SU511316A1 - Способ получени производных уреидофеноксиалканоламина - Google Patents
Способ получени производных уреидофеноксиалканоламинаInfo
- Publication number
- SU511316A1 SU511316A1 SU1908721A SU1908721A SU511316A1 SU 511316 A1 SU511316 A1 SU 511316A1 SU 1908721 A SU1908721 A SU 1908721A SU 1908721 A SU1908721 A SU 1908721A SU 511316 A1 SU511316 A1 SU 511316A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- alkyl
- phenoxy
- hydrolysis
- cleaved
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 8
- -1 ureidophenoxy Chemical group 0.000 title description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000006239 protecting group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 238000005984 hydrogenation reaction Methods 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical class [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 229910052763 palladium Inorganic materials 0.000 claims description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 claims 1
- 150000001728 carbonyl compounds Chemical class 0.000 claims 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims 1
- 239000012467 final product Substances 0.000 claims 1
- 230000036571 hydration Effects 0.000 claims 1
- 238000006703 hydration reaction Methods 0.000 claims 1
- 229910052697 platinum Inorganic materials 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 10
- 239000003085 diluting agent Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- VLSTXUUYLIALPB-UHFFFAOYSA-N n-propan-2-ylpropan-1-amine Chemical compound CCCNC(C)C VLSTXUUYLIALPB-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- PBXOIGMNAGFCHA-UHFFFAOYSA-N 1-[4-(3-amino-2-hydroxypropoxy)phenyl]-3-cyclohexylurea hydrochloride Chemical compound Cl.C1(CCCCC1)NC(NC1=CC=C(OCC(CN)O)C=C1)=O PBXOIGMNAGFCHA-UHFFFAOYSA-N 0.000 description 1
- ONXLHKFGTDDVLQ-UHFFFAOYSA-N 1-phenoxy-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=CC=C1 ONXLHKFGTDDVLQ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000003452 oxalyl group Chemical group *C(=O)C(*)=O 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD15123670 | 1970-11-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU511316A1 true SU511316A1 (ru) | 1976-04-25 |
Family
ID=5483145
Family Applications (7)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1908721A SU511316A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU1908717A SU510470A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU7101908715A SU580207A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU1908723A SU496268A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных урейдофеноксиалканоламина |
| SU1714257A SU521262A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU7301908722A SU578304A1 (ru) | 1970-11-13 | 1973-04-13 | Способ получени производных уреидофеноксиалканоламина |
| SU1908719A SU504758A1 (ru) | 1970-11-13 | 1973-04-13 | Способ получени производных уреидофеноксиалканоламина |
Family Applications After (6)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1908717A SU510470A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU7101908715A SU580207A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU1908723A SU496268A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных урейдофеноксиалканоламина |
| SU1714257A SU521262A1 (ru) | 1970-11-13 | 1971-11-12 | Способ получени производных уреидофеноксиалканоламина |
| SU7301908722A SU578304A1 (ru) | 1970-11-13 | 1973-04-13 | Способ получени производных уреидофеноксиалканоламина |
| SU1908719A SU504758A1 (ru) | 1970-11-13 | 1973-04-13 | Способ получени производных уреидофеноксиалканоламина |
Country Status (13)
| Country | Link |
|---|---|
| BG (7) | BG18958A1 (enExample) |
| CH (1) | CH565750A5 (enExample) |
| CS (7) | CS177496B1 (enExample) |
| DE (1) | DE2153024C3 (enExample) |
| DK (1) | DK136712C (enExample) |
| FI (1) | FI56374C (enExample) |
| FR (1) | FR2113982A1 (enExample) |
| HU (1) | HU172438B (enExample) |
| PL (7) | PL95648B1 (enExample) |
| RO (7) | RO64022A (enExample) |
| SE (1) | SE373838B (enExample) |
| SU (7) | SU511316A1 (enExample) |
| YU (4) | YU36491B (enExample) |
-
1971
- 1971-10-25 DE DE19712153024 patent/DE2153024C3/de not_active Expired
- 1971-10-27 CH CH1564971A patent/CH565750A5/xx not_active IP Right Cessation
- 1971-11-06 BG BG2093971A patent/BG18958A1/xx unknown
- 1971-11-06 BG BG2093871A patent/BG18957A1/xx unknown
- 1971-11-06 BG BG2093471A patent/BG18955A1/xx unknown
- 1971-11-06 BG BG2093571A patent/BG20898A1/xx unknown
- 1971-11-06 BG BG2093771A patent/BG18956A1/xx unknown
- 1971-11-06 BG BG2093671A patent/BG19907A1/xx unknown
- 1971-11-06 BG BG1894571A patent/BG20897A1/xx unknown
- 1971-11-09 RO RO7486571A patent/RO64022A/ro unknown
- 1971-11-09 RO RO7521871A patent/RO62905A/ro unknown
- 1971-11-09 RO RO6869271A patent/RO62250A/ro unknown
- 1971-11-09 RO RO7521971A patent/RO62906A/ro unknown
- 1971-11-09 RO RO7487271A patent/RO64200A/ro unknown
- 1971-11-09 RO RO7522171A patent/RO62907A/ro unknown
- 1971-11-09 RO RO7522071A patent/RO63448A/ro unknown
- 1971-11-10 CS CS801174A patent/CS177496B1/cs unknown
- 1971-11-10 CS CS801071A patent/CS177495B1/cs unknown
- 1971-11-10 CS CS801374A patent/CS183020B1/cs unknown
- 1971-11-10 CS CS801471A patent/CS177498B1/cs unknown
- 1971-11-10 CS CS801574A patent/CS177499B1/cs unknown
- 1971-11-10 CS CS801274A patent/CS177497B1/cs unknown
- 1971-11-10 CS CS787871A patent/CS177451B1/cs unknown
- 1971-11-11 PL PL17846571A patent/PL95648B1/pl unknown
- 1971-11-11 HU HU71AE00000345A patent/HU172438B/hu unknown
- 1971-11-11 YU YU283671A patent/YU36491B/xx unknown
- 1971-11-11 PL PL17846671A patent/PL94028B1/pl unknown
- 1971-11-11 PL PL17846971A patent/PL95743B1/pl unknown
- 1971-11-11 PL PL17846771A patent/PL94027B1/pl unknown
- 1971-11-11 DK DK551371A patent/DK136712C/da not_active IP Right Cessation
- 1971-11-11 PL PL17846871A patent/PL94076B1/pl unknown
- 1971-11-11 PL PL17847071A patent/PL95744B1/pl unknown
- 1971-11-11 PL PL15149071A patent/PL89374B1/pl unknown
- 1971-11-12 SE SE1455471A patent/SE373838B/xx unknown
- 1971-11-12 SU SU1908721A patent/SU511316A1/ru active
- 1971-11-12 SU SU1908717A patent/SU510470A1/ru active
- 1971-11-12 SU SU7101908715A patent/SU580207A1/ru active
- 1971-11-12 SU SU1908723A patent/SU496268A1/ru active
- 1971-11-12 SU SU1714257A patent/SU521262A1/ru active
- 1971-11-15 FI FI325671A patent/FI56374C/fi active
- 1971-11-15 FR FR7140829A patent/FR2113982A1/fr active Granted
-
1973
- 1973-04-13 SU SU7301908722A patent/SU578304A1/ru active
- 1973-04-13 SU SU1908719A patent/SU504758A1/ru active
-
1979
- 1979-02-20 YU YU41079A patent/YU41079A/xx unknown
- 1979-03-08 YU YU56479A patent/YU56479A/xx unknown
- 1979-03-15 YU YU62579A patent/YU62579A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3152173A (en) | Basically substituted diphenyl-methane derivatives and process for preparing them | |
| Henry et al. | 1, 3-and 1, 4-Dialkyl-5-iminotetrazoles | |
| DE3688937T2 (de) | Herstellung optisch aktiver aryloxypropanolamine und arylaethanolamine. | |
| US4824953A (en) | Multi-step process for producing 5-hydroxy-N-(6-oxo-piperidyl-methyl)-2-(2,2,2-trifluoro-ethoxy)-benzamide and derivatives | |
| SU511316A1 (ru) | Способ получени производных уреидофеноксиалканоламина | |
| US2852526A (en) | Substituted pyrrolidines | |
| US4435417A (en) | Antiinflammatory 3H-naphtho[1,2-d]imidazoles | |
| NO117866B (enExample) | ||
| US2557041A (en) | Synthesis of tryptophane | |
| US3116330A (en) | Nu-aminophenylethyl-2, 2-diphenyl-alkylamines | |
| US3168558A (en) | Ornithine synthesis | |
| SU586835A3 (ru) | Способ получени производных аминопропанола или их солей, рацематов или оптически-активных антиподов | |
| CA1039306A (en) | Preparation of optically active allethrolone via allethronyl acid phthalate | |
| CA1037494A (en) | Process for the preparation of n-(diethylaminoethyl)-2-methoxy-5-methylsulfonyl benzamide | |
| US4555573A (en) | Certain 6-benzamidomethyl-2(1H)-pyridone derivatives | |
| DE2409313A1 (de) | Neue pyrrolyl-verbindungen und verfahren zu ihrer herstellung | |
| Burger et al. | Syntheses in the 5, 8-Dihydroxyquinaldine Series | |
| SU1128831A3 (ru) | Способ получени производных аминоэтанола или их солей | |
| Angier et al. | Some N-Substituted-5-oxo-2-pyrrolidinecarboxamides | |
| CN110627642B (zh) | 一种合成长链脂肪酸脂类衍生物的方法 | |
| SU503508A3 (ru) | Способ получени -бис/ -оксиарилэтил- диаминоалканов | |
| US3144463A (en) | Nu-(p-aminophenethyl)- and nu-(p-nitrophenethyl)-2-methyl-3-phenyl-3-propionyloxy-pyrrolidines | |
| US4656285A (en) | Compound 2-acetamidomethyl-6-methoxy-pyridine | |
| JPS5965072A (ja) | インドリンまたはインドリン誘導体の製造方法 | |
| SU511860A3 (ru) | Способ получени имидазо (2,1-в) тиазолов |