AT394386B - Bleichende koernige waschmittelzusammensetzung - Google Patents
Bleichende koernige waschmittelzusammensetzung Download PDFInfo
- Publication number
- AT394386B AT394386B AT0394682A AT394682A AT394386B AT 394386 B AT394386 B AT 394386B AT 0394682 A AT0394682 A AT 0394682A AT 394682 A AT394682 A AT 394682A AT 394386 B AT394386 B AT 394386B
- Authority
- AT
- Austria
- Prior art keywords
- bleaching
- detergent composition
- water
- salt
- detergent
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 83
- 239000003599 detergent Substances 0.000 title claims description 53
- 238000004061 bleaching Methods 0.000 title claims description 34
- 150000003839 salts Chemical class 0.000 claims description 44
- 239000002738 chelating agent Substances 0.000 claims description 25
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 claims description 24
- 239000007844 bleaching agent Substances 0.000 claims description 23
- 239000004094 surface-active agent Substances 0.000 claims description 17
- 125000000864 peroxy group Chemical group O(O*)* 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 230000000694 effects Effects 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- 125000000129 anionic group Chemical group 0.000 claims description 7
- 239000002736 nonionic surfactant Substances 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 claims description 6
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003945 anionic surfactant Substances 0.000 claims description 5
- 239000000945 filler Substances 0.000 claims description 5
- USSBDBZGEDUBHE-UHFFFAOYSA-L magnesium;2-oxidooxycarbonylbenzoate Chemical compound [Mg+2].[O-]OC(=O)C1=CC=CC=C1C([O-])=O USSBDBZGEDUBHE-UHFFFAOYSA-L 0.000 claims description 5
- 239000003093 cationic surfactant Substances 0.000 claims description 4
- 239000008139 complexing agent Substances 0.000 claims description 4
- 239000002563 ionic surfactant Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000002091 cationic group Chemical group 0.000 claims description 3
- 150000004696 coordination complex Chemical class 0.000 claims description 3
- 238000011049 filling Methods 0.000 claims description 3
- 239000002245 particle Substances 0.000 claims description 3
- 239000002002 slurry Substances 0.000 claims description 3
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 2
- 238000005406 washing Methods 0.000 description 34
- 125000004432 carbon atom Chemical group C* 0.000 description 31
- -1 peroxy compound Chemical class 0.000 description 28
- 239000000243 solution Substances 0.000 description 22
- 238000012360 testing method Methods 0.000 description 19
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 17
- 229910052708 sodium Inorganic materials 0.000 description 17
- 239000011734 sodium Substances 0.000 description 17
- 239000004744 fabric Substances 0.000 description 15
- 125000000217 alkyl group Chemical group 0.000 description 13
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 12
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 8
- 239000012190 activator Substances 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 8
- 229910052760 oxygen Inorganic materials 0.000 description 8
- 239000001301 oxygen Substances 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- 150000003871 sulfonates Chemical class 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 150000001768 cations Chemical class 0.000 description 7
- 239000002304 perfume Substances 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 150000004965 peroxy acids Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 150000003863 ammonium salts Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 230000002209 hydrophobic effect Effects 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 239000003760 tallow Substances 0.000 description 5
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 4
