TWI621267B - 半導體裝置 - Google Patents
半導體裝置 Download PDFInfo
- Publication number
- TWI621267B TWI621267B TW104109653A TW104109653A TWI621267B TW I621267 B TWI621267 B TW I621267B TW 104109653 A TW104109653 A TW 104109653A TW 104109653 A TW104109653 A TW 104109653A TW I621267 B TWI621267 B TW I621267B
- Authority
- TW
- Taiwan
- Prior art keywords
- pattern
- fin
- semiconductor device
- gate electrode
- insulating layer
- Prior art date
Links
- 239000004065 semiconductor Substances 0.000 title claims abstract description 192
- 239000000758 substrate Substances 0.000 claims abstract description 87
- 239000000463 material Substances 0.000 claims abstract description 55
- 125000006850 spacer group Chemical group 0.000 claims description 67
- 229910052732 germanium Inorganic materials 0.000 claims description 39
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 39
- 239000012535 impurity Substances 0.000 claims description 34
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 20
- 229910052799 carbon Inorganic materials 0.000 claims description 20
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 16
- 229910052707 ruthenium Inorganic materials 0.000 claims description 16
- 230000004048 modification Effects 0.000 claims description 10
- 238000012986 modification Methods 0.000 claims description 10
- 229910044991 metal oxide Inorganic materials 0.000 claims description 7
- 150000004706 metal oxides Chemical class 0.000 claims description 7
- 229910000577 Silicon-germanium Inorganic materials 0.000 claims description 6
- 108010075750 P-Type Calcium Channels Proteins 0.000 claims 1
- 239000010410 layer Substances 0.000 description 352
- 238000010586 diagram Methods 0.000 description 26
- 238000000034 method Methods 0.000 description 19
- 150000001875 compounds Chemical class 0.000 description 18
- NFFIWVVINABMKP-UHFFFAOYSA-N methylidynetantalum Chemical compound [Ta]#C NFFIWVVINABMKP-UHFFFAOYSA-N 0.000 description 17
- 229910003468 tantalcarbide Inorganic materials 0.000 description 17
- 239000011229 interlayer Substances 0.000 description 13
- 229910000449 hafnium oxide Inorganic materials 0.000 description 11
- WIHZLLGSGQNAGK-UHFFFAOYSA-N hafnium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Hf+4] WIHZLLGSGQNAGK-UHFFFAOYSA-N 0.000 description 11
- 238000004519 manufacturing process Methods 0.000 description 10
- MZLGASXMSKOWSE-UHFFFAOYSA-N tantalum nitride Chemical compound [Ta]#N MZLGASXMSKOWSE-UHFFFAOYSA-N 0.000 description 8
- 238000009413 insulation Methods 0.000 description 5
- MTPVUVINMAGMJL-UHFFFAOYSA-N trimethyl(1,1,2,2,2-pentafluoroethyl)silane Chemical compound C[Si](C)(C)C(F)(F)C(F)(F)F MTPVUVINMAGMJL-UHFFFAOYSA-N 0.000 description 5
- NRTOMJZYCJJWKI-UHFFFAOYSA-N Titanium nitride Chemical compound [Ti]#N NRTOMJZYCJJWKI-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 238000005530 etching Methods 0.000 description 4
- 230000002093 peripheral effect Effects 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 229910052721 tungsten Inorganic materials 0.000 description 4
- 239000010937 tungsten Substances 0.000 description 4
- 230000006870 function Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 229910052735 hafnium Inorganic materials 0.000 description 3
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000004767 nitrides Chemical class 0.000 description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- LEVVHYCKPQWKOP-UHFFFAOYSA-N [Si].[Ge] Chemical compound [Si].[Ge] LEVVHYCKPQWKOP-UHFFFAOYSA-N 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 229910003460 diamond Inorganic materials 0.000 description 2
- 239000010432 diamond Substances 0.000 description 2
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 2
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 description 2
- 238000000059 patterning Methods 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229920003209 poly(hydridosilsesquioxane) Polymers 0.000 description 2
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 229910001936 tantalum oxide Inorganic materials 0.000 description 2
- JBRZTFJDHDCESZ-UHFFFAOYSA-N AsGa Chemical compound [As]#[Ga] JBRZTFJDHDCESZ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229910001218 Gallium arsenide Inorganic materials 0.000 description 1
- 229910000673 Indium arsenide Inorganic materials 0.000 description 1
- GPXJNWSHGFTCBW-UHFFFAOYSA-N Indium phosphide Chemical compound [In]#P GPXJNWSHGFTCBW-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- BOTDANWDWHJENH-UHFFFAOYSA-N Tetraethyl orthosilicate Chemical compound CCO[Si](OCC)(OCC)OCC BOTDANWDWHJENH-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- XWCMFHPRATWWFO-UHFFFAOYSA-N [O-2].[Ta+5].[Sc+3].[O-2].[O-2].[O-2] Chemical compound [O-2].[Ta+5].[Sc+3].[O-2].[O-2].[O-2] XWCMFHPRATWWFO-UHFFFAOYSA-N 0.000 description 1
- ILCYGSITMBHYNK-UHFFFAOYSA-N [Si]=O.[Hf] Chemical compound [Si]=O.[Hf] ILCYGSITMBHYNK-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- VKJLWXGJGDEGSO-UHFFFAOYSA-N barium(2+);oxygen(2-);titanium(4+) Chemical compound [O-2].[O-2].[O-2].[Ti+4].[Ba+2] VKJLWXGJGDEGSO-UHFFFAOYSA-N 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- VTGARNNDLOTBET-UHFFFAOYSA-N gallium antimonide Chemical compound [Sb]#[Ga] VTGARNNDLOTBET-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- WPYVAWXEWQSOGY-UHFFFAOYSA-N indium antimonide Chemical compound [Sb]#[In] WPYVAWXEWQSOGY-UHFFFAOYSA-N 0.000 description 1
- RPQDHPTXJYYUPQ-UHFFFAOYSA-N indium arsenide Chemical compound [In]#[As] RPQDHPTXJYYUPQ-UHFFFAOYSA-N 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- JQJCSZOEVBFDKO-UHFFFAOYSA-N lead zinc Chemical compound [Zn].[Pb] JQJCSZOEVBFDKO-UHFFFAOYSA-N 0.000 description 1
- UNASZPQZIFZUSI-UHFFFAOYSA-N methylidyneniobium Chemical compound [Nb]#C UNASZPQZIFZUSI-UHFFFAOYSA-N 0.000 description 1
- 239000002070 nanowire Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 230000005693 optoelectronics Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- KJXBRHIPHIVJCS-UHFFFAOYSA-N oxo(oxoalumanyloxy)lanthanum Chemical compound O=[Al]O[La]=O KJXBRHIPHIVJCS-UHFFFAOYSA-N 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical compound O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 description 1
- 229910021420 polycrystalline silicon Inorganic materials 0.000 description 1
- 229920005591 polysilicon Polymers 0.000 description 1
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 1
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 1
- 239000005368 silicate glass Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- VEALVRVVWBQVSL-UHFFFAOYSA-N strontium titanate Chemical compound [Sr+2].[O-][Ti]([O-])=O VEALVRVVWBQVSL-UHFFFAOYSA-N 0.000 description 1
- CZXRMHUWVGPWRM-UHFFFAOYSA-N strontium;barium(2+);oxygen(2-);titanium(4+) Chemical compound [O-2].[O-2].[O-2].[O-2].[Ti+4].[Sr+2].[Ba+2] CZXRMHUWVGPWRM-UHFFFAOYSA-N 0.000 description 1
- OCGWQDWYSQAFTO-UHFFFAOYSA-N tellanylidenelead Chemical compound [Pb]=[Te] OCGWQDWYSQAFTO-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L29/00—Semiconductor devices adapted for rectifying, amplifying, oscillating or switching, or capacitors or resistors with at least one potential-jump barrier or surface barrier, e.g. PN junction depletion layer or carrier concentration layer; Details of semiconductor bodies or of electrodes thereof ; Multistep manufacturing processes therefor
- H01L29/66—Types of semiconductor device ; Multistep manufacturing processes therefor
- H01L29/68—Types of semiconductor device ; Multistep manufacturing processes therefor controllable by only the electric current supplied, or only the electric potential applied, to an electrode which does not carry the current to be rectified, amplified or switched
- H01L29/76—Unipolar devices, e.g. field effect transistors
- H01L29/772—Field effect transistors
- H01L29/78—Field effect transistors with field effect produced by an insulated gate
- H01L29/785—Field effect transistors with field effect produced by an insulated gate having a channel with a horizontal current flow in a vertical sidewall of a semiconductor body, e.g. FinFET, MuGFET
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01L—SEMICONDUCTOR DEVICES NOT COVERED BY CLASS H10
- H01L29/00—Semiconductor devices adapted for rectifying, amplifying, oscillating or switching, or capacitors or resistors with at least one potential-jump barrier or surface barrier, e.g. PN junction depletion layer or carrier concentration layer; Details of semiconductor bodies or of electrodes thereof ; Multistep manufacturing processes therefor
- H01L29/66—Types of semiconductor device ; Multistep manufacturing processes therefor
- H01L29/68—Types of semiconductor device ; Multistep manufacturing processes therefor controllable by only the electric current supplied, or only the electric potential applied, to an electrode which does not carry the current to be rectified, amplified or switched
- H01L29/76—Unipolar devices, e.g. field effect transistors
- H01L29/772—Field effect transistors
- H01L29/78—Field effect transistors with field effect produced by an insulated gate
- H01L29/7831—Field effect transistors with field effect produced by an insulated gate with multiple gate structure
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201461970615P | 2014-03-26 | 2014-03-26 | |
| US61/970,615 | 2014-03-26 | ||
| KR1020140101756A KR102236560B1 (ko) | 2014-03-26 | 2014-08-07 | 반도체 장치 및 이의 제조 방법 |
| ??10-2014-0101756 | 2014-08-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201543678A TW201543678A (zh) | 2015-11-16 |
| TWI621267B true TWI621267B (zh) | 2018-04-11 |
Family
ID=54345147
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW104109653A TWI621267B (zh) | 2014-03-26 | 2015-03-26 | 半導體裝置 |
Country Status (3)
| Country | Link |
|---|---|
| KR (1) | KR102236560B1 (ko) |
| CN (1) | CN105047698B (ko) |
| TW (1) | TWI621267B (ko) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10008493B2 (en) * | 2015-06-08 | 2018-06-26 | Samsung Electronics Co., Ltd. | Semiconductor device and method of fabricating the same |
| CN106910739B (zh) * | 2015-12-21 | 2022-01-11 | 三星电子株式会社 | 半导体器件 |
| KR102449211B1 (ko) * | 2016-01-05 | 2022-09-30 | 삼성전자주식회사 | 전계 효과 트랜지스터를 포함하는 반도체 소자 |
| US10103262B2 (en) * | 2016-01-12 | 2018-10-16 | Taiwan Semiconductor Manufacturing Co., Ltd. | Method of forming a finFET structure with high quality EPI film |
| US9773911B2 (en) * | 2016-02-05 | 2017-09-26 | Taiwan Semiconductor Manufacturing Co., Ltd. | Fin field effect transistor and fabricating method thereof |
| KR102486477B1 (ko) * | 2016-05-31 | 2023-01-06 | 삼성전자주식회사 | 반도체 장치 및 이의 제조 방법 |
| US10249757B2 (en) * | 2016-12-21 | 2019-04-02 | Samsung Electronics Co., Ltd. | Semiconductor device and method of fabricating the same |
| KR102330087B1 (ko) * | 2017-04-03 | 2021-11-22 | 삼성전자주식회사 | 반도체 장치 및 이의 제조 방법 |
| WO2018194293A1 (ko) * | 2017-04-19 | 2018-10-25 | 경북대학교산학협력단 | 반도체 소자 및 그 제조방법 |
| KR102414182B1 (ko) * | 2017-06-29 | 2022-06-28 | 삼성전자주식회사 | 반도체 소자 |
| US10276718B2 (en) * | 2017-08-31 | 2019-04-30 | Taiwan Semiconductor Manufacturing Co., Ltd. | FinFET having a relaxation prevention anchor |
| KR102532118B1 (ko) * | 2018-03-20 | 2023-05-11 | 삼성전자주식회사 | 반도체 장치 및 이의 제조 방법 |
| KR102402763B1 (ko) * | 2018-03-27 | 2022-05-26 | 삼성전자주식회사 | 반도체 장치 |
| KR20200018863A (ko) * | 2018-08-13 | 2020-02-21 | 삼성전자주식회사 | 반도체 장치 |
| CN111509048A (zh) * | 2020-04-28 | 2020-08-07 | 上海华力集成电路制造有限公司 | N型鳍式晶体管及其制造方法 |
| US20220052042A1 (en) * | 2020-08-13 | 2022-02-17 | Taiwan Semiconductor Manufacturing Co., Ltd. | Fin height and sti depth for performance improvement in semiconductor devices having high-mobility p-channel transistors |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20140252481A1 (en) * | 2013-03-11 | 2014-09-11 | Globalfoundries Inc. | Transistor including a gate electrode extending all around one or more channel regions |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2009032955A (ja) * | 2007-07-27 | 2009-02-12 | Toshiba Corp | 半導体装置、およびその製造方法 |
| US7939889B2 (en) * | 2007-10-16 | 2011-05-10 | Taiwan Semiconductor Manufacturing Company, Ltd. | Reducing resistance in source and drain regions of FinFETs |
| US9324866B2 (en) * | 2012-01-23 | 2016-04-26 | Taiwan Semiconductor Manufacturing Company, Ltd. | Structure and method for transistor with line end extension |
| US9166022B2 (en) * | 2010-10-18 | 2015-10-20 | Taiwan Semiconductor Manufacturing Company, Ltd. | Fin-like field effect transistor (FinFET) device and method of manufacturing same |
| US8618556B2 (en) * | 2011-06-30 | 2013-12-31 | Taiwan Semiconductor Manufacturing Company, Ltd. | FinFET design and method of fabricating same |
| KR101835655B1 (ko) * | 2012-03-06 | 2018-03-07 | 삼성전자주식회사 | 핀 전계 효과 트랜지스터 및 이의 제조 방법 |
-
2014
- 2014-08-07 KR KR1020140101756A patent/KR102236560B1/ko active IP Right Grant
-
2015
- 2015-03-26 TW TW104109653A patent/TWI621267B/zh active
- 2015-03-26 CN CN201510136837.3A patent/CN105047698B/zh active Active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20140252481A1 (en) * | 2013-03-11 | 2014-09-11 | Globalfoundries Inc. | Transistor including a gate electrode extending all around one or more channel regions |
Also Published As
| Publication number | Publication date |
|---|---|
| CN105047698A (zh) | 2015-11-11 |
| TW201543678A (zh) | 2015-11-16 |
| CN105047698B (zh) | 2020-09-22 |
| KR102236560B1 (ko) | 2021-04-06 |
| KR20150111807A (ko) | 2015-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10411129B2 (en) | Methods of fabricating semiconductor devices | |
| TWI621267B (zh) | 半導體裝置 | |
| US9972717B2 (en) | Semiconductor device and method of fabricating the same | |
| KR102343234B1 (ko) | 반도체 장치 및 이의 제조 방법 | |
| US10163913B2 (en) | Semiconductor device and method for fabricating the same | |
| KR102158963B1 (ko) | 반도체 장치 및 그 제조 방법 | |
| US9614068B2 (en) | Semiconductor device and method of fabricating the same | |
| US20140374827A1 (en) | Semiconductor device and method for fabricating the same | |
| KR102343209B1 (ko) | 반도체 장치 및 그 제조 방법 | |
| KR20170090092A (ko) | 반도체 장치 및 이의 제조 방법 | |
| KR102291062B1 (ko) | 반도체 장치 및 이의 제조 방법 | |
| CN106298776B (zh) | 半导体器件 | |
| KR102425152B1 (ko) | 반도체 장치 | |
| KR102340313B1 (ko) | 반도체 장치 및 그 제조 방법 | |
| KR102270920B1 (ko) | 반도체 장치 및 이의 제조 방법 | |
| KR102426834B1 (ko) | 반도체 장치 | |
| KR102214018B1 (ko) | 반도체 장치 | |
| KR20170009669A (ko) | 반도체 장치 및 이의 제조 방법 | |
| US10008493B2 (en) | Semiconductor device and method of fabricating the same | |
| KR20170000134A (ko) | 반도체 장치 및 이의 제조 방법 | |
| KR102393321B1 (ko) | 반도체 장치 및 이의 제조 방법 | |
| KR102443803B1 (ko) | 반도체 장치 및 그 제조 방법 | |
| KR102388364B1 (ko) | 반도체 장치 | |
| KR20160144287A (ko) | 반도체 장치 및 이의 제조 방법 |