SK286759B6 - Tetrahydrochinolínové deriváty, farmaceutický prostriedok s ich obsahom a ich použitie - Google Patents
Tetrahydrochinolínové deriváty, farmaceutický prostriedok s ich obsahom a ich použitie Download PDFInfo
- Publication number
- SK286759B6 SK286759B6 SK1634-2003A SK16342003A SK286759B6 SK 286759 B6 SK286759 B6 SK 286759B6 SK 16342003 A SK16342003 A SK 16342003A SK 286759 B6 SK286759 B6 SK 286759B6
- Authority
- SK
- Slovakia
- Prior art keywords
- alkyl
- phenyl
- acetyl
- tetrahydro
- amino
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 10
- 125000000147 tetrahydroquinolinyl group Chemical class N1(CCCC2=CC=CC=C12)* 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 title description 80
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 189
- -1 nitro hydroxyl Chemical group 0.000 claims abstract description 69
- 125000003118 aryl group Chemical group 0.000 claims abstract description 58
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 39
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 33
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims abstract description 32
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 30
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 23
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 20
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 18
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 17
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 17
- 150000002367 halogens Chemical class 0.000 claims abstract description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 14
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 12
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims abstract description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 10
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims abstract description 9
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 9
- 150000003839 salts Chemical class 0.000 claims abstract description 9
- 230000035558 fertility Effects 0.000 claims abstract description 6
- 125000003670 adamantan-2-yl group Chemical group [H]C1([H])C(C2([H])[H])([H])C([H])([H])C3([H])C([*])([H])C1([H])C([H])([H])C2([H])C3([H])[H] 0.000 claims abstract description 4
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims abstract description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 4
- RTWPATFTOPMBPW-UHFFFAOYSA-N 1-(6-amino-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(N)C=C2C1(C)C1=CC=CC=C1 RTWPATFTOPMBPW-UHFFFAOYSA-N 0.000 claims description 38
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 19
- 150000003530 tetrahydroquinolines Chemical class 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 125000005199 aryl carbonyloxy group Chemical group 0.000 claims description 8
- 125000004104 aryloxy group Chemical group 0.000 claims description 7
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 6
- 125000001769 aryl amino group Chemical group 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 5
- 125000005116 aryl carbamoyl group Chemical group 0.000 claims description 5
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 5
- 125000005201 cycloalkylcarbonyloxy group Chemical group 0.000 claims description 5
- 125000005204 heteroarylcarbonyloxy group Chemical group 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- VMFDEEWJXWIULP-UHFFFAOYSA-N 1-(6-methoxy-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C12=CC(OC)=CC=C2N(C(C)=O)C(C)(C)CC1(C)C1=CC=CC=C1 VMFDEEWJXWIULP-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- IBPJOBWPZTZRQS-UHFFFAOYSA-N 1-(2,2,4,6,8-pentamethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=C(C)C=C(C)C=C2C1(C)C1=CC=CC=C1 IBPJOBWPZTZRQS-UHFFFAOYSA-N 0.000 claims description 3
- ZHNPUEPFTRRAJP-UHFFFAOYSA-N 1-[4-(4-chlorophenyl)-2,2,4,6-tetramethyl-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(C)C=C2C1(C)C1=CC=C(Cl)C=C1 ZHNPUEPFTRRAJP-UHFFFAOYSA-N 0.000 claims description 3
- ARWKEHPZVPYGDT-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-2,2,2-trifluoroacetamide Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)C(F)(F)F)C=C2C1(C)C1=CC=CC=C1 ARWKEHPZVPYGDT-UHFFFAOYSA-N 0.000 claims description 3
- QWLACKLMUBWFKR-UHFFFAOYSA-N n-[1-acetyl-2,2,4-trimethyl-4-(4-methylphenyl)-3h-quinolin-6-yl]benzamide Chemical compound C1=C2C(C)(C=3C=CC(C)=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1 QWLACKLMUBWFKR-UHFFFAOYSA-N 0.000 claims description 3
- 239000012453 solvate Substances 0.000 claims description 3
- WVAXDHRFGWSJSE-UHFFFAOYSA-N 1-[4-(4-bromophenyl)-2,2,4,6-tetramethyl-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(C)C=C2C1(C)C1=CC=C(Br)C=C1 WVAXDHRFGWSJSE-UHFFFAOYSA-N 0.000 claims description 2
- IUBSOZIHVZOVRB-UHFFFAOYSA-N 1-[6-amino-4-(4-aminophenyl)-2,2,4-trimethyl-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(N)C=C2C1(C)C1=CC=C(N)C=C1 IUBSOZIHVZOVRB-UHFFFAOYSA-N 0.000 claims description 2
- BMJCSYBLFOGGIA-UHFFFAOYSA-N n-[1-acetyl-2,2,4-trimethyl-4-(4-methylphenyl)-3h-quinolin-6-yl]-2,2,2-trifluoroacetamide Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)C(F)(F)F)C=C2C1(C)C1=CC=C(C)C=C1 BMJCSYBLFOGGIA-UHFFFAOYSA-N 0.000 claims description 2
- 125000005553 heteroaryloxy group Chemical group 0.000 claims 3
- ZXGXGZGKWSUMJK-UHFFFAOYSA-N 2,4,6-trimethylquinoline Chemical compound N1=C(C)C=C(C)C2=CC(C)=CC=C21 ZXGXGZGKWSUMJK-UHFFFAOYSA-N 0.000 claims 2
- UHWQFJIDBCYRIB-UHFFFAOYSA-N 1-(2,2,4,6-tetramethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(C)C=C2C1(C)C1=CC=CC=C1 UHWQFJIDBCYRIB-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 abstract description 9
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 1
- 238000000034 method Methods 0.000 description 155
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 102
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 98
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 84
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 81
- 238000004128 high performance liquid chromatography Methods 0.000 description 70
- 125000004432 carbon atom Chemical group C* 0.000 description 59
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 46
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 40
- 239000000203 mixture Substances 0.000 description 34
- 238000005917 acylation reaction Methods 0.000 description 29
- 230000010933 acylation Effects 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 26
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 238000009833 condensation Methods 0.000 description 24
- 230000005494 condensation Effects 0.000 description 24
- 239000012044 organic layer Substances 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 22
- 239000003480 eluent Substances 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 description 17
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 210000004027 cell Anatomy 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- 229940028334 follicle stimulating hormone Drugs 0.000 description 15
- 125000005842 heteroatom Chemical group 0.000 description 15
- 102000005962 receptors Human genes 0.000 description 15
- 108020003175 receptors Proteins 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- DKUNOXZTJNCJDK-UHFFFAOYSA-N 2,2,4-trimethyl-4-phenyl-3H-quinolin-1-amine Chemical compound CC1(C)CC(C)(c2ccccc2)c2ccccc2N1N DKUNOXZTJNCJDK-UHFFFAOYSA-N 0.000 description 11
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 11
- 108010060374 FSH Receptors Proteins 0.000 description 10
- 238000003547 Friedel-Crafts alkylation reaction Methods 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 9
- 102000008175 FSH Receptors Human genes 0.000 description 9
- 239000011630 iodine Substances 0.000 description 9
- 229910052740 iodine Inorganic materials 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 230000014509 gene expression Effects 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 7
- 230000027455 binding Effects 0.000 description 7
- 238000009739 binding Methods 0.000 description 7
- 230000001404 mediated effect Effects 0.000 description 7
- BALPUPABKHYFCR-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-2-hydroxybenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1O BALPUPABKHYFCR-UHFFFAOYSA-N 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- WVUMXBUVLLSUMD-UHFFFAOYSA-N 3-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)amino]-3-oxopropanoic acid Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)CC(O)=O)C=C2C1(C)C1=CC=CC=C1 WVUMXBUVLLSUMD-UHFFFAOYSA-N 0.000 description 6
- JPVUWCPKMYXOKW-UHFFFAOYSA-N 4-phenylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=CC=CC=C1 JPVUWCPKMYXOKW-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- OZXIZRZFGJZWBF-UHFFFAOYSA-N 1,3,5-trimethyl-2-(2,4,6-trimethylphenoxy)benzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=C(C)C=C(C)C=C1C OZXIZRZFGJZWBF-UHFFFAOYSA-N 0.000 description 5
- YIPDIHSVBRGRSA-UHFFFAOYSA-N 1-(6-hydroxy-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(O)C=C2C1(C)C1=CC=CC=C1 YIPDIHSVBRGRSA-UHFFFAOYSA-N 0.000 description 5
- GGIIQCYBWGKCMT-UHFFFAOYSA-N 1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinoline-6-carboxylic acid Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(C(O)=O)C=C2C1(C)C1=CC=CC=C1 GGIIQCYBWGKCMT-UHFFFAOYSA-N 0.000 description 5
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical class C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 5
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- 108020004414 DNA Proteins 0.000 description 5
- 108700008625 Reporter Genes Proteins 0.000 description 5
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- SHOJXDKTYKFBRD-UHFFFAOYSA-N mesityl oxide Natural products CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 230000000638 stimulation Effects 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- LBUJPTNKIBCYBY-UHFFFAOYSA-N tetrahydroquinoline Natural products C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 5
- UKSZBOKPHAQOMP-SVLSSHOZSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 UKSZBOKPHAQOMP-SVLSSHOZSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 102000006771 Gonadotropins Human genes 0.000 description 4
- 108010086677 Gonadotropins Proteins 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000005614 Skraup synthesis reaction Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 239000002622 gonadotropin Substances 0.000 description 4
- 229940094892 gonadotropins Drugs 0.000 description 4
- 229940088597 hormone Drugs 0.000 description 4
- 239000005556 hormone Substances 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- 208000000509 infertility Diseases 0.000 description 4
- 230000036512 infertility Effects 0.000 description 4
- 231100000535 infertility Toxicity 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 4
- SAZUCVCMGQEWDD-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-2-bromoacetamide Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)CBr)C=C2C1(C)C1=CC=CC=C1 SAZUCVCMGQEWDD-UHFFFAOYSA-N 0.000 description 4
- 230000016087 ovulation Effects 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- IBZVSQSOMRCRCD-UHFFFAOYSA-N tert-butyl n-(1-acetyl-2,2,4-trimethylquinolin-6-yl)carbamate Chemical compound C1=C(NC(=O)OC(C)(C)C)C=C2C(C)=CC(C)(C)N(C(=O)C)C2=C1 IBZVSQSOMRCRCD-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- DVDCSCQKHZSVFO-UHFFFAOYSA-N 1-[2-amino-1-methyl-4-(2,2,4-trimethyl-3,4-dihydroquinoline-1-carbonyl)cyclohexa-2,4-dien-1-yl]ethanone Chemical compound C12=CC=CC=C2C(C)CC(C)(C)N1C(=O)C1=CCC(C)(C(C)=O)C(N)=C1 DVDCSCQKHZSVFO-UHFFFAOYSA-N 0.000 description 3
- XESZUVZBAMCAEJ-UHFFFAOYSA-N 4-tert-butylcatechol Chemical compound CC(C)(C)C1=CC=C(O)C(O)=C1 XESZUVZBAMCAEJ-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 108060001084 Luciferase Proteins 0.000 description 3
- 239000005089 Luciferase Substances 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 238000006069 Suzuki reaction reaction Methods 0.000 description 3
- 238000007239 Wittig reaction Methods 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 125000005620 boronic acid group Chemical class 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 229940011871 estrogen Drugs 0.000 description 3
- 239000000262 estrogen Substances 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 210000001672 ovary Anatomy 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000005694 sulfonylation reaction Methods 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- TXFUWJLANVJXMK-UHFFFAOYSA-N tert-butyl n-(2,2,4-trimethyl-1h-quinolin-6-yl)carbamate Chemical compound C1=C(NC(=O)OC(C)(C)C)C=C2C(C)=CC(C)(C)NC2=C1 TXFUWJLANVJXMK-UHFFFAOYSA-N 0.000 description 3
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 2
- JTNDKSZCEDNYRI-UHFFFAOYSA-N 1-(6-amino-2,2,4,7-tetramethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC(C)=C(N)C=C2C1(C)C1=CC=CC=C1 JTNDKSZCEDNYRI-UHFFFAOYSA-N 0.000 description 2
- OWTGKQWLJGUEGQ-UHFFFAOYSA-N 1-(6-amino-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)butan-1-one Chemical compound C1C(C)(C)N(C(=O)CCC)C2=CC=C(N)C=C2C1(C)C1=CC=CC=C1 OWTGKQWLJGUEGQ-UHFFFAOYSA-N 0.000 description 2
- VXFOHILKMVCNDF-UHFFFAOYSA-N 1-(6-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone Chemical compound CC(=O)N1C(C)(C)CC(C)C2=CC(CC)=CC=C21 VXFOHILKMVCNDF-UHFFFAOYSA-N 0.000 description 2
- OCMSPQRCCCTMMQ-UHFFFAOYSA-N 1-(6-ethyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C12=CC(CC)=CC=C2N(C(C)=O)C(C)(C)CC1(C)C1=CC=CC=C1 OCMSPQRCCCTMMQ-UHFFFAOYSA-N 0.000 description 2