- 244000269722 Thea sinensis Species 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 229940088598 enzyme Drugs 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 125000001165 hydrophobic group Chemical group 0.000 description 4
- 159000000003 magnesium salts Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 4
- 229960003540 oxyquinoline Drugs 0.000 description 4
- 239000012188 paraffin wax Substances 0.000 description 4
- 159000000001 potassium salts Chemical class 0.000 description 4
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 4
- 150000004760 silicates Chemical class 0.000 description 4
- 235000019832 sodium triphosphate Nutrition 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- 108091005804 Peptidases Proteins 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- 244000078534 Vaccinium myrtillus Species 0.000 description 3
- 235000017537 Vaccinium myrtillus Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 235000011180 diphosphates Nutrition 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 229920005646 polycarboxylate Polymers 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 3
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000008399 tap water Substances 0.000 description 3
- 235000020679 tap water Nutrition 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000003095 Vaccinium corymbosum Nutrition 0.000 description 2
- 235000009754 Vitis X bourquina Nutrition 0.000 description 2
- 235000012333 Vitis X labruscana Nutrition 0.000 description 2
- 240000006365 Vitis vinifera Species 0.000 description 2
- 235000014787 Vitis vinifera Nutrition 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 235000021014 blueberries Nutrition 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000004453 electron probe microanalysis Methods 0.000 description 2
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 2
- 239000004872 foam stabilizing agent Substances 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 235000011151 potassium sulphates Nutrition 0.000 description 2
- 235000020095 red wine Nutrition 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000008053 sultones Chemical class 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- WJYAJBDKANFOID-AWEZNQCLSA-N (2s)-2-(dodecylamino)propanoic acid Chemical compound CCCCCCCCCCCCN[C@@H](C)C(O)=O WJYAJBDKANFOID-AWEZNQCLSA-N 0.000 description 1
- PSBDWGZCVUAZQS-UHFFFAOYSA-N (dimethylsulfonio)acetate Chemical compound C[S+](C)CC([O-])=O PSBDWGZCVUAZQS-UHFFFAOYSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical class OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- ZABKDTYOFYRFCI-UHFFFAOYSA-N 1-methoxy-1-oxotetradecane-2-sulfonic acid Chemical compound CCCCCCCCCCCCC(S(O)(=O)=O)C(=O)OC ZABKDTYOFYRFCI-UHFFFAOYSA-N 0.000 description 1
- JKTAIYGNOFSMCE-UHFFFAOYSA-N 2,3-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC=CC(O)=C1CCCCCCCCC JKTAIYGNOFSMCE-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 101100184721 Caenorhabditis elegans mppa-1 gene Proteins 0.000 description 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 229920004934 Dacron® Polymers 0.000 description 1
- 229940120146 EDTMP Drugs 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 1
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000220010 Rhode Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- VBIIFPGSPJYLRR-UHFFFAOYSA-M Stearyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)C VBIIFPGSPJYLRR-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 241000219094 Vitaceae Species 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 1
