CA1220086A - Box car - Google Patents
Box carInfo
- Publication number
- CA1220086A CA1220086A CA000435506A CA435506A CA1220086A CA 1220086 A CA1220086 A CA 1220086A CA 000435506 A CA000435506 A CA 000435506A CA 435506 A CA435506 A CA 435506A CA 1220086 A CA1220086 A CA 1220086A
- Authority
- CA
- Canada
- Prior art keywords
- box
- conveyor band
- conveyor
- car
- box car
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000005192 partition Methods 0.000 claims abstract description 60
- 239000013590 bulk material Substances 0.000 claims abstract description 35
- 239000002699 waste material Substances 0.000 claims abstract description 32
- 238000004140 cleaning Methods 0.000 claims abstract description 23
- 230000001174 ascending effect Effects 0.000 claims abstract description 16
- 238000010348 incorporation Methods 0.000 claims abstract description 3
- 238000006073 displacement reaction Methods 0.000 claims description 11
- 230000001360 synchronised effect Effects 0.000 claims description 3
- 238000007599 discharging Methods 0.000 claims 1
- 238000009434 installation Methods 0.000 description 11
- 239000000463 material Substances 0.000 description 6
- 239000004576 sand Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- 108091035710 E-box Proteins 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B61—RAILWAYS
- B61D—BODY DETAILS OR KINDS OF RAILWAY VEHICLES
- B61D15/00—Other railway vehicles, e.g. scaffold cars; Adaptations of vehicles for use on railways
-
- E—FIXED CONSTRUCTIONS
- E01—CONSTRUCTION OF ROADS, RAILWAYS, OR BRIDGES
- E01B—PERMANENT WAY; PERMANENT-WAY TOOLS; MACHINES FOR MAKING RAILWAYS OF ALL KINDS
- E01B27/00—Placing, renewing, working, cleaning, or taking-up the ballast, with or without concurrent work on the track; Devices therefor; Packing sleepers
-
- E—FIXED CONSTRUCTIONS
- E01—CONSTRUCTION OF ROADS, RAILWAYS, OR BRIDGES
- E01B—PERMANENT WAY; PERMANENT-WAY TOOLS; MACHINES FOR MAKING RAILWAYS OF ALL KINDS
- E01B27/00—Placing, renewing, working, cleaning, or taking-up the ballast, with or without concurrent work on the track; Devices therefor; Packing sleepers
- E01B27/06—Renewing or cleaning the ballast in situ, with or without concurrent work on the track
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Transportation (AREA)
- Mechanical Engineering (AREA)
- Machines For Laying And Maintaining Railways (AREA)
- Structure Of Belt Conveyors (AREA)
- Loading Or Unloading Of Vehicles (AREA)
- Filling Or Emptying Of Bunkers, Hoppers, And Tanks (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT0355482A AT378940B (de) | 1982-09-23 | 1982-09-23 | Schuettgutverladewagen, insbesondere zur abraumverladung von einer schotterbett-reinigungsmaschine |
| ATA3554/82 | 1982-09-23 | ||
| ATA879/83 | 1983-03-11 | ||
| AT87983A AT378973B (de) | 1983-03-11 | 1983-03-11 | Schuettgutverladewagen, insbesondere zur abraumverladung von einer schotterbett-reinigungsmaschine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1220086A true CA1220086A (en) | 1987-04-07 |
Family
ID=25594187
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000435506A Expired CA1220086A (en) | 1982-09-23 | 1983-08-26 | Box car |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4576538A (enExample) |
| AU (1) | AU557082B2 (enExample) |
| CA (1) | CA1220086A (enExample) |
| CH (1) | CH661074A5 (enExample) |
| DD (1) | DD210321A5 (enExample) |
| DE (1) | DE3312492A1 (enExample) |
| FR (1) | FR2533520B1 (enExample) |
| GB (1) | GB2127377B (enExample) |
| HU (1) | HU186803B (enExample) |
| IT (1) | IT1163518B (enExample) |
| PL (1) | PL143116B1 (enExample) |
| SU (1) | SU1176847A3 (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4925356A (en) * | 1985-06-06 | 1990-05-15 | Snead Edwin D | Self-unloading train for bulk commodities |
