SU604493A3 - Способ получени амидов лизергиновой кислоты или их солей - Google Patents
Способ получени амидов лизергиновой кислоты или их солейInfo
- Publication number
- SU604493A3 SU604493A3 SU762349104A SU2349104A SU604493A3 SU 604493 A3 SU604493 A3 SU 604493A3 SU 762349104 A SU762349104 A SU 762349104A SU 2349104 A SU2349104 A SU 2349104A SU 604493 A3 SU604493 A3 SU 604493A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acid
- carboxylic acid
- methyl
- medium
- amide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 23
- ZAGRKAFMISFKIO-UHFFFAOYSA-N Isolysergic acid Natural products C1=CC(C2=CC(CN(C2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-UHFFFAOYSA-N 0.000 title claims description 14
- ZAGRKAFMISFKIO-QMTHXVAHSA-N lysergic acid Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-QMTHXVAHSA-N 0.000 title claims description 12
- 150000003839 salts Chemical class 0.000 title claims description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 38
- 239000002253 acid Substances 0.000 claims description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 12
- -1 pentachlorophenyl esters Chemical class 0.000 claims description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 150000001540 azides Chemical class 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000003993 interaction Effects 0.000 claims description 2
- 150000007530 organic bases Chemical group 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 52
- 239000000243 solution Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 6
- 239000011976 maleic acid Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- ORBSYPFBZQJNJE-MPKXVKKWSA-N (6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC([C@H]2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-MPKXVKKWSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- REGFWZVTTFGQOJ-UHFFFAOYSA-N 4,5-dihydro-1,3-thiazol-2-amine Chemical compound NC1=NCCS1 REGFWZVTTFGQOJ-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000012264 purified product Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002689 maleic acids Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- XMIAFAKRAAMSGX-UHFFFAOYSA-N quinolin-5-amine Chemical compound C1=CC=C2C(N)=CC=CC2=N1 XMIAFAKRAAMSGX-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- YOZGACBWDKFAAD-MEBBXXQBSA-N (6ar,9r)-7,9-dimethyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C)C2)=C3C2=CNC3=C1 YOZGACBWDKFAAD-MEBBXXQBSA-N 0.000 description 1
- UUYMPWWTAQZUQB-QMTHXVAHSA-N (6ar,9r)-7-methyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline-9-carbohydrazide Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(=O)NN)=C3C2=CNC3=C1 UUYMPWWTAQZUQB-QMTHXVAHSA-N 0.000 description 1
- CIPFDHFTBYJKQB-UHFFFAOYSA-N 1,2,3,4,5-pentachloro-6-(2,3,4,5,6-pentachlorophenoxy)benzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CIPFDHFTBYJKQB-UHFFFAOYSA-N 0.000 description 1
- ZQEXBVHABAJPHJ-UHFFFAOYSA-N 2-fluoro-4-methylaniline Chemical compound CC1=CC=C(N)C(F)=C1 ZQEXBVHABAJPHJ-UHFFFAOYSA-N 0.000 description 1
- ZVNYYNAAEVZNDW-UHFFFAOYSA-N 2-phenylpyrazol-3-amine Chemical compound NC1=CC=NN1C1=CC=CC=C1 ZVNYYNAAEVZNDW-UHFFFAOYSA-N 0.000 description 1
