TWI631103B - 乙烯之羰基化的連續製程 - Google Patents
乙烯之羰基化的連續製程 Download PDFInfo
- Publication number
- TWI631103B TWI631103B TW101149102A TW101149102A TWI631103B TW I631103 B TWI631103 B TW I631103B TW 101149102 A TW101149102 A TW 101149102A TW 101149102 A TW101149102 A TW 101149102A TW I631103 B TWI631103 B TW I631103B
- Authority
- TW
- Taiwan
- Prior art keywords
- bis
- phosphinomethyl
- butylphosphinomethyl
- tetramethyl
- adamantyl
- Prior art date
Links
- 239000005977 Ethylene Substances 0.000 title claims abstract description 38
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 title claims abstract description 37
- 238000010924 continuous production Methods 0.000 title claims abstract description 32
- 238000005810 carbonylation reaction Methods 0.000 title claims abstract description 21
- 230000006315 carbonylation Effects 0.000 title claims abstract description 13
- 239000003054 catalyst Substances 0.000 claims abstract description 85
- 239000000047 product Substances 0.000 claims abstract description 73
- 229910052751 metal Inorganic materials 0.000 claims abstract description 72
- 239000002184 metal Substances 0.000 claims abstract description 72
- 239000002253 acid Substances 0.000 claims abstract description 71
- 239000003446 ligand Substances 0.000 claims abstract description 58
- 125000005907 alkyl ester group Chemical group 0.000 claims abstract description 47
- 238000000034 method Methods 0.000 claims abstract description 45
- 150000001875 compounds Chemical class 0.000 claims abstract description 42
- 230000008569 process Effects 0.000 claims abstract description 36
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims abstract description 27
- 239000000376 reactant Substances 0.000 claims abstract description 26
- 238000000926 separation method Methods 0.000 claims abstract description 25
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 23
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 23
- 150000002739 metals Chemical class 0.000 claims abstract description 14
- 238000007701 flash-distillation Methods 0.000 claims abstract description 11
- 230000003197 catalytic effect Effects 0.000 claims abstract description 9
- 239000012043 crude product Substances 0.000 claims abstract description 7
- 238000004821 distillation Methods 0.000 claims abstract description 7
- -1 butylphosphinomethyl Chemical group 0.000 claims description 487
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 265
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 claims description 112
- 229910052698 phosphorus Inorganic materials 0.000 claims description 96
- 125000000217 alkyl group Chemical group 0.000 claims description 86
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 60
- 238000006243 chemical reaction Methods 0.000 claims description 49
- 229910052799 carbon Inorganic materials 0.000 claims description 48
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 46
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 44
- 125000004429 atom Chemical group 0.000 claims description 43
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 39
- 239000011574 phosphorus Substances 0.000 claims description 35
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 32
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 32
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 30
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 26
- IHOMKOPTBSYOCI-UHFFFAOYSA-N [Fe].c1cccc1.c1ccc(c1)C1=CC=CC=C1 Chemical compound [Fe].c1cccc1.c1ccc(c1)C1=CC=CC=C1 IHOMKOPTBSYOCI-UHFFFAOYSA-N 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 21
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 19
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 229910003460 diamond Inorganic materials 0.000 claims description 15
- 239000010432 diamond Substances 0.000 claims description 15
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 15
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 claims description 13
- 150000001721 carbon Chemical group 0.000 claims description 13
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 13
- 239000000945 filler Substances 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 10
- 238000009825 accumulation Methods 0.000 claims description 10
- 238000012856 packing Methods 0.000 claims description 9
- 238000010306 acid treatment Methods 0.000 claims description 8
- 239000007983 Tris buffer Substances 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- QEGNUYASOUJEHD-UHFFFAOYSA-N 1,1-dimethylcyclohexane Chemical compound CC1(C)CCCCC1 QEGNUYASOUJEHD-UHFFFAOYSA-N 0.000 claims description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 229910052785 arsenic Inorganic materials 0.000 claims description 6
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 6
- OCKPCBLVNKHBMX-UHFFFAOYSA-N butylbenzene Chemical compound CCCCC1=CC=CC=C1 OCKPCBLVNKHBMX-UHFFFAOYSA-N 0.000 claims description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 5
- 229910052787 antimony Inorganic materials 0.000 claims description 5
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 claims description 5
- 238000010992 reflux Methods 0.000 claims description 5
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 claims description 4
- 229940078552 o-xylene Drugs 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 3
- 229940092714 benzenesulfonic acid Drugs 0.000 claims description 3
- QDHFHIQKOVNCNC-UHFFFAOYSA-N butane-1-sulfonic acid Chemical compound CCCCS(O)(=O)=O QDHFHIQKOVNCNC-UHFFFAOYSA-N 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- IMTWLILUFJBDKV-UHFFFAOYSA-N (1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound C1C(C2CP)(C)OC3(C)CC2(C)OC1(C)O3 IMTWLILUFJBDKV-UHFFFAOYSA-N 0.000 claims description 2
- QVGGXACWBDGASS-UHFFFAOYSA-N (8-cyclobutyl-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)C1CCC1 QVGGXACWBDGASS-UHFFFAOYSA-N 0.000 claims description 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 claims description 2
