NO131835B - - Google Patents
Download PDFInfo
- Publication number
- NO131835B NO131835B NO1456/71A NO145671A NO131835B NO 131835 B NO131835 B NO 131835B NO 1456/71 A NO1456/71 A NO 1456/71A NO 145671 A NO145671 A NO 145671A NO 131835 B NO131835 B NO 131835B
- Authority
- NO
- Norway
- Prior art keywords
- phenyl
- pyrimidinyl
- sulfamoyl
- general formula
- phenylacetic acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 54
- -1 guanidine-sulfonyl compound Chemical class 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 13
- 239000002585 base Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 239000008280 blood Substances 0.000 claims description 6
- 210000004369 blood Anatomy 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229940124530 sulfonamide Drugs 0.000 claims description 6
- 150000003456 sulfonamides Chemical class 0.000 claims description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 150000007529 inorganic bases Chemical class 0.000 claims description 3
- 150000007530 organic bases Chemical class 0.000 claims description 3
- WJJBIYLGJUVNJX-UHFFFAOYSA-N pyrimidine-2-sulfonamide Chemical class NS(=O)(=O)C1=NC=CC=N1 WJJBIYLGJUVNJX-UHFFFAOYSA-N 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- WSMYVTOQOOLQHP-UHFFFAOYSA-N Malondialdehyde Chemical class O=CCC=O WSMYVTOQOOLQHP-UHFFFAOYSA-N 0.000 claims description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims description 2
- 125000003172 aldehyde group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 2
- 229940118019 malondialdehyde Drugs 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000003230 pyrimidines Chemical class 0.000 claims description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 58
- 238000002844 melting Methods 0.000 description 55
- 230000008018 melting Effects 0.000 description 55
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 41
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 239000000243 solution Substances 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Substances [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 238000009835 boiling Methods 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- QECSATAUPZYUEL-UHFFFAOYSA-N 2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]acetyl chloride Chemical compound C(C(C)C)C=1C=NC(=NC1)NS(=O)(=O)C1=CC=C(C=C1)CC(=O)Cl QECSATAUPZYUEL-UHFFFAOYSA-N 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 238000010992 reflux Methods 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- RQEUFEKYXDPUSK-SSDOTTSWSA-N (1R)-1-phenylethanamine Chemical compound C[C@@H](N)C1=CC=CC=C1 RQEUFEKYXDPUSK-SSDOTTSWSA-N 0.000 description 5
- NDNZHQUDSYIJBX-UHFFFAOYSA-N 1-(5-chloro-2-methoxyphenyl)ethanamine Chemical compound COC1=CC=C(Cl)C=C1C(C)N NDNZHQUDSYIJBX-UHFFFAOYSA-N 0.000 description 5
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- JFNGTRVLHDCFOX-UHFFFAOYSA-N 1-(5-fluoro-2-methoxyphenyl)ethanamine Chemical compound COC1=CC=C(F)C=C1C(C)N JFNGTRVLHDCFOX-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 4
- ZWYIVRRLANGKDU-UHFFFAOYSA-N 1-(2,5-dimethoxyphenyl)ethanamine Chemical compound COC1=CC=C(OC)C(C(C)N)=C1 ZWYIVRRLANGKDU-UHFFFAOYSA-N 0.000 description 3