- 239000011609 ammonium molybdate Substances 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- 229940010552 ammonium molybdate Drugs 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical class N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ZAPUWVBRCYPPQT-UHFFFAOYSA-N ethyl(18-methylnonadecyl)azanium;chloride Chemical compound [Cl-].CC[NH2+]CCCCCCCCCCCCCCCCCC(C)C ZAPUWVBRCYPPQT-UHFFFAOYSA-N 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 235000021021 grapes Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- ATJCASULPHYKHT-UHFFFAOYSA-N hexadecane-1,16-diamine Chemical compound NCCCCCCCCCCCCCCCCN ATJCASULPHYKHT-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- POIZGMCHYSVWDU-UHFFFAOYSA-N icosane-1,20-diamine Chemical compound NCCCCCCCCCCCCCCCCCCCCN POIZGMCHYSVWDU-UHFFFAOYSA-N 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000005528 methosulfate group Chemical group 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- LMTSQIZQTFBYRL-UHFFFAOYSA-N n'-octadecylethane-1,2-diamine Chemical compound CCCCCCCCCCCCCCCCCCNCCN LMTSQIZQTFBYRL-UHFFFAOYSA-N 0.000 description 1
- QIBKKTQVKFEWCH-UHFFFAOYSA-N n'-tetradecylethane-1,2-diamine Chemical compound CCCCCCCCCCCCCCNCCN QIBKKTQVKFEWCH-UHFFFAOYSA-N 0.000 description 1
- SPTAJTRODSJRMF-UHFFFAOYSA-N n,n-dimethylheptadecan-1-amine;hydrochloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCC[NH+](C)C SPTAJTRODSJRMF-UHFFFAOYSA-N 0.000 description 1
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 229960003330 pentetic acid Drugs 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 235000013966 potassium salts of fatty acid Nutrition 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical class [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 229940048084 pyrophosphate Drugs 0.000 description 1
- 239000011347 resin Chemical class 0.000 description 1
- 229920005989 resin Chemical class 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- DUXXGJTXFHUORE-UHFFFAOYSA-M sodium;4-tridecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1 DUXXGJTXFHUORE-UHFFFAOYSA-M 0.000 description 1
- WJIKLJHKBNAFCI-UHFFFAOYSA-M sodium;n'-(2-aminoethyl)ethane-1,2-diamine;2-oxido-1,3,2$l^{5}-dioxaphosphocane 2-oxide Chemical compound [Na+].NCCNCCN.[O-]P1(=O)OCCCCCO1 WJIKLJHKBNAFCI-UHFFFAOYSA-M 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000003900 succinic acid esters Chemical class 0.000 description 1
- 229940117986 sulfobetaine Drugs 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/395—Bleaching agents
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3945—Organic per-compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US31617381A | 1981-10-29 | 1981-10-29 | |
| US06/379,824 US4448705A (en) | 1982-05-20 | 1982-05-20 | Monoperoxyphthalic acid bleaching composition containing DTPMP |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA394682A ATA394682A (de) | 1991-09-15 |
| AT394386B true AT394386B (de) | 1992-03-25 |
Family
ID=26980283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0394682A AT394386B (de) | 1981-10-29 | 1982-10-28 | Bleichende koernige waschmittelzusammensetzung |
Country Status (20)
| Country | Link |
|---|---|
| KR (1) | KR890002376B1 (en:Method) |
| AT (1) | AT394386B (en:Method) |
| AU (1) | AU559690B2 (en:Method) |
| BR (1) | BR8206232A (en:Method) |
| CA (1) | CA1207956A (en:Method) |
| CH (1) | CH667962GA3 (en:Method) |
| DE (1) | DE3240505A1 (en:Method) |
| DK (1) | DK480382A (en:Method) |
| ES (1) | ES8401523A1 (en:Method) |
| FR (1) | FR2515683B1 (en:Method) |
| GB (1) | GB2110259B (en:Method) |
| GR (1) | GR77694B (en:Method) |
| IT (1) | IT1157237B (en:Method) |
| MX (1) | MX163114B (en:Method) |
| NL (1) | NL8204204A (en:Method) |
| NO (1) | NO156209C (en:Method) |
| NZ (1) | NZ202252A (en:Method) |
| PT (1) | PT75760B (en:Method) |
| SE (1) | SE453100B (en:Method) |
| ZW (1) | ZW22882A1 (en:Method) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA837074B (en) * | 1982-10-04 | 1985-05-29 | Colgate Palmolive Co | Peroxyacid bleaching and laundering composition |
| GB8321404D0 (en) * | 1983-08-09 | 1983-09-07 | Interox Chemicals Ltd | Tablets |
| US4490269A (en) * | 1984-01-13 | 1984-12-25 | Warner-Lambert Company | Effervescent denture cleaning composition comprising monoperphthalate |
