SK106799A3 - Process for the production of 2,3-dihydroxypropylamino compound and intermediates therefor - Google Patents
Process for the production of 2,3-dihydroxypropylamino compound and intermediates therefor Download PDFInfo
- Publication number
- SK106799A3 SK106799A3 SK1067-99A SK106799A SK106799A3 SK 106799 A3 SK106799 A3 SK 106799A3 SK 106799 A SK106799 A SK 106799A SK 106799 A3 SK106799 A3 SK 106799A3
- Authority
- SK
- Slovakia
- Prior art keywords
- compound
- allylamino
- dihydroxypropylamino
- bis
- process according
- Prior art date
Links
- -1 2,3-dihydroxypropylamino compound Chemical class 0.000 title claims abstract description 39
- 238000000034 method Methods 0.000 title claims abstract description 29
- 239000000543 intermediate Substances 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 16
- 229960001025 iohexol Drugs 0.000 claims abstract description 10
- NTHXOOBQLCIOLC-UHFFFAOYSA-N iohexol Chemical compound OCC(O)CN(C(=O)C)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I NTHXOOBQLCIOLC-UHFFFAOYSA-N 0.000 claims abstract description 10
- 230000003301 hydrolyzing effect Effects 0.000 claims abstract description 5
- NBDAHKQJXVLAID-UHFFFAOYSA-N 5-nitroisophthalic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 NBDAHKQJXVLAID-UHFFFAOYSA-N 0.000 claims description 16
- 239000002872 contrast media Substances 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 238000006735 epoxidation reaction Methods 0.000 claims description 6
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 230000003381 solubilizing effect Effects 0.000 claims description 4
- ABBZJHFBQXYTLU-UHFFFAOYSA-N but-3-enamide Chemical compound NC(=O)CC=C ABBZJHFBQXYTLU-UHFFFAOYSA-N 0.000 claims description 3
- 125000005129 aryl carbonyl group Chemical class 0.000 claims description 2
- 230000001268 conjugating effect Effects 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 1
- 239000000539 dimer Substances 0.000 claims 1
- 150000002118 epoxides Chemical class 0.000 claims 1
- 230000002083 iodinating effect Effects 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 14
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 11
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- 238000004128 high performance liquid chromatography Methods 0.000 description 10
- 238000006460 hydrolysis reaction Methods 0.000 description 10
- 230000007062 hydrolysis Effects 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- GGTSJKFPGKFLCZ-UHFFFAOYSA-N dimethyl 5-nitrobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1 GGTSJKFPGKFLCZ-UHFFFAOYSA-N 0.000 description 6
- 230000026045 iodination Effects 0.000 description 5
- 238000006192 iodination reaction Methods 0.000 description 5
- KJVRLFWTIGWXFK-UHFFFAOYSA-N n-prop-2-enylbenzamide Chemical compound C=CCNC(=O)C1=CC=CC=C1 KJVRLFWTIGWXFK-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000013459 approach Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229960004359 iodixanol Drugs 0.000 description 4
- NBQNWMBBSKPBAY-UHFFFAOYSA-N iodixanol Chemical compound IC=1C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C(I)C=1N(C(=O)C)CC(O)CN(C(C)=O)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I NBQNWMBBSKPBAY-UHFFFAOYSA-N 0.000 description 4
