-20 GB GB5913/66A patent/GB1063522A/en not_active Expired
- 1963-09-20 GB GB37089/63A patent/GB1063521A/en not_active Expired
- 1963-09-20 GB GB5914/66A patent/GB1063523A/en not_active Expired
- 1963-09-21 NO NO150187A patent/NO115799B/no unknown
- 1963-09-23 DK DK447763AA patent/DK119354B/da unknown
- 1963-09-23 ES ES292187A patent/ES292187A1/es not_active Expired
- 1963-09-23 SE SE10372/63A patent/SE318271B/xx unknown
- 1963-09-24 CH CH184767A patent/CH463494A/de unknown
- 1963-09-24 CH CH1176163A patent/CH456578A/de unknown
- 1963-09-24 NL NL63298304A patent/NL147726B/xx unknown
- 1963-12-20 FR FR957991A patent/FR3193M/fr not_active Expired
-
1966
- 1966-07-28 SE SE17804/66A patent/SE344588B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE344588B (Direct) | 1972-04-24 |
| NO115799B (Direct) | 1968-12-09 |
| NL147726B (nl) | 1975-11-17 |
| US3306934A (en) | 1967-02-28 |
| SE318271B (Direct) | 1969-12-08 |
| DE1468283A1 (de) | 1968-11-28 |
| GB1063524A (en) | 1967-03-30 |
| GB1063523A (en) | 1967-03-30 |
| ES292187A1 (es) | 1963-12-01 |
| GB1063521A (en) | 1967-03-30 |
| FR3193M (fr) | 1965-03-15 |
| DK119354B (da) | 1970-12-21 |
| AT260203B (de) | 1968-02-12 |
| CH456578A (de) | 1968-07-31 |
| NL298304A (Direct) | |
| GB1063522A (en) | 1967-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3010195C2 (Direct) | ||
| DE1518002A1 (de) | Verfahren zur Herstellung von 4-Aryl-isoflavanoiden | |
| CH463494A (de) | Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo(a,d)cycloheptenen | |
| DE2609015A1 (de) | Verfahren zur herstellung von benz (f)-2,5-oxazocinen | |
| CH438352A (de) | Verfahren zur Herstellung von Diphenylalkylaminen | |
| DE10332684B3 (de) | Verfahren zur Herstellung von Bifonazol | |
| CH663204A5 (de) | Propannitrilderivate. | |
| DE1468283C (Direct) | ||
| CH493484A (de) | Verfahren zur Herstellung von 5H-Dibenzo (a,d)cycloheptenen | |
| DE1470264C3 (de) | Verfahren zur Herstellung von 1-Phenyl-1 - eckige Klammer auf thienyl-(2) eckige Klammer zu -carbinolen | |
| CH413825A (de) | Verfahren zur Herstellung von neuen Aminen | |
| AT226692B (de) | Verfahren zur Herstellung von neuen α-Pyrrolidino-valerophenonen | |
| AT278775B (de) | Verfahren zur Herstellung von Δ<2>-Imidazolinderivaten und ihren Salzen | |
| CH444850A (de) | Verfahren zur Herstellung von 5H-Dibenzo(a,d)cycloheptenen | |
| AT256844B (de) | Verfahren zur Herstellung von neuen 6,11-Dihydrodibenzo-[b,e]-thiepinen | |
| AT242139B (de) | Verfahren zur Herstellung von neuen Piperidinderivaten | |
| DE2124403A1 (de) | Verfahren zur Herstellung von Amitnptyhn und verwandten Verbindungen | |
| AT218526B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten | |
| DE916055C (de) | Verfahren zur Herstellung von Aminoverbindungen | |
| AT359210B (de) | Verfahren zur herstellung von desoxyvincamin- amiden | |
| AT282609B (de) | Verfahren zur herstellung von 3-aminoalkyl-3-arylindanolen-(1) und 1-aminoalkyl-1-arylindenen, deren derivaten und ihren saeureadditionssalzen | |
| AT319207B (de) | Vzh von neuen 3-(2',4',5'-trisubst.benzoyl)-propionsaeuren | |
| AT282630B (de) | Verfahren zur Herstellung neuer Zimtsäureamide | |
| CH443298A (de) | Verfahren zur Herstellung eines neuen Isoxazolderivates | |
| EP4045482A1 (de) | Verfahren zur herstellung von 1,1'-disulfandiylbis(4-fluor-2-methyl-5-nitrobenzol) |