AT395424B - Verfahren zur herstellung von neuen 1,5-benzothiazepinderivaten - Google Patents
Verfahren zur herstellung von neuen 1,5-benzothiazepinderivaten Download PDFInfo
- Publication number
- AT395424B AT395424B AT0206388A AT206388A AT395424B AT 395424 B AT395424 B AT 395424B AT 0206388 A AT0206388 A AT 0206388A AT 206388 A AT206388 A AT 206388A AT 395424 B AT395424 B AT 395424B
- Authority
- AT
- Austria
- Prior art keywords
- group
- compound
- hydrogen
- formula
- ethyl
- Prior art date
Links
- KJFRSZASZNLCDF-UHFFFAOYSA-N 1,5-benzothiazepine Chemical class S1C=CC=NC2=CC=CC=C12 KJFRSZASZNLCDF-UHFFFAOYSA-N 0.000 title claims abstract description 12
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 65
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 238000000034 method Methods 0.000 claims abstract description 15
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 13
- 239000001257 hydrogen Substances 0.000 claims abstract description 13
- -1 sulpho group Chemical group 0.000 claims abstract description 12
- 239000002253 acid Substances 0.000 claims abstract description 10
- 238000006482 condensation reaction Methods 0.000 claims abstract description 10
- 125000002252 acyl group Chemical group 0.000 claims abstract description 8
- 238000006243 chemical reaction Methods 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 6
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 5
- 125000005843 halogen group Chemical group 0.000 claims abstract description 5
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims abstract description 4
- 238000002360 preparation method Methods 0.000 claims abstract description 3
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical compound NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 claims abstract 2
- 150000003254 radicals Chemical class 0.000 claims abstract 2
- 239000000203 mixture Substances 0.000 claims description 19
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 8
- 208000010110 spontaneous platelet aggregation Diseases 0.000 claims description 8
- 241000700159 Rattus Species 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 4
- 230000000702 anti-platelet effect Effects 0.000 claims description 4
- 239000003146 anticoagulant agent Substances 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 239000012024 dehydrating agents Substances 0.000 claims description 4
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 4
- 239000012312 sodium hydride Substances 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 4
- SDGHXWKVBZYHRR-UHFFFAOYSA-N 2-(1h-imidazol-2-ylsulfonyl)-1h-imidazole Chemical compound N=1C=CNC=1S(=O)(=O)C1=NC=CN1 SDGHXWKVBZYHRR-UHFFFAOYSA-N 0.000 claims description 3
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- NCBFTYFOPLPRBX-UHFFFAOYSA-N dimethyl azodicarboxylate Substances COC(=O)N=NC(=O)OC NCBFTYFOPLPRBX-UHFFFAOYSA-N 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- NCBFTYFOPLPRBX-AATRIKPKSA-N methyl (ne)-n-methoxycarbonyliminocarbamate Chemical compound COC(=O)\N=N\C(=O)OC NCBFTYFOPLPRBX-AATRIKPKSA-N 0.000 claims description 2
- 230000002265 prevention Effects 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims 1
- 150000008041 alkali metal carbonates Chemical class 0.000 claims 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims 1
- 150000008046 alkali metal hydrides Chemical class 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 125000002947 alkylene group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 19
- 239000000047 product Substances 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 230000036772 blood pressure Effects 0.000 description 9