- CXDAPRCYUQYNCC-UHFFFAOYSA-N 5-ethylsulfanylpyrimidin-2-amine Chemical compound C(C)SC=1C=NC(=NC1)N CXDAPRCYUQYNCC-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229960004440 glymidine Drugs 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- JFNGTRVLHDCFOX-ZCFIWIBFSA-N (1r)-1-(5-fluoro-2-methoxyphenyl)ethanamine Chemical compound COC1=CC=C(F)C=C1[C@@H](C)N JFNGTRVLHDCFOX-ZCFIWIBFSA-N 0.000 description 2
- AQFLVLHRZFLDDV-UHFFFAOYSA-N 1-phenylpropan-1-amine Chemical compound CCC(N)C1=CC=CC=C1 AQFLVLHRZFLDDV-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- WWESVZFJIIMLNW-UHFFFAOYSA-N 2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]-n-(1-phenylethyl)acetamide Chemical compound N1=CC(CC(C)C)=CN=C1NS(=O)(=O)C(C=C1)=CC=C1CC(=O)NC(C)C1=CC=CC=C1 WWESVZFJIIMLNW-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical compound NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229940075930 picrate Drugs 0.000 description 2
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- AQFLVLHRZFLDDV-SECBINFHSA-N (1r)-1-phenylpropan-1-amine Chemical compound CC[C@@H](N)C1=CC=CC=C1 AQFLVLHRZFLDDV-SECBINFHSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FAXUIYJKGGUCBO-UHFFFAOYSA-N 1-(2,5-dimethoxyphenyl)ethanone Chemical compound COC1=CC=C(OC)C(C(C)=O)=C1 FAXUIYJKGGUCBO-UHFFFAOYSA-N 0.000 description 1
- JJHHWCQQAOZVKQ-UHFFFAOYSA-N 1-(4-propylphenyl)ethanamine Chemical compound CCCC1=CC=C(C(C)N)C=C1 JJHHWCQQAOZVKQ-UHFFFAOYSA-N 0.000 description 1
- QPIUQLBBCQTWMJ-UHFFFAOYSA-N 1-(5-chloro-2-methoxyphenyl)ethanone Chemical compound COC1=CC=C(Cl)C=C1C(C)=O QPIUQLBBCQTWMJ-UHFFFAOYSA-N 0.000 description 1
- RCJWKWDOIJCEIL-UHFFFAOYSA-N 1-(5-chloro-2-methylphenyl)ethanamine Chemical compound CC(N)C1=CC(Cl)=CC=C1C RCJWKWDOIJCEIL-UHFFFAOYSA-N 0.000 description 1
- CNVGMLMIQIPAFY-UHFFFAOYSA-N 1-(5-fluoro-2-methoxyphenyl)ethanone Chemical compound COC1=CC=C(F)C=C1C(C)=O CNVGMLMIQIPAFY-UHFFFAOYSA-N 0.000 description 1
- XHOXKVFLASIOJD-UHFFFAOYSA-N 1-phenylbutan-1-amine Chemical compound CCCC(N)C1=CC=CC=C1 XHOXKVFLASIOJD-UHFFFAOYSA-N 0.000 description 1
- KWTSXDURSIMDCE-UHFFFAOYSA-N 1-phenylpropan-2-amine Chemical compound CC(N)CC1=CC=CC=C1 KWTSXDURSIMDCE-UHFFFAOYSA-N 0.000 description 1
- FYXZTVPBFJQFBO-UHFFFAOYSA-N 2-(4-nitrophenyl)acetyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CC(Cl)=O)C=C1 FYXZTVPBFJQFBO-UHFFFAOYSA-N 0.000 description 1
- UKVQWQDRZZAJIP-UHFFFAOYSA-N 2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]-N-(1-phenylpropyl)acetamide Chemical compound C1(=CC=CC=C1)C(CC)NC(CC1=CC=C(C=C1)S(NC1=NC=C(C=N1)CC(C)C)(=O)=O)=O UKVQWQDRZZAJIP-UHFFFAOYSA-N 0.000 description 1
- WWESVZFJIIMLNW-GOSISDBHSA-N 2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]-n-[(1r)-1-phenylethyl]acetamide Chemical compound N1=CC(CC(C)C)=CN=C1NS(=O)(=O)C(C=C1)=CC=C1CC(=O)N[C@H](C)C1=CC=CC=C1 WWESVZFJIIMLNW-GOSISDBHSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- VQEHSBSZLWUDML-UHFFFAOYSA-N 2-chloro-5-(2-methylpropyl)pyrimidine Chemical compound CC(C)CC1=CN=C(Cl)N=C1 VQEHSBSZLWUDML-UHFFFAOYSA-N 0.000 description 1
- UVXXBSCXKKIBCH-UHFFFAOYSA-N 2-methyl-1-phenylpropan-1-amine Chemical compound CC(C)C(N)C1=CC=CC=C1 UVXXBSCXKKIBCH-UHFFFAOYSA-N 0.000 description 1
- XTTQGFJZEYVZAP-UHFFFAOYSA-N 2-phenylbutan-2-amine Chemical compound CCC(C)(N)C1=CC=CC=C1 XTTQGFJZEYVZAP-UHFFFAOYSA-N 0.000 description 1
- FOTITZRWZUAVPH-UHFFFAOYSA-N 2-phenylpropanoyl chloride Chemical compound ClC(=O)C(C)C1=CC=CC=C1 FOTITZRWZUAVPH-UHFFFAOYSA-N 0.000 description 1