- YYFLDZZDOUDZQM-UHFFFAOYSA-N 3-[1-[[4-(3-phenylquinolin-2-yl)phenyl]methyl]piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1C(CC1)CCN1CC(C=C1)=CC=C1C1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YYFLDZZDOUDZQM-UHFFFAOYSA-N 0.000 description 1
- MGRHBBRSAFPBIN-UHFFFAOYSA-N 3-fluoro-4-methylaniline Chemical compound CC1=CC=C(N)C=C1F MGRHBBRSAFPBIN-UHFFFAOYSA-N 0.000 description 1
- KCHLDNLIJVSRPK-UHFFFAOYSA-N 3-methylsulfanylaniline Chemical compound CSC1=CC=CC(N)=C1 KCHLDNLIJVSRPK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000000746 allylic group Chemical group 0.000 description 1
- 229950003476 aminothiazole Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001731 carboxylic acid azides Chemical class 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 1
- 238000013316 zoning Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
- C07D457/06—Lysergic acid amides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU75GO00001309A HU172649B (hu) | 1975-04-24 | 1975-04-24 | Sposob poluchenija novykh biologicheski aktivnykh lizergamidov |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU604493A3 true SU604493A3 (ru) | 1978-04-25 |
Family
ID=10996791
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762349104A SU604493A3 (ru) | 1975-04-24 | 1976-04-23 | Способ получени амидов лизергиновой кислоты или их солей |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4101552A (enExample) |
| JP (1) | JPS5940833B2 (enExample) |
| AT (1) | AT352297B (enExample) |
| AU (1) | AU503465B2 (enExample) |
| BE (1) | BE841049A (enExample) |
| BG (1) | BG33885A3 (enExample) |
| CA (1) | CA1081215A (enExample) |
| CH (1) | CH619708A5 (enExample) |
| CS (1) | CS194758B2 (enExample) |
| DD (1) | DD125487A5 (enExample) |
| DE (1) | DE2617738A1 (enExample) |
| DK (1) | DK144127C (enExample) |
| FR (1) | FR2308366A1 (enExample) |
| GB (1) | GB1512874A (enExample) |
| HU (1) | HU172649B (enExample) |
| IL (1) | IL49447A (enExample) |
| NL (1) | NL7604266A (enExample) |
| PL (1) | PL102509B1 (enExample) |
| SE (1) | SE425783B (enExample) |
| SU (1) | SU604493A3 (enExample) |
| YU (1) | YU42144B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2802023A1 (de) * | 1977-01-28 | 1978-08-03 | Sandoz Ag | Neue ergotderivate, ihre herstellung und verwendung |
| GB1584464A (en) * | 1977-04-19 | 1981-02-11 | Farmaceutici Italia | Ergot alkaloids |
| IT1192260B (it) * | 1977-07-05 | 1988-03-31 | Simes | Derivati di ergoline-2-tioeteri e loro solfossidi |
| FI76085C (fi) * | 1981-07-21 | 1988-09-09 | Erba Farmitalia | Foerfarande foer framstaellning av ergolinderivat. |
| CH653333A5 (de) * | 1981-11-04 | 1985-12-31 | Sandoz Ag | N-substituierte ergolin- und 9,10-didehydroergolinderivate, ihre herstellung und sie enthaltende arzneimittel. |
| YU254782A (en) * | 1981-12-18 | 1986-10-31 | Schering Ag | Process for making new ergot anilides |
| DE91652T1 (de) * | 1982-04-13 | 1984-03-29 | Farmitalia Carlo Erba S.p.A., 20159 Milano | Ergolinderivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zusammensetzungen. |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| US4910206A (en) * | 1986-07-14 | 1990-03-20 | Sandoz Pharmaceuticals Corp. | 5-hetero-or aryl-substituted-imidazo(2,1-a)isoquinolines and their use as PAF receptor antagonists |
| US4902691A (en) * | 1988-12-19 | 1990-02-20 | Eli Lilly And Company | Heteroalkylamides of (8-β)-1-alkyl-6-(substituted)ergolines useful for blocking 5HT2 receptors |
| CA2974117A1 (en) | 2015-01-20 | 2016-07-28 | Xoc Pharmaceuticals, Inc. | Ergoline compounds and uses thereof |
| BR112019025420A2 (pt) | 2017-06-01 | 2020-06-16 | Xoc Pharmaceuticals, Inc. | Compostos policíclicos e usos destes |
| FI4279070T3 (fi) | 2020-06-12 | 2025-01-02 | Beckley Psytech Ltd | Koostumus sisältäen 5-metoksi-N,N-dimetyylitryotamini-bentsoaattisuolaa |
| EP4126857A1 (en) | 2021-01-15 | 2023-02-08 | Beckley Psytech Limited | Ergoline analogues |
| GB202212116D0 (en) | 2022-08-19 | 2022-10-05 | Beckley Psytech Ltd | Pharmaceutically acceptable salts and Compositions thereof |
| US12264131B2 (en) | 2022-08-19 | 2025-04-01 | Beckley Psytech Limited | Pharmaceutically acceptable salts and compositions thereof |
| US12246005B2 (en) | 2023-06-13 | 2025-03-11 | Beckley Psytech Limited | 5-methoxy-n,n-dimethyltryptamine (5-MeO-DMT) formulations |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2090430A (en) * | 1937-08-17 | Lysergic acid amides and process for | ||
| US2736728A (en) * | 1954-12-06 | 1956-02-28 | Lilly Co Eli | Preparation of lysergic acid amides |
| DE1040560B (de) * | 1955-11-21 | 1958-10-09 | Lilly Co Eli | Verfahren zur Herstellung von Lysergsaeureamiden |
| US2997470A (en) * | 1956-03-05 | 1961-08-22 | Lilly Co Eli | Lysergic acid amides |
| GB1112909A (en) * | 1964-09-15 | 1968-05-08 | Sandoz Ltd | Ergoline derivatives |
| CH496010A (de) * | 1967-04-20 | 1970-09-15 | Richter Gedeon Vegyeszet | Verfahren zur Herstellung von d-Lysergsäureamiden |
| SE396753B (sv) * | 1970-05-18 | 1977-10-03 | Richter Gedeon Vegyeszet | Analogiforfarande for framstellning av en forening tillhorande dihydrolysergsyraserien |
| IL41409A (en) * | 1972-02-04 | 1977-04-29 | Richter Gedeon Vegyeszet | Lysergic acid amides and process for their preparation |
| HU169073B (enExample) * | 1974-05-28 | 1976-09-28 |
-
1975
- 1975-04-24 HU HU75GO00001309A patent/HU172649B/hu not_active IP Right Cessation
-
1976
- 1976-04-20 IL IL49447A patent/IL49447A/xx unknown
- 1976-04-20 CH CH491176A patent/CH619708A5/de not_active IP Right Cessation
- 1976-04-20 AT AT286376A patent/AT352297B/de not_active IP Right Cessation
- 1976-04-22 NL NL7604266A patent/NL7604266A/xx not_active Application Discontinuation
- 1976-04-23 DD DD192492A patent/DD125487A5/xx unknown
- 1976-04-23 US US05/679,866 patent/US4101552A/en not_active Expired - Lifetime
- 1976-04-23 FR FR7612014A patent/FR2308366A1/fr active Granted
- 1976-04-23 YU YU1031/76A patent/YU42144B/xx unknown
- 1976-04-23 CS CS762697A patent/CS194758B2/cs unknown
- 1976-04-23 BE BE166395A patent/BE841049A/xx not_active IP Right Cessation
- 1976-04-23 SE SE7604724A patent/SE425783B/xx not_active IP Right Cessation
- 1976-04-23 BG BG033012A patent/BG33885A3/xx unknown
- 1976-04-23 SU SU762349104A patent/SU604493A3/ru active
- 1976-04-23 DK DK184176A patent/DK144127C/da not_active IP Right Cessation
- 1976-04-23 AU AU13283/76A patent/AU503465B2/en not_active Expired
- 1976-04-23 PL PL1976189001A patent/PL102509B1/pl unknown
- 1976-04-23 GB GB16533/76A patent/GB1512874A/en not_active Expired
- 1976-04-23 DE DE19762617738 patent/DE2617738A1/de active Granted
- 1976-04-23 CA CA250,887A patent/CA1081215A/en not_active Expired
- 1976-04-24 JP JP51046135A patent/JPS5940833B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5940833B2 (ja) | 1984-10-03 |
| ATA286376A (de) | 1979-02-15 |
| YU42144B (en) | 1988-06-30 |
| DK144127C (da) | 1982-06-01 |
| YU103176A (en) | 1982-08-31 |
| JPS51131898A (en) | 1976-11-16 |
| CA1081215A (en) | 1980-07-08 |
| DD125487A5 (enExample) | 1977-04-20 |
| BE841049A (fr) | 1976-10-25 |
| NL7604266A (nl) | 1976-10-26 |
| GB1512874A (en) | 1978-06-01 |
| BG33885A3 (en) | 1983-05-16 |
| SE7604724L (sv) | 1976-10-25 |
| AT352297B (de) | 1979-09-10 |
| HU172649B (hu) | 1978-11-28 |
| DK184176A (da) | 1976-10-25 |
| AU1328376A (en) | 1977-10-27 |
| CS194758B2 (en) | 1979-12-31 |
| FR2308366A1 (fr) | 1976-11-19 |
| DE2617738A1 (de) | 1976-11-18 |
| DE2617738C2 (enExample) | 1989-10-19 |
| US4101552A (en) | 1978-07-18 |
| CH619708A5 (enExample) | 1980-10-15 |
| AU503465B2 (en) | 1979-09-06 |
| PL102509B1 (pl) | 1979-04-30 |
| IL49447A (en) | 1979-11-30 |
| SE425783B (sv) | 1982-11-08 |
| DK144127B (da) | 1981-12-14 |
| IL49447A0 (en) | 1976-06-30 |
| FR2308366B1 (enExample) | 1978-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU604493A3 (ru) | Способ получени амидов лизергиновой кислоты или их солей | |
| DE2760156C2 (enExample) | ||
| EP0328000B1 (de) | Indolocarbazol-Derivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| SU965356A3 (ru) | Способ получени производных /эрголинил/-N,N-диэтилмочевины или их солей | |
| SU625612A3 (ru) | Способ получени эрголиновых соединений или их солей | |
| SU698532A3 (ru) | Способ получени производных пиридо (1,2-а) пиримидина | |
| AU597136B2 (en) | Method for preparing crystalline cefadroxil monohydrate | |
| US4003896A (en) | Method of preparing a sparingly soluble complex of cephalexin | |
| SU542474A3 (ru) | Способ получени производных 7-амино-3-цефем-3 -4-карбоновой кислоты или их солей | |
| SU847923A3 (ru) | Способ получени 7 -/ -2-амино- 2-(Низший АлКилСульфОНилАМиНОфЕНил)- АцЕТилАМиНО/-3МЕТОКСи-3-цЕфЕМ-4- КАРбОНОВыХ КиСлОТ или иХ СОлЕй | |
| FR2496666A1 (fr) | Nouveaux derives de cephalosporine et composition pharmaceutique les contenant | |
| US4077969A (en) | Process for preparing azetidinone thiazolidine derivatives | |
| US3284451A (en) | Activated esters of 7-amino-cephalosporanic acid | |
| US4087438A (en) | Thieno[3,4-d]furoxan and process for its preparation | |
| SI9520145A (sl) | Diklavulanatne soli z diamino etrom in postopek priprave | |
| SU1757471A3 (ru) | Способ получени производных L-аланил-L-пролина или их фармацевтически приемлемых солей | |
| US4075219A (en) | Epimerization process | |
| KR830001969B1 (ko) | 6―{D―(―) α-(4―에틸-2. 3-디옥소-1 피페라지노카보닐아미노) 페닐(또는 하이드록시페닐)아세트아미도 페니실란산 및 그 염의 제조방법 | |
| KR840000079B1 (ko) | 6-β-치환된 페니실란산 유도체의 제조방법 | |
| SU999975A3 (ru) | Способ получени 6-амино-спиро [пенам-2,4-пиперидин]-3-карбоновых кислот или их сложных бензиловых эфиров | |
| JPH069642A (ja) | 4−デソキシ−4−エピポドフィロトキシン誘導体及びその塩 | |
| KR100402595B1 (ko) | 페니실린 g 페닐에스테르의 개량 제조 방법 | |
| SU721004A3 (ru) | Способ получени дегидропенициллинов | |
| SU471711A3 (ru) | Способ получени производных -аминоакриловой кислоты | |
| US4284557A (en) | Intermediate racemates for the preparation of biotin and a process for their preparation |