- AWMXNZMQKYEKLX-UHFFFAOYSA-N 1,3,5,7-tetramethyl-8-[[2-[(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)methyl]phenyl]methyl]-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)P2CC1=CC=CC=C1CP1C2(C)CC(C)(O3)OC1(C)CC3(C)O2 AWMXNZMQKYEKLX-UHFFFAOYSA-N 0.000 claims description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 2
- WFUDBPZFGCNRDM-UHFFFAOYSA-N 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) Chemical group [Fe+2].C=1C=C[CH-]C=1.CCCCC1=CC=C[CH-]1 WFUDBPZFGCNRDM-UHFFFAOYSA-N 0.000 claims description 2
- XWUOKKGULYZULR-UHFFFAOYSA-N C1(=CC=CC=C1)[C-]1C(=CC=C1)C1=CC=CC=C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound C1(=CC=CC=C1)[C-]1C(=CC=C1)C1=CC=CC=C1.[CH-]1C=CC=C1.[Fe+2] XWUOKKGULYZULR-UHFFFAOYSA-N 0.000 claims description 2
- ZIPHEXUEDRITMW-UHFFFAOYSA-N C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)C1(C)C(P23CC4CC(CC(C4)C2)C3)(C)C=CC=C1 Chemical group C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)C1(C)C(P23CC4CC(CC(C4)C2)C3)(C)C=CC=C1 ZIPHEXUEDRITMW-UHFFFAOYSA-N 0.000 claims description 2
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 2
- GMBMVDAIJGKWEY-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)C2(C3(CC1(OC(CC2(O1)C)(O3)C)C)C)CP.[CH-]3C=CC=C3.[Fe+2] GMBMVDAIJGKWEY-UHFFFAOYSA-N 0.000 claims description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 2
- KCEISFWCCWODBQ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-(2-methylcyclopentyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound CC1CCCC1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 KCEISFWCCWODBQ-UHFFFAOYSA-N 0.000 claims description 2
- STZDKJBOBKDXIP-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 STZDKJBOBKDXIP-UHFFFAOYSA-N 0.000 claims description 2
- SZBXVUKSDKXGMQ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[4-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=C1)C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)=CC=C1C1=CC=CC=C1 SZBXVUKSDKXGMQ-UHFFFAOYSA-N 0.000 claims description 2
- KNJLLVULIPAWDX-UHFFFAOYSA-N [1-(1-adamantyl)-1-[2-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13C(P)(C(C)(C)C)C1=CC=CC=C1C(P)(C(C)(C)C)C1(C2)CC(C3)CC2CC3C1 KNJLLVULIPAWDX-UHFFFAOYSA-N 0.000 claims description 2
- SVNWCLLUWXQARZ-UHFFFAOYSA-N [8-(3,4-dimethylcyclohexyl)-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)C2CCC(C(C2)C)C SVNWCLLUWXQARZ-UHFFFAOYSA-N 0.000 claims description 2
- FKUMADLCVKODJS-UHFFFAOYSA-N [8-[4-tert-butyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC=C(C(C)(C)C)C=C1C1(CP)C(O2)(C)CC3(C)OC2(C)CC1(C)O3 FKUMADLCVKODJS-UHFFFAOYSA-N 0.000 claims description 2
- QPHBUJJTFKRYHM-UHFFFAOYSA-N adamantane-1-sulfonic acid Chemical compound C1C(C2)CC3CC2CC1(S(=O)(=O)O)C3 QPHBUJJTFKRYHM-UHFFFAOYSA-N 0.000 claims description 2
- XTJOGEYJONDLKJ-UHFFFAOYSA-N adamantane-2-sulfonic acid Chemical compound C1C(C2)CC3CC1C(S(=O)(=O)O)C2C3 XTJOGEYJONDLKJ-UHFFFAOYSA-N 0.000 claims description 2
- HJZSRUBMWUFQDI-UHFFFAOYSA-N bis(1-adamantyl)-(cyclohexylmethyl)phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1CCCCC1 HJZSRUBMWUFQDI-UHFFFAOYSA-N 0.000 claims description 2
- WIKALRBJIOGSOK-UHFFFAOYSA-N bis(1-adamantyl)-[(2-methylcyclopentyl)methyl]phosphane Chemical compound CC1CCCC1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 WIKALRBJIOGSOK-UHFFFAOYSA-N 0.000 claims description 2
- QRYPNXSAZAEQNA-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-5-trimethylsilylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC([Si](C)(C)C)=CC=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 QRYPNXSAZAEQNA-UHFFFAOYSA-N 0.000 claims description 2
- OVKHDTCOBBKQRP-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-tert-butylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC(C(C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 OVKHDTCOBBKQRP-UHFFFAOYSA-N 0.000 claims description 2
- OXOFOTRVVAMBDF-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-trimethylsilylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC([Si](C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 OXOFOTRVVAMBDF-UHFFFAOYSA-N 0.000 claims description 2
- KIFJCWKPBJMROL-UHFFFAOYSA-N bis(1-adamantyl)-[[5-phenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=C1)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=C1C1=CC=CC=C1 KIFJCWKPBJMROL-UHFFFAOYSA-N 0.000 claims description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical compound OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 claims description 2
- KYMNSBSWJPFUJH-UHFFFAOYSA-N iron;5-methylcyclopenta-1,3-diene;methylcyclopentane Chemical compound [Fe].C[C-]1C=CC=C1.C[C-]1[CH-][CH-][CH-][CH-]1 KYMNSBSWJPFUJH-UHFFFAOYSA-N 0.000 claims description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 claims description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 claims description 2
- 230000003472 neutralizing effect Effects 0.000 claims description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000012264 purified product Substances 0.000 claims description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 2
- YHMJZIJXVNRXIN-UHFFFAOYSA-N trimethyl-(2-trimethylsilylphenyl)silane Chemical compound C[Si](C)(C)C1=CC=CC=C1[Si](C)(C)C YHMJZIJXVNRXIN-UHFFFAOYSA-N 0.000 claims description 2
- MZRCQWCFZQOVDZ-UHFFFAOYSA-N 5-tert-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) Chemical compound [Fe+2].C=1C=C[CH-]C=1.CC(C)(C)C1=CC=C[CH-]1 MZRCQWCFZQOVDZ-UHFFFAOYSA-N 0.000 claims 4
- 235000000621 Bidens tripartita Nutrition 0.000 claims 3
- 240000004082 Bidens tripartita Species 0.000 claims 3
- 208000006637 fused teeth Diseases 0.000 claims 3
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims 2
- HGECZKSVSWGGQQ-UHFFFAOYSA-N (8-cyclopentyl-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C1CCCC1 HGECZKSVSWGGQQ-UHFFFAOYSA-N 0.000 claims 1
- OIAQMFOKAXHPNH-UHFFFAOYSA-N 1,2-diphenylbenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1C1=CC=CC=C1 OIAQMFOKAXHPNH-UHFFFAOYSA-N 0.000 claims 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical compound C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 claims 1