- 229960000824 iopentol Drugs 0.000 description 4
- IUNJANQVIJDFTQ-UHFFFAOYSA-N iopentol Chemical compound COCC(O)CN(C(C)=O)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I IUNJANQVIJDFTQ-UHFFFAOYSA-N 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000012285 osmium tetroxide Substances 0.000 description 3
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000003570 air Substances 0.000 description 2
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical group 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- HNSDLXPSAYFUHK-UHFFFAOYSA-N 1,4-bis(2-ethylhexyl) sulfosuccinate Chemical compound CCCCC(CC)COC(=O)CC(S(O)(=O)=O)C(=O)OCC(CC)CCCC HNSDLXPSAYFUHK-UHFFFAOYSA-N 0.000 description 1
- KZYHGCLDUQBASN-UHFFFAOYSA-N 1-n,1-n,3-n,3-n,5-n,5-n-hexakis(2-hydroxyethyl)-2,4,6-triiodobenzene-1,3,5-tricarboxamide Chemical compound OCCN(CCO)C(=O)C1=C(I)C(C(=O)N(CCO)CCO)=C(I)C(C(=O)N(CCO)CCO)=C1I KZYHGCLDUQBASN-UHFFFAOYSA-N 0.000 description 1
- HVSOUCGIMNXGCY-UHFFFAOYSA-N 2-[[2-[2-[2-[2-(2-carboxy-3,5,6-triiodoanilino)-2-oxoethoxy]ethoxy]ethoxy]acetyl]amino]-3,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C(I)=C1NC(=O)COCCOCCOCC(=O)NC1=C(I)C(I)=CC(I)=C1C(O)=O HVSOUCGIMNXGCY-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- ULQQGOGMQRGFFR-UHFFFAOYSA-N 2-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1Cl ULQQGOGMQRGFFR-UHFFFAOYSA-N 0.000 description 1
- LARNQUAWIRVQPK-UHFFFAOYSA-N 2-methyloxiran-2-amine Chemical compound NC1(CO1)C LARNQUAWIRVQPK-UHFFFAOYSA-N 0.000 description 1
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 1
- OQHLOKBHRXMXLD-UHFFFAOYSA-N 5-[3-[3-[3,5-bis[2,3-dihydroxypropyl(methyl)carbamoyl]-2,4,6-triiodoanilino]-3-oxopropyl]sulfanylpropanoylamino]-1-n,3-n-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-1-n,3-n-dimethylbenzene-1,3-dicarboxamide Chemical compound OCC(O)CN(C)C(=O)C1=C(I)C(C(=O)N(CC(O)CO)C)=C(I)C(NC(=O)CCSCCC(=O)NC=2C(=C(C(=O)N(C)CC(O)CO)C(I)=C(C(=O)N(C)CC(O)CO)C=2I)I)=C1I OQHLOKBHRXMXLD-UHFFFAOYSA-N 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- SMQYOVYWPWASGU-UHFFFAOYSA-N Iocarmic acid Chemical compound OC(=O)C1=C(I)C(C(=O)NC)=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)NC)C(I)=C(C(O)=O)C=2I)I)=C1I SMQYOVYWPWASGU-UHFFFAOYSA-N 0.000 description 1
- WWVAPFRKZMUPHZ-UHFFFAOYSA-N Iodoxamic acid Chemical compound OC(=O)C1=C(I)C=C(I)C(NC(=O)CCOCCOCCOCCOCCC(=O)NC=2C(=C(C(O)=O)C(I)=CC=2I)I)=C1I WWVAPFRKZMUPHZ-UHFFFAOYSA-N 0.000 description 1
- OIRFJRBSRORBCM-UHFFFAOYSA-N Iopanoic acid Chemical compound CCC(C(O)=O)CC1=C(I)C=C(I)C(N)=C1I OIRFJRBSRORBCM-UHFFFAOYSA-N 0.000 description 1
- XUHXFSYUBXNTHU-UHFFFAOYSA-N Iotrolan Chemical compound IC=1C(C(=O)NC(CO)C(O)CO)=C(I)C(C(=O)NC(CO)C(O)CO)=C(I)C=1N(C)C(=O)CC(=O)N(C)C1=C(I)C(C(=O)NC(CO)C(O)CO)=C(I)C(C(=O)NC(CO)C(O)CO)=C1I XUHXFSYUBXNTHU-UHFFFAOYSA-N 0.000 description 1
- AMDBBAQNWSUWGN-UHFFFAOYSA-N Ioversol Chemical compound OCCN(C(=O)CO)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I AMDBBAQNWSUWGN-UHFFFAOYSA-N 0.000 description 1