| FR2583764B1 (fr) * | 1985-01-21 | 1987-07-10 | Union Gle Savonnerie | Composition detergente a base de savon et comprenant un agent de blanchiment |
| IT1208130B (it) * | 1985-09-16 | 1989-06-06 | Tomasini Ercole Casini Mario | Sistema di disinfezione per lenti corneale e suo procedimento industriale di fabbricazione |
| EP0297373A3 (en) * | 1987-06-25 | 1990-11-07 | Colgate-Palmolive Company | Granulated magnesium monoperoxyphthalate coated with fatty acid for prevention of dye damage of bleach sensitive fabrics |
| TR26356A (tr) * | 1988-06-24 | 1994-02-10 | Colgate Palmolive Co | AGARTICIYA DUYARLI CAMASIRLARDA BOYA HASARINI ÖNLEMEK ICIN YAG ASIDI ILE KAPLI GRANüLLENMIS MAGNEZYUM MONOPEROKSIFITALAT. |
| FR2691902B1 (fr) * | 1992-06-09 | 1994-08-19 | Oreal | Utilisation pour la décoloration ou l'éclaircissement des fibres kératiniques naturelles ou teintes du monoperoxyphtalate de magnésium et procédé de décoloration ou d'éclaircissement. |
| GB9411495D0 (en) * | 1994-06-08 | 1994-07-27 | Unilever Plc | Aqueous bleaching compositions comprising peroxy carboxylic acids |
| AU2021219053A1 (en) | 2020-02-10 | 2022-07-28 | Virox Technologies Inc. | Antimicrobial compositions containing peroxyphthalic acid and/or salt thereof |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1355855A (en) * | 1970-10-07 | 1974-06-05 | Procter & Gamble | Bleaching and cleaning compositions |
| EP0127693A1 (de) * | 1983-06-03 | 1984-12-12 | ANT Nachrichtentechnik GmbH | Verfahren zur automatischen Regelung der Ausgangsleistung eines Verstärkers |
| EP0137146A1 (de) * | 1983-10-12 | 1985-04-17 | Firma Schafberger + Sprödhuber | Rahmenpresse |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB926639A (en) * | 1960-05-31 | 1963-05-22 | Courtaulds Ltd | Improvements relating to the treatment of cellulosic fabrics |
| GB917495A (en) * | 1960-09-07 | 1963-02-06 | Laporte Chemical | Improvements in or relating to the stabilisation of peracetic acid |
| US3384596A (en) * | 1965-12-30 | 1968-05-21 | Dow Chemical Co | Peroxy acid bleaching systems |
| GB1538744A (en) * | 1975-05-13 | 1979-01-24 | Interox Chemicals Ltd | Bleaching composition containing diacyl peroxides |
| US3969072A (en) * | 1975-08-01 | 1976-07-13 | Ppg Industries, Inc. | Perphthalic acid after-treatment of phosphonate flameproofed fabrics |
| GB1569258A (en) * | 1975-11-18 | 1980-06-11 | Interox Chemicals Ltd | Bleaching compositions and processes |
| DE3064301D1 (en) * | 1979-10-18 | 1983-08-25 | Interox Chemicals Ltd | Magnesium salts of peroxycarboxylic acids, processes for their preparation and their use as bleaching agents in washing compositions, and processes |
| US4259201A (en) * | 1979-11-09 | 1981-03-31 | The Procter & Gamble Company | Detergent composition containing organic peracids buffered for optimum performance |
| US4325828A (en) * | 1980-03-27 | 1982-04-20 | Lever Brothers Company | Detergent bleach compositions |
| EP0068547B1 (en) * | 1981-06-22 | 1985-09-18 | THE PROCTER & GAMBLE COMPANY | Mixed peroxyacid bleaches having improved bleaching power |
-
1982
- 1982-10-21 NZ NZ202252A patent/NZ202252A/en unknown
- 1982-10-22 ZW ZW228/82A patent/ZW22882A1/xx unknown
- 1982-10-25 GR GR69629A patent/GR77694B/el unknown
- 1982-10-26 MX MX194942A patent/MX163114B/es unknown
- 1982-10-26 BR BR8206232A patent/BR8206232A/pt not_active IP Right Cessation
- 1982-10-28 AT AT0394682A patent/AT394386B/de not_active IP Right Cessation
- 1982-10-28 PT PT75760A patent/PT75760B/pt unknown
- 1982-10-28 KR KR8204862A patent/KR890002376B1/ko not_active Expired
- 1982-10-28 SE SE8206130A patent/SE453100B/sv not_active IP Right Cessation
- 1982-10-28 CA CA000414352A patent/CA1207956A/en not_active Expired
- 1982-10-28 FR FR8218093A patent/FR2515683B1/fr not_active Expired
- 1982-10-28 ES ES516910A patent/ES8401523A1/es not_active Expired
- 1982-10-28 IT IT49388/82A patent/IT1157237B/it active
- 1982-10-29 AU AU89890/82A patent/AU559690B2/en not_active Ceased