- HSXUNHYXJWDLDK-UHFFFAOYSA-N 2-hydroxypropane-1-sulfonic acid Chemical compound CC(O)CS(O)(=O)=O HSXUNHYXJWDLDK-UHFFFAOYSA-N 0.000 claims 1
- AVDAJJAPPAYZJH-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C1=CC=CC=C1)C1=CC=CC=C1)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C1=CC=CC=C1)C1=CC=CC=C1)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] AVDAJJAPPAYZJH-UHFFFAOYSA-N 0.000 claims 1
- YSWQPZSMFRQGCW-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C1=CC=CC=C1)C1=CC=CC=C1)CP(C12CC3CC(CC(C1)C3)C2)C23CC1CC(CC(C2)C1)C3.[CH-]3C=CC=C3.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1C1=CC=CC=C1)C1=CC=CC=C1)CP(C12CC3CC(CC(C1)C3)C2)C23CC1CC(CC(C2)C1)C3.[CH-]3C=CC=C3.[Fe+2] YSWQPZSMFRQGCW-UHFFFAOYSA-N 0.000 claims 1
- GKNUNEYYWNBZSH-UHFFFAOYSA-N C1C(C2)CC(C3)CC2CP13C1=CC([Si](C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 Chemical compound C1C(C2)CC(C3)CC2CP13C1=CC([Si](C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 GKNUNEYYWNBZSH-UHFFFAOYSA-N 0.000 claims 1
- YZYITWJJGDVCBN-UHFFFAOYSA-N P12(CC3CC(CC(C1)C3)C2)C1=C(C(=C(C=C1)[Si](C)(C)C)C)P12CC3CC(CC(C1)C3)C2 Chemical compound P12(CC3CC(CC(C1)C3)C2)C1=C(C(=C(C=C1)[Si](C)(C)C)C)P12CC3CC(CC(C1)C3)C2 YZYITWJJGDVCBN-UHFFFAOYSA-N 0.000 claims 1
- DSMAWJJQSJHUAZ-UHFFFAOYSA-N PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)CP(C23CC1CC(CC(C2)C1)C3)C31CC2CC(CC(C3)C2)C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound PCC1(C2(CC3(OC(CC1(O3)C)(O2)C)C)C)[C-]2C(=CC(=C2C2=CC=CC=C2)C2=CC=CC=C2)CP(C23CC1CC(CC(C2)C1)C3)C31CC2CC(CC(C3)C2)C1.[CH-]1C=CC=C1.[Fe+2] DSMAWJJQSJHUAZ-UHFFFAOYSA-N 0.000 claims 1
- CCWHPMYNOUFYEU-UHFFFAOYSA-N bis(1-adamantyl)-(cyclobutylmethyl)phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1CCC1 CCWHPMYNOUFYEU-UHFFFAOYSA-N 0.000 claims 1
- ATDZUAIRDWAAIK-UHFFFAOYSA-N bis(1-adamantyl)-(cyclopentylmethyl)phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1CCCC1 ATDZUAIRDWAAIK-UHFFFAOYSA-N 0.000 claims 1
- IIKDFXMBZFURRP-UHFFFAOYSA-N bis(1-adamantyl)-[2-(ditert-butylphosphanylmethyl)-5-trimethylsilylphenyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C([Si](C)(C)C)C=C1P(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 IIKDFXMBZFURRP-UHFFFAOYSA-N 0.000 claims 1
- UTYPLPDQQCZNSE-UHFFFAOYSA-N bis(1-adamantyl)-[2-[bis(1-adamantyl)phosphanylmethyl]-5-trimethylsilylphenyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)C1=CC([Si](C)(C)C)=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 UTYPLPDQQCZNSE-UHFFFAOYSA-N 0.000 claims 1
- FXSYSLYCDJFLAY-UHFFFAOYSA-N bis(1-adamantyl)-[2-[bis(1-adamantyl)phosphanylmethyl]phenyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)C1=CC=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 FXSYSLYCDJFLAY-UHFFFAOYSA-N 0.000 claims 1
- RHKRUKUHXVBJJD-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 RHKRUKUHXVBJJD-UHFFFAOYSA-N 0.000 claims 1
- MNPOPASJOFYBMI-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-5-phenylphenyl]methyl]phosphane Chemical compound C1=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C(CP(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 MNPOPASJOFYBMI-UHFFFAOYSA-N 0.000 claims 1
- MXPSHWBHUIQVPY-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4,5-bis(trimethylsilyl)phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC([Si](C)(C)C)=C([Si](C)(C)C)C=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 MXPSHWBHUIQVPY-UHFFFAOYSA-N 0.000 claims 1
- VGMQJPJIWFUDDR-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4-phenylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC(C(=C1)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=C1C1=CC=CC=C1 VGMQJPJIWFUDDR-UHFFFAOYSA-N 0.000 claims 1
- MIZJPSACHCOTRL-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]phenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC1=CC=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 MIZJPSACHCOTRL-UHFFFAOYSA-N 0.000 claims 1
- YGJWIGLZUMMAJJ-UHFFFAOYSA-N bis(1-adamantyl)-[[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=CC=1C=2C=CC=CC=2)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=1C1=CC=CC=C1 YGJWIGLZUMMAJJ-UHFFFAOYSA-N 0.000 claims 1
- BWSNJKVSHLWCQO-UHFFFAOYSA-N bis(1-adamantyl)-[[5-tert-butyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC=C(C(C)(C)C)C=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 BWSNJKVSHLWCQO-UHFFFAOYSA-N 0.000 claims 1
- 239000001273 butane Substances 0.000 claims 1
- QIILBXCUXXUTHA-UHFFFAOYSA-N cyclopenta-2,4-dien-1-ylbenzene;iron(2+) Chemical compound [Fe+2].C1=C[CH-]C(C=2C=CC=CC=2)=C1.C1=C[CH-]C(C=2C=CC=CC=2)=C1 QIILBXCUXXUTHA-UHFFFAOYSA-N 0.000 claims 1
- KLABTTOCEFBDRG-UHFFFAOYSA-N ditert-butyl-[2-(ditert-butylphosphanylmethyl)phenyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1P(C(C)(C)C)C(C)(C)C KLABTTOCEFBDRG-UHFFFAOYSA-N 0.000 claims 1
- CJRKTQKOGOVYTO-UHFFFAOYSA-N ditert-butyl-[[4-tert-butyl-2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=C(C(C)(C)C)C=C1CP(C(C)(C)C)C(C)(C)C CJRKTQKOGOVYTO-UHFFFAOYSA-N 0.000 claims 1
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methylcyclopentane Chemical compound CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 description 143
- 125000001424 substituent group Chemical group 0.000 description 86
- 125000006413 ring segment Chemical group 0.000 description 65
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 43
- 239000007789 gas Substances 0.000 description 43
- 125000004122 cyclic group Chemical group 0.000 description 35
- 125000005842 heteroatom Chemical group 0.000 description 32
- 239000007791 liquid phase Substances 0.000 description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 30
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 28
- 229940017219 methyl propionate Drugs 0.000 description 28
- 125000000753 cycloalkyl group Chemical group 0.000 description 27
