SU582767A3 - Способ получени тиофенсахаринов или их солей - Google Patents
Способ получени тиофенсахаринов или их солейInfo
- Publication number
- SU582767A3 SU582767A3 SU7502170855A SU2170855A SU582767A3 SU 582767 A3 SU582767 A3 SU 582767A3 SU 7502170855 A SU7502170855 A SU 7502170855A SU 2170855 A SU2170855 A SU 2170855A SU 582767 A3 SU582767 A3 SU 582767A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- solution
- water
- carboxylic acid
- chloride
- yield
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title description 6
- 238000000034 method Methods 0.000 title description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 54
- 239000000243 solution Substances 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 239000013078 crystal Substances 0.000 description 27
- 239000000047 product Substances 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- 235000011121 sodium hydroxide Nutrition 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl chloride Substances ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 150000004702 methyl esters Chemical class 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 7
- DLBPTOMGZXBZOX-UHFFFAOYSA-N 1,2-thiazole 1,1-dioxide Chemical compound O=S1(=O)C=CC=N1 DLBPTOMGZXBZOX-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 239000001103 potassium chloride Substances 0.000 description 5
- 235000011164 potassium chloride Nutrition 0.000 description 5
- YXNDIUKTRLHPOM-UHFFFAOYSA-N 3-sulfothiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1S(O)(=O)=O YXNDIUKTRLHPOM-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 4
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- PJKPZNOIFGAUSR-UHFFFAOYSA-N 3-(tert-butylsulfamoyl)thiophene-2-carboxylic acid Chemical compound CC(C)(C)NS(=O)(=O)C=1C=CSC=1C(O)=O PJKPZNOIFGAUSR-UHFFFAOYSA-N 0.000 description 3
- NRAVSUNXRBRPRE-UHFFFAOYSA-N 3-sulfamoylthiophene-2-carboxylic acid Chemical compound NS(=O)(=O)C=1C=CSC=1C(O)=O NRAVSUNXRBRPRE-UHFFFAOYSA-N 0.000 description 3
- BSLGMUKWYRKFDT-UHFFFAOYSA-N 4-sulfothiophene-3-carboxylic acid Chemical compound OC(=O)C1=CSC=C1S(O)(=O)=O BSLGMUKWYRKFDT-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 239000003929 acidic solution Substances 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000005342 ion exchange Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229920000137 polyphosphoric acid Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- FBUUZRITKBLZJX-UHFFFAOYSA-N 2,5-dichlorothiophene-3-carboxylic acid Chemical compound OC(=O)C=1C=C(Cl)SC=1Cl FBUUZRITKBLZJX-UHFFFAOYSA-N 0.000 description 2
- BXEAAHIHFFIMIE-UHFFFAOYSA-N 3-chlorothiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1Cl BXEAAHIHFFIMIE-UHFFFAOYSA-N 0.000 description 2
- VAHHPJSRCPYDLP-UHFFFAOYSA-N 4-sulfamoylthiophene-3-carboxylic acid Chemical compound NS(=O)(=O)C1=CSC=C1C(O)=O VAHHPJSRCPYDLP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- PMXNPOJHBQDJKS-UHFFFAOYSA-N methyl 3-sulfamoylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1S(N)(=O)=O PMXNPOJHBQDJKS-UHFFFAOYSA-N 0.000 description 2
- SCLQJMNDSAYRKW-UHFFFAOYSA-N n-tert-butylthiophene-3-sulfonamide Chemical compound CC(C)(C)NS(=O)(=O)C=1C=CSC=1 SCLQJMNDSAYRKW-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- JJIBEXZGSXIQBV-UHFFFAOYSA-N 1,1-dioxo-1,2-thiazol-3-one Chemical compound O=C1NS(=O)(=O)C=C1 JJIBEXZGSXIQBV-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- AYKJLZKNHNYZON-UHFFFAOYSA-N 2-methoxycarbonylthiophene-3-sulfonic acid Chemical compound COC(=O)C=1SC=CC=1S(O)(=O)=O AYKJLZKNHNYZON-UHFFFAOYSA-N 0.000 description 1
- LIFXVYYBEWUQDC-UHFFFAOYSA-N 4-chlorosulfonylthiophene-3-carbonyl chloride Chemical compound ClC(=O)C1=CSC=C1S(Cl)(=O)=O LIFXVYYBEWUQDC-UHFFFAOYSA-N 0.000 description 1
- XINKHPPAHJZEQZ-UHFFFAOYSA-N 4-chlorothiophene-3-carbonyl chloride Chemical compound ClC(=O)C1=CSC=C1Cl XINKHPPAHJZEQZ-UHFFFAOYSA-N 0.000 description 1
- QPYFNTQGFUWDDP-UHFFFAOYSA-N 4-chlorothiophene-3-carboxylic acid Chemical compound OC(=O)C1=CSC=C1Cl QPYFNTQGFUWDDP-UHFFFAOYSA-N 0.000 description 1
- ACBUQOCRIKFKLJ-UHFFFAOYSA-N 4-methoxycarbonylthiophene-3-sulfonic acid Chemical compound COC(=O)C1=CSC=C1S(O)(=O)=O ACBUQOCRIKFKLJ-UHFFFAOYSA-N 0.000 description 1
- YJAHARGVJDVKKK-UHFFFAOYSA-N 4-methyl-3-sulfamoylthiophene-2-carboxylic acid Chemical compound CC1=CSC(C(O)=O)=C1S(N)(=O)=O YJAHARGVJDVKKK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- LHDMHXAYDGJKNQ-UHFFFAOYSA-N CC=1C(=C(SC1)S(N)(=O)=O)C(=O)O Chemical compound CC=1C(=C(SC1)S(N)(=O)=O)C(=O)O LHDMHXAYDGJKNQ-UHFFFAOYSA-N 0.000 description 1
- NZPCVSVQESFXQI-UHFFFAOYSA-N CC=1SC=C(C1C(=O)O)S(N)(=O)=O Chemical compound CC=1SC=C(C1C(=O)O)S(N)(=O)=O NZPCVSVQESFXQI-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical class [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- KTTVPSDMWONLSY-UHFFFAOYSA-N Cc1scc(c1C(O)=O)S(Cl)(=O)=O Chemical compound Cc1scc(c1C(O)=O)S(Cl)(=O)=O KTTVPSDMWONLSY-UHFFFAOYSA-N 0.000 description 1
- -1 Chloride 3-chlorosulfonylthiophene-2-carboxylic acid Chemical compound 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- YOBAEOGBNPPUQV-UHFFFAOYSA-N iron;trihydrate Chemical compound O.O.O.[Fe].[Fe] YOBAEOGBNPPUQV-UHFFFAOYSA-N 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- MGIYRDNGCNKGJU-UHFFFAOYSA-N isothiazolinone Chemical compound O=C1C=CSN1 MGIYRDNGCNKGJU-UHFFFAOYSA-N 0.000 description 1
- PJVJBDAUWILEOG-UHFFFAOYSA-N methyl 3-chlorosulfonylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1S(Cl)(=O)=O PJVJBDAUWILEOG-UHFFFAOYSA-N 0.000 description 1
- SEMVRXMFCHXUMD-UHFFFAOYSA-N methyl 3-hydroxythiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1O SEMVRXMFCHXUMD-UHFFFAOYSA-N 0.000 description 1
- MRFIBCNQYJJOPN-UHFFFAOYSA-N methyl 4-chlorosulfonylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC=C1S(Cl)(=O)=O MRFIBCNQYJJOPN-UHFFFAOYSA-N 0.000 description 1
- BMRZKWAGTSKCLW-UHFFFAOYSA-N methyl 4-sulfamoylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC=C1S(N)(=O)=O BMRZKWAGTSKCLW-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical class ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- JJRZKVCZMUZTTI-UHFFFAOYSA-M potassium;5-chloro-2-sulfothiophene-3-carboxylate Chemical compound [K+].OS(=O)(=O)C=1SC(Cl)=CC=1C([O-])=O JJRZKVCZMUZTTI-UHFFFAOYSA-M 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- VSAISIQCTGDGPU-UHFFFAOYSA-N tetraphosphorus hexaoxide Chemical compound O1P(O2)OP3OP1OP2O3 VSAISIQCTGDGPU-UHFFFAOYSA-N 0.000 description 1
- YSPWSQNKRBSICH-UHFFFAOYSA-N thiophene-3-sulfonyl chloride Chemical compound ClS(=O)(=O)C=1C=CSC=1 YSPWSQNKRBSICH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23L—FOODS, FOODSTUFFS OR NON-ALCOHOLIC BEVERAGES, NOT OTHERWISE PROVIDED FOR; PREPARATION OR TREATMENT THEREOF
- A23L27/00—Spices; Flavouring agents or condiments; Artificial sweetening agents; Table salts; Dietetic salt substitutes; Preparation or treatment thereof
- A23L27/30—Artificial sweetening agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Food Science & Technology (AREA)
- Health & Medical Sciences (AREA)
- Polymers & Plastics (AREA)
- Nutrition Science (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
- Fodder In General (AREA)
- Seasonings (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT744874A AT334366B (de) | 1974-09-16 | 1974-09-16 | Verfahren zur herstellung des neuen 2,3-dihydro-3-oxo-thieno(2,3-d)isothiazol-1,1-dioxids und seiner salze |
| AT744974A AT334367B (de) | 1974-09-16 | 1974-09-16 | Verfahren zur herstellung des neuen 2,3-dihydro-3-oxo-thieno(3,4-d)isothiazol-1,1-dioxids und seiner salze |
| AT745074A AT334368B (de) | 1974-09-16 | 1974-09-16 | Verfahren zur herstellung des neuen 2,3-dihydro-3-oxo-thieno(3,2-d)isothiazol-1,1-dioxids und seiner salze |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU582767A3 true SU582767A3 (ru) | 1977-11-30 |
Family
ID=27150828
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7502170855A SU582767A3 (ru) | 1974-09-16 | 1975-09-12 | Способ получени тиофенсахаринов или их солей |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4028373A (enExample) |
| JP (1) | JPS5156491A (enExample) |
| AU (1) | AU502558B2 (enExample) |
| CA (1) | CA1062262A (enExample) |
| CH (1) | CH616427A5 (enExample) |
| CS (1) | CS184788B2 (enExample) |
| DD (1) | DD122543A5 (enExample) |
| DE (1) | DE2534689B2 (enExample) |
| DK (1) | DK411275A (enExample) |
| ES (1) | ES440990A1 (enExample) |
| FR (1) | FR2284323A1 (enExample) |
| GB (1) | GB1511340A (enExample) |
| HU (1) | HU172609B (enExample) |
| IL (1) | IL48009A (enExample) |
| NL (1) | NL7510886A (enExample) |
| SE (1) | SE424443B (enExample) |
| SU (1) | SU582767A3 (enExample) |
| TR (1) | TR18417A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU512465B2 (en) * | 1977-01-05 | 1980-10-09 | Basf Aktiengesellschaft | Manufacture of 3-halosulfonylthiophene-carboxylic acid derivatives |
| LU78009A1 (de) | 1977-08-22 | 1979-05-23 | Hoffmann La Roche | Verfahren zur herstellung von thiazinderivaten |
| AT364852B (de) | 1977-11-05 | 1981-11-25 | Thomae Gmbh Dr K | Verfahren zur herstellung von kondensierten isothiazol-3(2h)-on-1,1-dioxiden und von deren salzen |
| DK169255B1 (da) * | 1983-02-22 | 1994-09-26 | American Home Prod | Analogifremgangsmåde til fremstilling af thieno-isothiazol-1,1-dioxid-derivater og farmaceutisk acceptable salte heraf |
| US4587345A (en) * | 1984-09-28 | 1986-05-06 | American Home Products Corporation | Process for preparing thieno-fused heterocyclic anti-ulcer agents |
| CA1257262A (en) * | 1985-05-20 | 1989-07-11 | George Levitt | Herbicidal thiophenesulfonamides |
| FI862513A7 (fi) * | 1985-07-04 | 1987-01-05 | Chemie Linz Ag | Uudet tieno-1,2-tiatsolijohdokset, menetelmä niiden valmistamiseksi ja näitä sisältävät farmaseuttiset tuotteet. |
| US4974609A (en) * | 1986-08-18 | 1990-12-04 | Philip Morris Incorporated | Tobacco flavorants |
| ATA39088A (de) | 1988-02-18 | 1990-06-15 | Binder Dieter Dr | Basisch substituierte thienoisothiazol-3(2h)-on-1,1-dioxide und ihre pharmazeutisch vertraeglichen salze, verfahren zu ihrer herstellung und ihre verwendung |
| AT390060B (de) * | 1988-05-02 | 1990-03-12 | Cl Pharma | Verfahren zur herstellung von 5-chlor-3chlorsulfonyl-2-thiophencarbonsaeureestern |
| EP0558445A1 (de) * | 1992-02-20 | 1993-09-01 | Ciba-Geigy Ag | Sulfonylharnstoffe als Herbizide |
| DE60138903D1 (de) | 2000-11-03 | 2009-07-16 | Dow Agrosciences Llc | N-(1,2,4-triazoloazinyl)thiophensulfonamid-verbindungen als herbizide |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3050553A (en) * | 1958-11-14 | 1962-08-21 | Merck & Co Inc | Disulfamylbenzoic acids |
-
1975
- 1975-08-02 DE DE752534689A patent/DE2534689B2/de active Granted
- 1975-08-28 IL IL48009A patent/IL48009A/xx unknown
- 1975-08-29 AU AU84402/75A patent/AU502558B2/en not_active Expired
- 1975-09-02 US US05/609,623 patent/US4028373A/en not_active Expired - Lifetime
- 1975-09-02 CS CS7500005959A patent/CS184788B2/cs unknown
- 1975-09-08 CA CA235,363A patent/CA1062262A/en not_active Expired
- 1975-09-12 SU SU7502170855A patent/SU582767A3/ru active
- 1975-09-12 DD DD188311A patent/DD122543A5/xx unknown
- 1975-09-15 DK DK411275A patent/DK411275A/da not_active Application Discontinuation
- 1975-09-15 SE SE7510274A patent/SE424443B/xx unknown
- 1975-09-15 CH CH1191575A patent/CH616427A5/de not_active IP Right Cessation
- 1975-09-15 HU HU75BA00003314A patent/HU172609B/hu unknown
- 1975-09-15 GB GB37736/75A patent/GB1511340A/en not_active Expired
- 1975-09-16 ES ES440990A patent/ES440990A1/es not_active Expired
- 1975-09-16 JP JP50111026A patent/JPS5156491A/ja active Pending
- 1975-09-16 TR TR18417A patent/TR18417A/xx unknown
- 1975-09-16 NL NL7510886A patent/NL7510886A/xx not_active Application Discontinuation
- 1975-09-16 FR FR7528343A patent/FR2284323A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU8440275A (en) | 1977-03-03 |
| GB1511340A (en) | 1978-05-17 |
| SE424443B (sv) | 1982-07-19 |
| AU502558B2 (en) | 1979-08-02 |
| IL48009A0 (en) | 1975-11-25 |
| DE2534689C3 (enExample) | 1979-10-18 |
| FR2284323B1 (enExample) | 1980-04-18 |
| DE2534689A1 (de) | 1976-03-25 |
| CS184788B2 (en) | 1978-09-15 |
| DK411275A (da) | 1976-03-17 |
| DD122543A5 (enExample) | 1976-10-12 |
| SE7510274L (sv) | 1976-03-17 |
| FR2284323A1 (fr) | 1976-04-09 |
| ES440990A1 (es) | 1977-06-16 |
| HU172609B (hu) | 1978-11-28 |
| JPS5156491A (enExample) | 1976-05-18 |
| CA1062262A (en) | 1979-09-11 |
| IL48009A (en) | 1978-06-15 |
| NL7510886A (nl) | 1976-03-18 |
| TR18417A (tr) | 1977-01-28 |
| CH616427A5 (enExample) | 1980-03-31 |
| DE2534689B2 (de) | 1979-03-01 |
| US4028373A (en) | 1977-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU582767A3 (ru) | Способ получени тиофенсахаринов или их солей | |
| US4329479A (en) | Process for producing 1,3-dithiol-2-ylidene malonic acid dialkyl esters | |
| SU603338A3 (ru) | Способ получени производных тиенотиазина | |
| EP0053021B1 (en) | Process for 5-aroylation of 1,2-dihydro-3h-pyrrolo(1,2-a)pyrrole-1-carboxylic esters and nitriles | |
| US2772281A (en) | Synthesis of 4-amino-3-isoxazolidone and its derivatives | |
| US4144397A (en) | Preparation of 2-aryl-propionic acids by direct coupling utilizing a mixed magnesium halide complex | |
| Kipnis et al. | 2-Acyloxyacetylthiophenes | |
| US3560525A (en) | 5-phenyl-2-furanacetic acids,5-phenyl-2-thiopheneacetic acids,and their derivatives | |
| JPS5973579A (ja) | ベンゾフラン又はベンゾチオフェン誘導体,この化合物を有効成分とする尿酸排泄剤及びその製造方法 | |
| JPS5916871A (ja) | スルホンアミド系ベンズアミド類 | |
| US3007927A (en) | Triazine derivatives | |
| US2840565A (en) | Optical isomers of 4-amino-3-isoxazolidone | |
| Mannekens et al. | Efficient synthesis of 1-benzyloxyphenyl-3-phenylacetones | |
| SU596168A3 (ru) | Способ получени пропионовых кислот или их эфиров или их солей | |
| EP0062119B1 (en) | Process of producing 1,3-dithiol-2-ylidene malonic acid dialkyl esters | |
| SU427017A1 (ru) | Способ получения тиадиазолилтиокарбонатов | |
| SU400103A1 (ru) | Способ получения производных 3-карбокси-1-тиа-изохроман-1,1-диоксидов | |
| SU892876A1 (ru) | @ -Эфиры @ -оксотиогидроксимовых кислот,в качестве антидотов фосфорорганических соединений | |
| Purrington et al. | The Structure of Secondary Amine—Sulfur Dioxide Salts | |
| SU123531A1 (ru) | Способ получени 6-метоксиндола | |
| KR790001825B1 (ko) | 스틸벤 유도체의 제조법 | |
| SU1426970A1 (ru) | Амиды о- пропенилбензойных кислот в качестве промежуточных продуктов в синтезе 3- этилфталимидинов | |
| SU444364A1 (ru) | Способ получени производных 4-аминохинолина | |
| SU374815A1 (ru) | Способ получения феноксиэтиламинов | |
| US2502427A (en) | 3-acyl amino-4-carboalkoxyamino thiophenes |