- UCSNTTGDGGCVRT-UHFFFAOYSA-N 1-(6-iodo-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(I)C=C2C1(C)C1=CC=CC=C1 UCSNTTGDGGCVRT-UHFFFAOYSA-N 0.000 description 2
- OOTICFCGEDWGQQ-UHFFFAOYSA-N 1-(6-methoxy-2,2,4-trimethylquinolin-1-yl)ethanone Chemical compound CC(=O)N1C(C)(C)C=C(C)C2=CC(OC)=CC=C21 OOTICFCGEDWGQQ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- IPOVOSHRRIJKBR-UHFFFAOYSA-N 2-ethylpropanedioyl dichloride Chemical compound CCC(C(Cl)=O)C(Cl)=O IPOVOSHRRIJKBR-UHFFFAOYSA-N 0.000 description 2
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- LTPVSOCPYWDIFU-UHFFFAOYSA-N 4-methoxyphenylethylamine Chemical compound COC1=CC=C(CCN)C=C1 LTPVSOCPYWDIFU-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- YZPJUVSKXVLDHD-UHFFFAOYSA-N 6-ethyl-2,2,4-trimethyl-1h-quinoline Chemical compound N1C(C)(C)C=C(C)C2=CC(CC)=CC=C21 YZPJUVSKXVLDHD-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 206010006187 Breast cancer Diseases 0.000 description 2
- 208000026310 Breast neoplasm Diseases 0.000 description 2
- ALAHZHYWFPNPBW-UHFFFAOYSA-N C(=O)=C1C(NC2=CC=CC=C2C1(C)C1=CC=CC=C1)(C)C Chemical compound C(=O)=C1C(NC2=CC=CC=C2C1(C)C1=CC=CC=C1)(C)C ALAHZHYWFPNPBW-UHFFFAOYSA-N 0.000 description 2
- 108091026890 Coding region Proteins 0.000 description 2
- 201000009273 Endometriosis Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 102000003864 Human Follicle Stimulating Hormone Human genes 0.000 description 2
- 108010082302 Human Follicle Stimulating Hormone Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- 102000009151 Luteinizing Hormone Human genes 0.000 description 2
- 108010073521 Luteinizing Hormone Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 206010060862 Prostate cancer Diseases 0.000 description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 239000012317 TBTU Substances 0.000 description 2
- VIIGZJSYXKWUQC-UHFFFAOYSA-N [2-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamoyl]phenyl] methanesulfonate Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1OS(C)(=O)=O VIIGZJSYXKWUQC-UHFFFAOYSA-N 0.000 description 2
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 125000005097 aminocarbonylalkyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 235000015165 citric acid Nutrition 0.000 description 2
- 229960004106 citric acid Drugs 0.000 description 2
- 239000003433 contraceptive agent Substances 0.000 description 2
- 239000007822 coupling agent Substances 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- QTWDMQAGAOCBLT-UHFFFAOYSA-N methyl 1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinoline-6-carboxylate Chemical compound C12=CC(C(=O)OC)=CC=C2N(C(C)=O)C(C)(C)CC1(C)C1=CC=CC=C1 QTWDMQAGAOCBLT-UHFFFAOYSA-N 0.000 description 2
- MYLGEZKRNQBATR-UHFFFAOYSA-N methyl 1-acetyl-2,2,4-trimethylquinoline-6-carboxylate Chemical compound CC(=O)N1C(C)(C)C=C(C)C2=CC(C(=O)OC)=CC=C21 MYLGEZKRNQBATR-UHFFFAOYSA-N 0.000 description 2
- QGKRIVOUJPTDSH-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)prop-2-enamide Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)C=C)C=C2C1(C)C1=CC=CC=C1 QGKRIVOUJPTDSH-UHFFFAOYSA-N 0.000 description 2
- IMQMFWWDTYSSIV-UHFFFAOYSA-N n-[1-acetyl-4-(4-methoxyphenyl)-2,2,4-trimethyl-3h-quinolin-6-yl]-4-phenylbenzamide Chemical compound C1=CC(OC)=CC=C1C1(C)C2=CC(NC(=O)C=3C=CC(=CC=3)C=3C=CC=CC=3)=CC=C2N(C(C)=O)C(C)(C)C1 IMQMFWWDTYSSIV-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000002611 ovarian Effects 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000005022 packaging material Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- 230000023603 positive regulation of transcription initiation, DNA-dependent Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 230000004936 stimulating effect Effects 0.000 description 2
- 230000006103 sulfonylation Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- WWEJANUNXGNDAC-UHFFFAOYSA-N tert-butyl n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamate Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)OC(C)(C)C)C=C2C1(C)C1=CC=CC=C1 WWEJANUNXGNDAC-UHFFFAOYSA-N 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- FJAMXDQPTNGZQQ-UHFFFAOYSA-N (1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl) 3,3-dimethylbutanoate Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(OC(=O)CC(C)(C)C)C=C2C1(C)C1=CC=CC=C1 FJAMXDQPTNGZQQ-UHFFFAOYSA-N 0.000 description 1
- OVWRFBGLNCIAAX-UHFFFAOYSA-N (1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl) 4-phenylbenzoate Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1OC(=O)C(C=C1)=CC=C1C1=CC=CC=C1 OVWRFBGLNCIAAX-UHFFFAOYSA-N 0.000 description 1
- QDZZDVQGBKTLHV-UHFFFAOYSA-N (2,4-difluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1F QDZZDVQGBKTLHV-UHFFFAOYSA-N 0.000 description 1
- BUJDEEFZFZDYAT-UHFFFAOYSA-N (4-methoxyphenyl)methyl 1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinoline-6-carboxylate Chemical compound C1=CC(OC)=CC=C1COC(=O)C1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 BUJDEEFZFZDYAT-UHFFFAOYSA-N 0.000 description 1
- XPEIJWZLPWNNOK-UHFFFAOYSA-N (4-phenylphenyl)boronic acid Chemical compound C1=CC(B(O)O)=CC=C1C1=CC=CC=C1 XPEIJWZLPWNNOK-UHFFFAOYSA-N 0.000 description 1
- HXKMSGJZDDVPRX-UHFFFAOYSA-N (5-amino-2,2,4-trimethyl-1H-quinolin-3-yl)-(4-methylcyclohex-2-en-1-yl)methanone Chemical compound NC1=C2C(=C(C(NC2=CC=C1)(C)C)C(=O)C1CCC(C=C1)C)C HXKMSGJZDDVPRX-UHFFFAOYSA-N 0.000 description 1
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- IDPURXSQCKYKIJ-UHFFFAOYSA-N 1-(4-methoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1 IDPURXSQCKYKIJ-UHFFFAOYSA-N 0.000 description 1
- VLVFAFKKURSCGE-UHFFFAOYSA-N 1-(6-amino-2,2,4,7-tetramethylquinolin-1-yl)ethanone Chemical compound CC1=C(N)C=C2C(C)=CC(C)(C)N(C(=O)C)C2=C1 VLVFAFKKURSCGE-UHFFFAOYSA-N 0.000 description 1
- UXHPBUMRPIXRDI-UHFFFAOYSA-N 1-(6-amino-8-methoxy-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl)ethanone Chemical compound COC1=CC(N)=CC2=C1N(C(C)=O)C(C)(C)CC2(C)C1=CC=CC=C1 UXHPBUMRPIXRDI-UHFFFAOYSA-N 0.000 description 1
- OCGNQJCQAQWYOI-UHFFFAOYSA-N 1-(chloromethyl)-4-propylbenzene Chemical compound CCCC1=CC=C(CCl)C=C1 OCGNQJCQAQWYOI-UHFFFAOYSA-N 0.000 description 1
- MQLHMHPVIUUBQS-UHFFFAOYSA-N 1-[2,2,4-trimethyl-4-phenyl-6-(pyridin-3-ylmethoxy)-3h-quinolin-1-yl]ethanone Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1OCC1=CC=CN=C1 MQLHMHPVIUUBQS-UHFFFAOYSA-N 0.000 description 1
- PEXZKGBWVGEAOE-UHFFFAOYSA-N 1-[3-amino-2,2,4-trimethyl-6-(4-phenylbenzoyl)quinolin-1-yl]ethanone Chemical compound C(C)(=O)N1C(C(=C(C2=CC(=CC=C12)C(C1=CC=C(C=C1)C1=CC=CC=C1)=O)C)N)(C)C PEXZKGBWVGEAOE-UHFFFAOYSA-N 0.000 description 1
- BWMPQPAQUSSNOI-UHFFFAOYSA-N 1-[3-amino-4-(2-methoxyphenyl)-2,2,4-trimethyl-6-(4-phenylbenzoyl)-3H-quinolin-1-yl]ethanone Chemical compound C(C)(=O)N1C(C(C(C2=CC(=CC=C12)C(C1=CC=C(C=C1)C1=CC=CC=C1)=O)(C)C1=C(C=CC=C1)OC)N)(C)C BWMPQPAQUSSNOI-UHFFFAOYSA-N 0.000 description 1
- DXBSTBZXTPRIBK-UHFFFAOYSA-N 1-[3-amino-6-[(4-tert-butylphenyl)methyl]-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl]ethanone Chemical compound C(C)(=O)N1C(C(C(C2=CC(=CC=C12)CC1=CC=C(C=C1)C(C)(C)C)(C)C1=CC=CC=C1)N)(C)C DXBSTBZXTPRIBK-UHFFFAOYSA-N 0.000 description 1
- AYGMEZFQIYHBLH-UHFFFAOYSA-N 1-[6-(4-chlorophenyl)-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(C=3C=CC(Cl)=CC=3)C=C2C1(C)C1=CC=CC=C1 AYGMEZFQIYHBLH-UHFFFAOYSA-N 0.000 description 1
- FDADHBWOUHBOHU-UHFFFAOYSA-N 1-[6-(cyclopropylmethoxy)-2,2,4-trimethyl-4-phenyl-3h-quinolin-1-yl]ethanone Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1OCC1CC1 FDADHBWOUHBOHU-UHFFFAOYSA-N 0.000 description 1
- HIALKBFSMWTURD-UHFFFAOYSA-N 1-[6-amino-2,2,4-trimethyl-4-(4-methylbenzoyl)-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(N)C=C2C1(C)C(=O)C1=CC=C(C)C=C1 HIALKBFSMWTURD-UHFFFAOYSA-N 0.000 description 1
- PISQVMKYPCDABB-UHFFFAOYSA-N 1-[6-amino-4-(4-chlorophenyl)-2,2,4-trimethyl-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(N)C=C2C1(C)C1=CC=C(Cl)C=C1 PISQVMKYPCDABB-UHFFFAOYSA-N 0.000 description 1
- PPBBUHVIQDLGOI-UHFFFAOYSA-N 1-[6-amino-4-(4-fluorophenyl)-2,2,4-trimethyl-3h-quinolin-1-yl]ethanone Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(N)C=C2C1(C)C1=CC=C(F)C=C1 PPBBUHVIQDLGOI-UHFFFAOYSA-N 0.000 description 1
- GBYHIANUKWIMMJ-UHFFFAOYSA-N 1-acetyl-2,2,4-trimethyl-n-(2-methylsulfanylethyl)-4-phenyl-3h-quinoline-6-carboxamide Chemical compound C12=CC(C(=O)NCCSC)=CC=C2N(C(C)=O)C(C)(C)CC1(C)C1=CC=CC=C1 GBYHIANUKWIMMJ-UHFFFAOYSA-N 0.000 description 1
- LRYZMVUWQKWISQ-UHFFFAOYSA-N 1-acetyl-n-[2-(4-methoxyphenyl)ethyl]-2,2,4-trimethyl-4-phenyl-3h-quinoline-6-carboxamide Chemical compound C1=CC(OC)=CC=C1CCNC(=O)C1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 LRYZMVUWQKWISQ-UHFFFAOYSA-N 0.000 description 1
- WAXIFMGAKWIFDQ-UHFFFAOYSA-N 1-tert-butyl-4-(chloromethyl)benzene Chemical compound CC(C)(C)C1=CC=C(CCl)C=C1 WAXIFMGAKWIFDQ-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- HZIFZKIDDWEIGQ-UHFFFAOYSA-N 2,2,4-trimethyl-3,4-dihydroquinolin-1-amine Chemical compound NN1C(CC(C2=CC=CC=C12)C)(C)C HZIFZKIDDWEIGQ-UHFFFAOYSA-N 0.000 description 1
- XISJAYFEDONCPX-UHFFFAOYSA-N 2-(4-methylbenzoyl)oxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)OC1=CC=CC=C1C(O)=O XISJAYFEDONCPX-UHFFFAOYSA-N 0.000 description 1
- GIUTUZDGHNZVIA-UHFFFAOYSA-N 2-(ethylamino)acetic acid;hydrochloride Chemical compound Cl.CCNCC(O)=O GIUTUZDGHNZVIA-UHFFFAOYSA-N 0.000 description 1
- QVABAFHRLMDDLM-UHFFFAOYSA-N 2-acetamido-5-bromobenzoic acid Chemical compound CC(=O)NC1=CC=C(Br)C=C1C(O)=O QVABAFHRLMDDLM-UHFFFAOYSA-N 0.000 description 1
- BXZMXZPBJBRWMX-UHFFFAOYSA-N 2-acetamido-n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-5-bromobenzamide Chemical compound CC(=O)NC1=CC=C(Br)C=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 BXZMXZPBJBRWMX-UHFFFAOYSA-N 0.000 description 1
- LSRTWJCYIWGKCQ-UHFFFAOYSA-N 2-bromo-3-methylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1Br LSRTWJCYIWGKCQ-UHFFFAOYSA-N 0.000 description 1
- ODHJOROUCITYNF-UHFFFAOYSA-N 2-bromo-5-methoxybenzoic acid Chemical compound COC1=CC=C(Br)C(C(O)=O)=C1 ODHJOROUCITYNF-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- ZFWFRTVIIMTOLY-UHFFFAOYSA-N 2-isothiocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=S ZFWFRTVIIMTOLY-UHFFFAOYSA-N 0.000 description 1
- RZNHSEZOLFEFGB-UHFFFAOYSA-N 2-methoxybenzoyl chloride Chemical compound COC1=CC=CC=C1C(Cl)=O RZNHSEZOLFEFGB-UHFFFAOYSA-N 0.000 description 1
- CYWGSFFHHMQKET-UHFFFAOYSA-N 2-methylsulfanylethanamine Chemical compound CSCCN CYWGSFFHHMQKET-UHFFFAOYSA-N 0.000 description 1
- BUTKIHRNYUEGKB-UHFFFAOYSA-N 3,3-dimethylbutanoyl chloride Chemical compound CC(C)(C)CC(Cl)=O BUTKIHRNYUEGKB-UHFFFAOYSA-N 0.000 description 1
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 1
- SFTFNJZWZHASAQ-UHFFFAOYSA-N 3,5-dibromobenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC(Br)=C1 SFTFNJZWZHASAQ-UHFFFAOYSA-N 0.000 description 1
- JPIAALCEQSLBKF-UHFFFAOYSA-N 3,5-dichloro-2,6-dimethoxybenzoic acid Chemical compound COC1=C(Cl)C=C(Cl)C(OC)=C1C(O)=O JPIAALCEQSLBKF-UHFFFAOYSA-N 0.000 description 1
- GZLPFEYTAAXJCP-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazole-4-sulfonyl chloride Chemical compound CC1=NOC(C)=C1S(Cl)(=O)=O GZLPFEYTAAXJCP-UHFFFAOYSA-N 0.000 description 1
- MQLZRIWOJRILDI-UHFFFAOYSA-N 3-(1-adamantyl)propanoic acid Chemical compound C1C(C2)CC3CC2CC1(CCC(=O)O)C3 MQLZRIWOJRILDI-UHFFFAOYSA-N 0.000 description 1
- CNQCWYFDIQSALX-UHFFFAOYSA-N 3-(chloromethyl)pyridine Chemical compound ClCC1=CC=CN=C1 CNQCWYFDIQSALX-UHFFFAOYSA-N 0.000 description 1
- CUQANLQRQJHIQE-UHFFFAOYSA-N 3-bromo-2,6-dimethoxybenzoic acid Chemical compound COC1=CC=C(Br)C(OC)=C1C(O)=O CUQANLQRQJHIQE-UHFFFAOYSA-N 0.000 description 1
- QSILYWCNPOLKPN-UHFFFAOYSA-N 3-chloro-3-methylbut-1-yne Chemical compound CC(C)(Cl)C#C QSILYWCNPOLKPN-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 description 1
- VHYUNSUGCNKWSO-UHFFFAOYSA-N 3-propan-2-yloxypropan-1-amine Chemical compound CC(C)OCCCN VHYUNSUGCNKWSO-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- NJAKCIUOTIPYED-UHFFFAOYSA-N 4-iodobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(I)C=C1 NJAKCIUOTIPYED-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- RDDXLTPBALMBBI-UHFFFAOYSA-N 4-methyl-1,2-dihydroquinoline Chemical class C1=CC=C2C(C)=CCNC2=C1 RDDXLTPBALMBBI-UHFFFAOYSA-N 0.000 description 1
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 1
- CBQHLGRZQNTXOL-UHFFFAOYSA-N 4-o-[2-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamoyl]phenyl] 1-o-methyl butanedioate Chemical compound COC(=O)CCC(=O)OC1=CC=CC=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 CBQHLGRZQNTXOL-UHFFFAOYSA-N 0.000 description 1
- FNOZCEQRXKPZEZ-UHFFFAOYSA-N 5-(chloromethyl)-1,3-oxazolidin-2-one Chemical compound ClCC1CNC(=O)O1 FNOZCEQRXKPZEZ-UHFFFAOYSA-N 0.000 description 1
- SIAWPBGFCFNHCS-UHFFFAOYSA-N 5-bromo-2-(methylamino)benzoic acid Chemical compound CNC1=CC=C(Br)C=C1C(O)=O SIAWPBGFCFNHCS-UHFFFAOYSA-N 0.000 description 1
- OUVFWIHVZPQHJF-UHFFFAOYSA-N 5-ethenyl-5-methylcyclohexa-1,3-diene Chemical compound C=CC1(C)CC=CC=C1 OUVFWIHVZPQHJF-UHFFFAOYSA-N 0.000 description 1
- XMVNMWDLOGSUSM-UHFFFAOYSA-N 5-methyl-1,2-oxazole-3-carbonyl chloride Chemical compound CC1=CC(C(Cl)=O)=NO1 XMVNMWDLOGSUSM-UHFFFAOYSA-N 0.000 description 1
- OJOGUQPNKCQMBI-UHFFFAOYSA-N 6-iodo-1,2,3,4-tetrahydroquinoline Chemical class N1CCCC2=CC(I)=CC=C21 OJOGUQPNKCQMBI-UHFFFAOYSA-N 0.000 description 1
- KQICGCZZOQMMAX-UHFFFAOYSA-N 6-methoxy-2,2,4-trimethyl-1h-quinoline Chemical compound N1C(C)(C)C=C(C)C2=CC(OC)=CC=C21 KQICGCZZOQMMAX-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000699802 Cricetulus griseus Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 108090000331 Firefly luciferases Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 1
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 1
- 239000000579 Gonadotropin-Releasing Hormone Substances 0.000 description 1
- 108010043121 Green Fluorescent Proteins Proteins 0.000 description 1
- 102000004144 Green Fluorescent Proteins Human genes 0.000 description 1
- 108091006065 Gs proteins Proteins 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 208000007466 Male Infertility Diseases 0.000 description 1
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 1
- 206010033266 Ovarian Hyperstimulation Syndrome Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 108091027981 Response element Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 101000857870 Squalus acanthias Gonadoliberin Proteins 0.000 description 1
- 229920002472 Starch Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- NZQJBWABYYKCJZ-UHFFFAOYSA-N [2-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamoyl]phenyl] 3,5-dimethyl-1,2-oxazole-4-sulfonate Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1OS(=O)(=O)C=1C(C)=NOC=1C NZQJBWABYYKCJZ-UHFFFAOYSA-N 0.000 description 1
- VCXOAJAVABLUOJ-UHFFFAOYSA-N [2-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamoyl]phenyl] 4-methylbenzoate Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1OC(=O)C1=CC=C(C)C=C1 VCXOAJAVABLUOJ-UHFFFAOYSA-N 0.000 description 1
- PNFFNKBYALZKKR-UHFFFAOYSA-N [2-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamoyl]phenyl] 5-methyl-1,2-oxazole-3-carboxylate Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1OC(=O)C=1C=C(C)ON=1 PNFFNKBYALZKKR-UHFFFAOYSA-N 0.000 description 1
- NBWYABIPCWSQLD-UHFFFAOYSA-N [2-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)carbamoyl]phenyl] acetate Chemical compound CC(=O)OC1=CC=CC=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 NBWYABIPCWSQLD-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000005094 alkyl carbonyl amino alkyl group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 210000004198 anterior pituitary gland Anatomy 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- SBGUYEPUJPATFD-UHFFFAOYSA-N bromo(tripyrrolidin-1-yl)phosphanium Chemical compound C1CCCN1[P+](N1CCCC1)(Br)N1CCCC1 SBGUYEPUJPATFD-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 230000001593 cAMP accumulation Effects 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000005243 carbonyl alkyl group Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001793 charged compounds Chemical group 0.000 description 1
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000012875 competitive assay Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229940124558 contraceptive agent Drugs 0.000 description 1
- 230000002254 contraceptive effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 201000003585 eunuchism Diseases 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- ZWJINEZUASEZBH-UHFFFAOYSA-N fenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC=C1 ZWJINEZUASEZBH-UHFFFAOYSA-N 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- UJHMKOCLYGLAHI-UHFFFAOYSA-N furan-2-ylmethyl 3-[(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)amino]-3-oxopropanoate Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)CC(=O)OCC1=CC=CO1 UJHMKOCLYGLAHI-UHFFFAOYSA-N 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 230000006543 gametophyte development Effects 0.000 description 1
- 230000002710 gonadal effect Effects 0.000 description 1
- XLXSAKCOAKORKW-AQJXLSMYSA-N gonadorelin Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 XLXSAKCOAKORKW-AQJXLSMYSA-N 0.000 description 1
- 210000004368 gonadotroph Anatomy 0.000 description 1
- 230000001456 gonadotroph Effects 0.000 description 1
- 229940035638 gonadotropin-releasing hormone Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000005090 green fluorescent protein Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003668 hormone analog Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 208000021267 infertility disease Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 229940040129 luteinizing hormone Drugs 0.000 description 1
- 208000037106 male hypogonadism Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 108020004084 membrane receptors Proteins 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- YNMGJXLCAMLRNF-UHFFFAOYSA-N methyl 2,2,4-trimethyl-1h-quinoline-6-carboxylate Chemical compound N1C(C)(C)C=C(C)C2=CC(C(=O)OC)=CC=C21 YNMGJXLCAMLRNF-UHFFFAOYSA-N 0.000 description 1
- LZXXNPOYQCLXRS-UHFFFAOYSA-N methyl 4-aminobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1 LZXXNPOYQCLXRS-UHFFFAOYSA-N 0.000 description 1
- SRXOJMOGPYFZKC-UHFFFAOYSA-N methyl 4-chloro-4-oxobutanoate Chemical compound COC(=O)CCC(Cl)=O SRXOJMOGPYFZKC-UHFFFAOYSA-N 0.000 description 1
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 1
- VNXBKJFUJUWOCW-UHFFFAOYSA-N methylcyclopropane Chemical compound CC1CC1 VNXBKJFUJUWOCW-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000010369 molecular cloning Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- GNPPFOLOFVAMQJ-UHFFFAOYSA-N morpholine-2-thiol Chemical compound SC1CNCCO1 GNPPFOLOFVAMQJ-UHFFFAOYSA-N 0.000 description 1
- UWCBYNKZWHCIJQ-UHFFFAOYSA-N n'-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-n-[(4-methoxyphenyl)methyl]propanediamide Chemical compound C1=CC(OC)=CC=C1CNC(=O)CC(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 UWCBYNKZWHCIJQ-UHFFFAOYSA-N 0.000 description 1
- IATHBRQJVABHAM-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-1-phenylmethanesulfonamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NS(=O)(=O)CC1=CC=CC=C1 IATHBRQJVABHAM-UHFFFAOYSA-N 0.000 description 1
- AUJBWQROSOOELN-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-2-[(2,4-difluorophenyl)methylamino]acetamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)CNCC1=CC=C(F)C=C1F AUJBWQROSOOELN-UHFFFAOYSA-N 0.000 description 1
- JDDUJIRFAKCWND-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-2-bromo-5-methoxybenzamide Chemical compound COC1=CC=C(Br)C(C(=O)NC=2C=C3C(C)(C=4C=CC=CC=4)CC(C)(C)N(C(C)=O)C3=CC=2)=C1 JDDUJIRFAKCWND-UHFFFAOYSA-N 0.000 description 1
- WYIQKYAYRGUGMB-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 WYIQKYAYRGUGMB-UHFFFAOYSA-N 0.000 description 1
- HYZOKHXKRSCIDA-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3,4,5-trimethoxybenzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NC=2C=C3C(C)(C=4C=CC=CC=4)CC(C)(C)N(C(C)=O)C3=CC=2)=C1 HYZOKHXKRSCIDA-UHFFFAOYSA-N 0.000 description 1
- DRIOSZCBKCFLCO-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3,5-dibromobenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC(Br)=CC(Br)=C1 DRIOSZCBKCFLCO-UHFFFAOYSA-N 0.000 description 1
- ARISJKUPDVNIKQ-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3,5-dichloro-2,6-dimethoxybenzamide Chemical compound COC1=C(Cl)C=C(Cl)C(OC)=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 ARISJKUPDVNIKQ-UHFFFAOYSA-N 0.000 description 1
- UQJRQRCLCWJZEC-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3-(1-adamantyl)propanamide Chemical compound C1C(C)(C)N(C(=O)C)C2=CC=C(NC(=O)CCC34CC5CC(CC(C5)C3)C4)C=C2C1(C)C1=CC=CC=C1 UQJRQRCLCWJZEC-UHFFFAOYSA-N 0.000 description 1
- UZFHHSGOYONJNA-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3-(2-ethoxyethoxy)propanamide Chemical compound C12=CC(NC(=O)CCOCCOCC)=CC=C2N(C(C)=O)C(C)(C)CC1(C)C1=CC=CC=C1 UZFHHSGOYONJNA-UHFFFAOYSA-N 0.000 description 1
- SBJCOAQSRWXKCG-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3-bromo-2,6-dimethoxybenzamide Chemical compound COC1=CC=C(Br)C(OC)=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 SBJCOAQSRWXKCG-UHFFFAOYSA-N 0.000 description 1
- GNKYZESIWZXREM-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3-methyl-2-phenylbenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC(C)=C1C1=CC=CC=C1 GNKYZESIWZXREM-UHFFFAOYSA-N 0.000 description 1
- PPNLFPOQGFMBOQ-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3-methylbutanamide Chemical compound C12=CC(NC(=O)CC(C)C)=CC=C2N(C(C)=O)C(C)(C)CC1(C)C1=CC=CC=C1 PPNLFPOQGFMBOQ-UHFFFAOYSA-N 0.000 description 1
- STPKDYDFVJQTIS-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-3-phenylpropanamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)CCC1=CC=CC=C1 STPKDYDFVJQTIS-UHFFFAOYSA-N 0.000 description 1
- XMIWPECKEJMHJS-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-(4-chlorophenyl)benzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(Cl)C=C1 XMIWPECKEJMHJS-UHFFFAOYSA-N 0.000 description 1
- UWCKSOOAWYHHJL-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-(trifluoromethyl)benzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=C(C(F)(F)F)C=C1 UWCKSOOAWYHHJL-UHFFFAOYSA-N 0.000 description 1
- XLSXMUPFMSVFQJ-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-chlorobenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=C(Cl)C=C1 XLSXMUPFMSVFQJ-UHFFFAOYSA-N 0.000 description 1
- XDIYNVNPSHWTJB-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-iodobenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=C(I)C=C1 XDIYNVNPSHWTJB-UHFFFAOYSA-N 0.000 description 1
- JZESRYGCHZXHTO-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-nitrobenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=C([N+]([O-])=O)C=C1 JZESRYGCHZXHTO-UHFFFAOYSA-N 0.000 description 1
- AUNHRXZPYDMERZ-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-phenylbenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=CC=C1 AUNHRXZPYDMERZ-UHFFFAOYSA-N 0.000 description 1
- GUHHQHLOTUGFKQ-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-propylbenzamide Chemical compound C1=CC(CCC)=CC=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 GUHHQHLOTUGFKQ-UHFFFAOYSA-N 0.000 description 1
- JAKLNDLCOLMARD-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-pyridin-3-ylbenzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=CN=C1 JAKLNDLCOLMARD-UHFFFAOYSA-N 0.000 description 1
- OWCRWEGZMAFYBW-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-5-bromo-2-(methylamino)benzamide Chemical compound CNC1=CC=C(Br)C=C1C(=O)NC1=CC=C(N(C(C)=O)C(C)(C)CC2(C=3C=CC=CC=3)C)C2=C1 OWCRWEGZMAFYBW-UHFFFAOYSA-N 0.000 description 1
- NFBWFVVMNNLUCZ-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-5-methoxy-2-phenylbenzamide Chemical compound C=1C=C2N(C(C)=O)C(C)(C)CC(C)(C=3C=CC=CC=3)C2=CC=1NC(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 NFBWFVVMNNLUCZ-UHFFFAOYSA-N 0.000 description 1
- KTQWZLBMLZYZEL-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-5-methylpyridine-3-carboxamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CN=CC(C)=C1 KTQWZLBMLZYZEL-UHFFFAOYSA-N 0.000 description 1
- BCRDAOKTZQUNOP-UHFFFAOYSA-N n-(1-acetyl-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)benzamide Chemical compound C1=C2C(C)(C=3C=CC=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C1=CC=CC=C1 BCRDAOKTZQUNOP-UHFFFAOYSA-N 0.000 description 1
- MZFKNJKCVTUDFM-UHFFFAOYSA-N n-(1-acetyl-8-methoxy-2,2,4-trimethyl-4-phenyl-3h-quinolin-6-yl)-4-phenylbenzamide Chemical compound C=1C(C(CC(C)(C)N2C(C)=O)(C)C=3C=CC=CC=3)=C2C(OC)=CC=1NC(=O)C(C=C1)=CC=C1C1=CC=CC=C1 MZFKNJKCVTUDFM-UHFFFAOYSA-N 0.000 description 1
- XBECFEJUQZXMFE-UHFFFAOYSA-N n-(4-aminobutyl)acetamide;hydrochloride Chemical compound Cl.CC(=O)NCCCCN XBECFEJUQZXMFE-UHFFFAOYSA-N 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- BOSIOWJWBMFJNH-UHFFFAOYSA-N n-[1-acetyl-4-(4-hydroxyphenyl)-2,2,4-trimethyl-3h-quinolin-6-yl]-4-phenylbenzamide Chemical compound C1=C2C(C)(C=3C=CC(O)=CC=3)CC(C)(C)N(C(=O)C)C2=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=CC=C1 BOSIOWJWBMFJNH-UHFFFAOYSA-N 0.000 description 1
- PLTPSKPMQFZQRP-UHFFFAOYSA-N n-[6-acetyl-6-methyl-3-(2,2,4-trimethyl-1h-quinoline-3-carbonyl)cyclohexen-1-yl]furan-2-carboxamide Chemical compound CC(=O)C1(C)CCC(C(=O)C=2C(NC3=CC=CC=C3C=2C)(C)C)C=C1NC(=O)C1=CC=CO1 PLTPSKPMQFZQRP-UHFFFAOYSA-N 0.000 description 1
- HVAAHUDGWQAAOJ-UHFFFAOYSA-N n-benzylethanamine Chemical compound CCNCC1=CC=CC=C1 HVAAHUDGWQAAOJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 210000002394 ovarian follicle Anatomy 0.000 description 1
- 230000027758 ovulation cycle Effects 0.000 description 1
- 230000000624 ovulatory effect Effects 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 230000001817 pituitary effect Effects 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000027272 reproductive process Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 210000000717 sertoli cell Anatomy 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 238000002741 site-directed mutagenesis Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000010532 solid phase synthesis reaction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000021595 spermatogenesis Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Chemical class 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000010009 steroidogenesis Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- KNWMPOSCNXKJAJ-UHFFFAOYSA-N tert-butyl 1-acetyl-3-amino-2,2,4-trimethylquinoline-6-carboxylate Chemical compound C(C)(=O)N1C(C(=C(C2=CC(=CC=C12)C(=O)OC(C)(C)C)C)N)(C)C KNWMPOSCNXKJAJ-UHFFFAOYSA-N 0.000 description 1
- DGEHMLFUFOWHAF-UHFFFAOYSA-N tert-butyl 1-amino-2,2,4,7-tetramethylquinoline-6-carboxylate Chemical compound C(C)(C)(C)OC(=O)C=1C=C2C(=CC(N(C2=CC=1C)N)(C)C)C DGEHMLFUFOWHAF-UHFFFAOYSA-N 0.000 description 1
- XMCISUHCJIBPQC-UHFFFAOYSA-N tert-butyl 3-amino-1-butanoyl-2,2,4-trimethylquinoline-6-carboxylate Chemical compound C(C)(C)(C)OC(=O)C=1C=C2C(=C(C(N(C2=CC=1)C(CCC)=O)(C)C)N)C XMCISUHCJIBPQC-UHFFFAOYSA-N 0.000 description 1
- WMVAEBXGXONFMN-UHFFFAOYSA-N tert-butyl n-(1-butanoyl-2,2,4-trimethylquinolin-6-yl)carbamate Chemical compound C1=C(NC(=O)OC(C)(C)C)C=C2C(C)=CC(C)(C)N(C(=O)CCC)C2=C1 WMVAEBXGXONFMN-UHFFFAOYSA-N 0.000 description 1
- HSZKDVSZYCRBEC-UHFFFAOYSA-N tert-butyl n-(4-amino-2-methylphenyl)carbamate Chemical compound CC1=CC(N)=CC=C1NC(=O)OC(C)(C)C HSZKDVSZYCRBEC-UHFFFAOYSA-N 0.000 description 1
- 230000002381 testicular Effects 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/4709—Non-condensed quinolines and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
- A61P15/08—Drugs for genital or sexual disorders; Contraceptives for gonadal disorders or for enhancing fertility, e.g. inducers of ovulation or of spermatogenesis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
- A61P15/16—Masculine contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
- A61P15/18—Feminine contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/06—Drugs for disorders of the endocrine system of the anterior pituitary hormones, e.g. TSH, ACTH, FSH, LH, PRL, GH
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/06—Drugs for disorders of the endocrine system of the anterior pituitary hormones, e.g. TSH, ACTH, FSH, LH, PRL, GH
- A61P5/08—Drugs for disorders of the endocrine system of the anterior pituitary hormones, e.g. TSH, ACTH, FSH, LH, PRL, GH for decreasing, blocking or antagonising the activity of the anterior pituitary hormones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/10—Drugs for disorders of the endocrine system of the posterior pituitary hormones, e.g. oxytocin, ADH
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/24—Drugs for disorders of the endocrine system of the sex hormones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/08—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms with acylated ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Endocrinology (AREA)
- Diabetes (AREA)
- Reproductive Health (AREA)
- Epidemiology (AREA)
- Gynecology & Obstetrics (AREA)
- Pregnancy & Childbirth (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP01202531 | 2001-07-02 | ||
| PCT/EP2002/007053 WO2003004028A1 (en) | 2001-07-02 | 2002-06-25 | Tetrahydroquinoline derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK16342003A3 SK16342003A3 (sk) | 2004-07-07 |
| SK286759B6 true SK286759B6 (sk) | 2009-05-07 |
Family
ID=8180574
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK1634-2003A SK286759B6 (sk) | 2001-07-02 | 2002-06-25 | Tetrahydrochinolínové deriváty, farmaceutický prostriedok s ich obsahom a ich použitie |
Country Status (31)
| Country | Link |
|---|---|
| US (2) | US8058441B2 (enExample) |
| EP (1) | EP1406628B1 (enExample) |
| JP (1) | JP4523273B2 (enExample) |
| KR (1) | KR100908468B1 (enExample) |
| CN (1) | CN1261099C (enExample) |
| AR (1) | AR034669A1 (enExample) |
| AT (1) | ATE319451T1 (enExample) |
| AU (1) | AU2002317848B2 (enExample) |
| BR (1) | BR0210645A (enExample) |
| CA (1) | CA2452606C (enExample) |
| CY (1) | CY1106087T1 (enExample) |
| CZ (1) | CZ20042A3 (enExample) |
| DE (1) | DE60209734T2 (enExample) |
| DK (1) | DK1406628T3 (enExample) |
| EC (1) | ECSP034932A (enExample) |
| ES (1) | ES2260458T3 (enExample) |
| HR (1) | HRP20031080A2 (enExample) |
| HU (1) | HUP0400390A2 (enExample) |
| IL (1) | IL159288A0 (enExample) |
| IS (1) | IS2418B (enExample) |
| MX (1) | MXPA03011908A (enExample) |
| NO (1) | NO325516B1 (enExample) |
| NZ (1) | NZ530198A (enExample) |
| PE (1) | PE20030273A1 (enExample) |
| PL (1) | PL367638A1 (enExample) |
| PT (1) | PT1406628E (enExample) |
| RU (1) | RU2347570C2 (enExample) |
| SA (1) | SA02230260B1 (enExample) |
| SK (1) | SK286759B6 (enExample) |
| WO (1) | WO2003004028A1 (enExample) |
| ZA (1) | ZA200309921B (enExample) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PT1406628E (pt) * | 2001-07-02 | 2006-06-30 | Akzo Nobel Nv | Derivados de tera-hidroquinolina |
| EP2033953A1 (en) * | 2002-02-15 | 2009-03-11 | Glaxo Group Limited | Vanilloid receptor modulators |
| FR2836620B1 (fr) * | 2002-02-28 | 2004-04-16 | Snecma Services | Instrument de projection thermique |
| SE0200920D0 (sv) * | 2002-03-25 | 2002-03-25 | Astrazeneca Ab | Novel compounds |
| TWI306855B (en) * | 2002-12-20 | 2009-03-01 | Organon Nv | Tetrahydroquinoline derivatives |
| TWI322012B (en) * | 2002-12-20 | 2010-03-21 | Organon Nv | Tetrahydroquinoline derivatives |
| SE0300480D0 (sv) * | 2003-02-21 | 2003-02-21 | Astrazeneca Ab | Novel compounds |
| EP1644042A1 (en) * | 2003-05-29 | 2006-04-12 | AstraZeneca AB | A pharmaceutical composition containing a p2x7 receptor antagonist and methotrexate |
| EP1644041A1 (en) * | 2003-05-29 | 2006-04-12 | AstraZeneca AB | A pharmaceutical composition comprising a p2x7 antagonist and sulfasalazine |
| JP2007501270A (ja) * | 2003-05-29 | 2007-01-25 | アストラゼネカ・アクチエボラーグ | Ｐ２Ｘ７受容体アンタゴニストおよび腫瘍壊死因子αを含む医薬組成物 |
| GB0312609D0 (en) * | 2003-06-02 | 2003-07-09 | Astrazeneca Ab | Novel compounds |
| KR100554155B1 (ko) * | 2003-06-09 | 2006-02-22 | 학교법인 포항공과대학교 | 금속/반도체 나노막대 이종구조를 이용한 전극 구조물 및그 제조 방법 |
| SE0302139D0 (sv) * | 2003-07-28 | 2003-07-28 | Astrazeneca Ab | Novel compounds |
| SE0302192D0 (sv) * | 2003-08-08 | 2003-08-08 | Astrazeneca Ab | Novel compounds |
| SE0302488D0 (sv) * | 2003-09-18 | 2003-09-18 | Astrazeneca Ab | New combination |
| SA05260265A (ar) * | 2004-08-30 | 2005-12-03 | استرازينيكا ايه بي | مركبات جديدة |
| SE0402925D0 (sv) * | 2004-11-30 | 2004-11-30 | Astrazeneca Ab | Novel Compounds |
| US7691848B2 (en) | 2005-03-02 | 2010-04-06 | Wyeth | Pyrrolobenzodiazepine arylcarboxamides and derivatives thereof as follicle-stimulating hormone receptor antagonists |
| PL1879866T3 (pl) | 2005-05-04 | 2011-07-29 | N V Organon | Pochodne dihydropirydynowe |
| UA92009C2 (ru) | 2005-05-04 | 2010-09-27 | Н.В. Органон | Производные 4-фенил-5-оксо-1,4,5,6,7,8-гексагидрохинолина для лечения бесплодия |
| UA92008C2 (en) * | 2005-05-04 | 2010-09-27 | Н.В. Органон | 4-PHENYL-5-OXO-l,4,5,6,7,8-HEXAHYDROQUINOLINE DERIVATIVES AS MEDICAMENTS FOR THE TREATMENT OF INFERTILITY |
| UA92007C2 (ru) * | 2005-05-04 | 2010-09-27 | Н.В. Органон | Производные 4-фенил-5-оксо-1,4,5,6,7,8-гексагидрохинолина для лечения бесплодности |
| CA2607882A1 (en) | 2005-05-12 | 2006-11-23 | Wyeth | Pyrrolobenzodiazepines and heterocyclic carboxamide derivatives as follicle stimulating hormone receptor (fsh-r) antagonists |
| EP1893615A1 (en) | 2005-06-09 | 2008-03-05 | Wyeth a Corporation of the State of Delaware | Pyrrolobenzodiazepine pyridine carboxamides and derivatives as follicle-stimulating hormone receptor antagonists |
| JP2009504597A (ja) * | 2005-08-10 | 2009-02-05 | バイエル・シエーリング・ファーマ アクチエンゲゼルシャフト | アシルトリプトファノール |
| US20070060573A1 (en) * | 2005-08-10 | 2007-03-15 | Lars Wortmann | Acyltryptophanols |
| EP1932831A1 (en) * | 2006-12-13 | 2008-06-18 | Bayer Schering Pharma Aktiengesellschaft | 1,2-Diarylacetylene Derivatives of Acyltryptophanols |
| US20080221195A1 (en) * | 2006-12-13 | 2008-09-11 | Lars Wortmann | 1,2-diarylacetylene derivatives of acyltryptophanols |
| TWI410422B (zh) | 2007-01-15 | 2013-10-01 | Mitsubishi Tanabe Pharma Corp | 縮合四氫喹啉衍生物及其醫藥用途 |
| TW200848021A (en) | 2007-03-06 | 2008-12-16 | Wyeth Corp | Sulfonylated heterocycles useful for modulation of the progesterone receptor |
| PE20091225A1 (es) * | 2007-03-22 | 2009-09-16 | Astrazeneca Ab | Derivados de quinolina como antagonistas del receptor p2x7 |
| TW200918058A (en) * | 2007-08-31 | 2009-05-01 | Organon Nv | TSH receptor antagonizing tetrahydroquinoline compounds |
| PE20091036A1 (es) | 2007-11-30 | 2009-08-15 | Astrazeneca Ab | Derivado de quinolina como antagonista del receptor p2x7 |
| RU2359684C1 (ru) * | 2008-01-23 | 2009-06-27 | Закрытое акционерное общество "СКАЙ ЛТД" | Способ лечения эндометриоза |
| TW200944523A (en) | 2008-02-08 | 2009-11-01 | Organon Nv | (Dihydro)pyrrolo[2,1-a]isoquinolines |
| US20100061976A1 (en) * | 2008-07-24 | 2010-03-11 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Method for treating or preventing osteoporosis by reducing follicle stimulating hormone to cyclic physiological levels in a mammalian subject |
| US8071587B2 (en) | 2009-05-27 | 2011-12-06 | N. V. Organon | (Dihydro)imidazoiso[5,1-A]quinolines |
| TWI461426B (zh) * | 2009-05-27 | 2014-11-21 | Merck Sharp & Dohme | （二氫）咪唑並異〔５，１－ａ〕喹啉類 |
| TW201116531A (en) | 2009-07-29 | 2011-05-16 | Organon Nv | Ring-annulated dihydropyrrolo[2,1-a]isoquinolines |
| US8431564B2 (en) | 2009-07-29 | 2013-04-30 | Merck Sharp & Dohme B.V. | Ring-annulated dihydropyrrolo[2,1-α]isoquinolines |
| TW201116515A (en) | 2009-07-31 | 2011-05-16 | Organon Nv | Dihydrobenzoindazoles |
| BR112013007907A2 (pt) * | 2010-10-08 | 2016-06-14 | N30 Pharmaceuticals Inc | novos compostos de quinolina substituída como inibidores de s-nitrosoglutationa reductase |
| US8546427B2 (en) * | 2010-10-20 | 2013-10-01 | Hoffmann-La Roche Inc. | Tetrahydroquinoline derivatives |
| EP3174932B1 (en) | 2014-07-30 | 2021-06-09 | Henkel IP & Holding GmbH | Cure accelerators for anaerobic curable compositions |
| WO2019089412A1 (en) * | 2017-11-01 | 2019-05-09 | Merck Sharp & Dohme Corp. | Novel substituted tetrahydroquinolin compounds as indoleamine 2,3-dioxygenase (ido) inhibitors |
| CN118791413B (zh) * | 2024-06-18 | 2025-04-18 | 青岛润农化工有限公司 | 一种丁醚脲的合成方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2686182A (en) | 1950-12-07 | 1954-08-10 | Basf Ag | O-hydroxy-dihydro-quinoline carboxylic acids |
| DE3879031T2 (de) | 1987-08-08 | 1993-06-24 | Akzo Nv | Kontrazeptives implantat. |
| ATE269336T1 (de) * | 1994-12-22 | 2004-07-15 | Ligand Pharm Inc | Steroidrezeptor-modulator verbindungen und methoden |
| CA2339018A1 (en) * | 1998-08-07 | 2000-02-17 | Applied Research Systems Ars Holding N.V. | Fsh mimetics for the treatment of infertility |
| JP2000143636A (ja) * | 1998-09-02 | 2000-05-26 | Sumitomo Pharmaceut Co Ltd | アミノ誘導体 |
| US6200963B1 (en) * | 1999-03-31 | 2001-03-13 | American Home Products Corporation | Aryl sulfonic acids as FSH antagonists |
| PT1406628E (pt) | 2001-07-02 | 2006-06-30 | Akzo Nobel Nv | Derivados de tera-hidroquinolina |
| TWI322012B (en) | 2002-12-20 | 2010-03-21 | Organon Nv | Tetrahydroquinoline derivatives |
| TWI306855B (en) | 2002-12-20 | 2009-03-01 | Organon Nv | Tetrahydroquinoline derivatives |
-
2002
- 2002-06-25 PT PT02747437T patent/PT1406628E/pt unknown
- 2002-06-25 AU AU2002317848A patent/AU2002317848B2/en not_active Ceased
- 2002-06-25 US US10/482,707 patent/US8058441B2/en not_active Expired - Fee Related
- 2002-06-25 PL PL02367638A patent/PL367638A1/xx unknown
- 2002-06-25 CZ CZ20042A patent/CZ20042A3/cs unknown
- 2002-06-25 CA CA2452606A patent/CA2452606C/en not_active Expired - Fee Related
- 2002-06-25 JP JP2003510039A patent/JP4523273B2/ja not_active Expired - Fee Related
- 2002-06-25 DK DK02747437T patent/DK1406628T3/da active
- 2002-06-25 HR HR20031080A patent/HRP20031080A2/hr not_active Application Discontinuation
- 2002-06-25 KR KR1020037017088A patent/KR100908468B1/ko not_active Expired - Fee Related
- 2002-06-25 NZ NZ530198A patent/NZ530198A/en not_active IP Right Cessation
- 2002-06-25 IL IL15928802A patent/IL159288A0/xx not_active IP Right Cessation
- 2002-06-25 RU RU2004102693/15A patent/RU2347570C2/ru not_active IP Right Cessation
- 2002-06-25 ES ES02747437T patent/ES2260458T3/es not_active Expired - Lifetime
- 2002-06-25 HU HU0400390A patent/HUP0400390A2/hu unknown
- 2002-06-25 MX MXPA03011908A patent/MXPA03011908A/es active IP Right Grant
- 2002-06-25 WO PCT/EP2002/007053 patent/WO2003004028A1/en not_active Ceased
- 2002-06-25 DE DE60209734T patent/DE60209734T2/de not_active Expired - Lifetime
- 2002-06-25 EP EP02747437A patent/EP1406628B1/en not_active Expired - Lifetime
- 2002-06-25 CN CNB02813334XA patent/CN1261099C/zh not_active Expired - Fee Related
- 2002-06-25 AT AT02747437T patent/ATE319451T1/de not_active IP Right Cessation
- 2002-06-25 BR BR0210645-0A patent/BR0210645A/pt not_active IP Right Cessation
- 2002-06-25 SK SK1634-2003A patent/SK286759B6/sk not_active IP Right Cessation
- 2002-06-27 PE PE2002000581A patent/PE20030273A1/es not_active Application Discontinuation
- 2002-07-01 AR ARP020102468A patent/AR034669A1/es unknown
- 2002-08-26 SA SA02230260A patent/SA02230260B1/ar unknown
-
2003
- 2003-12-11 IS IS7071A patent/IS2418B/is unknown
- 2003-12-22 NO NO20035763A patent/NO325516B1/no not_active IP Right Cessation
- 2003-12-22 ZA ZA200309921A patent/ZA200309921B/en unknown
- 2003-12-30 EC EC2003004932A patent/ECSP034932A/es unknown
-
2006
- 2006-05-16 CY CY20061100628T patent/CY1106087T1/el unknown
-
2011
- 2011-10-07 US US13/268,214 patent/US8258293B2/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK286759B6 (sk) | Tetrahydrochinolínové deriváty, farmaceutický prostriedok s ich obsahom a ich použitie | |
| AU2002317848A1 (en) | Tetrahydroquinoline derivatives | |
| RU2328487C2 (ru) | Производные тетрагидрохинолина, фармацевтическая композиция на их основе, их применение в качестве регуляторов фертильности | |
| RU2328488C2 (ru) | Производные тетрагидрохинолина, фармацевтическая композиция на их основе, их применение в качестве регуляторов фертильности | |
| HK1061810B (en) | Tetrahydroquinoline derivatives | |
| KR20050084341A (ko) | 테트라하이드로퀴놀린 유도체 | |
| HK1077576A1 (en) | Tetrahydroquinoline derivatives and their use as fsh receptor modulators | |
| HK1077576B (en) | Tetrahydroquinoline derivatives and their use as fsh receptor modulators |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed due to non-payment of maintenance fees |
Effective date: 20100625 |