| ATE43380T1 (de) * | 1986-04-02 | 1989-06-15 | Plasser Bahnbaumasch Franz | Fahrbare anlage zum reinigen der schotterbettung eines gleises mit schotterverteileinrichtung. |
| AT389333B (de) * | 1986-09-08 | 1989-11-27 | Plasser Bahnbaumasch Franz | Gleisverfahrbare schuettgutverladewagen-anordnung mit regelbaren entladeschurren |
| IT1214197B (it) * | 1987-08-04 | 1990-01-10 | Danieli Off Mecc | Sistema per alimentare ed evacuare in continuo materiali in operazioni di risanamento piattaforme ferroviarie e simili. |
| GB8803593D0 (en) * | 1988-02-17 | 1988-03-16 | Standard Railway Wagon | Freight discharge of railway wagons |
| US4919583A (en) * | 1988-10-03 | 1990-04-24 | Speakman Jr William J | Trailer |
| AT398213B (de) * | 1989-10-31 | 1994-10-25 | Plasser Bahnbaumasch Franz | Maschine zum aufnehmen und verteilen des bettungsschotters |
| DE58903476D1 (de) * | 1989-11-27 | 1993-03-18 | Wiebe Hermann Grundstueck | Speicherbehaelter. |
| ATE90630T1 (de) * | 1989-12-01 | 1993-07-15 | Plasser Bahnbaumasch Franz | Schienengaengiger verladewagen fuer schuettgut. |
| US5203662A (en) * | 1989-12-01 | 1993-04-20 | Franz Plasser Bahnbaumaschinen-Industriegesellschaft M.B.H. | Track-bound freight car for bulk material |
| AT394530B (de) * | 1990-02-15 | 1992-04-27 | Plasser Bahnbaumasch Franz | Schuettgutverladewagen |
| US5033932A (en) * | 1990-05-29 | 1991-07-23 | Ira Compton | Harvest trailer with stick remover and load leveling structure |
| CN1027058C (zh) * | 1990-11-02 | 1994-12-21 | 弗朗茨普拉瑟尔铁路机械工业有限公司 | 连续收集和贮存被拆下钢轨扣件用的机械 |
| DE59100158D1 (de) * | 1990-12-14 | 1993-07-22 | Plasser Bahnbaumasch Franz | Verladewagen fuer schuettgut. |
| US5219262A (en) * | 1990-12-14 | 1993-06-15 | Franz Plasser Bahnbaumaschinen Industriegesellschaft M.B.H. | Freight car for transporting and storing bulk material |
| US5197845A (en) * | 1991-02-19 | 1993-03-30 | Snead Edwin D | Conveyor system for self-unloading train |
| AU643872B2 (en) * | 1991-02-27 | 1993-11-25 | Franz Plasser Bahnbaumaschinen-Industriegesellschaft M.B.H. | A transport wagon |
| US5277538A (en) * | 1991-03-26 | 1994-01-11 | Franz Plasser Bahnbaumaschinen-Industriegesellschaft M.B.H. | Loading car for bulk material |
| ATE127555T1 (de) * | 1991-09-03 | 1995-09-15 | Plasser Bahnbaumasch Franz | Maschinenanordnung zum aufnehmen, speichern und verteilen von schotter eines gleises. |
| AT398097B (de) * | 1991-11-13 | 1994-09-26 | Plasser Bahnbaumasch Franz | Anlage zur herstellung einer planumschutzschichte |
| SK280375B6 (sk) * | 1992-02-05 | 1999-12-10 | Mechanizace Traťového Hospodářství | Súprava na zachytávanie a prepravu sypkého materiá |
| AT671U1 (de) * | 1992-11-04 | 1996-03-25 | Plasser Bahnbaumasch Franz | Verladewagen zum speichern von schüttgut |
| CZ279535B6 (cs) * | 1993-05-07 | 1995-05-17 | Franz Plasser Bahnbaumaschinen-Industriegesellschaft M.B.H. | Nákladní vůz pro přepravu a ukládání sypkého materiálu |
| ES2083305T3 (es) * | 1993-08-31 | 1996-04-01 | Plasser Bahnbaumasch Franz | Maquina aspiradora para la aspiracion del balasto de una via. |
| AT403706B (de) * | 1993-12-01 | 1998-05-25 | Plasser Bahnbaumasch Franz | Maschinenanlage zur behandlung der schotterbettung eines gleises |
| RU2102549C1 (ru) * | 1995-11-10 | 1998-01-20 | Ярославский вагоноремонтный завод | Транспортная система для перегрузки сыпучего материала |
| DE59706089D1 (de) * | 1996-10-22 | 2002-02-28 | Plasser Bahnbaumasch Franz | Schüttgutverladewagen |
| ATE231940T1 (de) * | 1996-11-20 | 2003-02-15 | Plasser Bahnbaumasch Franz | Schüttgutverladewagen |
| AT405165B (de) * | 1997-05-28 | 1999-06-25 | Plasser Bahnbaumasch Franz | Schüttgutverladewagen |