- BAQCROVBDNBEEB-UBYUBLNFSA-N Metrizamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H]2[C@H]([C@H](O)[C@@H](CO)OC2O)O)=C1I BAQCROVBDNBEEB-UBYUBLNFSA-N 0.000 description 1
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- FFINMCNLQNTKLU-UHFFFAOYSA-N adipiodone Chemical compound OC(=O)C1=C(I)C=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(O)=O)C(I)=CC=2I)I)=C1I FFINMCNLQNTKLU-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005089 alkenylaminocarbonyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000013581 critical reagent Substances 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000005906 dihydroxylation reaction Methods 0.000 description 1
- 229950010286 diolamine Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 229960004901 iodamide Drugs 0.000 description 1
- VVDGWALACJEJKG-UHFFFAOYSA-N iodamide Chemical compound CC(=O)NCC1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I VVDGWALACJEJKG-UHFFFAOYSA-N 0.000 description 1
- 229940029355 iodipamide Drugs 0.000 description 1
- 229960002487 iodoxamic acid Drugs 0.000 description 1
- 229960000780 iomeprol Drugs 0.000 description 1
- NJKDOADNQSYQEV-UHFFFAOYSA-N iomeprol Chemical compound OCC(=O)N(C)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I NJKDOADNQSYQEV-UHFFFAOYSA-N 0.000 description 1
- 229960004647 iopamidol Drugs 0.000 description 1
- XQZXYNRDCRIARQ-LURJTMIESA-N iopamidol Chemical compound C[C@H](O)C(=O)NC1=C(I)C(C(=O)NC(CO)CO)=C(I)C(C(=O)NC(CO)CO)=C1I XQZXYNRDCRIARQ-LURJTMIESA-N 0.000 description 1
- 229940074884 iopanoate Drugs 0.000 description 1
- 229960002603 iopromide Drugs 0.000 description 1
- DGAIEPBNLOQYER-UHFFFAOYSA-N iopromide Chemical compound COCC(=O)NC1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)N(C)CC(O)CO)=C1I DGAIEPBNLOQYER-UHFFFAOYSA-N 0.000 description 1
- 229950011065 iosimide Drugs 0.000 description 1
- 229950011097 iotasul Drugs 0.000 description 1
- 229960003182 iotrolan Drugs 0.000 description 1
- 229960004537 ioversol Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960000554 metrizamide Drugs 0.000 description 1
- 229960004712 metrizoic acid Drugs 0.000 description 1
- GGGDNPWHMNJRFN-UHFFFAOYSA-N metrizoic acid Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I GGGDNPWHMNJRFN-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/12—Preparation of carboxylic acid amides by reactions not involving the formation of carboxamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/04—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reaction of ammonia or amines with olefin oxides or halohydrins
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/14—Preparation of carboxylic acid amides by formation of carboxamide groups together with reactions not involving the carboxamide groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/65—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/30—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having the nitrogen atom of the carboxamide group bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Steroid Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US08/796,212 US5824821A (en) | 1997-02-07 | 1997-02-07 | Process for the preparation of iodinated contrast agents and intermediates therefor |
PCT/GB1998/000356 WO1998034905A1 (en) | 1997-02-07 | 1998-02-05 | Process for the preparation of iodinated contrast agents and intermediates therefor |
Publications (1)
Publication Number | Publication Date |
---|---|
SK106799A3 true SK106799A3 (en) | 2000-01-18 |
Family
ID=25167625
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
SK1067-99A SK106799A3 (en) | 1997-02-07 | 1998-02-05 | Process for the production of 2,3-dihydroxypropylamino compound and intermediates therefor |
Country Status (15)
Country | Link |
---|---|
US (2) | US5824821A (no) |
EP (1) | EP0968173B1 (no) |
JP (1) | JP2001511173A (no) |
CN (1) | CN1246844A (no) |
AT (1) | ATE237578T1 (no) |
AU (1) | AU5996498A (no) |
BR (1) | BR9807154A (no) |
CA (1) | CA2280235A1 (no) |
DE (1) | DE69813534D1 (no) |
HU (1) | HUP0000845A3 (no) |
IL (1) | IL131423A0 (no) |
NO (1) | NO993806L (no) |
PL (1) | PL334954A1 (no) |
SK (1) | SK106799A3 (no) |
WO (1) | WO1998034905A1 (no) |
Families Citing this family (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR100358855B1 (ko) * | 2000-02-29 | 2002-10-31 | 광주과학기술원 | 사이클로덱스트린 또는 그 유도체와 조영제의 포접 착체형성 방법 |
KR100362080B1 (ko) * | 2000-03-29 | 2002-11-23 | 광주과학기술원 | 고리 올리고당과 그들의 유도체를 이용한 조영제의 새로운포접 착체 |
KR20050035137A (ko) * | 2001-10-12 | 2005-04-15 | 다우 글로벌 테크놀로지스 인크. | 아미드 연결기를 보유하는 폴리에폭시 화합물 |
US7300986B2 (en) * | 2001-10-12 | 2007-11-27 | Dow3Global Technologies Inc. | Polyepoxy compounds having an amide linkage |
KR100700701B1 (ko) | 2004-10-28 | 2007-03-28 | 동국정밀화학(주) | 이오딕사놀의 제조방법 |
US20070148096A1 (en) * | 2005-12-15 | 2007-06-28 | Lars-Goran Wistrand | Contrast Agents |
KR101098553B1 (ko) * | 2008-04-30 | 2011-12-26 | 주식회사 엘지생명과학 | 이오프로마이드의 신규한 제조방법 |
CN101921209B (zh) * | 2010-09-09 | 2013-01-30 | 江苏省原子医学研究所 | 5-硝基-n,n′-双(2,3-二羟丙基)-1,3-苯二甲酰胺的制备方法 |
US9006486B2 (en) * | 2013-01-15 | 2015-04-14 | Liebel-Flarsheim Company Llc | Synthesis of N1,N3-bis(2,3-dihydroxypropyl)-5-nitroisophthalamide |
EP3935997A1 (en) | 2015-06-08 | 2022-01-12 | Cosmetic Technologies, LLC | Automated delivery system of a cosmetic sample |
Family Cites Families (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB1548594A (en) * | 1976-06-11 | 1979-07-18 | Nyegaard & Co As | Triiodoisophthalic acid amides |
ES469020A1 (es) * | 1977-05-10 | 1979-09-01 | Kali Chemie Pharma Gmbh | Procedimiento para la preparacion de nuevos 1-acil-2-hidroxi-1,3-diaminopropanos |
DE2720968C2 (de) * | 1977-05-10 | 1986-05-07 | Kali-Chemie Pharma Gmbh, 3000 Hannover | N↓1↓-Acyl-2-hydroxy-1,3-diaminopropane und Arzneimittel |
US4115350A (en) * | 1977-07-27 | 1978-09-19 | Allied Chemical Corporation | Production of thermally stabilized polyester |
DE3014109A1 (de) * | 1980-04-12 | 1981-10-22 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von 1-aminopropandiol-2,3 (ii) |
JPS59191720A (ja) * | 1983-04-14 | 1984-10-30 | Unitika Ltd | 耐熱性ポリエステルの製造法 |
JPS6042376A (ja) * | 1983-08-18 | 1985-03-06 | Mitsubishi Chem Ind Ltd | Ν−(2,3−エポキシプロピレン)スルホンアミド誘導体及びそれを有効成分とする選択性除草剤 |
