CA1155855A - Hypoglycemic 5-substituted oxazolidine-2,4-diones - Google Patents
Hypoglycemic 5-substituted oxazolidine-2,4-dionesInfo
- Publication number
- CA1155855A CA1155855A CA000382586A CA382586A CA1155855A CA 1155855 A CA1155855 A CA 1155855A CA 000382586 A CA000382586 A CA 000382586A CA 382586 A CA382586 A CA 382586A CA 1155855 A CA1155855 A CA 1155855A
- Authority
- CA
- Canada
- Prior art keywords
- chloro
- formula
- compound
- fluoro
- dione
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 5-substituted oxazolidine-2,4-diones Chemical class 0.000 title claims description 64
- 230000002218 hypoglycaemic effect Effects 0.000 title abstract description 26
- 238000000034 method Methods 0.000 claims abstract description 198
- 150000001875 compounds Chemical class 0.000 claims abstract description 79
- 150000003839 salts Chemical class 0.000 claims abstract description 20
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 29
- 239000002253 acid Substances 0.000 claims description 24
- 150000002431 hydrogen Chemical class 0.000 claims description 21
- 125000001153 fluoro group Chemical group F* 0.000 claims description 20
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 18
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 18
- 150000002148 esters Chemical class 0.000 claims description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 125000001246 bromo group Chemical group Br* 0.000 claims description 9
- 238000002955 isolation Methods 0.000 claims description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- 239000012442 inert solvent Substances 0.000 claims description 7
- 239000004202 carbamide Substances 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 125000002091 cationic group Chemical group 0.000 claims description 5
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 4
- 239000012346 acetyl chloride Substances 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 3
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 230000020477 pH reduction Effects 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 125000006536 (C1-C2)alkoxy group Chemical group 0.000 claims 6
- 230000003301 hydrolyzing effect Effects 0.000 claims 4
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 claims 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims 1
- 230000000397 acetylating effect Effects 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 claims 1
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 1
- 239000012433 hydrogen halide Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 230000001172 regenerating effect Effects 0.000 claims 1
- 230000001131 transforming effect Effects 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 20
- 239000000543 intermediate Substances 0.000 abstract description 15
- 241001465754 Metazoa Species 0.000 abstract description 4
- AELRZBNOWPNTGP-UHFFFAOYSA-N 5-naphthalen-1-yl-1,3-oxazolidine-2,4-dione Chemical class O1C(=O)NC(=O)C1C1=CC=CC2=CC=CC=C12 AELRZBNOWPNTGP-UHFFFAOYSA-N 0.000 abstract description 3
- 230000003345 hyperglycaemic effect Effects 0.000 abstract description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 213
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 168
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 160
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 131
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 90
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 85
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 80
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 78
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 73
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 72
- 229940073584 methylene chloride Drugs 0.000 description 71
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 66
- 239000000203 mixture Substances 0.000 description 66
- COWNFYYYZFRNOY-UHFFFAOYSA-N oxazolidinedione Chemical compound O=C1COC(=O)N1 COWNFYYYZFRNOY-UHFFFAOYSA-N 0.000 description 62
- 239000003921 oil Substances 0.000 description 61
- 235000019198 oils Nutrition 0.000 description 61
- 239000011541 reaction mixture Substances 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 54
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 47
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 47
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 47
- 229960001701 chloroform Drugs 0.000 description 45
- 239000007787 solid Substances 0.000 description 45
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 42
- 229940093499 ethyl acetate Drugs 0.000 description 42
- 235000019439 ethyl acetate Nutrition 0.000 description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 39
- 239000000047 product Substances 0.000 description 37
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 36
- 229920006395 saturated elastomer Polymers 0.000 description 35
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 34
- 239000012267 brine Substances 0.000 description 33
- 238000001953 recrystallisation Methods 0.000 description 31
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 30
- 101150041968 CDC13 gene Proteins 0.000 description 28
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 25
- 239000000284 extract Substances 0.000 description 23
- 230000035484 reaction time Effects 0.000 description 23
- 238000003756 stirring Methods 0.000 description 21
- 230000000694 effects Effects 0.000 description 20
- 150000001477 2,4-oxazolidinediones Chemical class 0.000 description 19
- 239000008280 blood Substances 0.000 description 18
- 210000004369 blood Anatomy 0.000 description 18
- 239000012043 crude product Substances 0.000 description 18
- 229940086542 triethylamine Drugs 0.000 description 18
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 16
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 16
- 239000008103 glucose Substances 0.000 description 16
- 239000010410 layer Substances 0.000 description 16
- 239000012044 organic layer Substances 0.000 description 16
- 239000011734 sodium Substances 0.000 description 15
- 238000001914 filtration Methods 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- 229940022682 acetone Drugs 0.000 description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 150000001299 aldehydes Chemical class 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000003472 antidiabetic agent Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- 239000002243 precursor Substances 0.000 description 10
- SBYYYVAMWBVIIX-UHFFFAOYSA-N 5-phenyl-1,3-oxazolidine-2,4-dione Chemical compound O1C(=O)NC(=O)C1C1=CC=CC=C1 SBYYYVAMWBVIIX-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- HIMXGTXNXJYFGB-UHFFFAOYSA-N alloxan Chemical compound O=C1NC(=O)C(=O)C(=O)N1 HIMXGTXNXJYFGB-UHFFFAOYSA-N 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 150000002463 imidates Chemical class 0.000 description 8
- 239000012452 mother liquor Substances 0.000 description 8
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 229940126904 hypoglycaemic agent Drugs 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 230000010412 perfusion Effects 0.000 description 7
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 7
- UHXUZNJCLHADGD-UHFFFAOYSA-N 2-chloro-6-methoxybenzaldehyde Chemical compound COC1=CC=CC(Cl)=C1C=O UHXUZNJCLHADGD-UHFFFAOYSA-N 0.000 description 6
- UXSMKNBVXKFWCJ-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=C(Cl)C=C1C1C(=O)NC(=O)O1 UXSMKNBVXKFWCJ-UHFFFAOYSA-N 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 235000013877 carbamide Nutrition 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 238000007446 glucose tolerance test Methods 0.000 description 6
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 229940093956 potassium carbonate Drugs 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000001665 trituration Methods 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 5
- MGXCYBJZYSTREA-UHFFFAOYSA-N 5-(2-chloro-6-fluorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound FC1=CC=CC(Cl)=C1C1C(=O)NC(=O)O1 MGXCYBJZYSTREA-UHFFFAOYSA-N 0.000 description 5
- 102000004877 Insulin Human genes 0.000 description 5
- 108090001061 Insulin Proteins 0.000 description 5
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 229940125396 insulin Drugs 0.000 description 5