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 27
- 229910052760 oxygen Inorganic materials 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- 239000001257 hydrogen Substances 0.000 description 26
- 229910052739 hydrogen Inorganic materials 0.000 description 26
- 239000007788 liquid Substances 0.000 description 26
- 125000005843 halogen group Chemical group 0.000 description 24
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 23
- 125000004093 cyano group Chemical group *C#N 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 229910052763 palladium Inorganic materials 0.000 description 21
- 229920000642 polymer Polymers 0.000 description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 20
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 20
- 239000001301 oxygen Substances 0.000 description 20
- 229910052717 sulfur Inorganic materials 0.000 description 20
- 239000002270 dispersing agent Substances 0.000 description 18
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 17
- 239000012429 reaction media Substances 0.000 description 16
- 239000012071 phase Substances 0.000 description 15
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 13
- 125000003710 aryl alkyl group Chemical group 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 13
- 239000011593 sulfur Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 125000005647 linker group Chemical group 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 11
- 125000003342 alkenyl group Chemical group 0.000 description 11
- 125000002877 alkyl aryl group Chemical group 0.000 description 11
- 239000002245 particle Substances 0.000 description 11
- 238000000746 purification Methods 0.000 description 11
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 10
- 125000000304 alkynyl group Chemical group 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- 125000001183 hydrocarbyl group Chemical group 0.000 description 10
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000006467 substitution reaction Methods 0.000 description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 8
- 125000000732 arylene group Chemical group 0.000 description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- 125000003367 polycyclic group Chemical group 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- 229910052710 silicon Inorganic materials 0.000 description 8
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 7
- 239000000010 aprotic solvent Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 125000002619 bicyclic group Chemical group 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000002923 metal particle Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 6
- ZJDNAQRUUYRJLW-UHFFFAOYSA-N 2,2,6,6-tetramethylphosphinan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)P1 ZJDNAQRUUYRJLW-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 125000002947 alkylene group Chemical group 0.000 description 5
- 239000012530 fluid Substances 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 125000006574 non-aromatic ring group Chemical group 0.000 description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 5
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 5
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 5
- 239000011148 porous material Substances 0.000 description 5
- 125000003107 substituted aryl group Chemical group 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 4
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 229910052786 argon Inorganic materials 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 4
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000002736 metal compounds Chemical class 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 239000003586 protic polar solvent Substances 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 229920002873 Polyethylenimine Polymers 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- 125000002015 acyclic group Chemical group 0.000 description 3
- 229910001573 adamantine Inorganic materials 0.000 description 3
- 238000005054 agglomeration Methods 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 150000001447 alkali salts Chemical class 0.000 description 3
- 150000001409 amidines Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- 230000009977 dual effect Effects 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 229910052762 osmium Inorganic materials 0.000 description 3
- IMDDLOZQAJIBKJ-UHFFFAOYSA-N oxido-oxo-(2,2,6,6-tetramethyl-4-oxocyclohexyl)phosphanium Chemical compound CC1(C(C(CC(C1)=O)(C)C)P(=O)=O)C IMDDLOZQAJIBKJ-UHFFFAOYSA-N 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 125000004437 phosphorous atom Chemical group 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- VWWAILZUSKHANH-UHFFFAOYSA-N 1,2,4,5-tetramethylcyclohexane Chemical compound CC1CC(C)C(C)CC1C VWWAILZUSKHANH-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- KVZJLSYJROEPSQ-UHFFFAOYSA-N 1,2-dimethylcyclohexane Chemical compound CC1CCCCC1C KVZJLSYJROEPSQ-UHFFFAOYSA-N 0.000 description 2
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 2
- LOZWAPSEEHRYPG-UHFFFAOYSA-N 1,4-dithiane Chemical class C1CSCCS1 LOZWAPSEEHRYPG-UHFFFAOYSA-N 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 2
- DJXHXILQRDQZGU-UHFFFAOYSA-N 2-phosphatricyclo[3.3.1.13,7]decane Chemical compound C1C(P2)CC3CC1CC2C3 DJXHXILQRDQZGU-UHFFFAOYSA-N 0.000 description 2
- OZJPLYNZGCXSJM-UHFFFAOYSA-N 5-valerolactone Chemical compound O=C1CCCCO1 OZJPLYNZGCXSJM-UHFFFAOYSA-N 0.000 description 2
- 101100493820 Caenorhabditis elegans best-1 gene Proteins 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- DLPDVAAHPLJEAJ-UHFFFAOYSA-N benzene cyclopenta-1,3-diene iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.c1cc[cH-]c1.c1ccccc1 DLPDVAAHPLJEAJ-UHFFFAOYSA-N 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 229930188620 butyrolactone Natural products 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 239000003990 capacitor Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 239000006184 cosolvent Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000006841 cyclic skeleton Chemical group 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical class C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical class C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical class C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229940117927 ethylene oxide Drugs 0.000 description 2