- 1982-10-29 NO NO823607A patent/NO156209C/no unknown
- 1982-10-29 CH CH632582A patent/CH667962GA3/de unknown
- 1982-10-29 DE DE19823240505 patent/DE3240505A1/de not_active Ceased
- 1982-10-29 DK DK480382A patent/DK480382A/da not_active Application Discontinuation
- 1982-10-29 NL NL8204204A patent/NL8204204A/nl not_active Application Discontinuation
- 1982-10-29 GB GB08230963A patent/GB2110259B/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1355855A (en) * | 1970-10-07 | 1974-06-05 | Procter & Gamble | Bleaching and cleaning compositions |
| EP0127693A1 (de) * | 1983-06-03 | 1984-12-12 | ANT Nachrichtentechnik GmbH | Verfahren zur automatischen Regelung der Ausgangsleistung eines Verstärkers |
| EP0137146A1 (de) * | 1983-10-12 | 1985-04-17 | Firma Schafberger + Sprödhuber | Rahmenpresse |
Also Published As
| Publication number | Publication date |
|---|---|
| AU8989082A (en) | 1983-05-12 |
| NL8204204A (nl) | 1983-05-16 |
| GB2110259B (en) | 1986-02-12 |
| BR8206232A (pt) | 1983-09-20 |
| PT75760B (en) | 1985-07-26 |
| CA1207956A (en) | 1986-07-22 |
| SE8206130D0 (sv) | 1982-10-28 |
| CH667962GA3 (en:Method) | 1988-11-30 |
| KR890002376B1 (ko) | 1989-07-02 |
| GR77694B (en:Method) | 1984-09-25 |
| FR2515683B1 (fr) | 1986-10-31 |
| IT8249388A0 (it) | 1982-10-28 |
| ES516910A0 (es) | 1983-12-01 |
| SE453100B (sv) | 1988-01-11 |
| NO156209B (no) | 1987-05-04 |
| IT1157237B (it) | 1987-02-11 |
| NO823607L (no) | 1983-05-02 |
| NO156209C (no) | 1987-08-12 |
| ZW22882A1 (en) | 1983-03-23 |
| ATA394682A (de) | 1991-09-15 |
| DE3240505A1 (de) | 1983-06-30 |
| FR2515683A1 (fr) | 1983-05-06 |
| MX163114B (es) | 1991-08-28 |
| SE8206130L (sv) | 1983-04-30 |
| DK480382A (da) | 1983-04-30 |
| KR840002025A (ko) | 1984-06-11 |
| AU559690B2 (en) | 1987-03-19 |
| GB2110259A (en) | 1983-06-15 |
| NZ202252A (en) | 1986-04-11 |
| PT75760A (en) | 1982-11-01 |
| ES8401523A1 (es) | 1983-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69014384T2 (de) | Bleichaktivierung. | |
| DE69125310T2 (de) | Bleichmittelaktivierung | |
| DE3245169A1 (de) | Bleich- und waschmittelzusammensetzung | |
| DE69019781T2 (de) | Bleichmittelzusammensetzung. | |
| US4448705A (en) | Monoperoxyphthalic acid bleaching composition containing DTPMP | |
| DE2057355A1 (de) | N-(Hydroxyhydrocarbyl)-N-alkyl-aminocarboxylate und -iminodicarboxylate sowie die entsprechenden Aminoxyde,Verfahren zu ihrer Herstellung und ihre Verwendung als bzw. in Waschmitteln und Textilweichmachern | |
| DE2054019A1 (en) | Bleaching detergent | |
| DE3337719A1 (de) | Stabilisierte teilchenfoermige bleich- und waschmittelzusammensetzung | |
| EP0869171A2 (de) | Bleichaktive Metall-Komplexe | |
| CH655945A5 (de) | Silikatfreie, bleichende waschmittelzusammensetzung. | |
| AT394386B (de) | Bleichende koernige waschmittelzusammensetzung | |
| DE2226779A1 (de) | Quartare Ammoniumslaze und ihre Ver wendung in Wasch und Bleichmitteln | |
| CH655946A5 (de) | Silikatfreie, bleichende waschmittelzusammensetzung. | |
| DE3337750C2 (en:Method) | ||
| DE2843059A1 (de) | Peroxybleichen und hierfuer verwendbare zusammensetzungen | |
| DE1802576A1 (de) | Bleich- und Waschmittel | |
| AT394575B (de) | Bleich- und waschmittel | |
| DE2456633A1 (de) | Reinigungsmittelzusammensetzungen | |
| US4664837A (en) | Bleaching and laundering composition containing magnesium monoperoxyphthalate a chelating agent, a peroxygen compound and phthalic anhydride | |
| DE1802017A1 (de) | Bleich- und Waschmittel | |
| EP0002746A1 (de) | Perverbindungen und optische Aufheller enthaltendes Bleichmittel und dessen Verwendung als Textilbehandlungsmittel | |
| DE2214500A1 (de) | Stabilisierung von Peroxyverbindungen | |
| DE2730246A1 (de) | Aufhellmittel | |
| DE3304848A1 (de) | Organische cyanamidverbindungen als aktivatoren fuer anorganische perverbindungen | |
| DE2152141A1 (de) | Fluessigwaschmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| ELJ | Ceased due to non-payment of the annual fee |