CA1062257A - Purine compounds and salts thereof - Google Patents
Purine compounds and salts thereofInfo
- Publication number
- CA1062257A CA1062257A CA234,591A CA234591A CA1062257A CA 1062257 A CA1062257 A CA 1062257A CA 234591 A CA234591 A CA 234591A CA 1062257 A CA1062257 A CA 1062257A
- Authority
- CA
- Canada
- Prior art keywords
- amino
- hydroxy
- hydrogen
- hydroxyethoxymethyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003839 salts Chemical class 0.000 title claims description 31
- 125000000561 purinyl group Chemical class N1=C(N=C2N=CNC2=C1)* 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 65
- 239000001257 hydrogen Chemical group 0.000 claims abstract description 58
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 58
- 150000001875 compounds Chemical class 0.000 claims abstract description 53
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 40
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 37
- -1 hydroxy, amino Chemical group 0.000 claims abstract description 34
- 150000002431 hydrogen Chemical group 0.000 claims abstract description 27
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 23
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 20
- 150000002367 halogens Chemical group 0.000 claims abstract description 20
- 239000001301 oxygen Chemical group 0.000 claims abstract description 20
- 229910052760 oxygen Chemical group 0.000 claims abstract description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 17
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 12
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000005864 Sulphur Substances 0.000 claims abstract description 7
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims abstract description 7
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 7
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 69
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 42
- 230000008569 process Effects 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 33
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 31
- KDCGOANMDULRCW-UHFFFAOYSA-N Purine Natural products N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 claims description 29
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 125000003282 alkyl amino group Chemical group 0.000 claims description 13
- 239000000047 product Substances 0.000 claims description 13
- 238000010992 reflux Methods 0.000 claims description 13
- 229930024421 Adenine Natural products 0.000 claims description 12
- 229960000643 adenine Drugs 0.000 claims description 12
- 229910021529 ammonia Inorganic materials 0.000 claims description 12
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 claims description 11
- CSMCRCLIPQDIKB-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethanol Chemical compound NC1=NC(N)=C2N=CN(COCCO)C2=N1 CSMCRCLIPQDIKB-UHFFFAOYSA-N 0.000 claims description 9
- KFGDVSVZKZPADB-UHFFFAOYSA-N 2-[(6-amino-2-chloropurin-9-yl)methoxy]ethanol Chemical compound NC1=NC(Cl)=NC2=C1N=CN2COCCO KFGDVSVZKZPADB-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- HNQDBKBFYQVYLX-UHFFFAOYSA-N 2-(chloromethoxy)ethyl benzoate Chemical compound ClCOCCOC(=O)C1=CC=CC=C1 HNQDBKBFYQVYLX-UHFFFAOYSA-N 0.000 claims description 8
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 8
- 150000003212 purines Chemical class 0.000 claims description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 claims description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 6
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000006239 protecting group Chemical group 0.000 claims description 6
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 claims description 6
- 101710169336 5'-deoxyadenosine deaminase Proteins 0.000 claims description 5
- 102000055025 Adenosine deaminases Human genes 0.000 claims description 5
- 150000007942 carboxylates Chemical class 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 239000002243 precursor Substances 0.000 claims description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 4
- 230000000903 blocking effect Effects 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 4
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 claims description 4
- 235000010288 sodium nitrite Nutrition 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- VUJCFVXDTNKPKW-UHFFFAOYSA-N 2-[(2,6-dichloropurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(Cl)=NC(Cl)=C2N=CN1COCCOC(=O)C1=CC=CC=C1 VUJCFVXDTNKPKW-UHFFFAOYSA-N 0.000 claims description 3
- RWCYGLJSLQIGDH-UHFFFAOYSA-N 2-chloro-9-(2-hydroxyethoxymethyl)-3h-purin-6-one Chemical compound N1=C(Cl)NC(=O)C2=C1N(COCCO)C=N2 RWCYGLJSLQIGDH-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 238000005915 ammonolysis reaction Methods 0.000 claims description 3
- 239000007900 aqueous suspension Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 claims description 3
- YWNMCXWWDNKNTC-UHFFFAOYSA-N 2-[(2-amino-6-phenylmethoxypurin-9-yl)methoxy]ethanol Chemical compound C=12N=CN(COCCO)C2=NC(N)=NC=1OCC1=CC=CC=C1 YWNMCXWWDNKNTC-UHFFFAOYSA-N 0.000 claims description 2
- UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 12
- ROQWXTQKPITLJM-UHFFFAOYSA-N 2-[(2-aminopurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(N)=NC=C2N=CN1COCCOC(=O)C1=CC=CC=C1 ROQWXTQKPITLJM-UHFFFAOYSA-N 0.000 claims 1
- WJSVJNDMOQTICG-UHFFFAOYSA-N 2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7h-purin-6-one Chemical compound NC1=NC=2N=CNC=2C(=O)N1CC1(C)CC(=C)C(=O)O1 WJSVJNDMOQTICG-UHFFFAOYSA-N 0.000 claims 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims 1
- 230000000840 anti-viral effect Effects 0.000 abstract description 6
- 125000000217 alkyl group Chemical group 0.000 abstract description 5
- 150000001540 azides Chemical class 0.000 abstract description 4
- 241000124008 Mammalia Species 0.000 abstract description 3
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical group C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 abstract description 2
- 241000700605 Viruses Species 0.000 abstract description 2
- 239000003814 drug Substances 0.000 abstract description 2
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract description 2
- 229910019142 PO4 Inorganic materials 0.000 abstract 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical group [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 abstract 1
- 239000010452 phosphate Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 68
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 52
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 45
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 44
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 31
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 239000007787 solid Substances 0.000 description 23
- 239000002904 solvent Substances 0.000 description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 238000001914 filtration Methods 0.000 description 14
- 239000003921 oil Substances 0.000 description 13
- 238000001953 recrystallisation Methods 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 4
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 4
- 235000011130 ammonium sulphate Nutrition 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 4
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- MKTTXCDPHPEDCL-UHFFFAOYSA-N 2-[(2-amino-6-chloropurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(N)=NC(Cl)=C2N=CN1COCCOC(=O)C1=CC=CC=C1 MKTTXCDPHPEDCL-UHFFFAOYSA-N 0.000 description 3
- YDLAHBBJAGGIJZ-UHFFFAOYSA-N 2-sulfanylethyl acetate Chemical compound CC(=O)OCCS YDLAHBBJAGGIJZ-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 230000004927 fusion Effects 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- XFEQOLXBMLXKDE-UHFFFAOYSA-N 2-(acetyloxymethoxy)ethyl acetate Chemical compound CC(=O)OCCOCOC(C)=O XFEQOLXBMLXKDE-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- RHMAZSNTRRZPMG-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethyl acetate Chemical compound N1=C(N)N=C2N(COCCOC(=O)C)C=NC2=C1N RHMAZSNTRRZPMG-UHFFFAOYSA-N 0.000 description 2
- XAZMDVUJLSYFIQ-UHFFFAOYSA-N 2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]ethyl benzoate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1COCCOC(=O)C1=CC=CC=C1 XAZMDVUJLSYFIQ-UHFFFAOYSA-N 0.000 description 2
- DELWFOSIVCZBMF-UHFFFAOYSA-N 2-[(6-chloropurin-9-yl)methoxy]ethyl benzoate Chemical compound C1=NC=2C(Cl)=NC=NC=2N1COCCOC(=O)C1=CC=CC=C1 DELWFOSIVCZBMF-UHFFFAOYSA-N 0.000 description 2
- HAKQBKQEXFLTCF-UHFFFAOYSA-N 2-[2-[(6-aminopurin-9-yl)methoxy]ethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCOCN1C(N=CN=C2N)=C2N=C1 HAKQBKQEXFLTCF-UHFFFAOYSA-N 0.000 description 2
- LSWRBVSEWBWTDR-UHFFFAOYSA-N 2-hydroxyethyl benzoate Chemical compound OCCOC(=O)C1=CC=CC=C1 LSWRBVSEWBWTDR-UHFFFAOYSA-N 0.000 description 2
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 2
- NGDBUGSDGNWXQR-UHFFFAOYSA-N 9-(ethylsulfanylmethyl)purin-6-amine Chemical compound N1=CN=C2N(CSCC)C=NC2=C1N NGDBUGSDGNWXQR-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 206010046865 Vaccinia virus infection Diseases 0.000 description 2
- 208000036142 Viral infection Diseases 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- UQVDQSWZQXDUJB-UHFFFAOYSA-N hydron;7h-purin-6-amine;chloride Chemical compound Cl.NC1=NC=NC2=C1NC=N2 UQVDQSWZQXDUJB-UHFFFAOYSA-N 0.000 description 2
- 239000008309 hydrophilic cream Substances 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical class [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000003883 ointment base Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 229960003087 tioguanine Drugs 0.000 description 2
- 241001529453 unidentified herpesvirus Species 0.000 description 2
- 208000007089 vaccinia Diseases 0.000 description 2
- 230000009385 viral infection Effects 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RMFWVOLULURGJI-UHFFFAOYSA-N 2,6-dichloro-7h-purine Chemical compound ClC1=NC(Cl)=C2NC=NC2=N1 RMFWVOLULURGJI-UHFFFAOYSA-N 0.000 description 1
- SQDFPIZSEVKOHD-UHFFFAOYSA-N 2-(7H-purin-2-ylmethoxy)ethyl benzoate Chemical compound C(C1=CC=CC=C1)(=O)OCCOCC1=NC=C2NC=NC2=N1 SQDFPIZSEVKOHD-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- CBGCJDKLQNGINO-UHFFFAOYSA-N 2-(chloromethylsulfanyl)ethyl acetate Chemical compound CC(=O)OCCSCCl CBGCJDKLQNGINO-UHFFFAOYSA-N 0.000 description 1
- KTHPEBSKLPXIIR-UHFFFAOYSA-N 2-[(2,6-diazidopurin-9-yl)methoxy]ethyl acetate Chemical compound N1=C(N=[N+]=[N-])N=C2N(COCCOC(=O)C)C=NC2=C1N=[N+]=[N-] KTHPEBSKLPXIIR-UHFFFAOYSA-N 0.000 description 1
- ZLSUXFCQKHOZIN-UHFFFAOYSA-N 2-[(2,6-diazidopurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(N=[N+]=[N-])=NC(N=[N+]=[N-])=C2N=CN1COCCOC(=O)C1=CC=CC=C1 ZLSUXFCQKHOZIN-UHFFFAOYSA-N 0.000 description 1
- WDWFTRKUESNIEQ-UHFFFAOYSA-N 2-[(2,6-dichloropurin-9-yl)methoxy]ethyl acetate Chemical compound N1=C(Cl)N=C2N(COCCOC(=O)C)C=NC2=C1Cl WDWFTRKUESNIEQ-UHFFFAOYSA-N 0.000 description 1
- FZLBUUNVTLPQAK-UHFFFAOYSA-N 2-[(2-amino-6-methylsulfanylpurin-9-yl)methoxy]ethanol Chemical compound CSC1=NC(N)=NC2=C1N=CN2COCCO FZLBUUNVTLPQAK-UHFFFAOYSA-N 0.000 description 1
- PMVOVOOAYGEEHF-UHFFFAOYSA-N 2-[(2-amino-6-sulfanylidene-3h-purin-9-yl)methoxy]ethyl benzoate Chemical compound C1=NC=2C(=S)NC(N)=NC=2N1COCCOC(=O)C1=CC=CC=C1 PMVOVOOAYGEEHF-UHFFFAOYSA-N 0.000 description 1
- OKQHSIGMOWQUIK-UHFFFAOYSA-N 2-[(2-aminopurin-9-yl)methoxy]ethanol Chemical compound NC1=NC=C2N=CN(COCCO)C2=N1 OKQHSIGMOWQUIK-UHFFFAOYSA-N 0.000 description 1
- ROLQUXWMUOQSTR-UHFFFAOYSA-N 2-[(6-amino-7h-purin-2-yl)methoxy]ethanol Chemical compound NC1=NC(COCCO)=NC2=C1NC=N2 ROLQUXWMUOQSTR-UHFFFAOYSA-N 0.000 description 1
- PEIRNIBZTBBIHT-UHFFFAOYSA-N 2-[(6-aminopurin-9-yl)methoxy]ethanol Chemical compound NC1=NC=NC2=C1N=CN2COCCO PEIRNIBZTBBIHT-UHFFFAOYSA-N 0.000 description 1
- IFCSUTHKDBXWGF-UHFFFAOYSA-N 2-[(6-chloropurin-9-yl)methylsulfanyl]ethyl acetate Chemical compound N1=CN=C2N(CSCCOC(=O)C)C=NC2=C1Cl IFCSUTHKDBXWGF-UHFFFAOYSA-N 0.000 description 1
- GQJJWENQMWRFAT-UHFFFAOYSA-N 2-[2-(chloromethoxy)ethyl]isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CCOCCl)C(=O)C2=C1 GQJJWENQMWRFAT-UHFFFAOYSA-N 0.000 description 1
- QFNIAQMULZQGOW-UHFFFAOYSA-N 2-[bis(trimethylsilyl)amino]-8-trimethylsilyl-3,7-dihydropurin-6-one Chemical compound O=C1NC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=C1NC([Si](C)(C)C)=N2 QFNIAQMULZQGOW-UHFFFAOYSA-N 0.000 description 1
- DRDKSZBQTGDSQJ-UHFFFAOYSA-N 2-amino-9-(2-hydroxyethoxymethyl)-3h-purine-6-thione Chemical compound S=C1NC(N)=NC2=C1N=CN2COCCO DRDKSZBQTGDSQJ-UHFFFAOYSA-N 0.000 description 1
- SMSSGLYHZZTFDI-UHFFFAOYSA-N 3-(chloromethoxy)propyl benzoate Chemical compound ClCOCCCOC(=O)C1=CC=CC=C1 SMSSGLYHZZTFDI-UHFFFAOYSA-N 0.000 description 1
- KSOAFZITIFFWHS-UHFFFAOYSA-N 3-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]propyl benzoate Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1COCCCOC(=O)C1=CC=CC=C1 KSOAFZITIFFWHS-UHFFFAOYSA-N 0.000 description 1
- FJUPUBXRHPSANV-UHFFFAOYSA-N 4-hydroxy-1-phenylbutan-1-one Chemical compound OCCCC(=O)C1=CC=CC=C1 FJUPUBXRHPSANV-UHFFFAOYSA-N 0.000 description 1
- ONPGOSVDVDPBCY-CQSZACIVSA-N 6-amino-5-[(1r)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-n-[4-(4-methylpiperazine-1-carbonyl)phenyl]pyridazine-3-carboxamide Chemical compound O([C@H](C)C=1C(=C(F)C=CC=1Cl)Cl)C(C(=NN=1)N)=CC=1C(=O)NC(C=C1)=CC=C1C(=O)N1CCN(C)CC1 ONPGOSVDVDPBCY-CQSZACIVSA-N 0.000 description 1
- LEYMKLZVUYUKSH-UHFFFAOYSA-N 6-chloro-9-(ethylsulfanylmethyl)purine Chemical compound N1=CN=C2N(CSCC)C=NC2=C1Cl LEYMKLZVUYUKSH-UHFFFAOYSA-N 0.000 description 1
- UKADKJJNEZZNGH-UHFFFAOYSA-N 7h-purine-2,6-diamine;hydrate Chemical compound O.NC1=NC(N)=C2N=CNC2=N1 UKADKJJNEZZNGH-UHFFFAOYSA-N 0.000 description 1
- BLRZKRCLOZMDIP-UHFFFAOYSA-N 9-(2-aminoethoxymethyl)purin-6-amine Chemical compound N1=CN=C2N(COCCN)C=NC2=C1N BLRZKRCLOZMDIP-UHFFFAOYSA-N 0.000 description 1
- QDQLJQGWLUZFDW-UHFFFAOYSA-N 9-(ethylsulfanylmethyl)-n-methylpurin-6-amine Chemical compound N1=CN=C2N(CSCC)C=NC2=C1NC QDQLJQGWLUZFDW-UHFFFAOYSA-N 0.000 description 1
- MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical compound NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- 241000701022 Cytomegalovirus Species 0.000 description 1
- 241000709661 Enterovirus Species 0.000 description 1
- 208000001860 Eye Infections Diseases 0.000 description 1
- 208000000903 Herpes simplex encephalitis Diseases 0.000 description 1
- 208000037018 Herpes simplex virus encephalitis Diseases 0.000 description 1
- 208000007514 Herpes zoster Diseases 0.000 description 1
- 208000005100 Herpetic Keratitis Diseases 0.000 description 1
- 101001018064 Homo sapiens Lysosomal-trafficking regulator Proteins 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 102100033472 Lysosomal-trafficking regulator Human genes 0.000 description 1
- 241000710185 Mengo virus Species 0.000 description 1
- 235000010703 Modiola caroliniana Nutrition 0.000 description 1