- 150000002220 fluorenes Chemical class 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000002638 heterogeneous catalyst Substances 0.000 description 2
- 125000006038 hexenyl group Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 150000007518 monoprotic acids Chemical class 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N n-butylhexane Natural products CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 2
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 125000005372 silanol group Chemical group 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 2
- KXFSUVJPEQYUGN-UHFFFAOYSA-N trimethyl(phenyl)silane Chemical compound C[Si](C)(C)C1=CC=CC=C1 KXFSUVJPEQYUGN-UHFFFAOYSA-N 0.000 description 2
- WLHJCCUFRCTNRZ-UHFFFAOYSA-N (1-phenylcyclohexyl)benzene Chemical compound C1CCCCC1(C=1C=CC=CC=1)C1=CC=CC=C1 WLHJCCUFRCTNRZ-UHFFFAOYSA-N 0.000 description 1
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 1
- MUTGBJKUEZFXGO-WDSKDSINSA-N (3as,7as)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@H]21 MUTGBJKUEZFXGO-WDSKDSINSA-N 0.000 description 1
- HULDRXBPSOJSRJ-UHFFFAOYSA-N (8-cyclohexyl-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl)methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C1CCCCC1 HULDRXBPSOJSRJ-UHFFFAOYSA-N 0.000 description 1
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- JPJGNZQDELRZGE-UHFFFAOYSA-N (phenyl-$l^{2}-phosphanyl)benzene Chemical compound C=1C=CC=CC=1[P]C1=CC=CC=C1 JPJGNZQDELRZGE-UHFFFAOYSA-N 0.000 description 1
- OHPBXJJIESQPFY-UHFFFAOYSA-N 1,2-di(propan-2-yl)-9h-fluorene Chemical compound C1=CC=C2C3=CC=C(C(C)C)C(C(C)C)=C3CC2=C1 OHPBXJJIESQPFY-UHFFFAOYSA-N 0.000 description 1
- MNHSTWRXCNIKFM-UHFFFAOYSA-N 1,2-diethyl-9h-fluorene Chemical compound C1=CC=C2C3=CC=C(CC)C(CC)=C3CC2=C1 MNHSTWRXCNIKFM-UHFFFAOYSA-N 0.000 description 1
- CRXBTDWNHVBEIC-UHFFFAOYSA-N 1,2-dimethyl-9h-fluorene Chemical compound C1=CC=C2CC3=C(C)C(C)=CC=C3C2=C1 CRXBTDWNHVBEIC-UHFFFAOYSA-N 0.000 description 1
- DYEQHQNRKZJUCT-UHFFFAOYSA-N 1,2-dimethylidenecyclohexane Chemical compound C=C1CCCCC1=C DYEQHQNRKZJUCT-UHFFFAOYSA-N 0.000 description 1
- XBJHZEUYCYYCLK-UHFFFAOYSA-N 1,2-dimethylidenecyclopentane Chemical compound C=C1CCCC1=C XBJHZEUYCYYCLK-UHFFFAOYSA-N 0.000 description 1
- XUZOLQDPDMJAEZ-UHFFFAOYSA-N 1,3,7-triazecane Chemical compound C1CNCCCNCNC1 XUZOLQDPDMJAEZ-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- 150000000093 1,3-dioxanes Chemical class 0.000 description 1
- ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 1
- HVVZVBWIBBTXAJ-UHFFFAOYSA-N 1-methylideneindene Chemical compound C1=CC=C2C(=C)C=CC2=C1 HVVZVBWIBBTXAJ-UHFFFAOYSA-N 0.000 description 1
- XTDQDBVBDLYELW-UHFFFAOYSA-N 2,2,3-trimethylpentane Chemical compound CCC(C)C(C)(C)C XTDQDBVBDLYELW-UHFFFAOYSA-N 0.000 description 1
- AOIYTIDHFMNVOO-UHFFFAOYSA-N 2,3,3a,4,5,6-hexahydro-1h-indene Chemical compound C1CCC=C2CCCC21 AOIYTIDHFMNVOO-UHFFFAOYSA-N 0.000 description 1
- LWTIGYSPAXKMDG-UHFFFAOYSA-N 2,3-dihydro-1h-imidazole Chemical compound C1NC=CN1 LWTIGYSPAXKMDG-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- VMSBGXAJJLPWKV-UHFFFAOYSA-N 2-ethenylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=C VMSBGXAJJLPWKV-UHFFFAOYSA-N 0.000 description 1
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical compound CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 1
- QSVDFJNXDKTKTJ-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1h-indene Chemical compound C1CCCC2=C1CC=C2 QSVDFJNXDKTKTJ-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JBIQNUNPNKPZNX-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1)[Si](C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC(=C1)[Si](C)(C)C)CP(C(C)(C)C)C(C)(C)C.[CH-]1C=CC=C1.[Fe+2] JBIQNUNPNKPZNX-UHFFFAOYSA-N 0.000 description 1
- BBDBQGHTZXMKSE-UHFFFAOYSA-N C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC=C1)CP(C(C)(C)C)C(C)(C)C.C[Si]([C-]1C=CC=C1)(C)C.[Fe+2] Chemical compound C(C)(C)(C)P(C(C)(C)C)C[C-]1C(=CC=C1)CP(C(C)(C)C)C(C)(C)C.C[Si]([C-]1C=CC=C1)(C)C.[Fe+2] BBDBQGHTZXMKSE-UHFFFAOYSA-N 0.000 description 1
- OLEAZVNRNSVVAT-UHFFFAOYSA-N C1(=CC=CC=C1)C1(C(CCCC1)(C)C1=CC=CC=C1)C Chemical compound C1(=CC=CC=C1)C1(C(CCCC1)(C)C1=CC=CC=C1)C OLEAZVNRNSVVAT-UHFFFAOYSA-N 0.000 description 1
- UOZZAYDTNHHXLJ-UHFFFAOYSA-N C1(CCC1)C1=CC=CC=2C3=CC=CC=C3CC12 Chemical compound C1(CCC1)C1=CC=CC=2C3=CC=CC=C3CC12 UOZZAYDTNHHXLJ-UHFFFAOYSA-N 0.000 description 1
- ZIKHDOLERGJDEU-UHFFFAOYSA-N C12(CC3CC(CC(C1)C3)C2)P(C23CC1CC(CC(C2)C1)C3)C[C-]3C(=CC(=C3C3=CC=CC=C3)C3=CC=CC=C3)CP(C31CC2CC(CC(C3)C2)C1)C12CC3CC(CC(C1)C3)C2.[CH-]2C=CC=C2.[Fe+2] Chemical compound C12(CC3CC(CC(C1)C3)C2)P(C23CC1CC(CC(C2)C1)C3)C[C-]3C(=CC(=C3C3=CC=CC=C3)C3=CC=CC=C3)CP(C31CC2CC(CC(C3)C2)C1)C12CC3CC(CC(C1)C3)C2.[CH-]2C=CC=C2.[Fe+2] ZIKHDOLERGJDEU-UHFFFAOYSA-N 0.000 description 1
- NAZIEFODBBSYQY-UHFFFAOYSA-N C=C.C1(C=CC=C1)[Zr] Chemical group C=C.C1(C=CC=C1)[Zr] NAZIEFODBBSYQY-UHFFFAOYSA-N 0.000 description 1
- WHQSNFAZTUWRQI-UHFFFAOYSA-N CC(C)(C)[P]C(C)(C)C Chemical compound CC(C)(C)[P]C(C)(C)C WHQSNFAZTUWRQI-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- BZKFMUIJRXWWQK-UHFFFAOYSA-N Cyclopentenone Chemical compound O=C1CCC=C1 BZKFMUIJRXWWQK-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- UDSFAEKRVUSQDD-UHFFFAOYSA-N Dimethyl adipate Chemical compound COC(=O)CCCCC(=O)OC UDSFAEKRVUSQDD-UHFFFAOYSA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N Tetrahydrothiophene-1,1-dioxide, Natural products O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- YLGURJYLNZINMJ-UHFFFAOYSA-N [1,3,5,7-tetramethyl-8-[2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]-4-trimethylsilylphenyl]-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C2(C)CC(O3)(C)OC1(C)CC3(C)C2(CP)C1=CC([Si](C)(C)C)=CC=C1C1(CP)C2(C)CC(C)(O3)OC1(C)CC3(C)O2 YLGURJYLNZINMJ-UHFFFAOYSA-N 0.000 description 1
