SU1447278A3 - Способ получени производных бензоилмочевины - Google Patents
Способ получени производных бензоилмочевины Download PDFInfo
- Publication number
- SU1447278A3 SU1447278A3 SU853940050A SU3940050A SU1447278A3 SU 1447278 A3 SU1447278 A3 SU 1447278A3 SU 853940050 A SU853940050 A SU 853940050A SU 3940050 A SU3940050 A SU 3940050A SU 1447278 A3 SU1447278 A3 SU 1447278A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- yes
- rch
- tested
- group
- compound
- Prior art date
Links
- HRYILSDLIGTCOP-UHFFFAOYSA-N N-benzoylurea Chemical class NC(=O)NC(=O)C1=CC=CC=C1 HRYILSDLIGTCOP-UHFFFAOYSA-N 0.000 title claims description 4
- 238000000034 method Methods 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- 239000011737 fluorine Substances 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 230000000749 insecticidal effect Effects 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 238000005507 spraying Methods 0.000 claims description 3
- 230000001988 toxicity Effects 0.000 claims description 3
- 231100000419 toxicity Toxicity 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 abstract 6
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 5
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 3
- 125000001188 haloalkyl group Chemical group 0.000 abstract 3
- 125000005843 halogen group Chemical group 0.000 abstract 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 3
- 125000001424 substituent group Chemical group 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 abstract 1
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 abstract 1
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000000361 pesticidal effect Effects 0.000 abstract 1
- 125000005156 substituted alkylene group Chemical group 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 53
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 19
- 239000002904 solvent Substances 0.000 description 17
- 238000002360 preparation method Methods 0.000 description 15
- 239000000047 product Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- -1 2,6-difluorophenyl Chemical group 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZRJSABISRHPRSB-UHFFFAOYSA-N 2,6-difluorobenzoyl isocyanate Chemical compound FC1=CC=CC(F)=C1C(=O)N=C=O ZRJSABISRHPRSB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 3
- 241000256118 Aedes aegypti Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 241000256250 Spodoptera littoralis Species 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 2
- 229960002429 proline Drugs 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000013638 trimer Substances 0.000 description 2
- XILPLWOGHPSJBK-UHFFFAOYSA-N 1,2-dichloro-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(Cl)C(Cl)=C1 XILPLWOGHPSJBK-UHFFFAOYSA-N 0.000 description 1
- AVRQBXVUUXHRMY-UHFFFAOYSA-N 2,6-difluorobenzamide Chemical compound NC(=O)C1=C(F)C=CC=C1F AVRQBXVUUXHRMY-UHFFFAOYSA-N 0.000 description 1
- 101100295741 Gallus gallus COR4 gene Proteins 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000016027 Persea schiedeana Nutrition 0.000 description 1
- 244000261838 Persea schiedeana Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- BLWYXBNNBYXPPL-YFKPBYRVSA-N methyl (2s)-pyrrolidine-2-carboxylate Chemical compound COC(=O)[C@@H]1CCCN1 BLWYXBNNBYXPPL-YFKPBYRVSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OLLZXQIFCRIRMH-UHFFFAOYSA-N n-methylbutanamide Chemical compound CCCC(=O)NC OLLZXQIFCRIRMH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/34—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the groups, e.g. biuret; Thio analogues thereof; Urea-aldehyde condensation products
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C313/00—Sulfinic acids; Sulfenic acids; Halides, esters or anhydrides thereof; Amides of sulfinic or sulfenic acids, i.e. compounds having singly-bound oxygen atoms of sulfinic or sulfenic groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C313/08—Sulfenic acids; Derivatives thereof
- C07C313/18—Sulfenamides
- C07C313/26—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C313/30—Y being a hetero atom
- C07C313/34—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfenylureas
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/46—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with hetero atoms directly attached to the ring nitrogen atom
- C07D207/48—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8409240 | 1984-04-10 | ||
| GB848420930A GB8420930D0 (en) | 1984-08-17 | 1984-08-17 | Pesticidal benzoylurea compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1447278A3 true SU1447278A3 (ru) | 1988-12-23 |
Family
ID=26287600
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU853940050A SU1447278A3 (ru) | 1984-04-10 | 1985-08-19 | Способ получени производных бензоилмочевины |
Country Status (24)
| Country | Link |
|---|---|
| US (2) | US4666942A (enExample) |
| EP (1) | EP0161019B1 (enExample) |
| JP (1) | JPH0623164B2 (enExample) |
| KR (1) | KR940000813B1 (enExample) |
| AU (1) | AU571672B2 (enExample) |
| BR (1) | BR8501657A (enExample) |
| CA (1) | CA1339745C (enExample) |
| CS (1) | CS268519B2 (enExample) |
| DE (1) | DE3567858D1 (enExample) |
| DK (1) | DK161643C (enExample) |
| EG (1) | EG17741A (enExample) |
| ES (2) | ES8607220A1 (enExample) |
| GR (1) | GR850902B (enExample) |
| HU (1) | HU197721B (enExample) |
| IL (1) | IL74851A (enExample) |
| IN (1) | IN163910B (enExample) |
| MX (1) | MX160641A (enExample) |
| NZ (1) | NZ211686A (enExample) |
| OA (1) | OA07987A (enExample) |
| PH (1) | PH20753A (enExample) |
| PL (1) | PL145321B1 (enExample) |
| SU (1) | SU1447278A3 (enExample) |
| TR (1) | TR22406A (enExample) |
| ZW (1) | ZW6985A1 (enExample) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| GB8420930D0 (en) * | 1984-08-17 | 1984-09-19 | Shell Int Research | Pesticidal benzoylurea compounds |
| GB8523606D0 (en) * | 1985-09-25 | 1985-10-30 | Shell Int Research | Pesticidal benzoylurea compounds |
| DE3542201A1 (de) * | 1985-11-29 | 1987-06-04 | Basf Ag | N-benzoyl-,n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| DE3603089A1 (de) * | 1986-02-01 | 1987-08-06 | Basf Ag | N-benzoyl-n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| NZ221964A (en) * | 1986-10-03 | 1990-03-27 | Ishihara Sangyo Kaisha | Benzoylurea compounds and insecticidal compositions |
| GB8700838D0 (en) * | 1987-01-15 | 1987-02-18 | Shell Int Research | Termiticides |
| AU595417B2 (en) * | 1987-02-04 | 1990-03-29 | Sumitomo Chemical Company, Limited | A benzoylurea derivative and its production and use |
| US5157155A (en) * | 1987-02-04 | 1992-10-20 | Sumitomo Chemical Company, Limited | Benzoylurea derivative and its production and use |
| AU602060B2 (en) * | 1987-04-03 | 1990-09-27 | Sumitomo Chemical Company, Limited | A benzoylurea derivative and its production and use, and aniline intermediates therefor |
| IT1215550B (it) * | 1987-06-05 | 1990-02-14 | Donegani Guido Ist | Benzoil-uree ad attivita'insetticida |
| ES2055150T3 (es) * | 1988-02-04 | 1994-08-16 | Ciba Geigy Ag | N-benzoil-n'-trifluorofenilureas, su preparacion y empleo para el control de pestes. |
| JPH029855A (ja) * | 1988-03-31 | 1990-01-12 | Ishihara Sangyo Kaisha Ltd | 置換ベンゼン誘導体、それらの製造方法及びそれらを含有する抗癌性組成物 |
| GB8815882D0 (en) * | 1988-07-04 | 1988-08-10 | Shell Int Research | Benzoylthiourea compounds |
| EP0360748A1 (de) * | 1988-09-21 | 1990-03-28 | Ciba-Geigy Ag | Benzoylphenylharnstoffe |
| WO1990006680A1 (en) * | 1988-12-21 | 1990-06-28 | E.I. Du Pont De Nemours And Company | Insecticidal use of a benzoylurea |
| GB8829817D0 (en) * | 1988-12-21 | 1989-02-15 | Shell Int Research | Benzamide compounds,their preparation and their use as pesticides |
| GB8905741D0 (en) * | 1989-03-13 | 1989-04-26 | Shell Int Research | Process for preparing carbamates,and intermediates therin |
| WO1992012707A1 (en) * | 1991-01-22 | 1992-08-06 | E.I. Du Pont De Nemours And Company | A benzoylurea-containing composition for parasite control in animals |
| CA2176596A1 (en) * | 1993-11-18 | 1995-05-26 | Yoshio Katsuda | Use of benzoylureas for controlling house dust mites |
| ZA948564B (en) * | 1993-11-19 | 1995-07-26 | Bristol Myers Squibb Co | Liquid separation apparatus and method |
| FR2758050A1 (fr) * | 1997-01-06 | 1998-07-10 | American Home Prod | Methode pour lutter contre des populations de lepidopteres resistantes |
| US5874615A (en) * | 1998-03-17 | 1999-02-23 | American Cyanamid Co | Method for the preparation of insecticidal benzoylurea compounds |
| DE10013914A1 (de) | 2000-03-21 | 2001-09-27 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10043610A1 (de) * | 2000-09-05 | 2002-03-14 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10055941A1 (de) | 2000-11-10 | 2002-05-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10059606A1 (de) * | 2000-12-01 | 2002-06-06 | Bayer Ag | Wirkstoffkombinationen |
| DE10248257A1 (de) * | 2002-10-16 | 2004-04-29 | Bayer Cropscience Ag | Wirkstoffkombinationen im insektiziden und akariziden Eigenschaften |
| DE10353281A1 (de) | 2003-11-14 | 2005-06-16 | Bayer Cropscience Ag | Wirkstoffkombination mit insektiziden und akariziden Eigenschaften |
| DE102007045957A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akarziden Eigenschaften |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| WO2011043748A1 (en) | 2009-10-07 | 2011-04-14 | Chrysamed Ki̇mya Sanayi̇ Ve Diş Ti̇caret Li̇mi̇ted Şi̇rketi̇ | Composition used in the dissolution and stabilization of pesticide active agents |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
| EP2582239A1 (en) | 2010-06-21 | 2013-04-24 | Basf Se | Pesticidal composition comprising a benzoylurea compound and chlorfenapyr and their uses. |
| DK178649B1 (en) * | 2015-08-18 | 2016-10-17 | Niels Jørgen Olsen | Gutting Device |
| CN105646245A (zh) * | 2016-04-05 | 2016-06-08 | 叶芳 | 一种4-氨基-3-氟苯酚及其制备方法 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4013717A (en) * | 1970-05-15 | 1977-03-22 | U.S. Philips Corporation | Benzoyl phenyl urea derivatives having insecticidal activities |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
| DE2531202C2 (de) * | 1975-07-12 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| SU791197A3 (ru) * | 1975-07-24 | 1980-12-23 | Циба-Гейги Аг (Фирма) | Инсектоакарицидное средство |
| IL61273A (en) * | 1979-10-24 | 1984-02-29 | Basf Ag | Preparation of anilines and certain novel anilines |
| JPS572258A (en) * | 1980-05-30 | 1982-01-07 | Ishihara Sangyo Kaisha Ltd | N-benzoyl-n'-phenylurea compound, its preparation, and insecticide containing the same |
| JPS572259A (en) * | 1980-06-04 | 1982-01-07 | Ishihara Sangyo Kaisha Ltd | N-benzoyl-n'-phenoxyphenylurea compound, its preparation, and insecticide containing the same |
| DE3026825A1 (de) * | 1980-07-16 | 1982-02-18 | Basf Ag, 6700 Ludwigshafen | Substituierte n-benzoyl-n'-phenoxyphenylharnstoffe, ihre herstellung, ihre verwendung zur bekaempfung von bekaempfung von insekten und mittel dafuer |
| DE3104407A1 (de) * | 1981-02-07 | 1982-08-19 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| DE3135635A1 (de) * | 1981-09-09 | 1983-03-17 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von insekten |
| DE3217620A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,5-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| CA1205483A (en) * | 1982-06-30 | 1986-06-03 | David T. Chou | Pesticidal 1-(alkyl phenoxyaryl)-3-benzoyl ureas and process for preparation |
| US4529819A (en) * | 1982-08-02 | 1985-07-16 | The Dow Chemical Company | Method for making benzoylphenylureas |
| DE3371508D1 (en) * | 1983-01-24 | 1987-06-19 | Duphar Int Res | Benzoylurea compounds, and pesticidal and pharmaceutical compositions comprising same |
| ATE28862T1 (de) * | 1983-01-24 | 1987-08-15 | Duphar Int Res | Aktive kompositionen gegen motten, weisse fliegen und holzwuermer, pharmazeutische kompositionen und benzoylharnstoffderivaten. |
| DE3500468A1 (de) * | 1984-01-21 | 1985-08-01 | Bayer Ag, 5090 Leverkusen | Schneckenbekaempfungsmittel |
-
1985
- 1985-03-27 CA CA000477604A patent/CA1339745C/en not_active Expired - Lifetime
- 1985-04-03 EP EP85200525A patent/EP0161019B1/en not_active Expired
- 1985-04-03 DE DE8585200525T patent/DE3567858D1/de not_active Expired
- 1985-04-04 NZ NZ211686A patent/NZ211686A/en unknown
- 1985-04-08 KR KR1019850002353A patent/KR940000813B1/ko not_active Expired - Lifetime
- 1985-04-09 IN IN299/DEL/85A patent/IN163910B/en unknown
- 1985-04-09 IL IL74851A patent/IL74851A/xx not_active IP Right Cessation
- 1985-04-09 PH PH32109A patent/PH20753A/en unknown
- 1985-04-09 TR TR18002/85A patent/TR22406A/xx unknown
- 1985-04-09 OA OA58563A patent/OA07987A/xx unknown
- 1985-04-09 MX MX204886A patent/MX160641A/es unknown
- 1985-04-09 AU AU40924/85A patent/AU571672B2/en not_active Expired
- 1985-04-09 JP JP60073675A patent/JPH0623164B2/ja not_active Expired - Lifetime
- 1985-04-09 PL PL1985252849A patent/PL145321B1/pl unknown
- 1985-04-09 DK DK159585A patent/DK161643C/da not_active IP Right Cessation
- 1985-04-09 ZW ZW69/85A patent/ZW6985A1/xx unknown
- 1985-04-09 GR GR850902A patent/GR850902B/el not_active IP Right Cessation
- 1985-04-09 CS CS852624A patent/CS268519B2/cs not_active IP Right Cessation
- 1985-04-09 ES ES542051A patent/ES8607220A1/es not_active Expired
- 1985-04-09 BR BR8501657A patent/BR8501657A/pt not_active IP Right Cessation
- 1985-04-09 HU HU851304A patent/HU197721B/hu unknown
- 1985-04-10 EG EG234/85A patent/EG17741A/xx active
- 1985-08-19 SU SU853940050A patent/SU1447278A3/ru active
- 1985-10-16 ES ES547903A patent/ES8605465A1/es not_active Expired
-
1986
- 1986-07-24 US US06/889,523 patent/US4666942A/en not_active Expired - Fee Related
- 1986-11-25 US US06/935,155 patent/US4698365A/en not_active Expired - Fee Related
Non-Patent Citations (1)
| Title |
|---|
| Патент GB № 1460419, кл. С 2 С, опублик. 1968. Патент GB № 1324293, кл. С 2 С, опублик. 1965, 54) СПОСОБ ПОЛУЧЕНИЯ ПРОИЗВОДНЫХ ВЕНЗОИЛМОЧЕВИНЫ * |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1447278A3 (ru) | Способ получени производных бензоилмочевины | |
| US4013717A (en) | Benzoyl phenyl urea derivatives having insecticidal activities | |
| US4833151A (en) | Insecticidal Ureas and thioureas | |
| US4468405A (en) | Substituted N-aroyl N'-phenyl urea compounds | |
| CA1202962A (en) | Substituted n-phenyl-n'-benzoyl ureas and their use as insecticides and acaricides | |
| US4238497A (en) | Imidazoline derivatives, salts thereof and their use as pesticides | |
| EP0329020B1 (en) | Pyrazole derivatives, processes for their manufacture and insecticidal, miticidal and fungicidal compositions containg the derivatives as active ingredients | |
| US3818032A (en) | Substituted 1-phenyl-2,5-dioxo imidazolidines | |
| US4531002A (en) | Process for preparing insecticidal N-acyl-tetrahydro-2-nitromethylene-2H-1,3-thiazines | |
| US4665097A (en) | Novel bicyclooxyaryl thioureas and process for preparation | |
| EP0154508B1 (en) | Thiophenylureas, their production and use | |
| KR960012172B1 (ko) | 피라졸 유도체 및 이 유도체를 활성 성분으로 함유하는 살충제 및 살비제 조성물 | |
| US4276309A (en) | Acylurea insecticides | |
| FI84601C (fi) | Nya pesticidala n-substituerade heterocykliska nitrometylenfoereningar. | |
| CN1055083C (zh) | 用于杀虫杀螨的吡唑类化合物及其制剂 | |
| US6051737A (en) | Aryl benzoyl urea derivative and pesticidal composition comprising the same | |
| SU799662A3 (ru) | Способ получени производныхбЕНзОилМОчЕВиНы | |
| US4308258A (en) | Pyrimidin-4-yl-phosphorus esters and insecticidal, acaricidal or nematocidal compositions and methods using them | |
| US4358408A (en) | Propane-1,2-dionedioximes, pesticides containing these compounds, and the method for their preparation | |
| US4011343A (en) | Triazapentadienes as acaricides and insecticides | |
| US4873264A (en) | Novel pesticidal 1-(alkyl-phenoxy-aryl)-3-benzoyl ureas and process for preparation | |
| US4279897A (en) | (Alkoxycarbonyl)(alkyl)aminosulfenyl derivatives of phosphoramidothioate esters | |
| SU1402254A3 (ru) | Способ получени производных бензоилмочевины | |
| CS246092B2 (en) | Fungicide and method of its efficient component production | |
| EP0866056B1 (en) | N- (fluoroalkoxy)phenoxyalkyl]benzamide compounds, intermediates thereof, process for producing the same, and agricultural and horticultural pesticides |