- 238000012544 monitoring process Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- SRYYLXDOTXDYQW-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)-2-hydroxyacetamide Chemical compound NC(=O)C(O)C1=C(F)C=CC=C1Cl SRYYLXDOTXDYQW-UHFFFAOYSA-N 0.000 description 4
- YUJYVSIJMJJPLB-UHFFFAOYSA-N 2-(2-chloro-6-methoxyphenyl)-2-hydroxyacetamide Chemical compound COC1=CC=CC(Cl)=C1C(O)C(N)=O YUJYVSIJMJJPLB-UHFFFAOYSA-N 0.000 description 4
- XKHXOKLIRSKVHN-UHFFFAOYSA-N 2-[2-(trifluoromethyl)phenyl]-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC=C1C(F)(F)F XKHXOKLIRSKVHN-UHFFFAOYSA-N 0.000 description 4
- YFQUMJGYGHQFBV-UHFFFAOYSA-N 2-fluoronaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(F)=CC=C21 YFQUMJGYGHQFBV-UHFFFAOYSA-N 0.000 description 4
- CUMROJNWXHIHIV-UHFFFAOYSA-N 5-(2-chloro-6-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=CC(Cl)=C1C1C(=O)NC(=O)O1 CUMROJNWXHIHIV-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 239000002024 ethyl acetate extract Substances 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 4
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 4
- 238000010791 quenching Methods 0.000 description 4
- 150000003335 secondary amines Chemical group 0.000 description 4
- 238000000638 solvent extraction Methods 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- 238000010792 warming Methods 0.000 description 4
- SZKBFOWEOKWEDD-UHFFFAOYSA-N 2,6-dimethoxynaphthalene-1-carbaldehyde Chemical compound O=CC1=C(OC)C=CC2=CC(OC)=CC=C21 SZKBFOWEOKWEDD-UHFFFAOYSA-N 0.000 description 3
- IFIQCQZSRSSKNS-UHFFFAOYSA-N 2-(2,6-dichlorophenyl)-2-hydroxyacetamide Chemical compound NC(=O)C(O)C1=C(Cl)C=CC=C1Cl IFIQCQZSRSSKNS-UHFFFAOYSA-N 0.000 description 3
- MXKBSPSTPDCQOL-UHFFFAOYSA-N 2-(2,6-difluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=C(F)C=CC=C1F MXKBSPSTPDCQOL-UHFFFAOYSA-N 0.000 description 3
- JBQUIFCGWMPSPW-UHFFFAOYSA-N 2-(2-chlorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC=C1Cl JBQUIFCGWMPSPW-UHFFFAOYSA-N 0.000 description 3
- DJFBDNWHWUGNNT-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=C(C)C=C1C(O[Si](C)(C)C)C#N DJFBDNWHWUGNNT-UHFFFAOYSA-N 0.000 description 3
- XIXBHVUFYQRODZ-UHFFFAOYSA-N 2-(2-phenylmethoxynaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=CC2=CC=CC=C2C(C(C#N)O[Si](C)(C)C)=C1OCC1=CC=CC=C1 XIXBHVUFYQRODZ-UHFFFAOYSA-N 0.000 description 3
- MHXRIYWJXJHTMI-UHFFFAOYSA-N 2-(5-bromo-2-methoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=C(Br)C=C1C(O[Si](C)(C)C)C#N MHXRIYWJXJHTMI-UHFFFAOYSA-N 0.000 description 3
- IPDDLKUEUDNUEM-UHFFFAOYSA-N 2-(5-fluoro-2-methoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=C(F)C=C1C(O[Si](C)(C)C)C#N IPDDLKUEUDNUEM-UHFFFAOYSA-N 0.000 description 3
- OCLGHQGOTMUJQP-UHFFFAOYSA-N 2-(7-fluoronaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=C(F)C=C2C(C(C#N)O[Si](C)(C)C)=CC=CC2=C1 OCLGHQGOTMUJQP-UHFFFAOYSA-N 0.000 description 3
- WIAZTPUQHUFMQA-UHFFFAOYSA-N 2-methylnaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(C)=CC=C21 WIAZTPUQHUFMQA-UHFFFAOYSA-N 0.000 description 3
- PJKVFARRVXDXAD-UHFFFAOYSA-N 2-naphthaldehyde Chemical compound C1=CC=CC2=CC(C=O)=CC=C21 PJKVFARRVXDXAD-UHFFFAOYSA-N 0.000 description 3
- AAOHGIBACYAWHC-UHFFFAOYSA-N 3-acetyl-5-(5-chloro-2-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=C(Cl)C=C1C1C(=O)N(C(C)=O)C(=O)O1 AAOHGIBACYAWHC-UHFFFAOYSA-N 0.000 description 3
- JKPTVXAFTUKDQS-UHFFFAOYSA-N 3-fluoro-2-methoxy-5-methylbenzaldehyde Chemical compound COC1=C(F)C=C(C)C=C1C=O JKPTVXAFTUKDQS-UHFFFAOYSA-N 0.000 description 3
- BLAUJZDUKMXSBI-UHFFFAOYSA-N 5-(2-ethoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound CCOC1=CC=CC=C1C1C(=O)NC(=O)O1 BLAUJZDUKMXSBI-UHFFFAOYSA-N 0.000 description 3
- ULAQKPXNVOJZJW-UHFFFAOYSA-N 5-(2-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=CC=C1C1C(=O)NC(=O)O1 ULAQKPXNVOJZJW-UHFFFAOYSA-N 0.000 description 3
- HXTWDGGMXZXOIV-UHFFFAOYSA-N 5-chloro-2-methoxybenzaldehyde Chemical compound COC1=CC=C(Cl)C=C1C=O HXTWDGGMXZXOIV-UHFFFAOYSA-N 0.000 description 3
- MBOXPKNOGZJXPK-UHFFFAOYSA-N 5-fluoro-2-methylbenzaldehyde Chemical compound CC1=CC=C(F)C=C1C=O MBOXPKNOGZJXPK-UHFFFAOYSA-N 0.000 description 3
- KVCGYEULFRLZTJ-UHFFFAOYSA-N 7-fluoronaphthalene-1-carbaldehyde Chemical compound C1=CC=C(C=O)C2=CC(F)=CC=C21 KVCGYEULFRLZTJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 3
- 208000013016 Hypoglycemia Diseases 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 3
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 206010012601 diabetes mellitus Diseases 0.000 description 3
- BVEWMNTVZPFPQI-UHFFFAOYSA-N dialuric acid Chemical compound OC1C(=O)NC(=O)NC1=O BVEWMNTVZPFPQI-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- IYMVQFODLPTOEL-UHFFFAOYSA-N ethyl 2-(2,6-dimethoxynaphthalen-1-yl)-2-hydroxyethanimidate Chemical compound COC1=CC=C2C(C(O)C(=N)OCC)=C(OC)C=CC2=C1 IYMVQFODLPTOEL-UHFFFAOYSA-N 0.000 description 3
- 238000007429 general method Methods 0.000 description 3
- 150000004795 grignard reagents Chemical class 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- WZWGGYFEOBVNLA-UHFFFAOYSA-N sodium;dihydrate Chemical compound O.O.[Na] WZWGGYFEOBVNLA-UHFFFAOYSA-N 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- CHLICZRVGGXEOD-UHFFFAOYSA-N 1-Methoxy-4-methylbenzene Chemical compound COC1=CC=C(C)C=C1 CHLICZRVGGXEOD-UHFFFAOYSA-N 0.000 description 2
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- IXLSVQMYQRAMEW-UHFFFAOYSA-N 1-chloro-4-ethoxybenzene Chemical compound CCOC1=CC=C(Cl)C=C1 IXLSVQMYQRAMEW-UHFFFAOYSA-N 0.000 description 2
- NQMUGNMMFTYOHK-UHFFFAOYSA-N 1-methoxynaphthalene Chemical compound C1=CC=C2C(OC)=CC=CC2=C1 NQMUGNMMFTYOHK-UHFFFAOYSA-N 0.000 description 2
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 2
- SOWRUJSGHKNOKN-UHFFFAOYSA-N 2,6-difluorobenzaldehyde Chemical compound FC1=CC=CC(F)=C1C=O SOWRUJSGHKNOKN-UHFFFAOYSA-N 0.000 description 2
- DQZNEARAAKUGKL-UHFFFAOYSA-N 2-(2,5-dimethylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound CC1=CC=C(C)C(C(O[Si](C)(C)C)C#N)=C1 DQZNEARAAKUGKL-UHFFFAOYSA-N 0.000 description 2
- NWIDNBBMRITEIW-UHFFFAOYSA-N 2-(2,6-dimethoxynaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=C(OC)C=CC2=CC(OC)=CC=C21 NWIDNBBMRITEIW-UHFFFAOYSA-N 0.000 description 2
- JOKJBHYSHIMMAO-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=C(F)C=CC=C1Cl JOKJBHYSHIMMAO-UHFFFAOYSA-N 0.000 description 2
- LOYKSNILPZSMLV-UHFFFAOYSA-N 2-(2-chloro-6-methoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=CC(Cl)=C1C(O[Si](C)(C)C)C#N LOYKSNILPZSMLV-UHFFFAOYSA-N 0.000 description 2
- OLLNXLLMRZZOCR-UHFFFAOYSA-N 2-(2-ethoxy-5-fluorophenyl)-2-trimethylsilylacetonitrile Chemical compound CCOC1=CC=C(F)C=C1C(C#N)[Si](C)(C)C OLLNXLLMRZZOCR-UHFFFAOYSA-N 0.000 description 2
- QMDFSFBQZSVNGM-UHFFFAOYSA-N 2-(2-ethoxynaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=CC=CC2=C(C(O[Si](C)(C)C)C#N)C(OCC)=CC=C21 QMDFSFBQZSVNGM-UHFFFAOYSA-N 0.000 description 2
- MAYFTTLXNLPOKU-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound CCOC1=CC=CC=C1C(O[Si](C)(C)C)C#N MAYFTTLXNLPOKU-UHFFFAOYSA-N 0.000 description 2
- CFRDMJUUJGVMRT-UHFFFAOYSA-N 2-(2-fluoronaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=CC=C2C(C(C#N)O[Si](C)(C)C)=C(F)C=CC2=C1 CFRDMJUUJGVMRT-UHFFFAOYSA-N 0.000 description 2
- QLPDNMXWNVZPHF-UHFFFAOYSA-N 2-(2-methoxynaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=CC=CC2=C(C(O[Si](C)(C)C)C#N)C(OC)=CC=C21 QLPDNMXWNVZPHF-UHFFFAOYSA-N 0.000 description 2
- KYCVZQALMJGRSJ-UHFFFAOYSA-N 2-(2-methylnaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=CC=CC2=C(C(O[Si](C)(C)C)C#N)C(C)=CC=C21 KYCVZQALMJGRSJ-UHFFFAOYSA-N 0.000 description 2
- ZWIHLRRBWNXPKX-UHFFFAOYSA-N 2-(2-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound CC1=CC=CC=C1C(O[Si](C)(C)C)C#N ZWIHLRRBWNXPKX-UHFFFAOYSA-N 0.000 description 2
- VJOFWPFIKPTAKW-UHFFFAOYSA-N 2-(2-nitrophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC=C1[N+]([O-])=O VJOFWPFIKPTAKW-UHFFFAOYSA-N 0.000 description 2
- LBAOKJLBNMLKLN-UHFFFAOYSA-N 2-(2-phenylmethoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC=C1OCC1=CC=CC=C1 LBAOKJLBNMLKLN-UHFFFAOYSA-N 0.000 description 2
- DYWLCMCUMMBVAA-UHFFFAOYSA-N 2-(3-chloro-5-fluoro-2-methoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=C(Cl)C=C(F)C=C1C(O[Si](C)(C)C)C#N DYWLCMCUMMBVAA-UHFFFAOYSA-N 0.000 description 2
