CH356121A - Verfahren zur Herstellung von N-monosubstituierten Amiden vona-Aminoalkyl-a-phenyl-essigsäuren - Google Patents
Verfahren zur Herstellung von N-monosubstituierten Amiden vona-Aminoalkyl-a-phenyl-essigsäurenInfo
- Publication number
- CH356121A CH356121A CH356121DA CH356121A CH 356121 A CH356121 A CH 356121A CH 356121D A CH356121D A CH 356121DA CH 356121 A CH356121 A CH 356121A
- Authority
- CH
- Switzerland
- Prior art keywords
- dimethylamino
- methyl
- acid
- diphenyl
- diphenylvaleramide
- Prior art date
Links
- -1 N-monosubstituted amides Chemical class 0.000 title claims description 27
- 238000000034 method Methods 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 13
- 239000002253 acid Substances 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 14
- YGJYNWQCJYLWLV-UHFFFAOYSA-N 4-(dimethylamino)-2,2-diphenylpentanoic acid Chemical compound C=1C=CC=CC=1C(C(O)=O)(CC(C)N(C)C)C1=CC=CC=C1 YGJYNWQCJYLWLV-UHFFFAOYSA-N 0.000 claims description 12
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 11
- 150000001408 amides Chemical class 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 229930195733 hydrocarbon Natural products 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000001302 tertiary amino group Chemical group 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 7
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims 5
- 125000005843 halogen group Chemical group 0.000 claims 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims 3
- 150000002825 nitriles Chemical class 0.000 claims 3
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 claims 2
- 229910052698 phosphorus Inorganic materials 0.000 claims 2
- 239000011574 phosphorus Substances 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 126
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 45
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 34
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 238000002844 melting Methods 0.000 description 26
- 230000008018 melting Effects 0.000 description 26
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 25
- 239000000203 mixture Substances 0.000 description 24
- 230000002378 acidificating effect Effects 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000000460 chlorine Substances 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 18
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- 239000012458 free base Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- AEMHOWVIRUDMDB-UHFFFAOYSA-N 4-(dimethylamino)-2,2-diphenylpentanoyl chloride Chemical compound CC(CC(C(Cl)=O)(C1=CC=CC=C1)C1=CC=CC=C1)N(C)C AEMHOWVIRUDMDB-UHFFFAOYSA-N 0.000 description 13
- LNAGWQRZAGHEBH-UHFFFAOYSA-N 4-(dimethylamino)-n-methyl-2,2-diphenylpentanamide Chemical compound C=1C=CC=CC=1C(CC(C)N(C)C)(C(=O)NC)C1=CC=CC=C1 LNAGWQRZAGHEBH-UHFFFAOYSA-N 0.000 description 13
- 229950001902 dimevamide Drugs 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- 229940102396 methyl bromide Drugs 0.000 description 9
- 239000004305 biphenyl Substances 0.000 description 8
- 230000001882 diuretic effect Effects 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 230000002196 ecbolic effect Effects 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- NARHAGIVSFTMIG-UHFFFAOYSA-N 4-(dimethylamino)-2,2-diphenylpentanamide Chemical compound C=1C=CC=CC=1C(C(N)=O)(CC(C)N(C)C)C1=CC=CC=C1 NARHAGIVSFTMIG-UHFFFAOYSA-N 0.000 description 6
- UBRDSIYXHHJNJH-UHFFFAOYSA-N 4-(dimethylamino)-n-ethyl-2,2-diphenylpentanamide Chemical compound C=1C=CC=CC=1C(CC(C)N(C)C)(C(=O)NCC)C1=CC=CC=C1 UBRDSIYXHHJNJH-UHFFFAOYSA-N 0.000 description 6
- 230000001476 alcoholic effect Effects 0.000 description 6
- 230000001078 anti-cholinergic effect Effects 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 229910021653 sulphate ion Inorganic materials 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 208000004880 Polyuria Diseases 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- NJFJYYLQTHJUCN-UHFFFAOYSA-N n-cyclohexyl-4-(dimethylamino)-2,2-diphenylpentanamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(CC(C)N(C)C)C(=O)NC1CCCCC1 NJFJYYLQTHJUCN-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- JIRWRHJIVGYBBZ-UHFFFAOYSA-N 4-(dimethylamino)-2,2-diphenyl-n-propan-2-ylpentanamide Chemical compound C=1C=CC=CC=1C(CC(C)N(C)C)(C(=O)NC(C)C)C1=CC=CC=C1 JIRWRHJIVGYBBZ-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- GJJQIGFCGLPOQK-UHFFFAOYSA-N methadone intermediate Chemical compound C=1C=CC=CC=1C(C#N)(CC(C)N(C)C)C1=CC=CC=C1 GJJQIGFCGLPOQK-UHFFFAOYSA-N 0.000 description 4
- XBOQPGNZBJLXJS-UHFFFAOYSA-N 4-(dimethylamino)-n,2,2-triphenylpentanamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(CC(C)N(C)C)C(=O)NC1=CC=CC=C1 XBOQPGNZBJLXJS-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QNXCYAKGVHOQGW-UHFFFAOYSA-N N-butyl-4-(dimethylamino)-2,2-diphenylpentanamide Chemical compound C(CCC)NC(C(CC(C)N(C)C)(C1=CC=CC=C1)C1=CC=CC=C1)=O QNXCYAKGVHOQGW-UHFFFAOYSA-N 0.000 description 3
- 230000001262 anti-secretory effect Effects 0.000 description 3
- 230000002921 anti-spasmodic effect Effects 0.000 description 3
- 239000000812 cholinergic antagonist Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical group CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 230000003248 secreting effect Effects 0.000 description 3
- 229940005605 valeric acid Drugs 0.000 description 3
- PHODFIDDEBEGCS-UHFFFAOYSA-N 2,2-dimethylpyrrolidine Chemical compound CC1(C)CCCN1 PHODFIDDEBEGCS-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- RJKCKIDPLXFVRX-UHFFFAOYSA-N 4-(dimethylamino)-2,2-diphenyl-n-(2-pyrrolidin-1-ylethyl)pentanamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(CC(C)N(C)C)C(=O)NCCN1CCCC1 RJKCKIDPLXFVRX-UHFFFAOYSA-N 0.000 description 2
- RBYZWAMMGUXVDN-UHFFFAOYSA-N 5-(diethylamino)-2,2-diphenylpentanoic acid Chemical compound C(C)N(CCCC(C(=O)O)(C1=CC=CC=C1)C1=CC=CC=C1)CC RBYZWAMMGUXVDN-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002863 oxytocic agent Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- UPMXKGLJGJTVTG-UHFFFAOYSA-N (dimethylazaniumyl) sulfate Chemical group CN(C)OS(O)(=O)=O UPMXKGLJGJTVTG-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- LQMMFVPUIVBYII-UHFFFAOYSA-N 2-methylmorpholine Chemical compound CC1CNCCO1 LQMMFVPUIVBYII-UHFFFAOYSA-N 0.000 description 1
- RGHPCLZJAFCTIK-UHFFFAOYSA-N 2-methylpyrrolidine Chemical group CC1CCCN1 RGHPCLZJAFCTIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HKBSFGPFAYMXJL-UHFFFAOYSA-N 4-(dimethylamino)-2,2-diphenyl-n-propan-2-ylpentanamide;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(CC(C)N(C)C)(C(=O)NC(C)C)C1=CC=CC=C1 HKBSFGPFAYMXJL-UHFFFAOYSA-N 0.000 description 1
- BVPWJMCABCPUQY-UHFFFAOYSA-N 4-amino-5-chloro-2-methoxy-N-[1-(phenylmethyl)-4-piperidinyl]benzamide Chemical compound COC1=CC(N)=C(Cl)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 BVPWJMCABCPUQY-UHFFFAOYSA-N 0.000 description 1
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 1
- JCDKHHBMFSCUMQ-UHFFFAOYSA-N 5-(diethylamino)-2,2-diphenylpentanenitrile Chemical compound C(C)N(CCCC(C#N)(C1=CC=CC=C1)C1=CC=CC=C1)CC JCDKHHBMFSCUMQ-UHFFFAOYSA-N 0.000 description 1
- RDYSZYUPSALKBH-UHFFFAOYSA-N 5-(diethylamino)-2,2-diphenylpentanoyl chloride Chemical compound C(C)N(CCCC(C(=O)Cl)(C1=CC=CC=C1)C1=CC=CC=C1)CC RDYSZYUPSALKBH-UHFFFAOYSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical class ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000002731 stomach secretion inhibitor Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229940125711 uterine stimulant agent Drugs 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US516764A US3022314A (en) | 1955-06-20 | 1955-06-20 | Alpha-phenyl-omega-amino-alkanamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH356121A true CH356121A (de) | 1961-08-15 |
Family
ID=24056995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH356121D CH356121A (de) | 1955-06-20 | 1956-05-11 | Verfahren zur Herstellung von N-monosubstituierten Amiden vona-Aminoalkyl-a-phenyl-essigsäuren |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3022314A (enExample) |
| CH (1) | CH356121A (enExample) |
| DE (1) | DE1035150B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0046707A1 (fr) * | 1980-08-27 | 1982-03-03 | Sanofi S.A. | Dérivés de l'acide amino-4 butyrique et les médicaments, actifs notamment sur le système nerveux central, en contenant |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3299121A (en) * | 1961-11-06 | 1967-01-17 | Monsanto Co | Thio bis |
| US3337624A (en) * | 1965-02-25 | 1967-08-22 | Hooker Chemical Corp | Amides of 4, 5, 6-trichloroisophthalic acid |
| US4107205A (en) * | 1977-03-11 | 1978-08-15 | G. D. Searle & Co. | α-Aryl-α,α-bis[ω-(disubstituted amino)alkyl]acetamides and related compounds |
| US4217306A (en) * | 1978-05-01 | 1980-08-12 | G. D. Searle & Co. | α-Aryl-α,α-bis[ω-(disubstituted amino)alkyl]-acetamides |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE504085A (enExample) * | ||||
| DE606349C (de) * | 1933-01-04 | 1934-11-30 | Merck Ag E | Verfahren zur Herstellung von Verbindungen der Hydrouracilreihe |
| US2647926A (en) * | 1952-06-12 | 1953-08-04 | Bristol Lab Inc | Diphenyl-dimethyl-aminovaleramide |
-
1955
- 1955-06-20 US US516764A patent/US3022314A/en not_active Expired - Lifetime
-
1956
- 1956-05-11 CH CH356121D patent/CH356121A/de unknown
- 1956-06-14 DE DEU3956A patent/DE1035150B/de active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0046707A1 (fr) * | 1980-08-27 | 1982-03-03 | Sanofi S.A. | Dérivés de l'acide amino-4 butyrique et les médicaments, actifs notamment sur le système nerveux central, en contenant |
| FR2489319A1 (fr) * | 1980-08-27 | 1982-03-05 | Clin Midy | Derives de l'acide amino-4 butyrique et les medicaments, actifs notamment sur le systeme nerveux central, en contenant |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1035150C2 (enExample) | 1959-01-08 |
| US3022314A (en) | 1962-02-20 |
| DE1035150B (de) | 1958-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1493579B1 (de) | Verfahren zur Herstellung neuer pharmazeutisch wertvoller Verbindungen | |
| DE1670536B2 (de) | Neue 2-Anilino-5-acylamino-pyrimidlne | |
| DE2047658C3 (de) | 2-Styryl- und 2-Phenyläthinylbenzylaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| EP0110869A1 (de) | Thienylessigsäureamidderivate und pharmazeutisch verträgliche Säureadditionssalze hiervon sowie Verfahren zu deren Herstellung | |
| DE1017612B (de) | Verfahren zur Herstellung von tertiaeren Aminen, ihren Saeureadditionssalzen und quaternaeren Ammoniumverbindungen | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH356121A (de) | Verfahren zur Herstellung von N-monosubstituierten Amiden vona-Aminoalkyl-a-phenyl-essigsäuren | |
| DE1103342B (de) | Verfahren zur Herstellung neuer 1, 2-Diphenyl-3, 5-dioxo-1, 2, 4-triazolidin-Derivate | |
| CH419105A (de) | Verfahren zur Herstellung analeptisch wirksamer N-substituierter Amino-norcamphanderivate bzw. von deren Säureadditionssalzen und quaternären Ammoniumverbindungen | |
| DE2560602C2 (de) | Sauerstoffhaltige Diarylamidine | |
| DE2540334C2 (de) | Benzylaminoalkansäuren, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zubereitungen | |
| DE2240211A1 (de) | Fluorsubstituierte 3-(methylamino)- und 3-(dimethylamino)-tetrahydrocarbazole | |
| DE968561C (de) | Verfahren zur Herstellung von am Aminostickstoff substituierten Monoaminoacylaniliden | |
| DE862602C (de) | Verfahren zur Herstellung von Halogendiamidinen und ihren Salzen | |
| DE1046063B (de) | Verfahren zur Herstellung neuer, amoebicid wirkender Acetanilide | |
| DE946058C (de) | Verfahren zur Herstellung von 3-Aminoindanen | |
| AT257578B (de) | Verfahren zur Herstellung von neuen Phenyl-α-aminoalkyl-ketonen und deren Säureadditionssalzen | |
| DE950550C (de) | Verfahren zur Herstellung von basisch substituierten Phenylcycloalkenylpropanolen | |
| CH398613A (de) | Verfahren zur Herstellung von neuen Piperazinen | |
| AT226710B (de) | Verfahren zur Herstellung von neuen Dihydrochinoxalonen-(2) und von deren Salzen | |
| AT288393B (de) | Verfahren zur Herstellung von neuen Zimtsäureamiden | |
| AT266075B (de) | Verfahren zur Herstellung von neuen Sulfonaniliden und deren Säureadditions- und Metallsalzen | |
| DE1018868B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| DE1670019A1 (de) | Aeetylenische Imide und Verfahren zu deren Herstellung | |
| AT250342B (de) | Verfahren zur Herstellung von neuen Derivaten des 1-Phenyl-2, 3-dimethyl-4-amino-pyrazolons-(5) |