- XPLBBAQFWIYEOY-UHFFFAOYSA-N [2,2,4,4-tetramethyl-3-[2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)-4-tritert-butylsilylphenyl]pentan-3-yl]phosphane Chemical compound CC(C)(C)C(P)(C(C)(C)C)C1=CC=C([Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C)C=C1C(P)(C(C)(C)C)C(C)(C)C XPLBBAQFWIYEOY-UHFFFAOYSA-N 0.000 description 1
- NRULGPVQXYQMSP-UHFFFAOYSA-N [2-[bis(2-methylbutan-2-yl)phosphanylmethyl]phenyl]methyl-bis(2-methylbutan-2-yl)phosphane Chemical compound CCC(C)(C)P(C(C)(C)CC)CC1=CC=CC=C1CP(C(C)(C)CC)C(C)(C)CC NRULGPVQXYQMSP-UHFFFAOYSA-N 0.000 description 1
- VPEMLSHVKXWVJN-UHFFFAOYSA-N [3-[4-tert-butyl-2-(2,2,4,4-tetramethyl-3-phosphanylpentan-3-yl)phenyl]-2,2,4,4-tetramethylpentan-3-yl]phosphane Chemical compound CC(C)(C)C1=CC=C(C(P)(C(C)(C)C)C(C)(C)C)C(C(P)(C(C)(C)C)C(C)(C)C)=C1 VPEMLSHVKXWVJN-UHFFFAOYSA-N 0.000 description 1
- CYMDWWDRVMMQQW-UHFFFAOYSA-N [8-[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]-1,3,5,7-tetramethyl-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]methylphosphane Chemical compound O1C(C)(O2)CC3(C)OC2(C)CC1(C)C3(CP)C(C(=CC=1C=2C=CC=CC=2)C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)=CC=1C1=CC=CC=C1 CYMDWWDRVMMQQW-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- LRPDOGHXAWETLI-UHFFFAOYSA-N antimony Chemical compound [Sb].[Sb].[Sb].[Sb] LRPDOGHXAWETLI-UHFFFAOYSA-N 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- RPZUBXWEQBPUJR-UHFFFAOYSA-N bicyclo[4.2.0]octane Chemical compound C1CCCC2CCC21 RPZUBXWEQBPUJR-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- VTVFXNKSLYYIIG-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)-4,5-diphenylphenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 VTVFXNKSLYYIIG-UHFFFAOYSA-N 0.000 description 1
- ZTHCUOODJOPAKX-UHFFFAOYSA-N bis(1-adamantyl)-[[2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1CP(C12CC3CC(CC(C3)C1)C2)C1(C2)CC(C3)CC2CC3C1 ZTHCUOODJOPAKX-UHFFFAOYSA-N 0.000 description 1
- IYJFKBUCDIHNLX-UHFFFAOYSA-N bis(1-adamantyl)-[[2-[bis(1-adamantyl)phosphanylmethyl]-4,5-diphenylphenyl]methyl]phosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(C12CC3CC(CC(C3)C1)C2)CC(C(=CC=1C=2C=CC=CC=2)CP(C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)=CC=1C1=CC=CC=C1 IYJFKBUCDIHNLX-UHFFFAOYSA-N 0.000 description 1
- RRRZOLBZYZWQBZ-UHFFFAOYSA-N bis(1-adamantyl)phosphane Chemical compound C1C(C2)CC(C3)CC2CC13PC(C1)(C2)CC3CC2CC1C3 RRRZOLBZYZWQBZ-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- RHDGNLCLDBVESU-UHFFFAOYSA-N but-3-en-4-olide Chemical compound O=C1CC=CO1 RHDGNLCLDBVESU-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N carbon tetrachloride Substances ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-YPZZEJLDSA-N carbon-10 atom Chemical compound [10C] OKTJSMMVPCPJKN-YPZZEJLDSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KSDIHKMNSYWRFB-UHFFFAOYSA-N chrysen-2-amine Chemical compound C1=CC=CC2=CC=C3C4=CC=C(N)C=C4C=CC3=C21 KSDIHKMNSYWRFB-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- GPTJTTCOVDDHER-UHFFFAOYSA-N cyclononane Chemical compound C1CCCCCCCC1 GPTJTTCOVDDHER-UHFFFAOYSA-N 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- WJTCGQSWYFHTAC-UHFFFAOYSA-N cyclooctane Chemical compound C1CCCCCCC1 WJTCGQSWYFHTAC-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000006392 deoxygenation reaction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- DTAJOJDRSKTZNF-UHFFFAOYSA-N ditert-butyl-[2-[2-(ditert-butylphosphanylmethyl)phenyl]phenyl]phosphane Chemical group C(C)(C)(C)P(C(C)(C)C)CC1=C(C=CC=C1)C1=C(C=CC=C1)P(C(C)(C)C)C(C)(C)C DTAJOJDRSKTZNF-UHFFFAOYSA-N 0.000 description 1
- OGEKSEYIUOEDRE-UHFFFAOYSA-N ditert-butyl-[8-(ditert-butylphosphanylmethyl)naphthalen-1-yl]phosphane Chemical compound C1=CC(P(C(C)(C)C)C(C)(C)C)=C2C(CP(C(C)(C)C)C(C)(C)C)=CC=CC2=C1 OGEKSEYIUOEDRE-UHFFFAOYSA-N 0.000 description 1
- RFHJIKLLDUYFCV-UHFFFAOYSA-N ditert-butyl-[[1-(ditert-butylphosphanylmethyl)naphthalen-2-yl]methyl]phosphane Chemical compound C1=CC=CC2=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=C21 RFHJIKLLDUYFCV-UHFFFAOYSA-N 0.000 description 1
- NBASRKGKDHSQSV-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-3,6-diphenylphenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=C(CP(C(C)(C)C)C(C)(C)C)C(C=2C=CC=CC=2)=CC=C1C1=CC=CC=C1 NBASRKGKDHSQSV-UHFFFAOYSA-N 0.000 description 1
- CADVYTVWWILZML-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)-4-phenylphenyl]methyl]phosphane Chemical compound C1=C(CP(C(C)(C)C)C(C)(C)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=C1C1=CC=CC=C1 CADVYTVWWILZML-UHFFFAOYSA-N 0.000 description 1
- SFCNPIUDAIFHRD-UHFFFAOYSA-N ditert-butyl-[[2-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane Chemical compound CC(C)(C)P(C(C)(C)C)CC1=CC=CC=C1CP(C(C)(C)C)C(C)(C)C SFCNPIUDAIFHRD-UHFFFAOYSA-N 0.000 description 1
- FNVYFXOMLKSSFK-UHFFFAOYSA-N ditert-butyl-[[4,5-diphenyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]phenyl]methyl]phosphane Chemical compound C=1C=CC=CC=1C=1C=C(C2(CP)C3(C)CC4(OC(O3)(C)CC2(C)O4)C)C(CP(C(C)(C)C)C(C)(C)C)=CC=1C1=CC=CC=C1 FNVYFXOMLKSSFK-UHFFFAOYSA-N 0.000 description 1
- CRHWEIDCXNDTMO-UHFFFAOYSA-N ditert-butylphosphane Chemical compound CC(C)(C)PC(C)(C)C CRHWEIDCXNDTMO-UHFFFAOYSA-N 0.000 description 1
- MYRTYDVEIRVNKP-UHFFFAOYSA-N divinylbenzene Substances C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- CUHVTYCUTYWQOR-UHFFFAOYSA-N formaldehyde Chemical compound O=C.O=C CUHVTYCUTYWQOR-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- BNRNAKTVFSZAFA-UHFFFAOYSA-N hydrindane Chemical compound C1CCCC2CCCC21 BNRNAKTVFSZAFA-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910001504 inorganic chloride Inorganic materials 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- MBABOKRGFJTBAE-UHFFFAOYSA-N methyl methanesulfonate Chemical compound COS(C)(=O)=O MBABOKRGFJTBAE-UHFFFAOYSA-N 0.000 description 1