- YRZFCIFDXWUQNP-UHFFFAOYSA-N 2-(3-chloro-6-methoxy-2-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=C(Cl)C(C)=C1C(O[Si](C)(C)C)C#N YRZFCIFDXWUQNP-UHFFFAOYSA-N 0.000 description 2
- RNOOTRCEYZUFOL-UHFFFAOYSA-N 2-(3-chlorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC(Cl)=C1 RNOOTRCEYZUFOL-UHFFFAOYSA-N 0.000 description 2
- RMDXARJBHYOEIS-UHFFFAOYSA-N 2-(3-phenoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 RMDXARJBHYOEIS-UHFFFAOYSA-N 0.000 description 2
- WRCSWEGAAYHJGL-UHFFFAOYSA-N 2-(5-chloro-2-ethoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound CCOC1=CC=C(Cl)C=C1C(O[Si](C)(C)C)C#N WRCSWEGAAYHJGL-UHFFFAOYSA-N 0.000 description 2
- QXVSCYSIXYYSHO-UHFFFAOYSA-N 2-(5-chloro-2-methoxy-3-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=C(C)C=C(Cl)C=C1C(O[Si](C)(C)C)C#N QXVSCYSIXYYSHO-UHFFFAOYSA-N 0.000 description 2
- GQRHDMBGHIVTRA-UHFFFAOYSA-N 2-(5-chloro-2-methoxyphenyl)-2-hydroxyacetamide Chemical compound COC1=CC=C(Cl)C=C1C(O)C(N)=O GQRHDMBGHIVTRA-UHFFFAOYSA-N 0.000 description 2
- RTCYLPXXBGAFGL-UHFFFAOYSA-N 2-(5-chloro-2-methoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=C(Cl)C=C1C(O[Si](C)(C)C)C#N RTCYLPXXBGAFGL-UHFFFAOYSA-N 0.000 description 2
- XUYBVCMQWBSFJR-UHFFFAOYSA-N 2-(5-fluoro-2-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound CC1=CC=C(F)C=C1C(O[Si](C)(C)C)C#N XUYBVCMQWBSFJR-UHFFFAOYSA-N 0.000 description 2
- IVKPBNVMLKJSFG-UHFFFAOYSA-N 2-chloronaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(Cl)=CC=C21 IVKPBNVMLKJSFG-UHFFFAOYSA-N 0.000 description 2
- DUVJMSPTZMCSTQ-UHFFFAOYSA-N 2-ethoxybenzaldehyde Chemical compound CCOC1=CC=CC=C1C=O DUVJMSPTZMCSTQ-UHFFFAOYSA-N 0.000 description 2
- IMNKQTWVJHODOS-UHFFFAOYSA-N 2-ethoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(OCC)=CC=C21 IMNKQTWVJHODOS-UHFFFAOYSA-N 0.000 description 2
- FZIBGCDUHZBOLA-UHFFFAOYSA-N 2-fluoro-6-hydroxybenzaldehyde Chemical compound OC1=CC=CC(F)=C1C=O FZIBGCDUHZBOLA-UHFFFAOYSA-N 0.000 description 2
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 2
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 2
- DTAFQWDNWAXRLX-UHFFFAOYSA-N 2-phenyl-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC=C1 DTAFQWDNWAXRLX-UHFFFAOYSA-N 0.000 description 2
- VEMDBXGFPCYWJJ-UHFFFAOYSA-N 2-phenylmethoxy-1-naphthalenecarboxaldehyde Chemical compound C1=CC2=CC=CC=C2C(C=O)=C1OCC1=CC=CC=C1 VEMDBXGFPCYWJJ-UHFFFAOYSA-N 0.000 description 2
- JXQJCSWCSRQNMC-UHFFFAOYSA-N 3-acetyl-5-(2-chloro-6-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=CC(Cl)=C1C1C(=O)N(C(C)=O)C(=O)O1 JXQJCSWCSRQNMC-UHFFFAOYSA-N 0.000 description 2
- VHXIEGGPMOEWNK-UHFFFAOYSA-N 3-chloro-5-fluoro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(F)C=C1C=O VHXIEGGPMOEWNK-UHFFFAOYSA-N 0.000 description 2
- FMDHZKRBTPCCBK-UHFFFAOYSA-N 3-chloro-6-methoxy-2-methylbenzaldehyde Chemical compound COC1=CC=C(Cl)C(C)=C1C=O FMDHZKRBTPCCBK-UHFFFAOYSA-N 0.000 description 2
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 2
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 2
- ZIIHZVKHFWOENY-UHFFFAOYSA-N 5,5-dihydroxy-1,3-diazinane-2,4,6-trione Chemical compound OC1(O)C(=O)NC(=O)NC1=O ZIIHZVKHFWOENY-UHFFFAOYSA-N 0.000 description 2
- XPTFTIWHVUFKJU-UHFFFAOYSA-N 5-(2,6-difluorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound FC1=CC=CC(F)=C1C1C(=O)NC(=O)O1 XPTFTIWHVUFKJU-UHFFFAOYSA-N 0.000 description 2
- KRSACFUPPCULSN-UHFFFAOYSA-N 5-(2-chloro-6-methoxyphenyl)-1,3-oxazolidine-2,4-dione;sodium Chemical compound [Na].COC1=CC=CC(Cl)=C1C1C(=O)NC(=O)O1 KRSACFUPPCULSN-UHFFFAOYSA-N 0.000 description 2
- JNXGKOHDMSKDLW-UHFFFAOYSA-N 5-(2-chloro-6-methoxyphenyl)-1,3-oxazolidine-2,4-dione;sodium;dihydrate Chemical compound O.O.[Na].COC1=CC=CC(Cl)=C1C1C(=O)NC(=O)O1 JNXGKOHDMSKDLW-UHFFFAOYSA-N 0.000 description 2
- GTJKMXHJMJXFBA-UHFFFAOYSA-N 5-(2-ethoxynaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound CCOC1=CC=C2C=CC=CC2=C1C1OC(=O)NC1=O GTJKMXHJMJXFBA-UHFFFAOYSA-N 0.000 description 2
- FOWRGKPOZCNQTB-UHFFFAOYSA-N 5-(2-fluoronaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound FC1=CC=C2C=CC=CC2=C1C1OC(=O)NC1=O FOWRGKPOZCNQTB-UHFFFAOYSA-N 0.000 description 2
- LKXXYQWSDWFHTD-UHFFFAOYSA-N 5-(2-methylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound CC1=CC=CC=C1C1C(=O)NC(=O)O1 LKXXYQWSDWFHTD-UHFFFAOYSA-N 0.000 description 2
- RYAITGRQOYVWHN-UHFFFAOYSA-N 5-(2-nitrophenyl)-1,3-oxazolidine-2,4-dione Chemical compound [O-][N+](=O)C1=CC=CC=C1C1C(=O)NC(=O)O1 RYAITGRQOYVWHN-UHFFFAOYSA-N 0.000 description 2
- VXXFPWKVAQFPQI-UHFFFAOYSA-N 5-(2-phenylmethoxynaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound O1C(=O)NC(=O)C1C(C1=CC=CC=C1C=C1)=C1OCC1=CC=CC=C1 VXXFPWKVAQFPQI-UHFFFAOYSA-N 0.000 description 2
- YUNUZICDVVRCRV-UHFFFAOYSA-N 5-(3-fluorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound FC1=CC=CC(C2C(NC(=O)O2)=O)=C1 YUNUZICDVVRCRV-UHFFFAOYSA-N 0.000 description 2
- AUIHFDZXLSJZED-UHFFFAOYSA-N 5-(4-fluorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound C1=CC(F)=CC=C1C1C(=O)NC(=O)O1 AUIHFDZXLSJZED-UHFFFAOYSA-N 0.000 description 2
- YHYNKQHMTKHXIM-UHFFFAOYSA-N 5-(5-chloro-2-methoxy-3-methylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=C(C)C=C(Cl)C=C1C1C(=O)NC(=O)O1 YHYNKQHMTKHXIM-UHFFFAOYSA-N 0.000 description 2
- JNQYVRGRPXSDIM-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-1,3-oxazolidine-2,4-dione;sodium Chemical compound [Na].COC1=CC=C(Cl)C=C1C1C(=O)NC(=O)O1 JNQYVRGRPXSDIM-UHFFFAOYSA-N 0.000 description 2
- GSVPSCFQWLZQJS-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-n-cyclohexyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound COC1=CC=C(Cl)C=C1C1C(=O)N(C(=O)NC2CCCCC2)C(=O)O1 GSVPSCFQWLZQJS-UHFFFAOYSA-N 0.000 description 2
- PGMJXWORQWMZMQ-UHFFFAOYSA-N 5-(5-fluoro-2-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=C(F)C=C1C1C(=O)NC(=O)O1 PGMJXWORQWMZMQ-UHFFFAOYSA-N 0.000 description 2
- DILBEGIIJTTYOI-UHFFFAOYSA-N 5-[2-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,4-dione Chemical compound FC(F)(F)C1=CC=CC=C1C1C(=O)NC(=O)O1 DILBEGIIJTTYOI-UHFFFAOYSA-N 0.000 description 2
- IJIBRSFAXRFPPN-UHFFFAOYSA-N 5-bromo-2-methoxybenzaldehyde Chemical compound COC1=CC=C(Br)C=C1C=O IJIBRSFAXRFPPN-UHFFFAOYSA-N 0.000 description 2
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 2
- JVUJRLHWDLJULI-UHFFFAOYSA-N 5-chloro-2-ethoxybenzaldehyde Chemical compound CCOC1=CC=C(Cl)C=C1C=O JVUJRLHWDLJULI-UHFFFAOYSA-N 0.000 description 2
- NCLVPWLDDBBOAE-UHFFFAOYSA-N 5-naphthalen-2-yl-2-sulfanylidene-1,3-oxazolidin-4-one Chemical compound O=C1NC(=S)OC1C1=CC=C(C=CC=C2)C2=C1 NCLVPWLDDBBOAE-UHFFFAOYSA-N 0.000 description 2
- ZKSLQFFTSJWDBI-UHFFFAOYSA-N 5-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one Chemical compound O=C1NC(=S)OC1C1=CC=CC=C1 ZKSLQFFTSJWDBI-UHFFFAOYSA-N 0.000 description 2
- HQBCFROPFWQZIP-UHFFFAOYSA-N 7-chloronaphthalene-1-carbaldehyde Chemical compound C1=CC=C(C=O)C2=CC(Cl)=CC=C21 HQBCFROPFWQZIP-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-DCSYEGIMSA-N Beta-Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-DCSYEGIMSA-N 0.000 description 2
- 229940123208 Biguanide Drugs 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FVLTWAWRNOVORT-UHFFFAOYSA-N [2-amino-1-(2-chloro-6-methoxyphenyl)-2-oxoethyl] formate Chemical compound COC1=CC=CC(Cl)=C1C(OC=O)C(N)=O FVLTWAWRNOVORT-UHFFFAOYSA-N 0.000 description 2
- 230000005856 abnormality Effects 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 238000005915 ammonolysis reaction Methods 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940125708 antidiabetic agent Drugs 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 150000004283 biguanides Chemical class 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 2
- 229960001231 choline Drugs 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical class C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000006184 cosolvent Substances 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 229940043237 diethanolamine Drugs 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- QNBRSYZPBAUFGZ-UHFFFAOYSA-N ethyl 2-(2,5-dimethylphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(C)=CC=C1C QNBRSYZPBAUFGZ-UHFFFAOYSA-N 0.000 description 2
- IWBKEXPATTURSN-UHFFFAOYSA-N ethyl 2-(2-ethoxy-5-fluorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(F)=CC=C1OCC IWBKEXPATTURSN-UHFFFAOYSA-N 0.000 description 2
- INWXBMCYHDMCCD-UHFFFAOYSA-N ethyl 2-(2-ethoxy-6-fluorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=C(F)C=CC=C1OCC INWXBMCYHDMCCD-UHFFFAOYSA-N 0.000 description 2
- JRSQCJLZDSFZKP-UHFFFAOYSA-N ethyl 2-(2-ethoxynaphthalen-1-yl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.C1=CC=C2C(C(O)C(=N)OCC)=C(OCC)C=CC2=C1 JRSQCJLZDSFZKP-UHFFFAOYSA-N 0.000 description 2
- AVWBBFIBQXROLP-UHFFFAOYSA-N ethyl 2-(2-fluorophenyl)-2-hydroxyethanimidate Chemical compound CCOC(=N)C(O)C1=CC=CC=C1F AVWBBFIBQXROLP-UHFFFAOYSA-N 0.000 description 2
- POAHPTHIUNRTMW-UHFFFAOYSA-N ethyl 2-hydroxy-2-(2-methoxynaphthalen-1-yl)ethanimidate Chemical compound C1=CC=C2C(C(O)C(=N)OCC)=C(OC)C=CC2=C1 POAHPTHIUNRTMW-UHFFFAOYSA-N 0.000 description 2
- YQLXFXVENSSXMS-UHFFFAOYSA-N ethyl 2-hydroxy-2-(2-phenylmethoxynaphthalen-1-yl)ethanimidate;hydrochloride Chemical compound Cl.C1=CC2=CC=CC=C2C(C(O)C(=N)OCC)=C1OCC1=CC=CC=C1 YQLXFXVENSSXMS-UHFFFAOYSA-N 0.000 description 2
- MRHUEGYFGLBNFN-UHFFFAOYSA-N ethyl 2-hydroxy-2-(2-phenylmethoxyphenyl)ethanimidate Chemical compound CCOC(=N)C(O)C1=CC=CC=C1OCC1=CC=CC=C1 MRHUEGYFGLBNFN-UHFFFAOYSA-N 0.000 description 2
- BDCKDYFYCCNXIF-UHFFFAOYSA-N ethyl 5-(2-chloro-6-methoxyphenyl)-2,4-dioxo-1,3-oxazolidine-3-carboxylate Chemical compound O=C1N(C(=O)OCC)C(=O)OC1C1=C(Cl)C=CC=C1OC BDCKDYFYCCNXIF-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 229940012017 ethylenediamine Drugs 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000010030 glucose lowering effect Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 235000001055 magnesium Nutrition 0.000 description 2
- 229960003390 magnesium sulfate Drugs 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 229940091250 magnesium supplement Drugs 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229960003194 meglumine Drugs 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 235000019371 penicillin G benzathine Nutrition 0.000 description 2
- 229960005141 piperazine Drugs 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 238000006748 scratching Methods 0.000 description 2
- 230000002393 scratching effect Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229960001407 sodium bicarbonate Drugs 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229960000281 trometamol Drugs 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- QMDIZIDCORWBJK-UHFFFAOYSA-N 1,3-dichloro-2-(1,3-dichloropropan-2-yloxy)propane Chemical compound ClCC(CCl)OC(CCl)CCl QMDIZIDCORWBJK-UHFFFAOYSA-N 0.000 description 1
- GZTMCZAOQTVOJK-UHFFFAOYSA-N 1,3-dioxolan-4-one Chemical compound O=C1COCO1 GZTMCZAOQTVOJK-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- BHKKSKOHRFHHIN-MRVPVSSYSA-N 1-[[2-[(1R)-1-aminoethyl]-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one Chemical compound N[C@H](C)C1=C(CN2C(NC(C3=C2C=CN3)=O)=S)C=CC(=C1)Cl BHKKSKOHRFHHIN-MRVPVSSYSA-N 0.000 description 1
- JVEQWIQHHWNMQX-UHFFFAOYSA-N 1-bromo-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1Br JVEQWIQHHWNMQX-UHFFFAOYSA-N 0.000 description 1
- IPWBFGUBXWMIPR-UHFFFAOYSA-N 1-bromo-2-fluorobenzene Chemical compound FC1=CC=CC=C1Br IPWBFGUBXWMIPR-UHFFFAOYSA-N 0.000 description 1
- HTDQSWDEWGSAMN-UHFFFAOYSA-N 1-bromo-2-methoxybenzene Chemical compound COC1=CC=CC=C1Br HTDQSWDEWGSAMN-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- SDGMUBWPXBSKCT-UHFFFAOYSA-N 1-chloro-4-methoxy-2-methylbenzene Chemical compound COC1=CC=C(Cl)C(C)=C1 SDGMUBWPXBSKCT-UHFFFAOYSA-N 0.000 description 1
- PURLWQWDGIIYBG-UHFFFAOYSA-N 1-ethoxy-4-fluorobenzene Chemical compound CCOC1=CC=C(F)C=C1 PURLWQWDGIIYBG-UHFFFAOYSA-N 0.000 description 1
- WRWPPGUCZBJXKX-UHFFFAOYSA-N 1-fluoro-4-methylbenzene Chemical compound CC1=CC=C(F)C=C1 WRWPPGUCZBJXKX-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- LLMLNAVBOAMOEE-UHFFFAOYSA-N 2,3-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1Cl LLMLNAVBOAMOEE-UHFFFAOYSA-N 0.000 description 1
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- SMUVABOERCFKRW-UHFFFAOYSA-N 2,5-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C)C(C=O)=C1 SMUVABOERCFKRW-UHFFFAOYSA-N 0.000 description 1
- AHKDVDYNDXGFPP-UHFFFAOYSA-N 2,6-dimethoxynaphthalene Chemical compound C1=C(OC)C=CC2=CC(OC)=CC=C21 AHKDVDYNDXGFPP-UHFFFAOYSA-N 0.000 description 1
- XNQQMQFYWMTLJN-UHFFFAOYSA-N 2-(2-chloronaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=CC=C2C(C(C#N)O[Si](C)(C)C)=C(Cl)C=CC2=C1 XNQQMQFYWMTLJN-UHFFFAOYSA-N 0.000 description 1
- BXESWGJBKBSLCP-UHFFFAOYSA-N 2-(2-ethoxy-6-fluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound CCOC1=CC=CC(F)=C1C(O[Si](C)(C)C)C#N BXESWGJBKBSLCP-UHFFFAOYSA-N 0.000 description 1
- RXXQFIVKYXGKSA-UHFFFAOYSA-N 2-(2-fluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC=C1F RXXQFIVKYXGKSA-UHFFFAOYSA-N 0.000 description 1
- WTAMZKGHHBEVGA-UHFFFAOYSA-N 2-(2-methoxy-5-nitrophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C(O[Si](C)(C)C)C#N WTAMZKGHHBEVGA-UHFFFAOYSA-N 0.000 description 1
- WFYYOKSYJTXXGR-UHFFFAOYSA-N 2-(2-methoxy-6-nitrophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=CC([N+]([O-])=O)=C1C(O[Si](C)(C)C)C#N WFYYOKSYJTXXGR-UHFFFAOYSA-N 0.000 description 1
- WUBUKZXSHDELIA-UHFFFAOYSA-N 2-(2-methoxyphenyl)-2-trimethylsilylacetonitrile Chemical compound COC1=CC=CC=C1C(C#N)[Si](C)(C)C WUBUKZXSHDELIA-UHFFFAOYSA-N 0.000 description 1
- BCXQPILRBQANLT-UHFFFAOYSA-N 2-(2-methoxyphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=CC=CC=C1C(O[Si](C)(C)C)C#N BCXQPILRBQANLT-UHFFFAOYSA-N 0.000 description 1
- QFJRYUHTYMJUFO-UHFFFAOYSA-N 2-(3,4,5-trifluoro-2-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound FC=1C(=C(C(=C(C1)C(C#N)O[Si](C)(C)C)C)F)F QFJRYUHTYMJUFO-UHFFFAOYSA-N 0.000 description 1
- SYXSJROJYFVLLN-UHFFFAOYSA-N 2-(3-fluoro-2-methoxy-5-methylphenyl)-2-trimethylsilyloxyacetonitrile Chemical compound COC1=C(F)C=C(C)C=C1C(O[Si](C)(C)C)C#N SYXSJROJYFVLLN-UHFFFAOYSA-N 0.000 description 1
- NBVVTILJGGPFDU-UHFFFAOYSA-N 2-(3-fluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC(F)=C1 NBVVTILJGGPFDU-UHFFFAOYSA-N 0.000 description 1
- CPPJDRQDEDCYBA-UHFFFAOYSA-N 2-(4-fluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=C(F)C=C1 CPPJDRQDEDCYBA-UHFFFAOYSA-N 0.000 description 1
- VYUGUZAOTXPNTG-UHFFFAOYSA-N 2-(7-chloronaphthalen-1-yl)-2-trimethylsilyloxyacetonitrile Chemical compound C1=C(Cl)C=C2C(C(C#N)O[Si](C)(C)C)=CC=CC2=C1 VYUGUZAOTXPNTG-UHFFFAOYSA-N 0.000 description 1
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 1
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- KLQNFLVQMSJANN-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]-2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OC(C#N)C1=CC=CC(C(F)(F)F)=C1 KLQNFLVQMSJANN-UHFFFAOYSA-N 0.000 description 1
- KVUPQEKUVSNRCD-UHFFFAOYSA-N 2-amino-1,3-oxazol-4-one Chemical compound NC1=NC(=O)CO1 KVUPQEKUVSNRCD-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- YJEMGEBDXDPBSP-UHFFFAOYSA-N 2-bromo-4-chloro-1-methoxybenzene Chemical compound COC1=CC=C(Cl)C=C1Br YJEMGEBDXDPBSP-UHFFFAOYSA-N 0.000 description 1
- JIQXVIJARQLCOY-UHFFFAOYSA-N 2-bromo-4-fluoro-1-methoxybenzene Chemical compound COC1=CC=C(F)C=C1Br JIQXVIJARQLCOY-UHFFFAOYSA-N 0.000 description 1
- IGYXYGDEYHNFFT-UHFFFAOYSA-N 2-chloro-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Cl IGYXYGDEYHNFFT-UHFFFAOYSA-N 0.000 description 1
- KBYZNPRCCAXLPI-UHFFFAOYSA-N 2-chloro-6-fluorobenzaldehyde Chemical compound ClC1=C(C=O)C(=CC=C1)F.ClC1=C(C=O)C(=CC=C1)F KBYZNPRCCAXLPI-UHFFFAOYSA-N 0.000 description 1
- OACPOWYLLGHGCR-UHFFFAOYSA-N 2-chloro-6-fluorobenzaldehyde Chemical compound FC1=CC=CC(Cl)=C1C=O OACPOWYLLGHGCR-UHFFFAOYSA-N 0.000 description 1
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 description 1
- CGYGETOMCSJHJU-UHFFFAOYSA-N 2-chloronaphthalene Chemical compound C1=CC=CC2=CC(Cl)=CC=C21 CGYGETOMCSJHJU-UHFFFAOYSA-N 0.000 description 1
- IKVQETBZMVZUIL-UHFFFAOYSA-N 2-ethoxy-5-fluorobenzaldehyde Chemical compound CCOC1=CC=C(F)C=C1C=O IKVQETBZMVZUIL-UHFFFAOYSA-N 0.000 description 1
- VHZCPJWEAMDEKL-UHFFFAOYSA-N 2-ethoxy-6-fluorobenzaldehyde Chemical compound CCOC1=CC=CC(F)=C1C=O VHZCPJWEAMDEKL-UHFFFAOYSA-N 0.000 description 1
- FOVXANGOLMXKES-UHFFFAOYSA-N 2-fluoro-1-methoxy-4-methylbenzene Chemical compound COC1=CC=C(C)C=C1F FOVXANGOLMXKES-UHFFFAOYSA-N 0.000 description 1
- BAGQBTMEEISJLK-UHFFFAOYSA-N 2-fluoronaphthalene Chemical compound C1=CC=CC2=CC(F)=CC=C21 BAGQBTMEEISJLK-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 description 1
- CJVIGQCGJUDKOE-UHFFFAOYSA-N 2-methoxy-5-methylbenzaldehyde Chemical compound COC1=CC=C(C)C=C1C=O CJVIGQCGJUDKOE-UHFFFAOYSA-N 0.000 description 1
- QSFNHHUMUVEEHB-UHFFFAOYSA-N 2-methoxy-5-methylbenzaldehyde 1-methoxy-4-methylbenzene Chemical compound CC1=CC=C(C=C1)OC.COC1=C(C=O)C=C(C=C1)C QSFNHHUMUVEEHB-UHFFFAOYSA-N 0.000 description 1
- YWVSKFXYEWMHEO-UHFFFAOYSA-N 2-methoxy-5-nitrobenzaldehyde Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C=O YWVSKFXYEWMHEO-UHFFFAOYSA-N 0.000 description 1
- JTYRXDTZRNCQHG-UHFFFAOYSA-N 2-methoxy-5-nitrobenzaldehyde 1-methoxy-4-nitrobenzene Chemical compound [N+](=O)([O-])C1=CC=C(C=C1)OC.COC1=C(C=O)C=C(C=C1)[N+](=O)[O-] JTYRXDTZRNCQHG-UHFFFAOYSA-N 0.000 description 1
- NQCOCZQZPQKVGI-UHFFFAOYSA-N 2-methoxy-6-nitrobenzaldehyde Chemical compound COC1=CC=CC([N+]([O-])=O)=C1C=O NQCOCZQZPQKVGI-UHFFFAOYSA-N 0.000 description 1
- YIQGLTKAOHRZOL-UHFFFAOYSA-N 2-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C(OC)=CC=C21 YIQGLTKAOHRZOL-UHFFFAOYSA-N 0.000 description 1
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 1
- PBEJTRAJWCNHRS-UHFFFAOYSA-N 2-phenylmethoxybenzaldehyde Chemical compound O=CC1=CC=CC=C1OCC1=CC=CC=C1 PBEJTRAJWCNHRS-UHFFFAOYSA-N 0.000 description 1
- SVVZXVWJFYDKNR-UHFFFAOYSA-N 2-trimethylsilyloxyacetonitrile Chemical compound C[Si](C)(C)OCC#N SVVZXVWJFYDKNR-UHFFFAOYSA-N 0.000 description 1
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 description 1
- SUISZCALMBHJQX-UHFFFAOYSA-N 3-bromobenzaldehyde Chemical compound BrC1=CC=CC(C=O)=C1 SUISZCALMBHJQX-UHFFFAOYSA-N 0.000 description 1
- LUCYVSMQRYCVHN-UHFFFAOYSA-N 3-chloro-5-fluoro-2-methoxybenzaldehyde Chemical compound COC1=C(Cl)C=C(F)C=C1C=O LUCYVSMQRYCVHN-UHFFFAOYSA-N 0.000 description 1
- MBMPNPSGWKOLCC-UHFFFAOYSA-N 3-chloro-6-methoxy-2-methylbenzaldehyde 1-chloro-4-methoxy-2-methylbenzene Chemical compound ClC1=C(C=C(C=C1)OC)C.ClC=1C(=C(C=O)C(=CC1)OC)C MBMPNPSGWKOLCC-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- UMLOYMZBAUIGKF-UHFFFAOYSA-N 3-fluoro-2-methoxybenzaldehyde Chemical compound COC1=C(F)C=CC=C1C=O UMLOYMZBAUIGKF-UHFFFAOYSA-N 0.000 description 1
- ULRIPFMZHFSULT-UHFFFAOYSA-N 3-fluorobenzaldehyde 2-(3-fluorophenyl)-2-trimethylsilyloxyacetonitrile Chemical compound FC=1C=C(C=O)C=CC1.FC=1C=C(C=CC1)C(C#N)O[Si](C)(C)C ULRIPFMZHFSULT-UHFFFAOYSA-N 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 1
- LRDIEHDJWYRVPT-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 LRDIEHDJWYRVPT-UHFFFAOYSA-N 0.000 description 1
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 1
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 229940077398 4-methyl anisole Drugs 0.000 description 1
- JYJFNDQBESEHJQ-UHFFFAOYSA-N 5,5-dimethyloxazolidine-2,4-dione Chemical compound CC1(C)OC(=O)NC1=O JYJFNDQBESEHJQ-UHFFFAOYSA-N 0.000 description 1
- SBHKZHACUNPBFA-UHFFFAOYSA-N 5-(1h-pyrrol-2-yl)-1,3-oxazolidine-2,4-dione Chemical class O1C(=O)NC(=O)C1C1=CC=CN1 SBHKZHACUNPBFA-UHFFFAOYSA-N 0.000 description 1
- UJBTWDXPWHSHCC-UHFFFAOYSA-N 5-(2,5-dimethylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound CC1=CC=C(C)C(C2C(NC(=O)O2)=O)=C1 UJBTWDXPWHSHCC-UHFFFAOYSA-N 0.000 description 1
- IZZPXGOBVUZIMM-UHFFFAOYSA-N 5-(2,6-dichlorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound ClC1=CC=CC(Cl)=C1C1C(=O)NC(=O)O1 IZZPXGOBVUZIMM-UHFFFAOYSA-N 0.000 description 1
- RRLQWLWZRIFESM-UHFFFAOYSA-N 5-(2,6-dimethoxynaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound COC=1C=CC2=CC(OC)=CC=C2C=1C1OC(=O)NC1=O RRLQWLWZRIFESM-UHFFFAOYSA-N 0.000 description 1
- JDIOVWJTOZKXSC-UHFFFAOYSA-N 5-(2-aminophenyl)-1,3-oxazolidine-2,4-dione Chemical class NC1=CC=CC=C1C1C(=O)NC(=O)O1 JDIOVWJTOZKXSC-UHFFFAOYSA-N 0.000 description 1
- SYIMDELDEUOWOM-UHFFFAOYSA-N 5-(2-aminophenyl)-1,3-oxazolidine-2,4-dione;hydrochloride Chemical compound Cl.NC1=CC=CC=C1C1C(=O)NC(=O)O1 SYIMDELDEUOWOM-UHFFFAOYSA-N 0.000 description 1
- VKWXBLCIKDWVFA-UHFFFAOYSA-N 5-(2-chloro-6-fluorophenyl)-1,3-oxazolidine-2,4-dione ethyl 2-(2-chloro-6-fluorophenyl)-2-hydroxyethanimidate hydrochloride Chemical compound Cl.ClC1=C(C(=CC=C1)F)C(C(OCC)=N)O.ClC1=C(C(=CC=C1)F)C1C(NC(O1)=O)=O VKWXBLCIKDWVFA-UHFFFAOYSA-N 0.000 description 1
- HCEABIDLJMUSEJ-UHFFFAOYSA-N 5-(2-chloro-6-methoxyphenyl)-n-methyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound O=C1N(C(=O)NC)C(=O)OC1C1=C(Cl)C=CC=C1OC HCEABIDLJMUSEJ-UHFFFAOYSA-N 0.000 description 1
- HJNLVMQPUWWPAZ-UHFFFAOYSA-N 5-(2-chlorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound ClC1=CC=CC=C1C1C(=O)NC(=O)O1 HJNLVMQPUWWPAZ-UHFFFAOYSA-N 0.000 description 1
- MPUJFMDBFRVENB-UHFFFAOYSA-N 5-(2-ethoxy-6-fluorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound CCOC1=CC=CC(F)=C1C1C(=O)NC(=O)O1 MPUJFMDBFRVENB-UHFFFAOYSA-N 0.000 description 1
- UZCIXEQCAPMPKV-UHFFFAOYSA-N 5-(2-ethoxyphenyl)-5-hydroxy-1,3-diazinane-2,4,6-trione Chemical compound CCOC1=CC=CC=C1C1(O)C(=O)NC(=O)NC1=O UZCIXEQCAPMPKV-UHFFFAOYSA-N 0.000 description 1
- UFKAYRNOYLAMAV-UHFFFAOYSA-N 5-(2-fluoro-6-methoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=CC(F)=C1C1C(=O)NC(=O)O1 UFKAYRNOYLAMAV-UHFFFAOYSA-N 0.000 description 1
- SOUYSLIRYPWRBZ-UHFFFAOYSA-N 5-(2-fluorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound FC1=CC=CC=C1C1C(=O)NC(=O)O1 SOUYSLIRYPWRBZ-UHFFFAOYSA-N 0.000 description 1
- XDJKQMRTOMCOJX-UHFFFAOYSA-N 5-(2-methoxy-5-methylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=C(C)C=C1C1C(=O)NC(=O)O1 XDJKQMRTOMCOJX-UHFFFAOYSA-N 0.000 description 1
- OMLRUFVOBJOSJV-UHFFFAOYSA-N 5-(2-methoxynaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical group COC1=CC=C2C=CC=CC2=C1C1OC(=O)NC1=O OMLRUFVOBJOSJV-UHFFFAOYSA-N 0.000 description 1
- MPAJVZQLPIFKKT-UHFFFAOYSA-N 5-(2-methylnaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound CC1=CC=C2C=CC=CC2=C1C1OC(=O)NC1=O MPAJVZQLPIFKKT-UHFFFAOYSA-N 0.000 description 1
- HPKGRYJVZDVIGV-UHFFFAOYSA-N 5-(2-phenylmethoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound O1C(=O)NC(=O)C1C1=CC=CC=C1OCC1=CC=CC=C1 HPKGRYJVZDVIGV-UHFFFAOYSA-N 0.000 description 1
- SBEDNFAPSOUIAZ-UHFFFAOYSA-N 5-(3-chloro-6-methoxy-2-methylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=C(Cl)C(C)=C1C1C(=O)NC(=O)O1 SBEDNFAPSOUIAZ-UHFFFAOYSA-N 0.000 description 1
- PXYQVBQLMHTRMN-UHFFFAOYSA-N 5-(3-chlorophenyl)-1,3-oxazolidine-2,4-dione Chemical compound ClC1=CC=CC(C2C(NC(=O)O2)=O)=C1 PXYQVBQLMHTRMN-UHFFFAOYSA-N 0.000 description 1
- HMDURVBLOURAJA-UHFFFAOYSA-N 5-(3-fluoro-2-methoxy-5-methylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=C(F)C=C(C)C=C1C1C(=O)NC(=O)O1 HMDURVBLOURAJA-UHFFFAOYSA-N 0.000 description 1
- HCNPZCQGYCMOQF-UHFFFAOYSA-N 5-(3-phenoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound O1C(=O)NC(=O)C1C1=CC=CC(OC=2C=CC=CC=2)=C1 HCNPZCQGYCMOQF-UHFFFAOYSA-N 0.000 description 1
- YDBXXANXIVZRNL-UHFFFAOYSA-N 5-(4-methylphenyl)-1,3-oxazolidine-2,4-dione Chemical compound C1=CC(C)=CC=C1C1C(=O)NC(=O)O1 YDBXXANXIVZRNL-UHFFFAOYSA-N 0.000 description 1
- YORLWDGQTRSTLN-UHFFFAOYSA-N 5-(5-chloro-2-ethoxyphenyl)-1,3-oxazolidine-2,4-dione Chemical compound CCOC1=CC=C(Cl)C=C1C1C(=O)NC(=O)O1 YORLWDGQTRSTLN-UHFFFAOYSA-N 0.000 description 1
- QIKOEBKDWDHWNA-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-2,4-dioxo-1,3-oxazolidine-3-carbaldehyde Chemical compound COC1=CC=C(Cl)C=C1C1C(=O)N(C=O)C(=O)O1 QIKOEBKDWDHWNA-UHFFFAOYSA-N 0.000 description 1
- IBPYHYZUXCODQG-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-2,4-dioxo-n-propyl-1,3-oxazolidine-3-carboxamide Chemical compound O=C1N(C(=O)NCCC)C(=O)OC1C1=CC(Cl)=CC=C1OC IBPYHYZUXCODQG-UHFFFAOYSA-N 0.000 description 1
- BOLATULRMLIGFX-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-3-(2-methylpropanoyl)-1,3-oxazolidine-2,4-dione Chemical compound COC1=CC=C(Cl)C=C1C1C(=O)N(C(=O)C(C)C)C(=O)O1 BOLATULRMLIGFX-UHFFFAOYSA-N 0.000 description 1
- PLTCMNNHJNFCFH-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-5-hydroxy-1,3-diazinane-2,4,6-trione Chemical compound COC1=CC=C(Cl)C=C1C1(O)C(=O)NC(=O)NC1=O PLTCMNNHJNFCFH-UHFFFAOYSA-N 0.000 description 1
- YPHOBTMBFCOKGK-UHFFFAOYSA-N 5-(5-chloro-2-methoxyphenyl)-n,n-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound COC1=CC=C(Cl)C=C1C1C(=O)N(C(=O)N(C)C)C(=O)O1 YPHOBTMBFCOKGK-UHFFFAOYSA-N 0.000 description 1
- YHVXQVZQJFWWRI-UHFFFAOYSA-N 5-(7-chloronaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound C12=CC(Cl)=CC=C2C=CC=C1C1OC(=O)NC1=O YHVXQVZQJFWWRI-UHFFFAOYSA-N 0.000 description 1
- NTWXZUQFBUDLDW-UHFFFAOYSA-N 5-(7-fluoronaphthalen-1-yl)-1,3-oxazolidine-2,4-dione Chemical compound C12=CC(F)=CC=C2C=CC=C1C1OC(=O)NC1=O NTWXZUQFBUDLDW-UHFFFAOYSA-N 0.000 description 1
- FJLSWFYFARDZHG-UHFFFAOYSA-N 5-[3-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,4-dione Chemical compound FC(F)(F)C1=CC=CC(C2C(NC(=O)O2)=O)=C1 FJLSWFYFARDZHG-UHFFFAOYSA-N 0.000 description 1
- QRDUVWFODLIEOK-UHFFFAOYSA-N 5-chloro-2-methoxy-3-methylbenzaldehyde Chemical compound COC1=C(C)C=C(Cl)C=C1C=O QRDUVWFODLIEOK-UHFFFAOYSA-N 0.000 description 1
- QIFCXAISIRTSGA-UHFFFAOYSA-N 5-chloro-2-methoxy-4-methylbenzaldehyde Chemical compound COC1=CC(C)=C(Cl)C=C1C=O QIFCXAISIRTSGA-UHFFFAOYSA-N 0.000 description 1
- CRLDWFVRQNUUSZ-UHFFFAOYSA-N 5-fluoro-2-methoxybenzaldehyde Chemical compound COC1=CC=C(F)C=C1C=O CRLDWFVRQNUUSZ-UHFFFAOYSA-N 0.000 description 1
- YZSCPLGKKMSBMV-UHFFFAOYSA-N 5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-N-[5-(1-methylpiperidin-4-yl)pyridin-2-yl]pyrimidin-2-amine Chemical compound FC=1C(=NC(=NC=1)NC1=NC=C(C=C1)C1CCN(CC1)C)C1=CC2=C(OCCN2C(C)C)C(=C1)F YZSCPLGKKMSBMV-UHFFFAOYSA-N 0.000 description 1
- XANGJMDFCYLTED-UHFFFAOYSA-N 5-naphthalen-1-yl-2-sulfanylidene-1,3-oxazolidin-4-one Chemical compound O=C1NC(=S)OC1C1=CC=CC2=CC=CC=C12 XANGJMDFCYLTED-UHFFFAOYSA-N 0.000 description 1
- PEQXBBWSMDTUCO-UHFFFAOYSA-N 5-naphthalen-2-yl-1,3-oxazolidine-2,4-dione Chemical compound O1C(=O)NC(=O)C1C1=CC=C(C=CC=C2)C2=C1 PEQXBBWSMDTUCO-UHFFFAOYSA-N 0.000 description 1
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- QPJHNDWZFYDGKJ-UHFFFAOYSA-N CC(C)([O-])C.[K+].ClC1=C(C(=CC=C1)SC)C1C(NC(O1)=O)=O Chemical compound CC(C)([O-])C.[K+].ClC1=C(C(=CC=C1)SC)C1C(NC(O1)=O)=O QPJHNDWZFYDGKJ-UHFFFAOYSA-N 0.000 description 1
- GEGZDECILNPUNN-UHFFFAOYSA-N COC1=C(C=O)C=CC=C1.COC1=C(C=CC=C1)C(C#N)O[Si](C)(C)C Chemical compound COC1=C(C=O)C=CC=C1.COC1=C(C=CC=C1)C(C#N)O[Si](C)(C)C GEGZDECILNPUNN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 1
- GOVMEOKJXZXZQK-UHFFFAOYSA-N Cl.ClC1=C(C2=CC=CC=C2C=C1)C(C(O)=N)O Chemical compound Cl.ClC1=C(C2=CC=CC=C2C=C1)C(C(O)=N)O GOVMEOKJXZXZQK-UHFFFAOYSA-N 0.000 description 1
- YDWVGMOQJIXPAM-UHFFFAOYSA-N ClC1=C(C(=CC=C1)OC)C1C(NC(O1)=O)=O.ClC1=C(C(=CC=C1)OC)C1C(N(C(O1)=O)C(NC)=O)=O Chemical compound ClC1=C(C(=CC=C1)OC)C1C(NC(O1)=O)=O.ClC1=C(C(=CC=C1)OC)C1C(N(C(O1)=O)C(NC)=O)=O YDWVGMOQJIXPAM-UHFFFAOYSA-N 0.000 description 1
- DPEJTHLZFVNOQM-UHFFFAOYSA-N ClC1=C(C=O)C(=CC=C1)F.ClC1=C(C=O)C(=CC=C1)OC Chemical compound ClC1=C(C=O)C(=CC=C1)F.ClC1=C(C=O)C(=CC=C1)OC DPEJTHLZFVNOQM-UHFFFAOYSA-N 0.000 description 1
- VDTXCGGHMKQWSX-UHFFFAOYSA-N ClC=1C=CC(=C(C1)C1CNCO1)OC.[Na] Chemical compound ClC=1C=CC(=C(C1)C1CNCO1)OC.[Na] VDTXCGGHMKQWSX-UHFFFAOYSA-N 0.000 description 1
- 206010010071 Coma Diseases 0.000 description 1
- MTCFGRXMJLQNBG-UWTATZPHSA-N D-Serine Chemical compound OC[C@@H](N)C(O)=O MTCFGRXMJLQNBG-UWTATZPHSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical class CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- PPUUMMUYUQVNDP-UHFFFAOYSA-N FC1=CC(=CC=C1)F.FC1=C(C=O)C(=CC=C1)F Chemical compound FC1=CC(=CC=C1)F.FC1=C(C=O)C(=CC=C1)F PPUUMMUYUQVNDP-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- UPXFJQQHEGGNFW-UHFFFAOYSA-O O=C(CO1)NC1=[S+]C1=CC=CC2=CC=CC=C12 Chemical compound O=C(CO1)NC1=[S+]C1=CC=CC2=CC=CC=C12 UPXFJQQHEGGNFW-UHFFFAOYSA-O 0.000 description 1
- XFNAAEOLWOGURW-UHFFFAOYSA-N OC1=C(C2=CC=CC=C2C=C1)C=O.C(C)OC1=C(C2=CC=CC=C2C=C1)C=O Chemical compound OC1=C(C2=CC=CC=C2C=C1)C=O.C(C)OC1=C(C2=CC=CC=C2C=C1)C=O XFNAAEOLWOGURW-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 238000006828 Rosenmund reduction reaction Methods 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 238000006007 Sommelet synthesis reaction Methods 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- 239000004164 Wax ester Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- VGZSUPCWNCWDAN-UHFFFAOYSA-N acetohexamide Chemical compound C1=CC(C(=O)C)=CC=C1S(=O)(=O)NC(=O)NC1CCCCC1 VGZSUPCWNCWDAN-UHFFFAOYSA-N 0.000 description 1
- 229960001466 acetohexamide Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000012445 acidic reagent Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 150000001323 aldoses Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical group OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000002058 anti-hyperglycaemic effect Effects 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 229960001761 chlorpropamide Drugs 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- CRKCUSYNINXXSM-UHFFFAOYSA-N ethyl 2-(2,5-dimethylphenyl)-2,2-dihydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)(O)C1=CC(C)=CC=C1C CRKCUSYNINXXSM-UHFFFAOYSA-N 0.000 description 1
- MGKCUCSLQOWNDC-UHFFFAOYSA-N ethyl 2-(2-chloro-6-fluorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=C(F)C=CC=C1Cl MGKCUCSLQOWNDC-UHFFFAOYSA-N 0.000 description 1
- NVGMWJYWZOLUBL-UHFFFAOYSA-N ethyl 2-(2-chloro-6-methoxyphenyl)-2-hydroxyethanimidate Chemical compound CCOC(=N)C(O)C1=C(Cl)C=CC=C1OC NVGMWJYWZOLUBL-UHFFFAOYSA-N 0.000 description 1
- PUMHNAKSYDQLOJ-UHFFFAOYSA-N ethyl 2-(2-chloro-6-methoxyphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=C(Cl)C=CC=C1OC PUMHNAKSYDQLOJ-UHFFFAOYSA-N 0.000 description 1
- UUIYXDIKGSMNLF-UHFFFAOYSA-N ethyl 2-(2-chlorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=CC=C1Cl UUIYXDIKGSMNLF-UHFFFAOYSA-N 0.000 description 1
- XDVGLRWKVFAWQP-UHFFFAOYSA-N ethyl 2-(2-fluoronaphthalen-1-yl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.C1=CC=C2C(C(O)C(=N)OCC)=C(F)C=CC2=C1 XDVGLRWKVFAWQP-UHFFFAOYSA-N 0.000 description 1
- NHDVHAFTIAGUOL-UHFFFAOYSA-N ethyl 2-(2-fluorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=CC=C1F NHDVHAFTIAGUOL-UHFFFAOYSA-N 0.000 description 1
- QNWULQVUGUUZFR-UHFFFAOYSA-N ethyl 2-(3-chloro-5-fluoro-2-methoxyphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(F)=CC(Cl)=C1OC QNWULQVUGUUZFR-UHFFFAOYSA-N 0.000 description 1
- PPTJAIMORXLRLG-UHFFFAOYSA-N ethyl 2-(3-chloro-6-methoxy-2-methylphenyl)-2-hydroxyethanimidate Chemical compound CCOC(=N)C(O)C1=C(C)C(Cl)=CC=C1OC PPTJAIMORXLRLG-UHFFFAOYSA-N 0.000 description 1
- IPCFXLKDECOUKT-UHFFFAOYSA-N ethyl 2-(3-chlorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=CC(Cl)=C1 IPCFXLKDECOUKT-UHFFFAOYSA-N 0.000 description 1
- WTHPXDYOEVYATG-UHFFFAOYSA-N ethyl 2-(4-fluorophenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=C(F)C=C1 WTHPXDYOEVYATG-UHFFFAOYSA-N 0.000 description 1
- RTANUBTUJWBRFL-UHFFFAOYSA-N ethyl 2-(5-bromo-2-methoxyphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(Br)=CC=C1OC RTANUBTUJWBRFL-UHFFFAOYSA-N 0.000 description 1
- LNYQUUIYYCWMFF-UHFFFAOYSA-N ethyl 2-(5-chloro-2-methoxyphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(Cl)=CC=C1OC LNYQUUIYYCWMFF-UHFFFAOYSA-N 0.000 description 1
- KCVARQMYYXDNEC-UHFFFAOYSA-N ethyl 2-(5-fluoro-2-methoxyphenyl)-2-hydroxyethanimidate Chemical compound CCOC(=N)C(O)C1=CC(F)=CC=C1OC KCVARQMYYXDNEC-UHFFFAOYSA-N 0.000 description 1
- LKSPYEJRACLGQG-UHFFFAOYSA-N ethyl 2-(5-fluoro-2-methoxyphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(F)=CC=C1OC LKSPYEJRACLGQG-UHFFFAOYSA-N 0.000 description 1
- QFHYFFLSAZPIGT-UHFFFAOYSA-N ethyl 2-(5-fluoro-2-methylphenyl)-2-hydroxyethanimidate Chemical compound CCOC(=N)C(O)C1=CC(F)=CC=C1C QFHYFFLSAZPIGT-UHFFFAOYSA-N 0.000 description 1
- LZRDVWCMTHTQOT-UHFFFAOYSA-N ethyl 2-(5-fluoro-2-methylphenyl)-2-hydroxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC(F)=CC=C1C LZRDVWCMTHTQOT-UHFFFAOYSA-N 0.000 description 1
- ZHZHYRWTBYCZII-UHFFFAOYSA-N ethyl 2-(7-fluoronaphthalen-1-yl)-2-hydroxyethanimidate Chemical compound C1=C(F)C=C2C(C(O)C(=N)OCC)=CC=CC2=C1 ZHZHYRWTBYCZII-UHFFFAOYSA-N 0.000 description 1
- QIEYLRWWAMCENU-UHFFFAOYSA-N ethyl 2-hydroxy-2-(2-methoxy-5-nitrophenyl)ethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC([N+]([O-])=O)=CC=C1OC QIEYLRWWAMCENU-UHFFFAOYSA-N 0.000 description 1
- BVHQVCKQIXYNIP-UHFFFAOYSA-N ethyl 2-hydroxy-2-(2-methoxyphenyl)ethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=CC=C1OC BVHQVCKQIXYNIP-UHFFFAOYSA-N 0.000 description 1
- ZASGAAWGTBEHOH-UHFFFAOYSA-N ethyl 2-hydroxy-2-(2-methylnaphthalen-1-yl)ethanimidate;hydrochloride Chemical compound Cl.C1=CC=C2C(C(O)C(=N)OCC)=C(C)C=CC2=C1 ZASGAAWGTBEHOH-UHFFFAOYSA-N 0.000 description 1
- PAWHAQGMHSUQDF-UHFFFAOYSA-N ethyl 2-hydroxy-2-(3-phenoxyphenyl)ethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 PAWHAQGMHSUQDF-UHFFFAOYSA-N 0.000 description 1
- LBXKFXRERIKGHN-UHFFFAOYSA-N ethyl 2-hydroxy-2-phenylethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)C(O)C1=CC=CC=C1 LBXKFXRERIKGHN-UHFFFAOYSA-N 0.000 description 1
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 1
- LKLDKANLBFZNIJ-UHFFFAOYSA-N ethyl 5-(5-chloro-2-methoxyphenyl)-2,4-dioxo-1,3-oxazolidine-3-carboxylate Chemical compound O=C1N(C(=O)OCC)C(=O)OC1C1=CC(Cl)=CC=C1OC LKLDKANLBFZNIJ-UHFFFAOYSA-N 0.000 description 1
- LKHYFCSSVZVVNF-UHFFFAOYSA-N ethyl hexanoate;sodium Chemical compound [Na].CCCCCC(=O)OCC LKHYFCSSVZVVNF-UHFFFAOYSA-N 0.000 description 1
- DRDBNKYFCOLNQO-UHFFFAOYSA-N ethyl n-phenylmethanimidate Chemical compound CCOC=NC1=CC=CC=C1 DRDBNKYFCOLNQO-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 235000015220 hamburgers Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical class OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 229940037627 magnesium lauryl sulfate Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- AXLHVTKGDPVANO-UHFFFAOYSA-N methyl 2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Chemical compound COC(=O)C(N)CNC(=O)OC(C)(C)C AXLHVTKGDPVANO-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- SSSMPTRUVQBIIO-UHFFFAOYSA-N n-[2-(2,4-dioxo-1,3-oxazolidin-3-yl)phenyl]acetamide Chemical class CC(=O)NC1=CC=CC=C1N1C(=O)OCC1=O SSSMPTRUVQBIIO-UHFFFAOYSA-N 0.000 description 1
- NQRAFAJRALBNII-UHFFFAOYSA-N n-[2-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1C1C(=O)NC(=O)O1 NQRAFAJRALBNII-UHFFFAOYSA-N 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000003538 oral antidiabetic agent Substances 0.000 description 1
- 229940127209 oral hypoglycaemic agent Drugs 0.000 description 1
- 125000001979 organolithium group Chemical group 0.000 description 1
- 238000010653 organometallic reaction Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 229960005152 pentetrazol Drugs 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- ICFJFFQQTFMIBG-UHFFFAOYSA-N phenformin Chemical compound NC(=N)NC(=N)NCCC1=CC=CC=C1 ICFJFFQQTFMIBG-UHFFFAOYSA-N 0.000 description 1
- 229960003243 phenformin Drugs 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000012256 powdered iron Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- SOFSSZFBVOGIKD-UHFFFAOYSA-N pyrimidine-2,4,5-trione Chemical class O=C1NC(=O)C(=O)C=N1 SOFSSZFBVOGIKD-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000011110 re-filtration Methods 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000003579 shift reagent Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- VRZZFAMELVYLTO-UHFFFAOYSA-M sodium 3-chloro-5-fluoro-2-hydroxybenzaldehyde hydroxide Chemical compound [OH-].[Na+].ClC=1C(=C(C=O)C=C(C1)F)O VRZZFAMELVYLTO-UHFFFAOYSA-M 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- NASFKTWZWDYFER-UHFFFAOYSA-N sodium;hydrate Chemical compound O.[Na] NASFKTWZWDYFER-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008227 sterile water for injection Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229960002277 tolazamide Drugs 0.000 description 1
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 1
- 229960005371 tolbutamide Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 229940124586 β-lactam antibiotics Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/225—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/44—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by —CHO groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/008—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with tri- or tetrahalomethyl compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/511—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of singly bound oxygen functional groups to >C = O groups
- C07C45/513—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of singly bound oxygen functional groups to >C = O groups the singly bound functional group being an etherified hydroxyl group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/546—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/60—Three or more oxygen or sulfur atoms
- C07D239/62—Barbituric acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/44—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/46—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000434661A CA1164872A (en) | 1980-07-28 | 1983-08-15 | 4-substituted oxazolones |
| CA000434663A CA1164873A (en) | 1980-07-28 | 1983-08-15 | 5-(substituted)aryloxazolidin-4-one-2-thiones |
| CA000434662A CA1164884A (en) | 1980-07-28 | 1983-08-15 | 1-hydroxy-1-(substituted)aryl carboximidates |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17320680A | 1980-07-28 | 1980-07-28 | |
| US173,206 | 1980-07-28 | ||
| US06/222,202 US4367234A (en) | 1980-07-28 | 1981-01-02 | Hypoglycemic 5-substituted oxazolidine-2,4-diones |
| US222,202 | 1981-01-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1155855A true CA1155855A (en) | 1983-10-25 |
Family
ID=26868872
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000382586A Expired CA1155855A (en) | 1980-07-28 | 1981-07-27 | Hypoglycemic 5-substituted oxazolidine-2,4-diones |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4367234A (esLanguage) |
| KR (3) | KR850000381B1 (esLanguage) |
| AR (3) | AR228061A1 (esLanguage) |
| AT (1) | AT376424B (esLanguage) |
| AU (1) | AU526905B2 (esLanguage) |
| CA (1) | CA1155855A (esLanguage) |
| CH (1) | CH653025A5 (esLanguage) |
| DD (1) | DD202149A5 (esLanguage) |
| DE (1) | DE3129309A1 (esLanguage) |
| DK (1) | DK151882C (esLanguage) |
| ES (3) | ES8306367A1 (esLanguage) |
| FI (1) | FI77457C (esLanguage) |
| FR (1) | FR2487348B1 (esLanguage) |
| GB (3) | GB2083810B (esLanguage) |
| GR (1) | GR74590B (esLanguage) |
| HU (1) | HU185682B (esLanguage) |
| IE (1) | IE51427B1 (esLanguage) |
| IL (1) | IL63422A (esLanguage) |
| IT (1) | IT1138110B (esLanguage) |
| LU (1) | LU83512A1 (esLanguage) |
| NL (1) | NL8103536A (esLanguage) |
| NO (1) | NO812558L (esLanguage) |
| NZ (1) | NZ197853A (esLanguage) |
| PH (1) | PH17421A (esLanguage) |
| PT (1) | PT73437B (esLanguage) |
| SE (1) | SE460849B (esLanguage) |
| YU (3) | YU185281A (esLanguage) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4689336A (en) * | 1981-01-02 | 1987-08-25 | Pfizer Inc. | Hypoglycemic 5-substituted oxazolidine 2,4-diones |
| GR78120B (esLanguage) * | 1982-03-01 | 1984-09-26 | Pfizer | |
| US4430337A (en) * | 1982-06-23 | 1984-02-07 | Pfizer Inc. | Alicyclic substituted oxazolidine-2,4-diones having hypoglycemic activity |
| JPS59186916A (ja) * | 1983-04-06 | 1984-10-23 | Aiji Noda | 膵石症治療剤 |
| US5130379A (en) * | 1988-03-08 | 1992-07-14 | Pfizer Inc. | Hypoglycemic thiazolidinedione derivatives |
| US4946942A (en) * | 1988-03-11 | 1990-08-07 | Bioresearch, Inc. | Urethane-protected amino acid-N-carboxyanhydrides |
| US5442124A (en) * | 1989-06-30 | 1995-08-15 | Firmenich Sa | Process for the preparation of novel aromatic compounds |
| WO1991007107A1 (en) * | 1989-11-13 | 1991-05-30 | Pfizer Inc. | Oxazolidinedione hypoglycemic agents |
| US5036079A (en) * | 1989-12-07 | 1991-07-30 | Pfizer Inc. | Hypoglycemic thiazolidinedione derivatives |
| PT97888B (pt) * | 1990-06-07 | 1998-12-31 | Zeneca Ltd | Processo para a preparacao de compostos heterociclicos derivados de indol e de composicoes farmaceuticas que os contem |
| GB9017218D0 (en) * | 1990-08-06 | 1990-09-19 | Beecham Group Plc | Novel compounds |
| US5334604A (en) * | 1990-08-23 | 1994-08-02 | Pfizer Inc. | Hypoglycemic hydroxyurea derivatives |
| TW222626B (esLanguage) | 1991-07-22 | 1994-04-21 | Pfizer | |
| US5498621A (en) * | 1992-05-01 | 1996-03-12 | Pfizer Inc. | Oxazolidinedione hypoglycemic agents |
| US5401761A (en) * | 1993-12-09 | 1995-03-28 | Pfizer, Inc. | Thiazolidinedione hypoglycemic agents |
| US5925656A (en) * | 1995-04-10 | 1999-07-20 | Dr. Reddy's Research Foundation | Compounds having antidiabetic, hypolipidemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them |
| GB9604242D0 (en) | 1996-02-28 | 1996-05-01 | Glaxo Wellcome Inc | Chemical compounds |
| US5801173A (en) * | 1996-05-06 | 1998-09-01 | Dr. Reddy's Research Foundation | Heterocyclic compounds having antidiabetic, hypolipidaemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them |
| ZA973850B (en) * | 1996-05-06 | 1997-12-02 | Reddy Research Foundation | Novel antidiabetic compounds having hypolipidaemic, anti-hypertensive properties, process for their preparation and pharmaceutical compositions containing them. |
| ZA973848B (en) * | 1996-05-06 | 1997-12-02 | Reddy Research Foundation | Novel heterocyclic compounds having antidiabetic, hypolipidaemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them. |
| US5919782A (en) * | 1996-05-06 | 1999-07-06 | Dr. Reddy's Research Foundation | Heterocyclic compounds having antidiabetic, hypolipidaemic, antihypertensive properties, process for their preparation and pharmaceutical compositions containing them |
| US5985884A (en) * | 1996-07-01 | 1999-11-16 | Dr. Reddy's Research Foundation | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them and their use in the treatment of diabetes and related diseases |
| US6114526A (en) * | 1996-07-01 | 2000-09-05 | Dr. Reddy's Research Foundation | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them and their use in the treatment of diabetes and related diseases |
| USRE39266E1 (en) * | 1996-07-01 | 2006-09-05 | Dr. Reddy's Laboratories, Limited | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them and their use in the treatment of diabetes and related diseases |
| US6372750B2 (en) | 1996-07-01 | 2002-04-16 | Dr. Reddy's Research Foundation | Heterocyclic compounds, process for their preparation and pharmaceutical compounds containing them and their use in the treatment of diabetes and related diseases |
| CN1325309A (zh) * | 1998-08-21 | 2001-12-05 | 维洛药品公司 | 用于治疗或预防病毒感染和相关疾病的化合物、组合物和方法 |
| WO2000018745A1 (en) * | 1998-09-30 | 2000-04-06 | Roche Diagnostics Gmbh | Oxazolidine derivatives for the treatment and prevention of metabolic bone disorders |
| EP1194147B1 (en) | 1999-06-18 | 2007-01-10 | Merck & Co., Inc. | Arylthiazolidinedione and aryloxazolidinedione derivatives |
| AU773505B2 (en) | 1999-06-18 | 2004-05-27 | Merck & Co., Inc. | Arylthiazolidinedione and aryloxazolidinedione derivatives |
| EP2134169A2 (en) | 2007-03-09 | 2009-12-23 | Indigene Pharmaceuticals Inc. | Combination of metformin r-(+) lipoate and antihyperlipidemic agents for the treatment of diabetic hyperglycemia and diabetic complications |
| JP5417860B2 (ja) * | 2008-08-26 | 2014-02-19 | 住友化学株式会社 | α−ヒドロキシエステル類の製造方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE729852C (de) * | 1939-07-06 | 1943-01-04 | Carl Nachtigall | Verfahren zur Herstellung von 2, 4-Dioxooxazolidinen |
| US2338220A (en) * | 1942-01-31 | 1944-01-04 | Mallinckrodt Chemical Works | Process of making oxazolidinediones |
| US2721197A (en) * | 1953-01-05 | 1955-10-18 | Bristol Lab Inc | Bicyclic lactams |
| US2961377A (en) * | 1957-08-05 | 1960-11-22 | Us Vitamin Pharm Corp | Oral anti-diabetic compositions and methods |
| FR1284516A (fr) * | 1957-11-20 | 1962-02-16 | France Etat | Produits utilisables notamment comme agents susceptibles d'agir sur la croissance des plantes et leur procédé de fabrication |
| GB1227428A (esLanguage) * | 1968-04-08 | 1971-04-07 | ||
| US3699229A (en) * | 1970-12-18 | 1972-10-17 | Abbott Lab | 2-oxo-5-phenyl-4-oxazolidinone as an anti-depressant agent |
| AT322266B (de) * | 1972-11-06 | 1975-05-12 | Rath Karl Friedrich | Vorrichtung zum einsetzen von pflanzen |
| FR2207706B1 (esLanguage) * | 1972-11-24 | 1975-11-28 | Orsymonde | |
| DE2813873A1 (de) * | 1978-03-31 | 1979-10-11 | Basf Ag | Verfahren zur herstellung von oxazolidin-2,4-dionen |
| US4200642A (en) * | 1978-08-21 | 1980-04-29 | Pfizer Inc. | Spiro-oxazolidindiones |
-
1981
- 1981-01-02 US US06/222,202 patent/US4367234A/en not_active Expired - Fee Related
- 1981-07-22 GB GB8122525A patent/GB2083810B/en not_active Expired
- 1981-07-22 HU HU812142A patent/HU185682B/hu not_active IP Right Cessation
- 1981-07-24 DE DE19813129309 patent/DE3129309A1/de active Granted
- 1981-07-24 AT AT0328681A patent/AT376424B/de not_active IP Right Cessation
- 1981-07-24 SE SE8104542A patent/SE460849B/sv not_active IP Right Cessation
- 1981-07-24 AR AR286202A patent/AR228061A1/es active
- 1981-07-27 FI FI812340A patent/FI77457C/fi not_active IP Right Cessation
- 1981-07-27 PH PH25969A patent/PH17421A/en unknown
- 1981-07-27 LU LU83512A patent/LU83512A1/fr unknown
- 1981-07-27 AU AU73435/81A patent/AU526905B2/en not_active Ceased
- 1981-07-27 FR FR8114543A patent/FR2487348B1/fr not_active Expired
- 1981-07-27 CA CA000382586A patent/CA1155855A/en not_active Expired
- 1981-07-27 NZ NZ197853A patent/NZ197853A/en unknown
- 1981-07-27 ES ES504322A patent/ES8306367A1/es not_active Expired
- 1981-07-27 IE IE1695/81A patent/IE51427B1/en unknown
- 1981-07-27 IT IT23175/81A patent/IT1138110B/it active
- 1981-07-27 KR KR1019810002716A patent/KR850000381B1/ko not_active Expired
- 1981-07-27 CH CH4879/81A patent/CH653025A5/fr not_active IP Right Cessation
- 1981-07-27 IL IL63422A patent/IL63422A/xx unknown
- 1981-07-27 NL NL8103536A patent/NL8103536A/nl not_active Application Discontinuation
- 1981-07-27 NO NO812558A patent/NO812558L/no unknown
- 1981-07-27 YU YU01852/81A patent/YU185281A/xx unknown
- 1981-07-27 PT PT73437A patent/PT73437B/pt unknown
- 1981-07-27 DK DK334681A patent/DK151882C/da active
- 1981-07-27 GR GR65637A patent/GR74590B/el unknown
- 1981-07-28 DD DD81232154A patent/DD202149A5/de unknown
-
1982
- 1982-05-13 AR AR289383A patent/AR230834A1/es active
- 1982-05-13 AR AR289384A patent/AR231721A1/es active
- 1982-08-02 ES ES514666A patent/ES514666A0/es active Granted
- 1982-08-02 ES ES514665A patent/ES514665A0/es active Granted
-
1983
- 1983-04-18 YU YU00882/83A patent/YU88283A/xx unknown
- 1983-04-18 YU YU00881/83A patent/YU88183A/xx unknown
- 1983-06-24 GB GB08317144A patent/GB2128987B/en not_active Expired
- 1983-06-24 GB GB08317145A patent/GB2132609B/en not_active Expired
-
1984
- 1984-10-29 KR KR1019840006723A patent/KR850000382B1/ko not_active Expired
- 1984-10-29 KR KR1019840006724A patent/KR850000387B1/ko not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1155855A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| US4342771A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| Toja et al. | 3-Alkyl-2-aryl-3H-naphth [1, 2-d] imidazoles, a novel class of nonacidic antiinflammatory agents | |
| US4617312A (en) | Aldose reductase inhibiting 5-(2-alkoxyphenyl) thiazolidinediones | |
| US4311840A (en) | 2,3,6,7-Tetrahydro-2-thioxo-4H-oxazolo[3,2-a]-1,3,5 triazin-4-ones | |
| US4753956A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| US4448971A (en) | Hypoglycemic 5-phenyl-substituted oxazolidine-2,4-diones | |
| US4689336A (en) | Hypoglycemic 5-substituted oxazolidine 2,4-diones | |
| US4407811A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| Schnur et al. | Improved glucose tolerance in rats treated with oxazolidinediones | |
| US4399296A (en) | Hypoglycemic 5-substituted oxazolidine-2,4-diones | |
| JOJIMA et al. | Pyridazines. IV. Intramolecular Cycloaddition of 3-Chloro-6-(2-allyloxyphenoxy) pyridazines | |
| US4153719A (en) | Aromatic diketones | |
| EP0045602B1 (en) | Novel polycyclic indole derivatives | |
| US4565820A (en) | Hypoglycemic 5-pyrrolyl, indolyl and quinolyl substituted oxazolidine-2,4-diones and their use | |
| US4812471A (en) | Hypoglycemic 5-(isoxazolyl or isothiazolyl)-oxazolidine-2,4-diones | |
| EP0117035B1 (en) | Aldose reductase inhibiting 5-(2-alkoxyphenyl)thiazolidinediones | |
| US4454320A (en) | Process for 5-substituted dialuric acids | |
| US4457939A (en) | Aldose reductase inhibiting 5-(2-alkoxy-3-substituted phenyl)hydantoins | |
| US4431810A (en) | Intermediates for the preparation of 5-substituted oxazolidine-2,4-diones | |
| US4401831A (en) | Substituted 3-aryl-2-cycloalken-1-one and method of preparation thereof | |
| NZ209272A (en) | 5-hydroxy-5-(phenyl or naphthyl)hexahydropyrimidine-2,4,6-triones | |
| EP0112620B1 (en) | 5-(substituted phenyl) hydantoins | |
| CA1164872A (en) | 4-substituted oxazolones | |
| JPS6135188B2 (esLanguage) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |