SU415878A3 - - Google Patents
Info
- Publication number
- SU415878A3 SU415878A3 SU1692740A SU1692740A SU415878A3 SU 415878 A3 SU415878 A3 SU 415878A3 SU 1692740 A SU1692740 A SU 1692740A SU 1692740 A SU1692740 A SU 1692740A SU 415878 A3 SU415878 A3 SU 415878A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- general formula
- atoms
- acid
- sulfamoyl
- chloroform
- Prior art date
Links
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 238000000034 method Methods 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- -1 benzenesulfonamido Chemical group 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- VQEHSBSZLWUDML-UHFFFAOYSA-N 2-chloro-5-(2-methylpropyl)pyrimidine Chemical compound CC(C)CC1=CN=C(Cl)N=C1 VQEHSBSZLWUDML-UHFFFAOYSA-N 0.000 description 2
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229960003424 phenylacetic acid Drugs 0.000 description 2
- 239000003279 phenylacetic acid Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- ONVURFJRZJXWDD-UHFFFAOYSA-N 2-(4-sulfamoylphenyl)acetic acid Chemical compound NS(=O)(=O)C1=CC=C(CC(O)=O)C=C1 ONVURFJRZJXWDD-UHFFFAOYSA-N 0.000 description 1
- PUBNQGVTWYSXFJ-UHFFFAOYSA-N 2-phenyl-2-sulfonylacetic acid Chemical compound OC(=O)C(=S(=O)=O)C1=CC=CC=C1 PUBNQGVTWYSXFJ-UHFFFAOYSA-N 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 235000010044 Hernandia moerenhoutiana Nutrition 0.000 description 1
- 244000084296 Hernandia moerenhoutiana Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- WJJBIYLGJUVNJX-UHFFFAOYSA-N pyrimidine-2-sulfonamide Chemical class NS(=O)(=O)C1=NC=CC=N1 WJJBIYLGJUVNJX-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2021962A DE2021962C3 (de) | 1970-04-28 | 1970-04-28 | Blutzuckersenkende Sulfamoylpyrimidine mit asymmetrischem Kohlenstoffatom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU415878A3 true SU415878A3 (enExample) | 1974-02-15 |
Family
ID=5770301
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1692740A SU415878A3 (enExample) | 1970-04-28 | 1971-04-28 | |
| SU1692737A SU439978A3 (ru) | 1970-04-28 | 1971-04-28 | Способ получения сульфамоилпиримидина или его соли |
| SU1692741A SU415879A3 (enExample) | 1970-04-28 | 1971-04-28 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1692737A SU439978A3 (ru) | 1970-04-28 | 1971-04-28 | Способ получения сульфамоилпиримидина или его соли |
| SU1692741A SU415879A3 (enExample) | 1970-04-28 | 1971-04-28 |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5516143B1 (enExample) |
| AT (3) | AT307431B (enExample) |
| BE (1) | BE766409A (enExample) |
| CH (3) | CH568983A5 (enExample) |
| DE (1) | DE2021962C3 (enExample) |
| DK (1) | DK125324B (enExample) |
| ES (1) | ES390365A1 (enExample) |
| FR (1) | FR2092102B1 (enExample) |
| GB (1) | GB1353511A (enExample) |
| IL (1) | IL36704A (enExample) |
| NL (1) | NL170853C (enExample) |
| NO (1) | NO131835C (enExample) |
| SE (1) | SE378419B (enExample) |
| SU (3) | SU415878A3 (enExample) |
| YU (1) | YU34412B (enExample) |
| ZA (1) | ZA712142B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE789712R (fr) * | 1970-04-28 | 1973-04-05 | Schering Ag | Sulfamoylpyrimidines, a atome de carbone asymetrique, leur procede de preparation et leur |
| JPS6088929U (ja) * | 1983-11-28 | 1985-06-18 | 五十嵐 五大 | 健康保持具 |
| JPS62128478U (enExample) * | 1986-02-05 | 1987-08-14 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670188A1 (de) * | 1967-02-01 | 1971-03-25 | Boehringer Mannheim Gmbh | Verfahren zur Herstellung von neuen antidiabetisch wirksamen Sulfonamiden |
| DE1695855C3 (de) * | 1967-12-30 | 1979-07-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | 4-(5-Isobutyl-2-pyrimidinyl)-sulfonamidophenylessigsäure-(2-methoxy-5chloranilid) und dessen Salze mit physiologisch verträglichen Basen |
-
1970
- 1970-04-28 DE DE2021962A patent/DE2021962C3/de not_active Expired
-
1971
- 1971-03-15 CH CH245174A patent/CH568983A5/xx not_active IP Right Cessation
- 1971-03-15 CH CH370971A patent/CH550181A/xx not_active IP Right Cessation
- 1971-03-15 CH CH245274A patent/CH556846A/xx not_active IP Right Cessation
- 1971-04-01 YU YU809/71A patent/YU34412B/xx unknown
- 1971-04-02 DK DK158671AA patent/DK125324B/da unknown
- 1971-04-02 ZA ZA712142A patent/ZA712142B/xx unknown
- 1971-04-20 ES ES390365A patent/ES390365A1/es not_active Expired
- 1971-04-20 AT AT521372A patent/AT307431B/de not_active IP Right Cessation
- 1971-04-20 NO NO1456/71A patent/NO131835C/no unknown
- 1971-04-20 AT AT521272A patent/AT307430B/de not_active IP Right Cessation
- 1971-04-20 AT AT335971A patent/AT307421B/de not_active IP Right Cessation
- 1971-04-23 SE SE7105321A patent/SE378419B/xx unknown
- 1971-04-25 IL IL36704A patent/IL36704A/xx unknown
- 1971-04-26 GB GB1129571*[A patent/GB1353511A/en not_active Expired
- 1971-04-27 FR FR7114939A patent/FR2092102B1/fr not_active Expired
- 1971-04-28 JP JP2852471A patent/JPS5516143B1/ja active Pending
- 1971-04-28 BE BE766409A patent/BE766409A/xx unknown
- 1971-04-28 NL NLAANVRAGE7105835,A patent/NL170853C/xx not_active IP Right Cessation
- 1971-04-28 SU SU1692740A patent/SU415878A3/ru active
- 1971-04-28 SU SU1692737A patent/SU439978A3/ru active
- 1971-04-28 SU SU1692741A patent/SU415879A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SU389661A3 (enExample) | 1973-07-05 |
| SU415879A3 (enExample) | 1974-02-15 |
| DK125324B (da) | 1973-02-05 |
| ZA712142B (en) | 1971-12-29 |
| ES390365A1 (es) | 1974-06-01 |
| CH556846A (de) | 1974-12-13 |
| AT307421B (de) | 1973-05-25 |
| DE2021962A1 (de) | 1971-11-18 |
| NL7105835A (enExample) | 1971-11-01 |
| FR2092102A1 (enExample) | 1972-01-21 |
| GB1353511A (en) | 1974-05-22 |
| CH550181A (de) | 1974-06-14 |
| YU80971A (en) | 1978-12-31 |
| JPS5516143B1 (enExample) | 1980-04-30 |
| AT307431B (de) | 1973-05-25 |
| CH568983A5 (enExample) | 1975-11-14 |
| BE766409A (fr) | 1971-10-28 |
| NO131835C (enExample) | 1975-08-13 |
| DE2021962C3 (de) | 1981-12-24 |
| FR2092102B1 (enExample) | 1974-08-30 |
| NO131835B (enExample) | 1975-05-05 |
| YU34412B (en) | 1979-07-10 |
| AT307430B (de) | 1973-05-25 |
| NL170853C (nl) | 1983-01-03 |
| IL36704A0 (en) | 1971-06-23 |
| SE378419B (enExample) | 1975-09-01 |
| IL36704A (en) | 1974-09-10 |
| NL170853B (nl) | 1982-08-02 |
| SU439978A3 (ru) | 1974-08-15 |
| DE2021962B2 (de) | 1981-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Einberg | Alkylation of 5-substituted tetrazoles with. alpha.-chlorocarbonyl compounds | |
| US3573305A (en) | (3-amino-pyrazinoyl)sulfamides and their preparation | |
| SU415878A3 (enExample) | ||
| HU177482B (en) | Process for preparing new uracyl derivatives | |
| Zienty et al. | N-Substituted 2-pyrrolidones | |
| Kipnis et al. | 2-Acyloxyacetylthiophenes | |
| FI91392B (fi) | Menetelmä terapeuttisesti käyttökelpoisten polyprenyyliyhdisteiden valmistamiseksi | |
| CN1022410C (zh) | 嘧啶衍生物的制备方法 | |
| SU619098A3 (ru) | Способ получени карбоновых кислот или их минеральных,или органических солей,или сложных эфиров | |
| NO160133B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 2-amino-3-(halobenzoyl)-methylfenyleddiksyrer, estere og salter derav. | |
| US3084168A (en) | 2, 4, 6-tris(2-cyanoalkyl)-trioxanes | |
| Corwin et al. | A Stepwise Porphyrin Synthesis1 | |
| US4447367A (en) | Phosphonoformaldehyde, a process for its preparation and its use as an intermediate product for the preparation of medicaments | |
| SU999974A3 (ru) | Способ получени конденсированных производных пиримидина или их солей | |
| US2404510A (en) | Hydantoins and methods of obtaining the same | |
| Stewart et al. | A Convenient Synthesis of β-Chloropropionitrile | |
| US3244725A (en) | 4, 5-diacyl-3-hydroxy-3-pyrrolin-2-ones | |
| US3442890A (en) | Substituted 3-benzazocin-16-ones | |
| US4237270A (en) | Derivatives of carboxyalkyl imino- and thioxo-barbituric acids | |
| SU730303A3 (ru) | Способ получени производных тиазолидинкарбоновых кислот или их кислотно-аддитивных солей | |
| US2530570A (en) | Pyrimidylmercapto-carboxylic acids | |
| US2773872A (en) | Dihydroorotic acid | |
| ES434095A1 (es) | Procedimiento para preparar cicloalcanol (b) tienilureas. | |
| Maguire et al. | 464. Purines, pyrimidines, and glyoxalines. Part X. Synthesis of uracil-6-phosphonic acid, an analogue of orotic acid | |
| SU503863A1 (ru) | Способ получени 1,3-дизамещенных 5-амино-4цианпиразолов |