- BDJAEZRIGNCQBZ-UHFFFAOYSA-N methylcyclobutane Chemical compound CC1CCC1 BDJAEZRIGNCQBZ-UHFFFAOYSA-N 0.000 description 1
- UIUXUFNYAYAMOE-UHFFFAOYSA-N methylsilane Chemical group [SiH3]C UIUXUFNYAYAMOE-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- XURVRZSODRHRNK-UHFFFAOYSA-N o-quinodimethane Chemical compound C=C1C=CC=CC1=C XURVRZSODRHRNK-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000011197 physicochemical method Methods 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 108010094020 polyglycine Proteins 0.000 description 1
- 229920000232 polyglycine polymer Polymers 0.000 description 1
- 108010050934 polyleucine Proteins 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 108010087948 polymethionine Proteins 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 108010000222 polyserine Proteins 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229910021426 porous silicon Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 229960002429 proline Drugs 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- ANIDRZQDJXBHHM-UHFFFAOYSA-N pyridin-2-ylphosphane Chemical compound PC1=CC=CC=N1 ANIDRZQDJXBHHM-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010223 real-time analysis Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- FZHCFNGSGGGXEH-UHFFFAOYSA-N ruthenocene Chemical compound [Ru+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 FZHCFNGSGGGXEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 230000003335 steric effect Effects 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 230000009469 supplementation Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- GXQVETCYFIVHCC-UHFFFAOYSA-N trimethyl-(3-trimethylsilyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-1-yl)silane Chemical compound C1CCCC2C([Si](C)(C)C)OC([Si](C)(C)C)C21 GXQVETCYFIVHCC-UHFFFAOYSA-N 0.000 description 1
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical compound C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 1
- 229960004441 tyrosine Drugs 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/36—Preparation of carboxylic acid esters by reaction with carbon monoxide or formates
- C07C67/38—Preparation of carboxylic acid esters by reaction with carbon monoxide or formates by addition to an unsaturated carbon-to-carbon bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/48—Separation; Purification; Stabilisation; Use of additives
- C07C67/52—Separation; Purification; Stabilisation; Use of additives by change in the physical state, e.g. crystallisation
- C07C67/54—Separation; Purification; Stabilisation; Use of additives by change in the physical state, e.g. crystallisation by distillation
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Crystallography & Structural Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ??1122054.8 | 2011-12-21 | ||
| GB201122054A GB201122054D0 (en) | 2011-12-21 | 2011-12-21 | A continuous process for the carbonylation of ethylene |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201336822A TW201336822A (zh) | 2013-09-16 |
| TWI631103B true TWI631103B (zh) | 2018-08-01 |
Family
ID=45572827
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW101149102A TWI631103B (zh) | 2011-12-21 | 2012-12-21 | 乙烯之羰基化的連續製程 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US9382190B2 (enExample) |
| EP (1) | EP2794548B1 (enExample) |
| JP (3) | JP2015502393A (enExample) |
| KR (1) | KR102105599B1 (enExample) |
| CN (2) | CN106928061B (enExample) |
| AU (1) | AU2012356457B2 (enExample) |
| BR (1) | BR112014015157B1 (enExample) |
| CA (1) | CA2857572C (enExample) |
| EA (1) | EA032583B1 (enExample) |
| ES (1) | ES2742329T3 (enExample) |
| GB (1) | GB201122054D0 (enExample) |
| IN (1) | IN2014DN05822A (enExample) |
| MX (1) | MX348494B (enExample) |
| MY (1) | MY171403A (enExample) |
| SG (2) | SG11201402921RA (enExample) |
| TW (1) | TWI631103B (enExample) |
| WO (1) | WO2013093472A1 (enExample) |
| ZA (1) | ZA201404484B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB201122054D0 (en) * | 2011-12-21 | 2012-02-01 | Lucite Int Uk Ltd | A continuous process for the carbonylation of ethylene |
| CN112898123B (zh) * | 2019-11-19 | 2022-02-11 | 中国科学院大连化学物理研究所 | 一种制备丙醇的方法 |
| US20240083926A1 (en) * | 2020-12-15 | 2024-03-14 | Agency For Science, Technology And Research | Phosphorus compounds and methods thereof |
| CN115959994B (zh) * | 2021-10-13 | 2025-11-04 | 上海浦景化工技术股份有限公司 | 一种制备高纯度mma的系统及方法 |
| CN115957823B (zh) * | 2021-10-13 | 2025-04-08 | 上海浦景化工技术股份有限公司 | 一种乙烯羰基化催化剂及其应用 |
| CN116139939B (zh) * | 2022-12-28 | 2025-08-26 | 浙江新和成股份有限公司 | 催化剂体系和羰基化反应的方法 |
| CN116082157B (zh) * | 2023-01-18 | 2025-09-16 | 上海梓龄化工技术有限公司 | 一种烯属不饱和化合物烷氧羰基化反应制备有机羧酸酯的方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998041495A1 (en) * | 1997-03-19 | 1998-09-24 | Imperial Chemical Industries Plc | Process for the carbonylation of ethylene |
| WO2007020379A1 (en) * | 2005-08-12 | 2007-02-22 | Lucite International Uk Limited | Improved catalyst system |
| EP2243549A1 (en) * | 2004-02-18 | 2010-10-27 | Lucite International UK Limited | A catalyst system |
| WO2011073655A1 (en) * | 2009-12-15 | 2011-06-23 | Lucite International Uk Limited | A continuous process for the carbonylation of ethylene |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5440901A (en) * | 1977-09-07 | 1979-03-31 | Masabumi Isobe | Flash tank which houses filler |
| US4262138A (en) | 1979-04-09 | 1981-04-14 | Chem Systems Inc. | Preparation of carboxylic acid esters with BF3 complex catalyst |
| EP0055875B1 (en) | 1981-01-06 | 1986-08-20 | Shell Internationale Researchmaatschappij B.V. | Process for the carbonylation of olefins |
| CA1231346A (en) | 1982-09-30 | 1988-01-12 | Eit Drent | Process for the carbonylation of olefinically unsaturated compounds with a palladium catalyst |
| JPS62102883A (ja) * | 1985-10-30 | 1987-05-13 | Hitachi Ltd | 廃液濃縮器 |
| GB8531624D0 (en) | 1985-12-23 | 1986-02-05 | Shell Int Research | Carbonylation of ethylenically unsaturated compounds |
| GB8605034D0 (en) | 1986-02-28 | 1986-04-09 | Shell Int Research | Carbonylation of compounds |
| KR880007426A (ko) | 1986-12-24 | 1988-08-27 | 오노 알버어스 | 팔라듐 촉매를 사용한 올레핀형 불포화 화합물의 카르보닐화 방법 |
| GB8705699D0 (en) | 1987-03-11 | 1987-04-15 | Shell Int Research | Carbonylation of olefinically unsaturated compounds |
| KR0144567B1 (ko) | 1989-03-03 | 1998-07-15 | 오노 알버어스 | 카르보닐화촉매시스템 |
| CA2034971A1 (en) | 1990-02-05 | 1991-08-06 | Eit Drent | Carbonylation catalyst system |
| FI91135C (fi) | 1990-03-19 | 1994-05-25 | Valmet Paper Machinery Inc | Menetelmä reikien poraamiseksi paperikoneen sylinterin vaippaan ja menetelmässä käytetty laitteisto |
| CA2055628A1 (en) | 1990-12-03 | 1992-06-04 | Eit Drent | Carbonylation process and catalyst composition |
| DE69204691T2 (de) | 1991-01-15 | 1996-04-11 | Shell Int Research | Verfahren zur Karbonylierung von Olefin. |
| ES2088082T3 (es) | 1991-01-15 | 1996-08-01 | Shell Int Research | Carbonilacion de olefinas. |
| ES2054519T3 (es) | 1991-02-15 | 1994-08-01 | Shell Int Research | Sistema de catalizador de carbonilacion. |
| JP3489592B2 (ja) * | 1994-02-28 | 2004-01-19 | 三菱瓦斯化学株式会社 | エステル類の製造方法 |
| GB9425911D0 (en) | 1994-12-22 | 1995-02-22 | Ici Plc | Process for the carbonylation of olefins and catalyst system for use therein |
| JP2922848B2 (ja) * | 1996-06-14 | 1999-07-26 | 株式会社日本触媒 | 芳香族炭酸エステルの製造方法 |
| US6156934A (en) | 1997-03-26 | 2000-12-05 | Shell Oil Company | Diphosphines |
| MY127358A (en) | 2000-03-14 | 2006-11-30 | Shell Int Research | Process for the carbonylation of ethylenically unsaturated compounds |
| DE10048874A1 (de) | 2000-09-29 | 2002-04-11 | Basf Ag | Katalysatorsystem und Verfahren zur Carbonylierung |
| DE10228293A1 (de) | 2001-07-28 | 2003-02-13 | Basf Ag | Verfahren zur Herstellung von Dialkylketonen |
| JP2003267917A (ja) * | 2002-03-15 | 2003-09-25 | Mitsubishi Chemicals Corp | 蒸留塔の運転停止方法 |
| JP2003113138A (ja) * | 2001-10-09 | 2003-04-18 | Mitsubishi Chemicals Corp | （メタ）アクリル酸類の蒸留方法 |
| EP1478463B1 (en) | 2002-02-19 | 2012-04-11 | Lucite International UK Limited | Process for the carbonylation of an ethylenically unsaturated compound and catalyst therefore |
| EP1554039B1 (en) | 2002-09-12 | 2013-07-03 | Lucite International UK Limited | A catalyst system comprising a 1,2-bis-(phosphino)metallocene ligand |
| BRPI0410471A (pt) | 2003-05-22 | 2006-05-30 | Shell Int Research | processo para a carbonilação de um dieno conjugado, ligante de difosfina bidentada, composição catalìtica, e, composição de produto de carbonilação |
| CA2557362A1 (en) | 2004-02-26 | 2005-09-09 | Shell Internationale Research Maatschappij B.V. | Process for the carbonylation of ethylenically or acetylenically unsaturated compounds |
| MX2008000817A (es) * | 2005-07-18 | 2008-03-14 | Union Engineering As | Un metodo para la recuperacion de dioxido de carbon de alta pureza a partir de una fuente gaseosa que comprende compuestos de nitrogeno. |
| GB0921876D0 (en) * | 2009-12-15 | 2010-01-27 | Lucite Int Uk Ltd | Improved carbonylation process |
| GB201122054D0 (en) * | 2011-12-21 | 2012-02-01 | Lucite Int Uk Ltd | A continuous process for the carbonylation of ethylene |
-
2011
- 2011-12-21 GB GB201122054A patent/GB201122054D0/en not_active Ceased
-
2012
- 2012-12-20 KR KR1020147020382A patent/KR102105599B1/ko active Active
- 2012-12-20 CN CN201710180912.5A patent/CN106928061B/zh active Active
- 2012-12-20 SG SG11201402921RA patent/SG11201402921RA/en unknown
- 2012-12-20 SG SG10201700374VA patent/SG10201700374VA/en unknown
- 2012-12-20 WO PCT/GB2012/053204 patent/WO2013093472A1/en not_active Ceased
- 2012-12-20 US US14/364,718 patent/US9382190B2/en active Active
- 2012-12-20 EA EA201491208A patent/EA032583B1/ru not_active IP Right Cessation
- 2012-12-20 JP JP2014548192A patent/JP2015502393A/ja active Pending
- 2012-12-20 CN CN201280063887.8A patent/CN104011007B/zh active Active
- 2012-12-20 AU AU2012356457A patent/AU2012356457B2/en not_active Ceased
- 2012-12-20 IN IN5822DEN2014 patent/IN2014DN05822A/en unknown
- 2012-12-20 ES ES12809846T patent/ES2742329T3/es active Active
- 2012-12-20 MY MYPI2014701673A patent/MY171403A/en unknown
- 2012-12-20 BR BR112014015157-1A patent/BR112014015157B1/pt not_active IP Right Cessation
- 2012-12-20 MX MX2014007326A patent/MX348494B/es active IP Right Grant
- 2012-12-20 EP EP12809846.4A patent/EP2794548B1/en active Active
- 2012-12-20 CA CA2857572A patent/CA2857572C/en active Active
- 2012-12-21 TW TW101149102A patent/TWI631103B/zh active
-
2014
- 2014-06-18 ZA ZA2014/04484A patent/ZA201404484B/en unknown
-
2017
- 2017-07-12 JP JP2017135935A patent/JP6716503B2/ja active Active
-
2019
- 2019-02-28 JP JP2019035068A patent/JP2019089844A/ja not_active Withdrawn
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998041495A1 (en) * | 1997-03-19 | 1998-09-24 | Imperial Chemical Industries Plc | Process for the carbonylation of ethylene |
| EP2243549A1 (en) * | 2004-02-18 | 2010-10-27 | Lucite International UK Limited | A catalyst system |
| WO2007020379A1 (en) * | 2005-08-12 | 2007-02-22 | Lucite International Uk Limited | Improved catalyst system |
| WO2011073655A1 (en) * | 2009-12-15 | 2011-06-23 | Lucite International Uk Limited | A continuous process for the carbonylation of ethylene |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI631103B (zh) | 乙烯之羰基化的連續製程 | |
| KR101814054B1 (ko) | 에틸렌의 카르보닐화를 위한 연속 공정 | |
| RU2470028C2 (ru) | Комплексы металлов | |
| JP2010533162A (ja) | エチレン性不飽和化合物のカルボニル化方法および触媒系 | |
| KR20120127435A (ko) | 에틸렌성 불포화 화합물의 카르보닐화 방법, 신규한 카르보닐화 리간드 및 이러한 리간드를 포함하는 촉매 시스템 | |
| JP2015017127A (ja) | エチレン性不飽和化合物のカルボニル化法、新規なカルボニル化配位子およびかかる配位子を組み入れた触媒系 | |
| CN102740972B (zh) | 改进的羰基化工艺 | |
| US20100022799A1 (en) | Carbonylation of conjugated dienes |