SU415879A3 - - Google Patents
Info
- Publication number
- SU415879A3 SU415879A3 SU1692741A SU1692741A SU415879A3 SU 415879 A3 SU415879 A3 SU 415879A3 SU 1692741 A SU1692741 A SU 1692741A SU 1692741 A SU1692741 A SU 1692741A SU 415879 A3 SU415879 A3 SU 415879A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- atoms
- acid
- chloroform
- mixture
- salt
- Prior art date
Links
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 229960003424 phenylacetic acid Drugs 0.000 description 3
- 239000003279 phenylacetic acid Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- -1 5-isobutyl-2 - pyrimidinyl Chemical group 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910052702 rhenium Inorganic materials 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- JFNGTRVLHDCFOX-UHFFFAOYSA-N 1-(5-fluoro-2-methoxyphenyl)ethanamine Chemical compound COC1=CC=C(F)C=C1C(C)N JFNGTRVLHDCFOX-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 1
- FYXZTVPBFJQFBO-UHFFFAOYSA-N 2-(4-nitrophenyl)acetyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CC(Cl)=O)C=C1 FYXZTVPBFJQFBO-UHFFFAOYSA-N 0.000 description 1
- KEDRWBAQKNIHRN-UHFFFAOYSA-N 2-amino-5-ethyl-1H-pyrimidine-6-thione Chemical compound C(C)C=1C(=NC(=NC1)N)S KEDRWBAQKNIHRN-UHFFFAOYSA-N 0.000 description 1
- YAKIJEZSDKOGGQ-UHFFFAOYSA-N 5-(2-methylpropyl)pyrimidin-2-amine Chemical compound CC(C)CC1=CN=C(N)N=C1 YAKIJEZSDKOGGQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- WJJBIYLGJUVNJX-UHFFFAOYSA-N pyrimidine-2-sulfonamide Chemical class NS(=O)(=O)C1=NC=CC=N1 WJJBIYLGJUVNJX-UHFFFAOYSA-N 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2021962A DE2021962C3 (de) | 1970-04-28 | 1970-04-28 | Blutzuckersenkende Sulfamoylpyrimidine mit asymmetrischem Kohlenstoffatom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU415879A3 true SU415879A3 (enExample) | 1974-02-15 |
Family
ID=5770301
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1692737A SU439978A3 (ru) | 1970-04-28 | 1971-04-28 | Способ получения сульфамоилпиримидина или его соли |
| SU1692740A SU415878A3 (enExample) | 1970-04-28 | 1971-04-28 | |
| SU1692741A SU415879A3 (enExample) | 1970-04-28 | 1971-04-28 |
Family Applications Before (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1692737A SU439978A3 (ru) | 1970-04-28 | 1971-04-28 | Способ получения сульфамоилпиримидина или его соли |
| SU1692740A SU415878A3 (enExample) | 1970-04-28 | 1971-04-28 |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5516143B1 (enExample) |
| AT (3) | AT307421B (enExample) |
| BE (1) | BE766409A (enExample) |
| CH (3) | CH550181A (enExample) |
| DE (1) | DE2021962C3 (enExample) |
| DK (1) | DK125324B (enExample) |
| ES (1) | ES390365A1 (enExample) |
| FR (1) | FR2092102B1 (enExample) |
| GB (1) | GB1353511A (enExample) |
| IL (1) | IL36704A (enExample) |
| NL (1) | NL170853C (enExample) |
| NO (1) | NO131835C (enExample) |
| SE (1) | SE378419B (enExample) |
| SU (3) | SU439978A3 (enExample) |
| YU (1) | YU34412B (enExample) |
| ZA (1) | ZA712142B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE789712R (fr) * | 1970-04-28 | 1973-04-05 | Schering Ag | Sulfamoylpyrimidines, a atome de carbone asymetrique, leur procede de preparation et leur |
| JPS6088929U (ja) * | 1983-11-28 | 1985-06-18 | 五十嵐 五大 | 健康保持具 |
| JPS62128478U (enExample) * | 1986-02-05 | 1987-08-14 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670188A1 (de) * | 1967-02-01 | 1971-03-25 | Boehringer Mannheim Gmbh | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden |
| DE1695855C3 (de) * | 1967-12-30 | 1979-07-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 4-(5-Isobutyl-2-pyrimidinyl)-sulfonamidophenylessigsäure-(2-methoxy-5chloranilid) und dessen Salze mit physiologisch verträglichen Basen |
-
1970
- 1970-04-28 DE DE2021962A patent/DE2021962C3/de not_active Expired
-
1971
- 1971-03-15 CH CH370971A patent/CH550181A/xx not_active IP Right Cessation
- 1971-03-15 CH CH245274A patent/CH556846A/xx not_active IP Right Cessation
- 1971-03-15 CH CH245174A patent/CH568983A5/xx not_active IP Right Cessation
- 1971-04-01 YU YU809/71A patent/YU34412B/xx unknown
- 1971-04-02 ZA ZA712142A patent/ZA712142B/xx unknown
- 1971-04-02 DK DK158671AA patent/DK125324B/da unknown
- 1971-04-20 AT AT335971A patent/AT307421B/de not_active IP Right Cessation
- 1971-04-20 AT AT521372A patent/AT307431B/de not_active IP Right Cessation
- 1971-04-20 AT AT521272A patent/AT307430B/de not_active IP Right Cessation
- 1971-04-20 NO NO1456/71A patent/NO131835C/no unknown
- 1971-04-20 ES ES390365A patent/ES390365A1/es not_active Expired
- 1971-04-23 SE SE7105321A patent/SE378419B/xx unknown
- 1971-04-25 IL IL36704A patent/IL36704A/xx unknown
- 1971-04-26 GB GB1129571*[A patent/GB1353511A/en not_active Expired
- 1971-04-27 FR FR7114939A patent/FR2092102B1/fr not_active Expired
- 1971-04-28 NL NLAANVRAGE7105835,A patent/NL170853C/xx not_active IP Right Cessation
- 1971-04-28 BE BE766409A patent/BE766409A/xx unknown
- 1971-04-28 JP JP2852471A patent/JPS5516143B1/ja active Pending
- 1971-04-28 SU SU1692737A patent/SU439978A3/ru active
- 1971-04-28 SU SU1692740A patent/SU415878A3/ru active
- 1971-04-28 SU SU1692741A patent/SU415879A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| NL170853B (nl) | 1982-08-02 |
| YU34412B (en) | 1979-07-10 |
| SU415878A3 (enExample) | 1974-02-15 |
| YU80971A (en) | 1978-12-31 |
| AT307421B (de) | 1973-05-25 |
| SU439978A3 (ru) | 1974-08-15 |
| JPS5516143B1 (enExample) | 1980-04-30 |
| GB1353511A (en) | 1974-05-22 |
| NO131835B (enExample) | 1975-05-05 |
| DE2021962C3 (de) | 1981-12-24 |
| DE2021962A1 (de) | 1971-11-18 |
| NL170853C (nl) | 1983-01-03 |
| DE2021962B2 (de) | 1981-04-16 |
| NL7105835A (enExample) | 1971-11-01 |
| BE766409A (fr) | 1971-10-28 |
| FR2092102B1 (enExample) | 1974-08-30 |
| CH556846A (de) | 1974-12-13 |
| SU389661A3 (enExample) | 1973-07-05 |
| DK125324B (da) | 1973-02-05 |
| ZA712142B (en) | 1971-12-29 |
| SE378419B (enExample) | 1975-09-01 |
| ES390365A1 (es) | 1974-06-01 |
| IL36704A (en) | 1974-09-10 |
| CH568983A5 (enExample) | 1975-11-14 |
| FR2092102A1 (enExample) | 1972-01-21 |
| CH550181A (de) | 1974-06-14 |
| AT307430B (de) | 1973-05-25 |
| IL36704A0 (en) | 1971-06-23 |
| NO131835C (enExample) | 1975-08-13 |
| AT307431B (de) | 1973-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE425488B (sv) | Bensoesyraderivat avsedda som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoylbensoesyraderivat | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| SU415879A3 (enExample) | ||
| US2540946A (en) | Pyridoxal-histamine and processes for preparing the same | |
| US4008269A (en) | Phenylacetic acids | |
| CH646133A5 (de) | Phenolderivate, verwendung derselben zur herstellung von arylessigsaeure-derivaten. | |
| SU439978A1 (ru) | Способ получени сульфамоилпиримидина или его соли | |
| US3442890A (en) | Substituted 3-benzazocin-16-ones | |
| US4005146A (en) | Resolution of dl-allethrolone | |
| NO132930B (enExample) | ||
| SU895280A3 (ru) | Способ получени производных индана | |
| SU440836A1 (ru) | Способ получения 2-{фурилметил)- 6,7-бензоморфанов | |
| SU563913A3 (ru) | Способ получени производных 1-фталазона | |
| SU591145A3 (ru) | Способ получени производных 2,4-диметил-3-карбоксианилидфурана или их солей | |
| Laliberte et al. | IMPROVED SYNTHESIS OF N-ALKYL-ASPARTIC ACIDS | |
| US3312738A (en) | Dibenzocycloheptenes and processes for the preparation thereof | |
| SU421186A3 (ru) | Способ получения производных 17-аза-16-кетостероидов | |
| SU544654A1 (ru) | Способ получени гидрохлорида дианила глутаконового альдегида | |
| SU368258A1 (ru) | Способ получения 1,4-диарил-2-карбоксиметил- 3-оксопиперазинов | |
| SU503863A1 (ru) | Способ получени 1,3-дизамещенных 5-амино-4цианпиразолов | |
| SU465786A3 (ru) | Способ получени соли 4-хлор-м-толуол или 3,4-дихлорбензолсульфокислоты и -форм пропоксифена | |
| KR850000427B1 (ko) | 피롤 유도체의 제조방법 | |
| KR860000848B1 (ko) | 소염진통 작용을 갖는 아릴알칸산 유도체의 프탈리딜에스테르 제조방법 | |
| US4208526A (en) | Process for the preparation of thiazolidin-4-one-acetic acid derivatives | |
| SU899553A1 (ru) | Способ получени 2-метил-3-этоксикарбонил-хиноксалинов |