CH439327A - Verfahren zur Herstellung von 1-Phenyl-1-(o-chlor-phenyl)-3-tert.-amino-propanolen-(1) - Google Patents
Verfahren zur Herstellung von 1-Phenyl-1-(o-chlor-phenyl)-3-tert.-amino-propanolen-(1)Info
- Publication number
- CH439327A CH439327A CH745864A CH745864A CH439327A CH 439327 A CH439327 A CH 439327A CH 745864 A CH745864 A CH 745864A CH 745864 A CH745864 A CH 745864A CH 439327 A CH439327 A CH 439327A
- Authority
- CH
- Switzerland
- Prior art keywords
- phenyl
- chlorophenyl
- tert
- amino
- alkyl groups
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 239000000243 solution Substances 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- -1 [o-chloro-phenyl] -magnesium halides Chemical class 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 238000003756 stirring Methods 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- QBELEDRHMPMKHP-UHFFFAOYSA-N 1-bromo-2-chlorobenzene Chemical compound ClC1=CC=CC=C1Br QBELEDRHMPMKHP-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 230000000954 anitussive effect Effects 0.000 claims description 2
- 229940124584 antitussives Drugs 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000006227 byproduct Substances 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/02—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions involving the formation of amino groups from compounds containing hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C221/00—Preparation of compounds containing amino groups and doubly-bound oxygen atoms bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0025420 | 1958-04-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH439327A true CH439327A (de) | 1967-07-15 |
Family
ID=7091623
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH7080859A CH408053A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(chlor-phenyl)-3-tert.-aminopropanolen-(1) |
| CH745864A CH439327A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(o-chlor-phenyl)-3-tert.-amino-propanolen-(1) |
| CH1676364A CH418353A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(o-chlorphenyl)-3-tert.-aminopropanolen-(1) |
| CH745764A CH441377A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(o-chlor-phenyl)-3-tert.-aminopropanolen-(1) |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH7080859A CH408053A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(chlor-phenyl)-3-tert.-aminopropanolen-(1) |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1676364A CH418353A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(o-chlorphenyl)-3-tert.-aminopropanolen-(1) |
| CH745764A CH441377A (de) | 1958-04-05 | 1959-03-16 | Verfahren zur Herstellung von 1-Phenyl-1-(o-chlor-phenyl)-3-tert.-aminopropanolen-(1) |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE577370A (enExample) |
| CH (4) | CH408053A (enExample) |
| FR (1) | FR451M (enExample) |
-
1959
- 1959-03-16 CH CH7080859A patent/CH408053A/de unknown
- 1959-03-16 CH CH745864A patent/CH439327A/de unknown
- 1959-03-16 CH CH1676364A patent/CH418353A/de unknown
- 1959-03-16 CH CH745764A patent/CH441377A/de unknown
- 1959-04-04 BE BE577370A patent/BE577370A/fr unknown
-
1960
- 1960-08-30 FR FR837161A patent/FR451M/fr active Active
Also Published As
| Publication number | Publication date |
|---|---|
| CH418353A (de) | 1966-08-15 |
| CH408053A (de) | 1966-02-28 |
| CH441377A (de) | 1967-08-15 |
| FR451M (enExample) | 1961-04-24 |
| BE577370A (fr) | 1959-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH439327A (de) | Verfahren zur Herstellung von 1-Phenyl-1-(o-chlor-phenyl)-3-tert.-amino-propanolen-(1) | |
| EP0018540B1 (de) | Ester des Isocamphyl-guajakols, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von 3-(Iso-camphyl-(5))-cyclohexanol | |
| AT246747B (de) | Verfahren zur Herstellung eines L-Lyxopyranosylhalogenids | |
| AT224125B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| DE917424C (de) | Verfahren zur Herstellung von N-Acetyl-propargyl-arylaminen und ihrer p-staendigen Substitutionsprodukte | |
| AT203495B (de) | Verfahren zur Herstellung von neuen tertiären Aminen | |
| AT211819B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| AT240850B (de) | Verfahren zur Herstellung neuer Thiophenverbindungen | |
| AT155800B (de) | Verfahren zur Herstellung von Diaminoalkoholen. | |
| AT206898B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| AT372080B (de) | Verfahren zum herstellen von neuen optisch aktiven prost-5-en-13-in-carbonsaeurederivaten | |
| AT201582B (de) | Verfahren zur Herstellung von neuen Dimethylaminopropoxybenzolen | |
| US1649668A (en) | Iso-alkyl resorcinol | |
| AT338772B (de) | Verfahren zur herstellung neuer 3- (4-biphenylyl)-buttersauren, deren ester, amide und salze | |
| DE1906551C3 (de) | 2-Alkoxy-3,5-dihalogenphenyldialkylamlnoalkyläther | |
| AT230389B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| AT335436B (de) | Verfahren zur herstellung neuer 3-(4-biphenylyl)-buttersauren, deren estern, amiden und salzen | |
| AT235274B (de) | Verfahren zur Herstellung von 3,4-Dichlormandelsäure und deren Methyläther | |
| AT334349B (de) | Verfahren zur herstellung von neuen 3- (4-biphenylyl) -buttersauren, deren estern, amiden und salzen | |
| AT210896B (de) | Verfahren zur Herstellung neuer tert.-Alkylferrocene | |
| AT226235B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| AT210435B (de) | Verfahren zur Herstellung von neuen Ferrocenderivaten | |
| DE1620536C (de) | Verfahren zur Herstellung von alpha Pyrrolidinoketonen und ihren Salzen | |
| AT282628B (de) | Verfahren zur herstellung neuer zimtsaeureamide | |
| AT247859B (de) | Verfahren zur Herstellung neuer sekundär-tertiärer Alkendiole |