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 230000001077 hypotensive effect Effects 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 6
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- CRYDUXLWJITARY-UHFFFAOYSA-N dimethyl(2-methylsulfonyloxyethyl)azanium;chloride Chemical compound Cl.CN(C)CCOS(C)(=O)=O CRYDUXLWJITARY-UHFFFAOYSA-N 0.000 description 4
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- 210000004623 platelet-rich plasma Anatomy 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LUPMVIMQIVHFCV-UHFFFAOYSA-N 2-(dimethylamino)ethyl methanesulfonate Chemical compound CN(C)CCOS(C)(=O)=O LUPMVIMQIVHFCV-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 208000001953 Hypotension Diseases 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 206010008118 cerebral infarction Diseases 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 208000021822 hypotensive Diseases 0.000 description 2
- 229910010272 inorganic material Inorganic materials 0.000 description 2
- 239000011147 inorganic material Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N methyl cyanide Natural products CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 2
- 229940017219 methyl propionate Drugs 0.000 description 2
- 239000012046 mixed solvent Substances 0.000 description 2
- LCEDQNDDFOCWGG-UHFFFAOYSA-N morpholine-4-carbaldehyde Chemical compound O=CN1CCOCC1 LCEDQNDDFOCWGG-UHFFFAOYSA-N 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- KAANMZCKNKVSAA-CABCVRRESA-N (2s,3s)-8-chloro-3-hydroxy-2-(4-methoxyphenyl)-3,5-dihydro-2h-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)NC2=CC=C(Cl)C=C2S1 KAANMZCKNKVSAA-CABCVRRESA-N 0.000 description 1
- DWOKUCFPFUCSID-MOPGFXCFSA-N (2s,3s)-8-chloro-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](O)C(=O)N(CCN(C)C)C2=CC=C(Cl)C=C2S1 DWOKUCFPFUCSID-MOPGFXCFSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VYKCVWDAFBANGO-UHFFFAOYSA-N 2-(dimethylamino)ethyl benzenesulfonate Chemical compound CN(C)CCOS(=O)(=O)C1=CC=CC=C1 VYKCVWDAFBANGO-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 201000006474 Brain Ischemia Diseases 0.000 description 1
- 208000014644 Brain disease Diseases 0.000 description 1
- 206010008120 Cerebral ischaemia Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- IKJIITMEIPMVQE-SJORKVTESA-N [(2s,3s)-8-chloro-2-(4-methoxyphenyl)-4-oxo-3,5-dihydro-2h-1,5-benzothiazepin-3-yl] acetate Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)NC2=CC=C(Cl)C=C2S1 IKJIITMEIPMVQE-SJORKVTESA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229960004166 diltiazem Drugs 0.000 description 1
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- 229940038773 trisodium citrate Drugs 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D281/00—Heterocyclic compounds containing rings of more than six members having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D281/02—Seven-membered rings
- C07D281/04—Seven-membered rings having the hetero atoms in positions 1 and 4
- C07D281/08—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D281/10—Seven-membered rings having the hetero atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems condensed with one six-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP62208482A JPS6450872A (en) | 1987-08-21 | 1987-08-21 | Production of 1,5-benzothiazepine derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA206388A ATA206388A (de) | 1992-05-15 |
| AT395424B true AT395424B (de) | 1992-12-28 |
Family
ID=16556895
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0206388A AT395424B (de) | 1987-08-21 | 1988-08-19 | Verfahren zur herstellung von neuen 1,5-benzothiazepinderivaten |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS6450872A (show.php) |
| KR (1) | KR890003723A (show.php) |
| CN (1) | CN1031374A (show.php) |
| AT (1) | AT395424B (show.php) |
| BG (1) | BG49047A3 (show.php) |
| CA (1) | CA1312077C (show.php) |
| ES (1) | ES2007993A6 (show.php) |
| FI (1) | FI93009C (show.php) |
| GR (1) | GR1000452B (show.php) |
| IE (1) | IE61169B1 (show.php) |
| IL (1) | IL87026A (show.php) |
| NO (1) | NO170541C (show.php) |
| PT (1) | PT88300B (show.php) |
| RU (1) | RU1784041C (show.php) |
| TW (1) | TW207536B (show.php) |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT287722B (de) * | 1967-10-28 | 1971-02-10 | Tanabe Seiyaku Co | Verfahren zur Herstellung von neuen Benzothiazepinderivaten und deren Säureadditionssalze |
| EP0125056A2 (en) * | 1983-04-22 | 1984-11-14 | Takeda Chemical Industries, Ltd. | Condensed, seven-membered ring compounds, their production and use |
| AT380015B (de) * | 1982-07-09 | 1986-03-25 | Tanabe Seiyaku Co | Verfahren zur herstellung von 1,5-benzothiazepinderivaten sowie von deren saeureadditionssalzen |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8315364D0 (en) * | 1983-06-03 | 1983-07-06 | Tanabe Seiyaku Co | 8-chloro-1 5-benzothiazepine derivatives |
| US4567175A (en) * | 1983-06-03 | 1986-01-28 | Tanabe Seiyaku Co., Ltd. | 8-Chloro-1,5-benzothiazepine derivatives |
| GB8406318D0 (en) * | 1984-03-10 | 1984-04-11 | Tanabe Seiyaku Co | 1 5-benzothiazepine derivatives |
| JPS61103877A (ja) * | 1984-10-24 | 1986-05-22 | Tanabe Seiyaku Co Ltd | ベンゾチアゼピン誘導体及びその製法 |
| GB2167063A (en) * | 1984-11-17 | 1986-05-21 | Tanabe Seiyaku Co | 6 or 9-chloro-1, 5-benzothiazepine derivatives |
| JPS61225175A (ja) * | 1985-03-28 | 1986-10-06 | Sawai Seiyaku Kk | 1,5−ベンゾチアゼピン誘導体の製造方法 |
| HU195795B (en) * | 1985-11-06 | 1988-07-28 | Richter Gedeon Vegyeszet | Process for preparing (2s,3s)-3-acetoxy-5-(n,n-dimethyl-amino-ethyl)-2-(h-methoxy-phenyl)-2,3-dihydro-1,5-benzothiazepin-h(5h)-one |
-
1987
- 1987-08-21 JP JP62208482A patent/JPS6450872A/ja active Pending
-
1988
- 1988-06-27 IE IE195088A patent/IE61169B1/en not_active IP Right Cessation
- 1988-06-29 FI FI883116A patent/FI93009C/fi not_active IP Right Cessation
- 1988-07-07 IL IL8702688A patent/IL87026A/en not_active IP Right Cessation
- 1988-07-07 CA CA000571434A patent/CA1312077C/en not_active Expired - Lifetime
- 1988-07-16 CN CN88104429A patent/CN1031374A/zh active Pending
- 1988-08-02 BG BG085117A patent/BG49047A3/xx unknown
- 1988-08-04 GR GR880100516A patent/GR1000452B/el unknown
- 1988-08-09 NO NO883526A patent/NO170541C/no unknown
- 1988-08-12 ES ES8802539A patent/ES2007993A6/es not_active Expired
- 1988-08-18 PT PT88300A patent/PT88300B/pt not_active IP Right Cessation
- 1988-08-19 RU SU884356329A patent/RU1784041C/ru active
- 1988-08-19 AT AT0206388A patent/AT395424B/de not_active IP Right Cessation
- 1988-08-20 KR KR1019880010577A patent/KR890003723A/ko not_active Ceased
-
1990
- 1990-05-07 TW TW079103691A patent/TW207536B/zh active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT287722B (de) * | 1967-10-28 | 1971-02-10 | Tanabe Seiyaku Co | Verfahren zur Herstellung von neuen Benzothiazepinderivaten und deren Säureadditionssalze |
| AT380015B (de) * | 1982-07-09 | 1986-03-25 | Tanabe Seiyaku Co | Verfahren zur herstellung von 1,5-benzothiazepinderivaten sowie von deren saeureadditionssalzen |
| EP0125056A2 (en) * | 1983-04-22 | 1984-11-14 | Takeda Chemical Industries, Ltd. | Condensed, seven-membered ring compounds, their production and use |
Also Published As
| Publication number | Publication date |
|---|---|
| FI883116A0 (fi) | 1988-06-29 |
| ES2007993A6 (es) | 1989-07-01 |
| NO883526D0 (no) | 1988-08-09 |
| PT88300B (pt) | 1995-03-31 |
| NO170541B (no) | 1992-07-20 |
| IL87026A0 (en) | 1988-12-30 |
| NO170541C (no) | 1992-10-28 |
| PT88300A (pt) | 1989-06-30 |
| JPS6450872A (en) | 1989-02-27 |
| CN1031374A (zh) | 1989-03-01 |
| BG49047A3 (bg) | 1991-07-15 |
| GR880100516A (en) | 1989-05-25 |
| GR1000452B (el) | 1992-07-30 |
| ATA206388A (de) | 1992-05-15 |
| CA1312077C (en) | 1992-12-29 |
| NO883526L (no) | 1989-02-22 |
| IE61169B1 (en) | 1994-10-05 |
| RU1784041C (ru) | 1992-12-23 |
| FI93009C (fi) | 1995-02-10 |
| FI883116A7 (fi) | 1989-02-22 |
| KR890003723A (ko) | 1989-04-17 |
| TW207536B (show.php) | 1993-06-11 |
| IL87026A (en) | 1995-01-24 |
| IE881950L (en) | 1989-02-21 |
| FI93009B (fi) | 1994-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD218619A5 (de) | Verfahren zur herstellung von neuen 8-chlor-1,5-benzothiazepin-derivaten | |
| CH637382A5 (de) | Verfahren zur herstellung neuer tetracyclischer pyridin- oder pyrrolderivate. | |
| DE2733868A1 (de) | Neue 1,2,4,5-tetrahydro-3h-2-benzazepin-3-one, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| EP0400430B1 (de) | Chromanderivate | |
| CH661508A5 (de) | 1,5-benzothiazepine mit cardiovascularer wirksamkeit, verfahren zu ihrer herstellung und pharmazeutische praeparate, welche diese verbindungen enthalten. | |
| EP0074014B1 (de) | 2-(2'-Hydroxy-3'-(1,1-dimethylpropylamino)-propoxy)-beta-phenylpropiophenon, seine Säureadditionssalze, Verfahren zu seiner Herstellung und Arzneimittel | |
| DE1805714A1 (de) | Benzothiazepin-Derivate,ihre Salze und Verfahren zu ihrer Herstellung | |
| DD239202A5 (de) | Verfahren zur herstellung von 9-chlor-1,5-benzothiazepin-derivaten | |
| DE69030897T2 (de) | Verfahren zur Herstellung von 1,5-Benzothiazepin-Derivaten | |
| AT395424B (de) | Verfahren zur herstellung von neuen 1,5-benzothiazepinderivaten | |
| DE2629887A1 (de) | Arzneimittel mit die peripheren dopamin-rezeptoren stimulierender, die nierengefaesse erweiternder, diuretischer und das parkinsonsyndrom lindernder wirkung | |
| EP0254955A2 (de) | Substituierte Pyrido-[2,3-b][1,4]benzodiazepin-6-one, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69516257T2 (de) | 1,4-Benzoxazinderivate, es enthaltende pharmazeutische Zusammensetzung und seine Verwendung | |
| DD145536A5 (de) | Verfahren zur herstellung von trans-2-substituierten-5-aryl-2,3,4,4a,5,9b-hexahydro-1h-pyrido(4,3-b)-indolderivaten | |
| DE2014911A1 (de) | Verfahren zur Herstellung von neuen Imidazolidinenderivaten | |
| DE3423429A1 (de) | Substituierte phenoxyalkylaminopropanole, verfahren zu ihrer herstellung und ihre verwendung sowie diese verbindungen enthaltende zubereitungen | |
| DE3884518T2 (de) | Naphthothiazepin-Derivate und Verfahren zu ihrer Herstellung. | |
| DE4217103C2 (de) | Verfahren zur Herstellung eines Benzothiazepins durch Cyclisierung mit Phosphonsäuren | |
| DE2905637C3 (de) | 1,5-Benzothiazepin-Derivate | |
| AT395010B (de) | Verfahren zur herstellung von 1,5-benzothiazepinderivaten und von deren salzen | |
| EP0371312B1 (de) | Benzoxazinderivate | |
| AT394367B (de) | Verfahren zur herstellung eines 1,5-benzothiazepinderivates oder eines salzes davon | |
| EP0014996B1 (de) | Heterocyclische spiroverknüpfte Amidine, ihre Stereoisomeren und optischen Isomeren, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE3726425A1 (de) | Basisch substituierte saccharine | |
| EP0030916B1 (de) | Azatetracyclische Carbonitrile |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |