CH120252A - Verfahren zur Darstellung hochkonzentrierter Ätzalkalilaugen. - Google Patents
Verfahren zur Darstellung hochkonzentrierter Ätzalkalilaugen.Info
- Publication number
- CH120252A CH120252A CH120252DA CH120252A CH 120252 A CH120252 A CH 120252A CH 120252D A CH120252D A CH 120252DA CH 120252 A CH120252 A CH 120252A
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation
- highly concentrated
- amalgam
- concentrated caustic
- alkalis
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000003518 caustics Substances 0.000 title description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- 229910000497 Amalgam Inorganic materials 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 235000011121 sodium hydroxide Nutrition 0.000 claims 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 238000007743 anodising Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/70—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid
- H01H33/76—Switches with separate means for directing, obtaining, or increasing flow of arc-extinguishing fluid wherein arc-extinguishing gas is evolved from stationary parts; Selection of material therefor
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/12—Auxiliary contacts on to which the arc is transferred from the main contacts
- H01H33/121—Load break switches
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K7/00—Lamps for purposes other than general lighting
- H01K7/04—Lamps for purposes other than general lighting for indicating
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H33/00—High-tension or heavy-current switches with arc-extinguishing or arc-preventing means
- H01H33/02—Details
- H01H33/04—Means for extinguishing or preventing arc between current-carrying parts
- H01H33/08—Stationary parts for restricting or subdividing the arc, e.g. barrier plate
- H01H2033/085—Stationary parts for restricting or subdividing the arc, e.g. barrier plate using a flat arc chute, the width of arc chamber being only slightly greater then thickness of switch blade
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Arc-Extinguishing Devices That Are Switches (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE320531X | 1951-05-25 | ||
| DEC5396A DE1053615B (de) | 1951-05-25 | 1951-05-25 | Lichtbogen-Loeschkammer fuer elektrische Schalter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH120252A true CH120252A (de) | 1927-05-02 |
Family
ID=25799604
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH120252D CH120252A (de) | 1951-05-25 | 1926-04-15 | Verfahren zur Darstellung hochkonzentrierter Ätzalkalilaugen. |
| CH320531D CH320531A (de) | 1951-05-25 | 1952-05-21 | Trennschalter mit Schnellschaltvorrichtung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH320531D CH320531A (de) | 1951-05-25 | 1952-05-21 | Trennschalter mit Schnellschaltvorrichtung |
Country Status (4)
| Country | Link |
|---|---|
| CH (2) | CH120252A (index.php) |
| DE (1) | DE1053615B (index.php) |
| FR (1) | FR412771A (index.php) |
| NL (2) | NL96095C (index.php) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1156470B (de) * | 1959-06-11 | 1963-10-31 | Licentia Gmbh | Leistungsschalter mit Flachloeschkammer |
| US3056009A (en) * | 1959-06-30 | 1962-09-25 | Westinghouse Electric Corp | Electric-switch construction |
| DE1105947B (de) * | 1960-03-23 | 1961-05-04 | Siemens Ag | Elektrischer Schalter, insbesondere Lasttrennschalter |
| DE1175315B (de) * | 1960-05-10 | 1964-08-06 | Continental Elektro Ind Ag | Lasttrennschalter |
| US3066209A (en) * | 1960-12-08 | 1962-11-27 | Ite Circuit Breaker Ltd | Distribution side opening load break switch |
| DE1159538B (de) * | 1961-01-21 | 1963-12-19 | Energieversorgung Erfurt Veb | Loeschkammer fuer elektrische Schalteinrichtungen |
| DE1143252B (de) * | 1961-04-19 | 1963-02-07 | Sachsenwerk Licht & Kraft Ag | Trennschalter mit Loeschkammer-Lasttrennstelle |
| DE1134446B (de) * | 1961-05-16 | 1962-08-09 | Sachsenwerk Licht & Kraft Ag | Kontakteinrichtung fuer elektrische Schaltgeraete |
| US3136874A (en) * | 1961-06-28 | 1964-06-09 | Ite Circuit Breaker Ltd | Sealed arc chutes for an auxiliary interrupting blade of a circuit interrupter |
| DE2856670B2 (de) * | 1978-12-29 | 1980-11-20 | Concordia Sprecher-Schaltgeraete Gmbh, 7024 Filderstadt | Flachlöschkammer |
| DE2949607A1 (de) * | 1979-12-10 | 1981-06-11 | Concordia Sprecher-Schaltgeräte GmbH, 7024 Filderstadt | Flachloeschkammer |
| FR2628259A1 (fr) * | 1988-03-01 | 1989-09-08 | Merlin Gerin | Disjoncteur electrique a autosoufflage par pistonnage ou expansion de gaz isolant |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE661809C (index.php) * | ||||
| DE728612C (de) * | 1934-10-20 | 1942-11-30 | Siemens Ag | Schalter mit Lichtbogenkammer |
| DE644580C (de) * | 1935-02-23 | 1937-05-08 | Frida Strauss Geb Ruppel | Trennschalter mit Lichtbogenloescheinrichtung |
| DE671284C (de) * | 1935-07-03 | 1939-02-03 | Frida Strauss Geb Ruppel | OElgefuellter, elektrischer Apparat mit Lichtbogenbildung unter OEl, insbesondere Schlter |
| DE681438C (de) * | 1935-09-03 | 1939-09-22 | Frida Strauss Geb Ruppel | Installationsschalter mit Lichtbogenbildung |
| DE673883C (de) * | 1936-02-10 | 1939-03-30 | Aeg | Loeschrohr fuer elektrische Gasschalter |
| DE661561C (de) * | 1936-09-08 | 1938-06-21 | Aeg | Loeschrohr fuer elektrische Schalter |
| DE665376C (de) * | 1937-05-29 | 1938-09-23 | Aeg | Schaltkammer fuer elektrische Gasschalter |
| US2160681A (en) * | 1937-12-30 | 1939-05-30 | Westinghouse Electric & Mfg Co | Circuit interrupter |
| DE680261C (de) * | 1938-03-17 | 1939-08-25 | Aeg | Loeschrohr fuer elektrische Schalter mit Lichtbogenloeschung durch Gase und Daempfe |
| USB223901I5 (index.php) * | 1938-03-25 | |||
| DE690443C (de) * | 1938-10-13 | 1940-04-25 | Aeg | Schaltkammer fuer elektrische Gasschalter |
| DE690910C (de) * | 1938-10-16 | 1940-05-10 | Voigt & Haeffner Akt Ges | Blaskasten fuer Luftschalter mit Lichtbogenloeschung durch magnetische Blasung |
| DE711654C (de) * | 1938-11-06 | 1941-10-03 | Aeg | Elektrischer Stromunterbrecher mit Lichtbogenloeschung durch vom Lichtbogen selbst erzeugte Gase und Daempfe |
| DE725471C (de) * | 1939-06-28 | 1942-09-23 | Aeg | Elektrischer Stromunterbrecher |
| DE708319C (de) * | 1939-09-26 | 1941-07-17 | Aeg | Elektrischer Stromunterbrecher, insbesondere Gasschalter |
| DE726218C (de) * | 1940-05-09 | 1942-10-08 | Aeg | Elektrischer Stromunterbrecher mit Lichtbogenloeschung mittels durch den Lichtbogen aus festen gasabgebenden Schaltraumwandungen erzeugtem Loeschgas |
| DE737461C (de) * | 1941-02-27 | 1943-07-14 | Aeg | Elektrischer Stromunterbrecher, insbesondere Hochspannungsschalter |
| DE746525C (de) * | 1941-03-09 | 1944-08-03 | Elin Und Schorch Werke Ag Fuer | Trennschalter mit isolierendem keramischem Zwischenstueck zwischen Antrieb und Trennmesser |
| DE874929C (de) * | 1951-08-03 | 1953-04-27 | Licentia Gmbh | Elektrischer Stromunterbrecher, insbesondere Gasschalter, mit einer unter dem Einfluss der Lichtbogenwaerme loeschgasabgebenden Loeschkammer |
-
0
- NL NLAANVRAGE7302380,A patent/NL169844B/xx unknown
-
1910
- 1910-02-18 FR FR412771A patent/FR412771A/fr not_active Expired
-
1926
- 1926-04-15 CH CH120252D patent/CH120252A/de unknown
-
1951
- 1951-05-25 DE DEC5396A patent/DE1053615B/de active Pending
-
1952
- 1952-05-21 CH CH320531D patent/CH320531A/de unknown
-
1958
- 1958-04-17 NL NL226980A patent/NL96095C/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| NL96095C (index.php) | 1960-11-15 |
| NL169844B (nl) | |
| CH320531A (de) | 1957-03-31 |
| FR412771A (fr) | 1910-07-22 |
| NL226980A (index.php) | 1960-06-15 |
| DE1053615B (de) | 1959-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH120252A (de) | Verfahren zur Darstellung hochkonzentrierter Ätzalkalilaugen. | |
| DE3143149A1 (de) | Herstellung von 1,1,1,3,3,3-hexafluorpropan-2-ol durch katalytische reaktion von hexafluoracetonhydrat mit wasserstoff in der dampfphase | |
| GB282112A (en) | Manufacture of finely porous metals | |
| AT107844B (de) | Verfahren zur Darstellung hochkonzentrierter Aetzalkalilaugen. | |
| DE842198C (de) | Verfahren zur Herstellung von Vinylsulfonen | |
| US2550494A (en) | Salts of 3, 6 endoxohexahydrophthalic acid | |
| DE1048894B (de) | Verfahren zur Herstellung von Aluminiumoxyd | |
| US2681936A (en) | Sodium carbonate in cumene oxidation | |
| DE875519C (de) | Verfahren zur Herstellung von Kupferkatalysatoren | |
| US1965268A (en) | Use of lime in precipitation | |
| JPH02258062A (ja) | ニッケル/アルミナ触媒の製造方法 | |
| US2392669A (en) | Purification of alkali metal sulphates | |
| DE1817691B2 (de) | Verfahren zur Herstellung von Monoisopropylamin | |
| US1851418A (en) | Process for the production of alkali metal hydroxide by conversion of alkali metal salts with alkaline earth metal hydroxide | |
| DE492243C (de) | Abscheidung von Erdalkali-Phosphaten aus primaeren Alkaliphosphatlaugen | |
| US651509A (en) | Precipitation of precious metals from cyanid solutions. | |
| US1718287A (en) | Manufacture of calcium hypochlorite | |
| DE1276635B (de) | Verfahren zur Herstellung von Kaliumsorbat | |
| US1233273A (en) | Process of decomposing silicates. | |
| AT29276B (de) | Verfahren zur Darstellung von Schwefelzink. | |
| US1704909A (en) | Manufacture of alkali of high concentration | |
| DE186738C (index.php) | ||
| DE2501342B2 (de) | Verfahren zur Herstellung von Wasserstoffperoxid | |
| AT209864B (de) | Verfahren zur Herstellung von Kaliummonopersulfat (KHSO5) | |
| DE2713345A1 (de) | Verfahren zur herstellung von reinem brom |