| US6087677A (en) * | 1997-11-10 | 2000-07-11 | Integrated Silicon Solutions Inc. | High density self-aligned antifuse |
| AT6219U3 (de) * | 2002-07-23 | 2004-07-26 | Plasser Bahnbaumasch Franz | Verfahren zur beladung eines verladezuges |
| DE10338463A1 (de) * | 2003-08-21 | 2005-03-31 | Germanbelt Systems Gmbh & Co.Kg | Schüttgutwaggon |
| US20050281643A1 (en) * | 2004-03-01 | 2005-12-22 | Villar Christopher M | Conveyor system for loading hopper cars of dump train and associated methods |
| EP1775190A3 (en) * | 2005-10-17 | 2007-06-20 | VolkerRail Nederland BV | Renewal of the ballast bed of a railway |
| EP2054552B1 (de) * | 2006-08-25 | 2014-01-08 | Sersa Maschineller Gleisbau AG | Verfahren und vorrichtung zur erneuerung einer schotterbettung |
| US8132512B2 (en) * | 2009-03-04 | 2012-03-13 | H & H Railroad Contracting, Inc. | Railroad tie plate apparatus and method |
| US8528484B2 (en) * | 2009-03-04 | 2013-09-10 | H & H Railroad Contracting, Inc. | Railroad tie plate apparatus and method |
| AT507788B1 (de) * | 2009-06-03 | 2010-08-15 | Plasser Bahnbaumasch Franz | Schotterpflug zum einschottern eines gleises |
| DE102012220877A1 (de) * | 2012-11-15 | 2014-05-15 | K & K Maschinenentwicklungs Gmbh & Co. Kg | System zum gleisgebundenen Transport von Gegenständen |
| US9868451B2 (en) * | 2013-03-15 | 2018-01-16 | Georgetown Rail Equipment Company | Self-unloading aggregate train |
| CA2857903A1 (en) | 2014-07-28 | 2016-01-28 | Can American Stone Spreader Sales Ltd. | Apparatus for discharge of bulk materials |
| CA2963988C (en) | 2014-11-05 | 2018-03-20 | Herzog Railroad Services, Inc. | Material transport and distribution consist with controlled gated hopper cars and conveyor systems |
| PL234056B1 (pl) * | 2017-07-07 | 2020-01-31 | Int Tobacco Machinery Poland Spolka Z Ograniczona Odpowiedzialnoscia | Maszyna do produkcji sztabek wielosegmentowych i sposób czyszczenia maszyny do produkcji sztabek wielosegmentowych |
| AT520268B1 (de) * | 2017-08-11 | 2020-01-15 | Plasser & Theurer Export Von Bahnbaumaschinen Gmbh | Speicherwagen für Schüttgut |
| CN109849758B (zh) * | 2019-02-28 | 2021-03-23 | 江苏大学 | 一种用于货物的自动排放装置及方法 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT90348B (de) * | 1917-03-12 | 1922-12-11 | Edward Wayne Shutt | Auslegersturzgerüst zum Anschütten von Eisenbahndämmen. |
| DE402008C (de) * | 1923-12-02 | 1924-09-12 | Heinrich Schmetz | Vorrichtung zum Befoerdern und Entladen von Massengut |
| DE470175C (de) * | 1926-01-22 | 1929-01-11 | Albert Lampe | Einrichtung zum Foerdern und Abwerfen von Schuettgut |
| US1920500A (en) * | 1932-01-18 | 1933-08-01 | Cassidy | Conveyer apparatus for loading cars |
| GB417246A (en) * | 1932-12-29 | 1934-09-24 | Hardy Et Cie Soc Ets | Improvements in or relating to belt conveyors, more particularly for vehicle bodies |
| GB419351A (en) * | 1934-06-29 | 1934-11-09 | Shelvoke & Drewry Ltd | Improvements relating to movable floors for vehicles |
| GB501068A (en) * | 1937-08-26 | 1939-02-21 | Harry Kulhanek | Improvements relating to movable floors for vehicles |
| US2194144A (en) * | 1937-09-16 | 1940-03-19 | Charles A Gill | Car loading device for ballast cleanings |
| GB529551A (en) * | 1939-06-03 | 1940-11-22 | Allan Maclachlan | Improvements in and relating to movable floor vehicles |
| US2637457A (en) * | 1948-07-09 | 1953-05-05 | Joy Mfg Co | Material receiving, storing, and discharging apparatus |
| GB709012A (en) * | 1951-02-20 | 1954-05-12 | William James Heywood | Improvements in or relating to load carriers |
| GB730300A (en) * | 1951-08-20 | 1955-05-18 | Wilhelm Heidemann | Articulated transporter carriages for use in mining and the like |
| US3033393A (en) * | 1958-11-20 | 1962-05-08 | Boby Ltd Robert | Process containers |
| DE1580970A1 (de) * | 1967-04-29 | 1971-03-04 | Gewerk Eisenhuette Westfalia | Fahrbarer Bunker fuer schuettfaehiges Gut |
| US3578183A (en) * | 1969-03-03 | 1971-05-11 | Perdue & Son Inc A W | Method and apparatus for conveying material |
| DE2146590A1 (de) * | 1970-09-17 | 1972-03-23 | Rossi, Lionello, Rom | Trichterwagen mit Vorrichtungen zum automatischen Beladen und Entladen |
| AT336670B (de) * | 1973-01-12 | 1977-05-25 | Plasser Bahnbaumasch Franz | Fahrbarer silowagen, eisenbahnwaggon u.dgl. mit einer belade- oder materialuberfuhrungseinrichtung |
-
1983
- 1983-04-07 DE DE19833312492 patent/DE3312492A1/de active Granted
- 1983-05-25 CH CH2858/83A patent/CH661074A5/de not_active IP Right Cessation
- 1983-06-14 IT IT21606/83A patent/IT1163518B/it active
- 1983-06-27 PL PL1983242716A patent/PL143116B1/pl unknown
- 1983-06-30 AU AU16438/83A patent/AU557082B2/en not_active Ceased
- 1983-08-11 SU SU833637310A patent/SU1176847A3/ru active
- 1983-08-15 US US06/523,125 patent/US4576538A/en not_active Expired - Fee Related
- 1983-08-26 CA CA000435506A patent/CA1220086A/en not_active Expired
- 1983-09-14 GB GB08324554A patent/GB2127377B/en not_active Expired
- 1983-09-14 DD DD83254820A patent/DD210321A5/de not_active IP Right Cessation
- 1983-09-22 FR FR8315085A patent/FR2533520B1/fr not_active Expired
- 1983-09-22 HU HU833262A patent/HU186803B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3312492C2 (enExample) | 1987-08-27 |
| DE3312492A1 (de) | 1984-03-29 |
| CH661074A5 (de) | 1987-06-30 |
| FR2533520B1 (fr) | 1986-12-26 |
| IT8321606A0 (it) | 1983-06-14 |
| DD210321A5 (de) | 1984-06-06 |
| US4576538A (en) | 1986-03-18 |
| IT1163518B (it) | 1987-04-08 |
| GB8324554D0 (en) | 1983-10-19 |
| PL242716A1 (en) | 1984-04-24 |
| GB2127377A (en) | 1984-04-11 |
| SU1176847A3 (ru) | 1985-08-30 |
| GB2127377B (en) | 1986-01-15 |
| IT8321606A1 (it) | 1984-12-14 |
| AU1643883A (en) | 1984-03-29 |
| FR2533520A1 (fr) | 1984-03-30 |
| AU557082B2 (en) | 1986-12-04 |
| PL143116B1 (en) | 1988-01-30 |
| HU186803B (en) | 1985-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1220086A (en) | Box car | |
| US3842994A (en) | Train of freight cars | |
| CA1287265C (en) | Box car | |
| CA2036019C (en) | Freight car for bulk material | |
| US5364221A (en) | Track-bound freight car | |
| CA2028542C (en) | Mobile ballast plow for receiving and distributing track ballast | |
| US3976142A (en) | Ballast treating apparatus | |
| US5400718A (en) | Loading wagon for transport, storage and discharge of bulk material | |
| US4813488A (en) | Ballast cleaning machine | |
| US4152989A (en) | Mobile apparatus for continuously laying ties | |
| US3685589A (en) | Ballast treating machine | |
| US6073561A (en) | Box car for transporting bulk material | |
| SU1558304A3 (ru) | Шпалоподбивочна машина | |
| US3957000A (en) | Ballast treating method | |
| PL154181B1 (en) | A travelling unit for cleaning breakstone sub-crust of a railway track with a breakstone laying device | |
| US4534415A (en) | Ballast cleaning machine with two ballast screening installations | |
| US5513452A (en) | Installation for the rehabilitation of a ballast bed | |
| US5289648A (en) | Machine arrangement for receiving, storing and distributing track ballast | |
| US4556112A (en) | Mobile conveyor arrangement | |
| US10717451B2 (en) | Aggregate train and methods of loading and unloading | |
| US3618744A (en) | Apparatus for stacking and reclaiming bulk materials | |
| US4043398A (en) | Mobile ballast cleaning machine | |
| CZ31592A3 (en) | set for catching and transportation of ballast, waste or another loose material | |
| US3272357A (en) | Loading and transportation equipment | |
| US1681001A (en) | Apparatus for loading cars |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |