SU1138020A3 - Способ получени производных 2,3,4-тринор- @ -интер-фениленпростагландина - Google Patents
Способ получени производных 2,3,4-тринор- @ -интер-фениленпростагландина Download PDFInfo
- Publication number
- SU1138020A3 SU1138020A3 SU823424149A SU3424149A SU1138020A3 SU 1138020 A3 SU1138020 A3 SU 1138020A3 SU 823424149 A SU823424149 A SU 823424149A SU 3424149 A SU3424149 A SU 3424149A SU 1138020 A3 SU1138020 A3 SU 1138020A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- formula
- compound
- carbon atoms
- hydrogen
- inter
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 17
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- -1 alkali metal cation Chemical class 0.000 claims abstract description 12
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 11
- 125000003277 amino group Chemical group 0.000 claims abstract description 8
- 239000002585 base Substances 0.000 claims abstract description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 3
- 150000001450 anions Chemical class 0.000 claims abstract description 3
- 239000000010 aprotic solvent Substances 0.000 claims abstract description 3
- 150000004714 phosphonium salts Chemical class 0.000 claims abstract description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 claims abstract description 3
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims abstract description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims abstract 2
- 125000001589 carboacyl group Chemical group 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 claims description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 230000020176 deacylation Effects 0.000 claims description 2
- 238000005947 deacylation reaction Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 125000005236 alkanoylamino group Chemical group 0.000 abstract description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 3
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 2
- 125000002619 bicyclic group Chemical group 0.000 abstract description 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 abstract description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 abstract description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 abstract description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004665 trialkylsilyl group Chemical group 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 32
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- 150000004702 methyl esters Chemical class 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000012043 crude product Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000003180 prostaglandins Chemical class 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 125000006633 tert-butoxycarbonylamino group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- LZLOFGMGFADIKQ-UHFFFAOYSA-N benzene;1,4-dioxane Chemical compound C1COCCO1.C1=CC=CC=C1 LZLOFGMGFADIKQ-UHFFFAOYSA-N 0.000 description 2
- FUJOVDPEIYDEJE-UHFFFAOYSA-N benzene;dioxane Chemical compound C1CCOOC1.C1=CC=CC=C1 FUJOVDPEIYDEJE-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 230000002744 anti-aggregatory effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- OKKJLVBELUTLKV-MICDWDOJSA-N deuteriomethanol Chemical compound [2H]CO OKKJLVBELUTLKV-MICDWDOJSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000006772 olefination reaction Methods 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical class [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 210000004623 platelet-rich plasma Anatomy 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
- C07D307/937—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans with hydrocarbon or substituted hydrocarbon radicals directly attached in position 2, e.g. prostacyclins
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
- C07C405/0008—Analogues having the carboxyl group in the side-chains replaced by other functional groups
- C07C405/0041—Analogues having the carboxyl group in the side-chains replaced by other functional groups containing nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU96281A HU189974B (hu) | 1981-04-14 | 1981-04-14 | Eljárás 2,3,4-trinor-m-iníer-fenilidén-PGI2 származékok előállítására |
| HU96381A HU188286B (hu) | 1981-04-14 | 1981-04-14 | ELJÁRÁS 23,4-TRINOR-M-INTER-FENILIDÉN-PGl! SZÁRMAZÉKOK ELŐÁLLÍTÁSÁRA |
| HU96481A HU188009B (en) | 1981-04-14 | 1981-04-14 | Process for preparing new derivatives of 2,3,4-trinor-1,5-inter-m-phenylene-pgt down 2alpha |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1138020A3 true SU1138020A3 (ru) | 1985-01-30 |
Family
ID=27269950
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU823424149A SU1138020A3 (ru) | 1981-04-14 | 1982-04-13 | Способ получени производных 2,3,4-тринор- @ -интер-фениленпростагландина |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4451483A (enExample) |
| EP (1) | EP0062902B1 (enExample) |
| AT (1) | AT381494B (enExample) |
| CS (1) | CS241102B2 (enExample) |
| DD (1) | DD202434A5 (enExample) |
| DE (1) | DE3268487D1 (enExample) |
| DK (1) | DK165882A (enExample) |
| FI (1) | FI75156C (enExample) |
| GR (1) | GR76127B (enExample) |
| IL (1) | IL65387A0 (enExample) |
| PL (1) | PL129427B1 (enExample) |
| SU (1) | SU1138020A3 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL67332A (en) * | 1981-12-01 | 1985-12-31 | Chinoin Gyogyszer Es Vegyeszet | Inter-m-phenylene-prostacyclin analogues,process for the preparation thereof and pharmaceutical compositions containing them |
| HU188559B (en) * | 1981-12-01 | 1986-04-28 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt,Hu | Process for preparing new inter-m-phenylene-prostacyclin derivatives |
| HU190007B (en) * | 1982-05-06 | 1986-08-28 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt,Hu | Process for producing new aromatic prostacylin analogues |
| DE3317159A1 (de) * | 1982-05-27 | 1983-12-01 | Grünenthal GmbH, 5190 Stolberg | Verfahren zur herstellung von 5z-formen von 2,3,4-trinor-1,5-inter-m-phenylen- prostacyclinderivaten |
| AT381309B (de) * | 1982-05-27 | 1986-09-25 | Gruenenthal Gmbh | Verfahren zur herstellung von 5z-formen von 2,3,4 -trinor-1,5-inter-m-phenylen-prostacyclinderiva en |
| US4474804A (en) * | 1983-09-19 | 1984-10-02 | E. R. Squibb & Sons, Inc. | 7-Oxabicyclo substituted prostaglandin phenyl carboxylic acid derivatives useful as cardiovascular agents |
| DE3408699A1 (de) * | 1984-03-08 | 1985-09-12 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue carbacycline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US5661178A (en) * | 1995-09-01 | 1997-08-26 | Allergan | Method for effecting vasodilation with (1,5-inter)aryl prostaglandin derivatives |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE795200A (fr) * | 1972-05-10 | 1973-08-09 | Ciba Geigy | Nouveaux oxabicyclooctanes et leurs procedes de preparation |
| HU179001B (en) * | 1978-05-29 | 1982-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing 5-halo-6,9alpha-oxido-prostaglandin derivatives |
| US4312810A (en) * | 1978-11-22 | 1982-01-26 | The Upjohn Company | 2,5-Inter-o-phenylene-3,4-dinor-5,9α-epoxy-9-deoxy-PGF1 compounds |
| DE3029984C2 (de) * | 1980-08-08 | 1983-12-15 | Grünenthal GmbH, 5190 Stolberg | 2-Oxabicyclo [3.3.0] octanderivate und diese enthaltende Arzneimittel |
-
1982
- 1982-03-30 IL IL65387A patent/IL65387A0/xx not_active IP Right Cessation
- 1982-04-02 FI FI821164A patent/FI75156C/fi not_active IP Right Cessation
- 1982-04-08 AT AT0139282A patent/AT381494B/de not_active IP Right Cessation
- 1982-04-08 EP EP82103024A patent/EP0062902B1/de not_active Expired
- 1982-04-08 DE DE8282103024T patent/DE3268487D1/de not_active Expired
- 1982-04-09 CS CS822561A patent/CS241102B2/cs unknown
- 1982-04-09 US US06/367,068 patent/US4451483A/en not_active Expired - Fee Related
- 1982-04-13 PL PL1982235949A patent/PL129427B1/pl unknown
- 1982-04-13 SU SU823424149A patent/SU1138020A3/ru active
- 1982-04-13 GR GR67910A patent/GR76127B/el unknown
- 1982-04-13 DD DD82238954A patent/DD202434A5/de not_active IP Right Cessation
- 1982-04-13 DK DK165882A patent/DK165882A/da not_active IP Right Cessation
Non-Patent Citations (1)
| Title |
|---|
| 1. E.J. Corey et al. Total Synthesis of Prosfaglandins и E2 as the Naturally Occurinp Forms. - Y. Amer. Chera. Soc., 92, 397 * |
Also Published As
| Publication number | Publication date |
|---|---|
| US4451483A (en) | 1984-05-29 |
| PL235949A1 (en) | 1983-01-03 |
| DK165882A (da) | 1982-10-15 |
| DD202434A5 (de) | 1983-09-14 |
| FI821164L (fi) | 1982-10-15 |
| DE3268487D1 (en) | 1986-02-27 |
| FI821164A0 (fi) | 1982-04-02 |
| ATA139282A (de) | 1986-03-15 |
| FI75156C (fi) | 1988-05-09 |
| GR76127B (enExample) | 1984-08-03 |
| EP0062902B1 (de) | 1986-01-15 |
| FI75156B (fi) | 1988-01-29 |
| AT381494B (de) | 1986-10-27 |
| CS241102B2 (en) | 1986-03-13 |
| CS256182A2 (en) | 1985-07-16 |
| IL65387A0 (en) | 1982-05-31 |
| PL129427B1 (en) | 1984-05-31 |
| EP0062902A1 (de) | 1982-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0744400A2 (en) | Process for producing 4-trifluoromethylnicotinic acid | |
| SU921465A3 (ru) | Способ получени производных простана или их солей | |
| DK158672B (da) | Fremgangsmaade til fremstilling af 3-substitueret-methyl-7-methoxy-7beta-(2-substitueret-amido)-3-cephem-4-carboxylsyrer og alkalimetalsalte deraf. | |
| KR20130018809A (ko) | 술폰아미도―벤조푸란 유도체의 제조 방법 | |
| SU1138020A3 (ru) | Способ получени производных 2,3,4-тринор- @ -интер-фениленпростагландина | |
| BG97471A (bg) | Метод за получаване на 13,14-дихидро-15(r)-17-фенил- 18,19,20-тринор-рgf долу 2 алфа естери | |
| US4143046A (en) | Carbon and oxygen analogs of penicillin | |
| Bukownik et al. | Synthetic receptors. 3, 6-Anhydro-7-benzenesulfonamido-1, 7-dideoxy-4, 5-O-isopropylidene-D-altro-hept-1-ynitol: A useful component for the preparation of chiral water-soluble cyclophanes based on carbohydrate precursors | |
| SG188948A1 (en) | Process for preparing 2-hydroxybutyrolactone | |
| US4282149A (en) | Carbon and oxygen analogs of penicillin | |
| SU1277897A3 (ru) | Способ получени 1,1-диоксо-6-бром(или-6,6-дибром)пеницилланоилоксиметиловых эфиров 6-(2-азидо-2-фенилацетамидо)пенициллановой кислоты | |
| Ward et al. | Synthesis of (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate, a key intermediate in the biosynthesis of isoprenoids | |
| JP2991348B2 (ja) | 7−(ジフェニルメチル)オキシ−9a−メトキシマイトサン並びにその製造及び使用 | |
| US4755612A (en) | Intermediate compounds resulting from method for forming a dihydrogen-phosphate inositol | |
| SU955861A3 (ru) | Способ получени производных стрептоварицина с | |
| JPWO2018220888A1 (ja) | Pge1コアブロック誘導体およびその製造方法 | |
| Turkenburg et al. | SN2 substitution with inversion at a cyclopropyl carbon atom: formation of 9-oxatetracyclo [6.2. 1.01, 6.06, 10] undecane | |
| US4107181A (en) | Useful prostaglandin intermediates | |
| FI71562C (fi) | Foerfarande foer framstaellning av 6- - substituerade penicillansyraderivat och saosom mellanprodukter anvaendbara 6-perfluoralkylsulfonyloxipenicillansyraderivat. | |
| Barili et al. | Alkaline and enzymatic hydrolysis of isobutyl 3, 4-anhydro-2, 6-dideoxy-DL-hexopyranosides. Preparation of enantiomeric boivinopyranosides through a highly efficient kinetic resolution | |
| EP0135683B1 (en) | Method for production of cephalosporin compounds | |
| RU1830070C (ru) | Способ получени аллил-7 @ -феноксиацетиламино-3-метил-1-карба(детиа)-3-цефем-4-карбоксилата | |
| US4176122A (en) | Process for the preparation of bicyclic enone compounds | |
| SU1291587A1 (ru) | Способ получени простагландина @ 2 @ или его аналогов | |
| Christov et al. | Alkatrienyl sulfoxides and sulfones. Part II.[1](5-methyl-1, 3, 4-hexatriene-3-yl) phenyl sulfoxide-synthesis and electrophile-promoted cyclization reactions |