- 244000038561 Modiola caroliniana Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010073938 Ophthalmic herpes simplex Diseases 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000710960 Sindbis virus Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- QXAITBQSYVNQDR-UHFFFAOYSA-N amitraz Chemical compound C=1C=C(C)C=C(C)C=1N=CN(C)C=NC1=CC=C(C)C=C1C QXAITBQSYVNQDR-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KRIFIIWBVJKVST-UHFFFAOYSA-N chloro(chloromethylsulfanyl)methane Chemical compound ClCSCCl KRIFIIWBVJKVST-UHFFFAOYSA-N 0.000 description 1
- XZCHJYXUPALGHH-UHFFFAOYSA-N chloromethylsulfanylethane Chemical compound CCSCCl XZCHJYXUPALGHH-UHFFFAOYSA-N 0.000 description 1
- 238000010549 co-Evaporation Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- NDMXSCGMYOVVJE-UHFFFAOYSA-N ethoxymethyl acetate Chemical compound CCOCOC(C)=O NDMXSCGMYOVVJE-UHFFFAOYSA-N 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 208000011323 eye infectious disease Diseases 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 201000010884 herpes simplex virus keratitis Diseases 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 201000006747 infectious mononucleosis Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 229940080428 lactose 200 mg Drugs 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical class Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- GRWIABMEEKERFV-UHFFFAOYSA-N methanol;oxolane Chemical compound OC.C1CCOC1 GRWIABMEEKERFV-UHFFFAOYSA-N 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229940093430 polyethylene glycol 1500 Drugs 0.000 description 1
- 239000001818 polyoxyethylene sorbitan monostearate Substances 0.000 description 1
- 235000010989 polyoxyethylene sorbitan monostearate Nutrition 0.000 description 1
- 229940113124 polysorbate 60 Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- LFQULJPVXNYWAG-UHFFFAOYSA-N sodium;phenylmethanolate Chemical compound [Na]OCC1=CC=CC=C1 LFQULJPVXNYWAG-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 229940100611 topical cream Drugs 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 229940100615 topical ointment Drugs 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/32—Nitrogen atom
- C07D473/34—Nitrogen atom attached in position 6, e.g. adenine
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Virology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB38278/74A GB1523865A (en) | 1974-09-02 | 1974-09-02 | Purine compunds and salts thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1062257A true CA1062257A (en) | 1979-09-11 |
Family
ID=10402412
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA234,591A Expired CA1062257A (en) | 1974-09-02 | 1975-09-02 | Purine compounds and salts thereof |
Country Status (35)
| Country | Link |
|---|---|
| US (3) | US4294831A (OSRAM) |
| JP (1) | JPS5154589A (OSRAM) |
| AR (4) | AR220299A1 (OSRAM) |
| AT (1) | AT354462B (OSRAM) |
| AU (1) | AU503160B2 (OSRAM) |
| BE (1) | BE833006A (OSRAM) |
| BG (4) | BG26389A3 (OSRAM) |
| CA (1) | CA1062257A (OSRAM) |
| CH (7) | CH626363A5 (OSRAM) |
| CS (2) | CS203092B2 (OSRAM) |
| CY (1) | CY1033A (OSRAM) |
| DD (1) | DD122092A5 (OSRAM) |
| DE (1) | DE2539963C2 (OSRAM) |
| DK (1) | DK146595C (OSRAM) |
| ES (3) | ES440631A1 (OSRAM) |
| FI (1) | FI60709C (OSRAM) |
| FR (1) | FR2282892A1 (OSRAM) |
| GB (1) | GB1523865A (OSRAM) |
| HK (1) | HK84379A (OSRAM) |
| HU (1) | HU176730B (OSRAM) |
| IE (1) | IE42282B1 (OSRAM) |
| IL (1) | IL48035A (OSRAM) |
| KE (1) | KE3002A (OSRAM) |
| LU (1) | LU73304A1 (OSRAM) |
| MC (1) | MC1068A1 (OSRAM) |
| MY (1) | MY8200191A (OSRAM) |
| NL (1) | NL175061C (OSRAM) |
| NO (1) | NO144216C (OSRAM) |
| NZ (1) | NZ178556A (OSRAM) |
| RO (4) | RO76939A (OSRAM) |
| SE (1) | SE428562C (OSRAM) |
| SU (7) | SU904523A3 (OSRAM) |
| YU (4) | YU39947B (OSRAM) |
| ZA (1) | ZA755574B (OSRAM) |
| ZM (1) | ZM12875A1 (OSRAM) |
Families Citing this family (120)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4146715A (en) | 1975-08-27 | 1979-03-27 | Burroughs Wellcome Co. | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines |
| US4060616A (en) * | 1976-03-01 | 1977-11-29 | Burroughs Wellcome Co. | Purine derivatives with repeating unit |
| AU521577B2 (en) * | 1977-02-24 | 1982-04-22 | Wellcome Foundation Limited, The | 9-hydroxyethoxymethyl guanine phosphates |
| US4287188A (en) | 1977-02-24 | 1981-09-01 | Burroughs Wellcome Co. | Purine derivatives |
| KR830005852A (ko) * | 1980-07-18 | 1983-09-14 | 미첼 페터 잭슨 | 피부와 점막의 비루스 감염치료에 적합한 국소치료제의 제조방법 |
| US4347360A (en) * | 1980-09-16 | 1982-08-31 | Ens Bio Logicals Inc. | Ring open nucleoside analogues |
| US5157120A (en) * | 1980-09-16 | 1992-10-20 | Syntex (U.S.A.) Inc. | Guanine derivatives |
| JPS57102818A (en) * | 1980-10-15 | 1982-06-26 | Wellcome Found | Treatment for fish virus diseases |
| US4355032B2 (en) * | 1981-05-21 | 1990-10-30 | 9-(1,3-dihydroxy-2-propoxymethyl)guanine as antiviral agent | |
| US4423050A (en) * | 1981-05-21 | 1983-12-27 | Syntex (U.S.A.) Inc. | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent |
| US4603219A (en) * | 1981-05-21 | 1986-07-29 | Syntex (U.S.A.) Inc. | 1,3-dibenzyloxy-2-acetoxymethoxypropane, intermediate for 9-(1,3-dihydroxy-2-propoxymethyl)guanine |
| PL141198B1 (en) * | 1981-08-11 | 1987-07-31 | Wellcome Found | Process for preparing derivatives of purine |
| FI823195L (fi) * | 1981-09-16 | 1983-03-17 | Ens Bio Logicals Inc | Framstaellningsfoerfarande foer purinderivat |
| AU564576B2 (en) * | 1981-09-24 | 1987-08-20 | Sigma-Tau Industrie Farmaceutiche Riunite S.P.A. | Purine derivatives |
| US5250535A (en) * | 1982-02-01 | 1993-10-05 | Syntex Inc. | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent |
| EP0101441B1 (en) * | 1982-02-12 | 1987-01-14 | Syntex (U.S.A.) Inc. | Anti-viral compositions |
| SE8203855D0 (sv) * | 1982-06-21 | 1982-06-21 | Astra Laekemedel Ab | Novel derivatives of guanine i |
| SE8203856D0 (sv) * | 1982-06-21 | 1982-06-21 | Astra Laekemedel Ab | Novel derivatives of guanine ii |
| NL8202626A (nl) * | 1982-06-29 | 1984-01-16 | Stichting Rega V Z W | Derivaten van 9-(2-hydroxyethoxymethyl)guanine. |
| US4649140A (en) * | 1982-10-14 | 1987-03-10 | Burroughs Wellcome Co. | Purine derivatives |
| US4609662A (en) * | 1982-10-14 | 1986-09-02 | Burroughs Wellcome Co. | Method for using purine derivatives |
| US4745119A (en) * | 1982-10-14 | 1988-05-17 | Burroughs Wellcome Co. | Method for using purine derivatives |
| DE3376326D1 (en) * | 1982-10-14 | 1988-05-26 | Wellcome Found | Antiviral purine derivatives |
| US5059604A (en) * | 1982-10-14 | 1991-10-22 | Burroughs Wellcome Co. | 2-amino purine derivatives |
| US4612314A (en) * | 1982-12-22 | 1986-09-16 | Syntex (U.S.A.) Inc. | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent |
| US4461757A (en) * | 1983-02-23 | 1984-07-24 | Ens Bio Logicals Inc. | Dimethylaminomethylenated anti-herpes compounds |
| ES520140A0 (es) * | 1983-02-25 | 1984-04-01 | Ind Farma Especial | Un procedimiento para la preparacion de acicloguanosina. |
| US5047533A (en) * | 1983-05-24 | 1991-09-10 | Sri International | Acyclic purine phosphonate nucleotide analogs |
| US4557934A (en) | 1983-06-21 | 1985-12-10 | The Procter & Gamble Company | Penetrating topical pharmaceutical compositions containing 1-dodecyl-azacycloheptan-2-one |
| JPS6023380A (ja) * | 1983-06-24 | 1985-02-05 | メルク・エンド・カムパニー・インコーポレーテッド | 抗ウイルス剤 |
| US4880820A (en) * | 1983-06-24 | 1989-11-14 | Merck & Co., Inc. | Guanine derivatives |
| US5684153A (en) * | 1984-08-16 | 1997-11-04 | Beecham Group Plc | Process for the preparation of purine derivatives |
| US4897479A (en) * | 1983-09-30 | 1990-01-30 | Merck & Co., Inc. | Arylsulfonyloxy purine intermediates |
| JPS6094992A (ja) * | 1983-10-28 | 1985-05-28 | Sankyo Co Ltd | グリゼオ−ル酸誘導体 |
| US4918219A (en) * | 1983-10-31 | 1990-04-17 | Warner-Lambert Company | Glycerine derivatives |
| IE842642L (en) * | 1983-10-31 | 1985-04-30 | Harvard College | Purine Derivatives |
| ZA848080B (en) * | 1983-10-31 | 1985-06-26 | Warner Lambert Co | Purine derivatives |
| US4806642A (en) * | 1984-10-05 | 1989-02-21 | Warner-Lambert Company | Purine derivatives |
| US4579849A (en) * | 1984-04-06 | 1986-04-01 | Merck & Co., Inc. | N-alkylguanine acyclonucleosides as antiviral agents |
| US4617304A (en) * | 1984-04-10 | 1986-10-14 | Merck & Co., Inc. | Purine derivatives |
| DK163985A (da) * | 1984-04-13 | 1985-10-14 | Wellcome Found | Antivirale purinderivater, fremgangsmaade til deres fremstilling og farmaceutiske kompositioner indeholdende forbindelserne |
| US4636507A (en) * | 1984-04-30 | 1987-01-13 | Hoechst-Roussel Pharmaceuticals Inc. | Host defense mechanism enhancement |
| JPH0625061B2 (ja) | 1984-07-03 | 1994-04-06 | ザ ウエルカム フアウンデ−シヨン リミテツド | 抗ウイルス性化合物 |
| EP0190123A1 (en) * | 1984-07-20 | 1986-08-13 | GAUNTT, Charles, O. | Immunoregulatory and anti-viral compound |
| SE8406538D0 (sv) * | 1984-12-21 | 1984-12-21 | Astra Laekemedel Ab | Novel derivatives of purine |
| US4724232A (en) * | 1985-03-16 | 1988-02-09 | Burroughs Wellcome Co. | Treatment of human viral infections |
| US5683990A (en) * | 1985-03-16 | 1997-11-04 | Glaxo Wellcome Inc. | Treatment of human viral infections |
| CS263952B1 (en) * | 1985-04-25 | 1989-05-12 | Holy Antonin | Remedy with antiviral effect |
| CS263951B1 (en) * | 1985-04-25 | 1989-05-12 | Antonin Holy | 9-(phosponylmethoxyalkyl)adenines and method of their preparation |
| DE3667058D1 (en) | 1985-05-02 | 1989-12-28 | Wellcome Found | Antiviral compounds |
| IL78643A0 (en) * | 1985-05-02 | 1986-08-31 | Wellcome Found | Purine derivatives,their preparation and pharmaceutical compositions containing them |
| DE3529497A1 (de) * | 1985-08-17 | 1987-02-26 | Boehringer Mannheim Gmbh | N(pfeil hoch)6(pfeil hoch)-disubstituierte purinderivate, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| DE3627024A1 (de) * | 1985-09-24 | 1987-04-02 | Hoechst Ag | In 6- und 9-stellung substituierte 2-aminopurine, ihre verwendung, diese purine enthaltende arzneimittel und verfahren zur herstellung der purine |
| IT1207507B (it) * | 1985-10-21 | 1989-05-25 | Baldacci Lab Spa | Coniugato della 9-(2-idrossietossimetil)guanina con albumina umana lattosaminata, procedimento per la sua preparazione e composizioni farmaceutiche che la contengono. |
| EP0290496B2 (en) * | 1986-10-06 | 1995-12-20 | The University Of Virginia Alumni Patents Foundation | Use of an adenosine, hypoxanthine and ribose-containing solution for improved protection of the heart during surgery |
| WO1988003923A1 (fr) * | 1986-11-25 | 1988-06-02 | Institut Organicheskogo Sinteza Akademii Nauk Latv | Guanines substitutees en position 9 |
| US4978655A (en) * | 1986-12-17 | 1990-12-18 | Yale University | Use of 3'-deoxythymidin-2'-ene (3'deoxy-2',3'-didehydrothymidine) in treating patients infected with retroviruses |
| US4829055A (en) * | 1987-01-23 | 1989-05-09 | Naficy Sadeque S | Method of treatment for herpes infections of external tissues |
| US5565566A (en) * | 1987-04-24 | 1996-10-15 | Discovery Therapeutics, Inc. | N6 -substituted 9-methyladenines: a new class of adenosine receptor antagonists |
| US4835104A (en) * | 1987-06-16 | 1989-05-30 | Ajinomoto Co., Inc., Patent & Licensing Department | Process for producing and purifying 2',3'-dideoxynucleosides, and process for producing 2',3'-dideoxy-2',3'-didehydronucleosides |
| US6306647B1 (en) | 1987-06-16 | 2001-10-23 | Ajinomoto Co., Inc. | Process for producing and purifying 2′,3′-dideoxynucleosides, and process for producing 2′,3′-dideoxy-2′,3′-didehydronucleosides |
| GB8719367D0 (en) * | 1987-08-15 | 1987-09-23 | Wellcome Found | Therapeutic compounds |
| GB8725939D0 (en) * | 1987-11-05 | 1987-12-09 | Wellcome Found | Therapeutic compounds |
| CA1302887C (en) * | 1987-11-24 | 1992-06-09 | Yves Langelier | Combination of acyclovir or a derivative thereof and bacitracin |
| JPH01121424U (OSRAM) * | 1988-02-10 | 1989-08-17 | ||
| US5164395A (en) * | 1988-06-27 | 1992-11-17 | Burroughs Wellcome Co. | Antiviral acetyl pyridine derivative or said acetyl pyridine derivative in combination with acyclovir |
| GB8815241D0 (en) * | 1988-06-27 | 1988-08-03 | Wellcome Found | Antiviral combinations & compounds therefor |
| GB8816760D0 (en) * | 1988-07-14 | 1988-08-17 | Wellcome Found | Therapeutic compounds |
| DE68907013D1 (de) * | 1988-10-24 | 1993-07-15 | Wellcome Found | Guaninderivate mit antiviraler wirkung und deren pharmazeutisch vertraegliche salze. |
| WO1990009178A1 (en) * | 1989-01-31 | 1990-08-23 | Whitby Research, Inc. | N6-substituted 9-methyladenines: a new class of adenosine receptor antagonists |
| US4966895A (en) * | 1989-02-02 | 1990-10-30 | Merck & Co. Inc. | Cyclic monophosphates of purine and pyrimidine acyclonucleosides as anti-retroviral agents |
| GB8907173D0 (en) * | 1989-03-30 | 1989-05-10 | Beecham Group Plc | Novel compounds |
| GB8912043D0 (en) * | 1989-05-25 | 1989-07-12 | Beecham Group Plc | Novel compounds |
| GB9001886D0 (en) * | 1990-01-26 | 1990-03-28 | Beecham Group Plc | Pharmaceutical formulation |
| DE4008858A1 (de) * | 1990-03-20 | 1991-09-26 | Hoechst Ag | Substituierte purine, verfahren zu ihrer hertellung sowie ihre verwendung als antivirale mittel |
| CA2033447C (en) * | 1990-12-31 | 1999-08-31 | Robert Deziel | Synergistic combination for treating herpes infections |
| US5580571A (en) * | 1991-10-15 | 1996-12-03 | Hostetler; Karl Y. | Nucleoside analogues |
| US5879700A (en) * | 1991-10-15 | 1999-03-09 | Hostetler; Karl Y. | Nucleoside analogue phosphates for topical use |
| CA2091732C (en) * | 1992-07-08 | 1998-07-21 | Anica Markovac | A process for the preparation of 2-fluoro-9-(2,3,5-tri-o-benzyl-beta-d-arabinofuranosyl) adenine |
| DK169121B1 (da) | 1992-09-09 | 1994-08-22 | Gea Farmaceutisk Fabrik As | Antiviralt virksom farmaceutisk olie-i-vand-emulsion indeholdende 9-[(2-hydroxyethoxy)methyl]guanin (acyclovir) eller et salt eller en ester deraf |
| EP0589335B1 (de) * | 1992-09-24 | 2003-06-18 | Hoechst Aktiengesellschaft | N1-Substituierte 1H-1,2,3-Triazolo[4,5-d]pyrimidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als antivirale Mittel |
| US5654286A (en) * | 1993-05-12 | 1997-08-05 | Hostetler; Karl Y. | Nucleotides for topical treatment of psoriasis, and methods for using same |
| US6015573A (en) * | 1993-05-12 | 2000-01-18 | Hostetler; Karl Y. | Nucleoside phosphate therapy for viral infection |
| IT1264599B1 (it) * | 1993-06-14 | 1996-10-04 | Solar Chem Sa | Processo per la sintesi della 9-(2-idrossietossimetil)- guanina |
| US5567816A (en) * | 1994-07-26 | 1996-10-22 | Syntex (U.S.A.) Inc. | Preparation of acyclovir using 1,3 dioxolane |
| US5543414A (en) * | 1994-07-28 | 1996-08-06 | Syntex (Usa) Inc. | Achiral amino acid acyl esters of ganciclovir and its derivatives |
| US5856481A (en) * | 1994-07-28 | 1999-01-05 | Syntex (U.S.A.) Inc. | 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| US5565565A (en) | 1994-08-04 | 1996-10-15 | Syntex (U.S.A.) Inc. | Preparation of N-9 substituted guanine compounds |
| US5627185A (en) * | 1994-11-23 | 1997-05-06 | Gosselin; Gilles | Acyclovir derivatives as antiviral agents |
| US6040446A (en) | 1996-01-26 | 2000-03-21 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol derivative |
| US5700936A (en) * | 1996-01-26 | 1997-12-23 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol valinate |
| US5840890A (en) * | 1996-01-26 | 1998-11-24 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| US5756736A (en) * | 1996-01-26 | 1998-05-26 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| IN179493B (OSRAM) * | 1996-02-22 | 1997-10-11 | Lupin Laboraties Ltd | |
| US5789589A (en) * | 1996-04-22 | 1998-08-04 | Drug Innovation & Design, Inc. | Guanine analog phosphates |
| US6440980B1 (en) * | 1996-09-17 | 2002-08-27 | Avanir Pharmaceuticals | Synergistic inhibition of viral replication by long-chain hydrocarbons and nucleoside analogs |
| RU2111967C1 (ru) * | 1996-09-26 | 1998-05-27 | Генкин Дмитрий Дмитриевич | Способ получения ацикловира |
| US6180790B1 (en) | 1997-05-15 | 2001-01-30 | Drug Innovation And Design, Inc. | Methods of preparing acyclovir prodrugs |
| JP2001527561A (ja) | 1997-05-15 | 2001-12-25 | ドラッグ イノベーション アンド デザイン,インコーポレーテッド | アシクロビルジエステル誘導体 |
| RU2160105C1 (ru) * | 2000-04-27 | 2000-12-10 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Противовирусное средство и способ его получения |
| RU2179851C1 (ru) * | 2000-12-21 | 2002-02-27 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Противовирусный фармацевтический состав |
| RU2175230C1 (ru) * | 2001-01-23 | 2001-10-27 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Фармацевтическая композиция с противовирусной активностью и способ ее получения |
| CA2421026C (en) * | 2001-10-16 | 2005-02-15 | Avanir Pharmaceuticals | Viral inhibition by n-docosanol |
| US20070129334A1 (en) * | 2001-10-30 | 2007-06-07 | Conforma Therapeutics Corporation | Orally Active Purine-Based Inhibitors of Heat Shock Protein 90 |
| CA2464031A1 (en) * | 2001-10-30 | 2003-05-08 | Conforma Therapeutics Corporation | Purine analogs having hsp90-inhibiting activity |
| WO2004048380A1 (en) | 2002-11-22 | 2004-06-10 | Ranbaxy Laboratories Limited | Process for the synthesis of ganciclovir |
| RU2233842C1 (ru) * | 2003-01-13 | 2004-08-10 | Петров Владимир Иванович | Производные пурина, обладающие противовирусной активностью |
| AU2004206821C1 (en) | 2003-01-14 | 2009-10-01 | Gilead Sciences, Inc. | Compositions and methods for combination antiviral therapy |
| US20040200730A1 (en) * | 2003-04-14 | 2004-10-14 | Kyo Jibiki | Hydrometallurgical copper recovery process |
| WO2005112937A1 (en) | 2004-05-19 | 2005-12-01 | Emisphere Technologies, Inc. | Acyclovir formulations |
| TWI471145B (zh) | 2005-06-13 | 2015-02-01 | Bristol Myers Squibb & Gilead Sciences Llc | 單一式藥學劑量型 |
| TWI375560B (en) | 2005-06-13 | 2012-11-01 | Gilead Sciences Inc | Composition comprising dry granulated emtricitabine and tenofovir df and method for making the same |
| WO2007106561A2 (en) * | 2006-03-14 | 2007-09-20 | Alt Solutions, Inc. | Prevention and treatment of cancer and other diseases |
| US8173621B2 (en) | 2008-06-11 | 2012-05-08 | Gilead Pharmasset Llc | Nucleoside cyclicphosphates |
| TW201026716A (en) | 2008-12-23 | 2010-07-16 | Pharmasset Inc | Nucleoside analogs |
| US8716263B2 (en) | 2008-12-23 | 2014-05-06 | Gilead Pharmasset Llc | Synthesis of purine nucleosides |
| TW201026715A (en) | 2008-12-23 | 2010-07-16 | Pharmasset Inc | Nucleoside phosphoramidates |
| PT3290428T (pt) | 2010-03-31 | 2021-12-27 | Gilead Pharmasset Llc | Comprimido compreendendo 2-(((s)-(((2r,3r,4r,5r)-5-(2,4-dioxo-3,4-dihidropirimidin-1-(2h)-il)¿4¿fluoro¿3¿hidroxi¿4¿metiltetrahidrofuran¿2¿il)metoxi) (fenoxi)fosforil)amino)propanoato de (s)- isopropil cristalino |
| GB201819418D0 (en) | 2018-11-29 | 2019-01-16 | Daniel Calladine Ltd | Anti-viral compositions |
| WO2021209563A1 (en) | 2020-04-16 | 2021-10-21 | Som Innovation Biotech, S.A. | Compounds for use in the treatment of viral infections by respiratory syndrome-related coronavirus |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4199574A (en) * | 1974-09-02 | 1980-04-22 | Burroughs Wellcome Co. | Methods and compositions for treating viral infections and guanine acyclic nucleosides |
| US4146715A (en) * | 1975-08-27 | 1979-03-27 | Burroughs Wellcome Co. | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines |
-
1974
- 1974-09-02 GB GB38278/74A patent/GB1523865A/en not_active Expired
-
1975
- 1975-09-01 SE SE7509675A patent/SE428562C/xx not_active IP Right Cessation
- 1975-09-01 IE IE1911/75A patent/IE42282B1/en not_active IP Right Cessation
- 1975-09-01 DK DK392675A patent/DK146595C/da not_active IP Right Cessation
- 1975-09-02 DD DD188132A patent/DD122092A5/xx active Search and Examination
- 1975-09-02 RO RO7583306A patent/RO76939A/ro unknown
- 1975-09-02 CY CY1033A patent/CY1033A/xx unknown
- 1975-09-02 CS CS755957A patent/CS203092B2/cs unknown
- 1975-09-02 AT AT676375A patent/AT354462B/de not_active IP Right Cessation
- 1975-09-02 NO NO753009A patent/NO144216C/no unknown
- 1975-09-02 LU LU73304A patent/LU73304A1/xx unknown
- 1975-09-02 HU HU75WE527A patent/HU176730B/hu unknown
- 1975-09-02 RO RO7589176A patent/RO74276A/ro unknown
- 1975-09-02 RO RO7589174A patent/RO74274A/ro unknown
- 1975-09-02 IL IL48035A patent/IL48035A/xx unknown
- 1975-09-02 CH CH1132275A patent/CH626363A5/de active Protection Beyond IP Right Term
- 1975-09-02 BG BG030910A patent/BG26389A3/xx unknown
- 1975-09-02 NZ NZ178556A patent/NZ178556A/xx unknown
- 1975-09-02 JP JP50106479A patent/JPS5154589A/ja active Granted
- 1975-09-02 SU SU752169001A patent/SU904523A3/ru active
- 1975-09-02 RO RO7589175A patent/RO74275A/ro unknown
- 1975-09-02 ZA ZA755574A patent/ZA755574B/xx unknown
- 1975-09-02 BE BE159690A patent/BE833006A/xx not_active IP Right Cessation
- 1975-09-02 YU YU2220/75A patent/YU39947B/xx unknown
- 1975-09-02 NL NLAANVRAGE7510342,A patent/NL175061C/xx not_active IP Right Cessation
- 1975-09-02 MC MC751158A patent/MC1068A1/xx unknown
- 1975-09-02 BG BG032818A patent/BG25094A3/xx unknown
- 1975-09-02 ES ES440631A patent/ES440631A1/es not_active Expired
- 1975-09-02 DE DE2539963A patent/DE2539963C2/de not_active Expired
- 1975-09-02 FR FR7526826A patent/FR2282892A1/fr active Granted
- 1975-09-02 CA CA234,591A patent/CA1062257A/en not_active Expired
- 1975-09-02 AU AU84459/75A patent/AU503160B2/en not_active Expired
- 1975-09-02 CS CS773087A patent/CS203093B2/cs unknown
- 1975-09-02 BG BG032817A patent/BG26536A4/xx unknown
- 1975-09-02 AR AR260225A patent/AR220299A1/es active
- 1975-09-02 FI FI752465A patent/FI60709C/fi not_active IP Right Cessation
- 1975-09-02 BG BG032819A patent/BG24815A3/xx unknown
- 1975-09-02 ZM ZM128/75A patent/ZM12875A1/xx unknown
-
1976
- 1976-04-23 AR AR262995A patent/AR220508A1/es active
- 1976-04-23 AR AR262994A patent/AR220885A1/es active
- 1976-04-28 AR AR262993A patent/AR212914A1/es active
-
1977
- 1977-01-24 SU SU772442252A patent/SU686618A3/ru active
- 1977-01-24 SU SU772442435A patent/SU751325A3/ru active
- 1977-01-24 SU SU772444408A patent/SU700064A3/ru active
- 1977-02-16 ES ES455979A patent/ES455979A1/es not_active Expired
- 1977-02-16 ES ES455978A patent/ES455978A1/es not_active Expired
-
1978
- 1978-02-01 US US05/874,060 patent/US4294831A/en not_active Expired - Lifetime
- 1978-02-01 US US05/874,130 patent/US4323573A/en not_active Expired - Lifetime
- 1978-02-01 US US05/874,067 patent/US4360522A/en not_active Expired - Lifetime
-
1979
- 1979-06-18 SU SU792780252A patent/SU784777A3/ru active
- 1979-08-14 CH CH744879A patent/CH623587A5/de not_active IP Right Cessation
- 1979-08-14 CH CH744679A patent/CH626364A5/de not_active IP Right Cessation
- 1979-08-14 CH CH744779A patent/CH623586A5/de not_active IP Right Cessation
- 1979-08-29 SU SU792804760A patent/SU858569A3/ru active
- 1979-10-18 SU SU792833104A patent/SU799664A3/ru active
- 1979-11-13 KE KE3002A patent/KE3002A/xx unknown
- 1979-12-06 HK HK843/79A patent/HK84379A/xx unknown
-
1981
- 1981-05-05 CH CH292481A patent/CH629805A5/de not_active IP Right Cessation
- 1981-05-05 CH CH292581A patent/CH628897A5/de not_active IP Right Cessation
- 1981-05-05 CH CH292381A patent/CH629206A5/de not_active IP Right Cessation
-
1982
- 1982-06-04 YU YU1200/82A patent/YU40079B/xx unknown
- 1982-06-04 YU YU01199/82A patent/YU119982A/xx unknown
- 1982-06-04 YU YU1201/82A patent/YU40080B/xx unknown
- 1982-12-30 MY MY191/82A patent/MY8200191A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1062257A (en) | Purine compounds and salts thereof | |
| US4199574A (en) | Methods and compositions for treating viral infections and guanine acyclic nucleosides | |
| US4146715A (en) | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines | |
| US4287188A (en) | Purine derivatives | |
| AP55A (en) | Therapeutic Acyclic Nucleosides | |
| CA1208637A (en) | Derivatives of 9-(2-hydroxyethoxymethyl)guanine | |
| EP0159264A2 (en) | Antiviral compounds | |
| Shealy et al. | Synthesis and antiviral activity of carbocyclic analogs of 2'-deoxyribofuranosides of 2-amino-6-substituted-purines and of 2-amino-6-substituted-8-azapurines | |
| KR940010033B1 (ko) | 항비루스 활성을 갖는 화합물의 제조방법 | |
| US4921858A (en) | 7-deazaguanines as immunomodulators | |
| US4060616A (en) | Purine derivatives with repeating unit | |
| US4027025A (en) | 8-Azapurine derivatives | |
| CA1086316A (en) | Purine acyclic nucleosides | |
| JP3072600B2 (ja) | 新規化合物、その製法及びそれを含む医薬組成物 | |
| DK147596B (da) | Analogifremgangsmaade til fremstilling af 7-alkoxymethylpuriner | |
| US5098905A (en) | 7-deazaguanines as immunomodulators | |
| CS203095B2 (cs) | Způsob přípravy substituovaných purinů | |
| NO145404B (no) | Analogifremgangsmaate til fremstilling av terapeutisk virksomme purinforbindelser og salter derav | |
| JPS61277687A (ja) | 新規なプリン誘導体およびその製造法ならびにその製剤組成物 | |
| KR20000051515A (ko) | 항바이러스 활성을 가지는 2-아미노퓨린 |