- UYHIRHJRXARWSP-UHFFFAOYSA-N 4-[2-oxo-2-(1-phenylethylamino)ethyl]benzenesulfonyl chloride Chemical compound C1(=CC=CC=C1)C(C)NC(CC1=CC=C(C=C1)S(=O)(=O)Cl)=O UYHIRHJRXARWSP-UHFFFAOYSA-N 0.000 description 1
- YAKIJEZSDKOGGQ-UHFFFAOYSA-N 5-(2-methylpropyl)pyrimidin-2-amine Chemical compound CC(C)CC1=CN=C(N)N=C1 YAKIJEZSDKOGGQ-UHFFFAOYSA-N 0.000 description 1
- HFBZPKYQUFLCEL-UHFFFAOYSA-N 5-chloro-2-methylbenzonitrile Chemical compound CC1=CC=C(Cl)C=C1C#N HFBZPKYQUFLCEL-UHFFFAOYSA-N 0.000 description 1
- UVVXVOXBBHGUIX-UHFFFAOYSA-N 5-propan-2-yloxypyrimidin-2-amine Chemical compound CC(C)OC1=CN=C(N)N=C1 UVVXVOXBBHGUIX-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 239000001358 L(+)-tartaric acid Substances 0.000 description 1
- 235000011002 L(+)-tartaric acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-LWMBPPNESA-N L-(+)-Tartaric acid Natural products OC(=O)[C@@H](O)[C@H](O)C(O)=O FEWJPZIEWOKRBE-LWMBPPNESA-N 0.000 description 1
- BQBMOIURAFZIHI-UHFFFAOYSA-N N-(1-phenylpropyl)-2-[4-[(5-propan-2-yloxypyrimidin-2-yl)sulfamoyl]phenyl]acetamide Chemical compound C1(=CC=CC=C1)C(CC)NC(CC1=CC=C(C=C1)S(NC1=NC=C(C=N1)OC(C)C)(=O)=O)=O BQBMOIURAFZIHI-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- AXORVIZLPOGIRG-QMMMGPOBSA-N R-BETA-METHYLPHENYLETHYLAMINE Chemical compound NC[C@H](C)C1=CC=CC=C1 AXORVIZLPOGIRG-QMMMGPOBSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- XSEUMFJMFFMCIU-UHFFFAOYSA-N buformin Chemical compound CCCC\N=C(/N)N=C(N)N XSEUMFJMFFMCIU-UHFFFAOYSA-N 0.000 description 1
- 229960004111 buformin Drugs 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- VDTNNGKXZGSZIP-UHFFFAOYSA-N carbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VDTNNGKXZGSZIP-UHFFFAOYSA-N 0.000 description 1
- 229960003362 carbutamide Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- AUONNNVJUCSETH-UHFFFAOYSA-N icosanoyl icosanoate Chemical compound CCCCCCCCCCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCCCCCCCCCC AUONNNVJUCSETH-UHFFFAOYSA-N 0.000 description 1
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Substances [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- BHFLUDRTVIDDOR-UHFFFAOYSA-N methyl 2-amino-2-phenylacetate Chemical compound COC(=O)C(N)C1=CC=CC=C1 BHFLUDRTVIDDOR-UHFFFAOYSA-N 0.000 description 1
- ULVVZAHNKGIBGY-UHFFFAOYSA-N n,n-dimethyl-2-phenylpropanamide Chemical compound CN(C)C(=O)C(C)C1=CC=CC=C1 ULVVZAHNKGIBGY-UHFFFAOYSA-N 0.000 description 1
- CKOLETHYECDWSS-QGZVFWFLSA-N n-[(1r)-1-(5-fluoro-2-methoxyphenyl)ethyl]-2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]acetamide Chemical compound COC1=CC=C(F)C=C1[C@@H](C)NC(=O)CC1=CC=C(S(=O)(=O)NC=2N=CC(CC(C)C)=CN=2)C=C1 CKOLETHYECDWSS-QGZVFWFLSA-N 0.000 description 1
- CKOLETHYECDWSS-UHFFFAOYSA-N n-[1-(5-fluoro-2-methoxyphenyl)ethyl]-2-[4-[[5-(2-methylpropyl)pyrimidin-2-yl]sulfamoyl]phenyl]acetamide Chemical compound COC1=CC=C(F)C=C1C(C)NC(=O)CC1=CC=C(S(=O)(=O)NC=2N=CC(CC(C)C)=CN=2)C=C1 CKOLETHYECDWSS-UHFFFAOYSA-N 0.000 description 1
- RCSSHZGQHHEHPZ-UHFFFAOYSA-N n-methyl-1-phenylethanamine Chemical compound CNC(C)C1=CC=CC=C1 RCSSHZGQHHEHPZ-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- BRBKOPJOKNSWSG-UHFFFAOYSA-N sulfaguanidine Chemical compound NC(=N)NS(=O)(=O)C1=CC=C(N)C=C1 BRBKOPJOKNSWSG-UHFFFAOYSA-N 0.000 description 1
- 229960004257 sulfaguanidine Drugs 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 238000010408 sweeping Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229960005371 tolbutamide Drugs 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- AXORVIZLPOGIRG-UHFFFAOYSA-N β-methylphenethylamine Chemical compound NCC(C)C1=CC=CC=C1 AXORVIZLPOGIRG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2021962A DE2021962C3 (de) | 1970-04-28 | 1970-04-28 | Blutzuckersenkende Sulfamoylpyrimidine mit asymmetrischem Kohlenstoffatom |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131835B true NO131835B (enExample) | 1975-05-05 |
| NO131835C NO131835C (enExample) | 1975-08-13 |
Family
ID=5770301
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1456/71A NO131835C (enExample) | 1970-04-28 | 1971-04-20 |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5516143B1 (enExample) |
| AT (3) | AT307421B (enExample) |
| BE (1) | BE766409A (enExample) |
| CH (3) | CH550181A (enExample) |
| DE (1) | DE2021962C3 (enExample) |
| DK (1) | DK125324B (enExample) |
| ES (1) | ES390365A1 (enExample) |
| FR (1) | FR2092102B1 (enExample) |
| GB (1) | GB1353511A (enExample) |
| IL (1) | IL36704A (enExample) |
| NL (1) | NL170853C (enExample) |
| NO (1) | NO131835C (enExample) |
| SE (1) | SE378419B (enExample) |
| SU (3) | SU439978A3 (enExample) |
| YU (1) | YU34412B (enExample) |
| ZA (1) | ZA712142B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE789712R (fr) * | 1970-04-28 | 1973-04-05 | Schering Ag | Sulfamoylpyrimidines, a atome de carbone asymetrique, leur procede de preparation et leur |
| JPS6088929U (ja) * | 1983-11-28 | 1985-06-18 | 五十嵐 五大 | 健康保持具 |
| JPS62128478U (enExample) * | 1986-02-05 | 1987-08-14 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670188A1 (de) * | 1967-02-01 | 1971-03-25 | Boehringer Mannheim Gmbh | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden |
| DE1695855C3 (de) * | 1967-12-30 | 1979-07-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 4-(5-Isobutyl-2-pyrimidinyl)-sulfonamidophenylessigsäure-(2-methoxy-5chloranilid) und dessen Salze mit physiologisch verträglichen Basen |
-
1970
- 1970-04-28 DE DE2021962A patent/DE2021962C3/de not_active Expired
-
1971
- 1971-03-15 CH CH370971A patent/CH550181A/xx not_active IP Right Cessation
- 1971-03-15 CH CH245274A patent/CH556846A/xx not_active IP Right Cessation
- 1971-03-15 CH CH245174A patent/CH568983A5/xx not_active IP Right Cessation
- 1971-04-01 YU YU809/71A patent/YU34412B/xx unknown
- 1971-04-02 ZA ZA712142A patent/ZA712142B/xx unknown
- 1971-04-02 DK DK158671AA patent/DK125324B/da unknown
- 1971-04-20 AT AT335971A patent/AT307421B/de not_active IP Right Cessation
- 1971-04-20 AT AT521372A patent/AT307431B/de not_active IP Right Cessation
- 1971-04-20 AT AT521272A patent/AT307430B/de not_active IP Right Cessation
- 1971-04-20 NO NO1456/71A patent/NO131835C/no unknown
- 1971-04-20 ES ES390365A patent/ES390365A1/es not_active Expired
- 1971-04-23 SE SE7105321A patent/SE378419B/xx unknown
- 1971-04-25 IL IL36704A patent/IL36704A/xx unknown
- 1971-04-26 GB GB1129571*[A patent/GB1353511A/en not_active Expired
- 1971-04-27 FR FR7114939A patent/FR2092102B1/fr not_active Expired
- 1971-04-28 NL NLAANVRAGE7105835,A patent/NL170853C/xx not_active IP Right Cessation
- 1971-04-28 BE BE766409A patent/BE766409A/xx unknown
- 1971-04-28 JP JP2852471A patent/JPS5516143B1/ja active Pending
- 1971-04-28 SU SU1692737A patent/SU439978A3/ru active
- 1971-04-28 SU SU1692740A patent/SU415878A3/ru active
- 1971-04-28 SU SU1692741A patent/SU415879A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| NL170853B (nl) | 1982-08-02 |
| YU34412B (en) | 1979-07-10 |
| SU415878A3 (enExample) | 1974-02-15 |
| YU80971A (en) | 1978-12-31 |
| AT307421B (de) | 1973-05-25 |
| SU439978A3 (ru) | 1974-08-15 |
| JPS5516143B1 (enExample) | 1980-04-30 |
| GB1353511A (en) | 1974-05-22 |
| DE2021962C3 (de) | 1981-12-24 |
| DE2021962A1 (de) | 1971-11-18 |
| NL170853C (nl) | 1983-01-03 |
| DE2021962B2 (de) | 1981-04-16 |
| NL7105835A (enExample) | 1971-11-01 |
| BE766409A (fr) | 1971-10-28 |
| FR2092102B1 (enExample) | 1974-08-30 |
| CH556846A (de) | 1974-12-13 |
| SU389661A3 (enExample) | 1973-07-05 |
| DK125324B (da) | 1973-02-05 |
| ZA712142B (en) | 1971-12-29 |
| SE378419B (enExample) | 1975-09-01 |
| ES390365A1 (es) | 1974-06-01 |
| IL36704A (en) | 1974-09-10 |
| CH568983A5 (enExample) | 1975-11-14 |
| FR2092102A1 (enExample) | 1972-01-21 |
| SU415879A3 (enExample) | 1974-02-15 |
| CH550181A (de) | 1974-06-14 |
| AT307430B (de) | 1973-05-25 |
| IL36704A0 (en) | 1971-06-23 |
| NO131835C (enExample) | 1975-08-13 |
| AT307431B (de) | 1973-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60033689T2 (de) | Inhibitoren von serinproteasen | |
| WO1998007420A1 (en) | Neuropeptide-y ligands | |
| WO1997025315A1 (fr) | Nouveaux derives de n-(arylsulfonyl)aminoacides ayant une affinite pour les recepteurs de la bradykinine | |
| CN1658877B (zh) | 碱性非肽缓激肽拮抗剂及其药物组合物 | |
| US3974158A (en) | 2-(Substituted anilino)methylmorpholines | |
| SU416945A3 (ru) | Способ получения рацемических или оптически активных производных пиперазина | |
| DE60316683T2 (de) | Phenylcyclohexylpropanolaminderivate, deren herstellung und therapeutsche anwendung | |
| IE47518B1 (en) | Indolo (2,3-a) quinolizidines,preparation and therapeutic use | |
| DE69814800T2 (de) | Epoxysuccinamid-derivate oder ihre salze | |
| DK156301B (da) | Analogifremgangsmaade til fremstilling af oxy- eller oxosubstituerede phenoxy- eller phenylthio-azacycloalkaner eller deres syreadditionssalte | |
| US6022984A (en) | Efficient synthesis of furan sulfonamide compounds useful in the synthesis of new IL-1 inhibitors | |
| US3103516A (en) | J-tertiaryaminq-lower alkyl-jb-meta- | |
| JPWO1998047887A1 (ja) | 新規なエポキシコハク酸アミド誘導体又はその塩 | |
| NO131835B (enExample) | ||
| IL43749A (en) | Cyclopropylmethylamine derivatives of n-containing heterocyclic compounds their production and pharmaceutical compositions containing them | |
| US4731376A (en) | 2-(-(2,2,5,5-tetramethyl-3-pyrrolin-3-carbonyl))-amino derivatives | |
| DE69713128T2 (de) | 4-(1-piperazinyl)benzosäurederivate, verfahren zu ihrer herstellung und ihre therapeutischen verwendungen | |
| GB2171997A (en) | 4-Amino-6,7-dimethoxy-2-Piperazin-1-ylquinazoline derivatives | |
| US5707979A (en) | Phosphinic acid derivatives, their preparation and their use | |
| US2942001A (en) | Piperazo-pyridazines | |
| IE45782B1 (en) | 1-(n-acylcarbamoyl)-2-cyanoziridines | |
| CS249503B2 (en) | Method of new 1-(3-/3,4,5-trimethoxyphenoxy/-2-hydroxypropyl-4-aryl-piperazine derivatives production | |
| US4029786A (en) | Morpholine derivatives for treating depression | |
| NO133138B (enExample) | ||
| US2483435A (en) | Beta-benzohydryloxyethylamines and process for preparing |