US5191119A (en) * | 1983-10-20 | 1993-03-02 | Cook Imaging Corp. | Process for producing non-ionic radiographic contrast media utilizing N-allylation |
-
1997
- 1997-02-07 US US08/796,212 patent/US5824821A/en not_active Expired - Lifetime
-
1998
- 1998-02-05 CN CN98802399.7A patent/CN1246844A/zh active Pending
- 1998-02-05 IL IL13142398A patent/IL131423A0/xx unknown
- 1998-02-05 EP EP98903137A patent/EP0968173B1/en not_active Expired - Lifetime
- 1998-02-05 AU AU59964/98A patent/AU5996498A/en not_active Abandoned
- 1998-02-05 HU HU0000845A patent/HUP0000845A3/hu unknown
- 1998-02-05 WO PCT/GB1998/000356 patent/WO1998034905A1/en active IP Right Grant
- 1998-02-05 SK SK1067-99A patent/SK106799A3/sk unknown
- 1998-02-05 DE DE69813534T patent/DE69813534D1/de not_active Expired - Lifetime
- 1998-02-05 CA CA002280235A patent/CA2280235A1/en not_active Abandoned
- 1998-02-05 PL PL98334954A patent/PL334954A1/xx unknown
- 1998-02-05 AT AT98903137T patent/ATE237578T1/de not_active IP Right Cessation
- 1998-02-05 JP JP53399398A patent/JP2001511173A/ja active Pending
- 1998-02-05 BR BR9807154-8A patent/BR9807154A/pt not_active Application Discontinuation
- 1998-09-30 US US09/163,490 patent/US6153771A/en not_active Expired - Lifetime
-
1999
- 1999-08-06 NO NO993806A patent/NO993806L/no not_active Application Discontinuation
Also Published As
Publication number | Publication date |
---|---|
US5824821A (en) | 1998-10-20 |
ATE237578T1 (de) | 2003-05-15 |
EP0968173B1 (en) | 2003-04-16 |
NO993806D0 (no) | 1999-08-06 |
DE69813534D1 (de) | 2003-05-22 |
EP0968173A1 (en) | 2000-01-05 |
JP2001511173A (ja) | 2001-08-07 |
CN1246844A (zh) | 2000-03-08 |
IL131423A0 (en) | 2001-01-28 |
BR9807154A (pt) | 2000-01-25 |
US6153771A (en) | 2000-11-28 |
NO993806L (no) | 1999-09-08 |
CA2280235A1 (en) | 1998-08-13 |
WO1998034905A1 (en) | 1998-08-13 |
AU5996498A (en) | 1998-08-26 |
HUP0000845A2 (hu) | 2002-02-28 |
HUP0000845A3 (en) | 2002-07-29 |
PL334954A1 (en) | 2000-03-27 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0108638B1 (en) | X-ray contrast agents | |
SK106799A3 (en) | Process for the production of 2,3-dihydroxypropylamino compound and intermediates therefor | |
JPH05502230A (ja) | 非イオン性x線造影剤、組成物及び方法 | |
HUT65652A (en) | Process for producing 1,3-bis-/3-(mono- or poly-hydroxy)acylamino-5-(mono-or polyhydroxyalkyl)-aminocarbonyl-2,4,6-triiodo-benzoyl-amino/-hydroxy- or hydroxyalkyl-propanes and x-ray contrast media containing them | |
RU2659214C2 (ru) | Получение промежуточных соединений для получения рентгеноконтрастных веществ | |
WO1993016983A1 (fr) | Composes utilisables dans des produits de contraste pour la radiographie | |
EP0886634B1 (en) | Process for producing ioversol | |
WO2013063737A1 (en) | Iodination process for the preparation of 3,5-disubstituted-2,4,6-triiodo aromatic amines compounds | |
AU2010224945A1 (en) | Process for the preparation of triiodinated carboxylic aromatic derivatives | |
BG63663B1 (bg) | Метод за получаване на йохексол | |
EP0923537B1 (en) | Process for the preparation of contrast agents | |
US5177261A (en) | Synthesis of ioversol using chloroacetyl chloride | |
US5840967A (en) | Process for the preparation of contrast agents | |
KR100539067B1 (ko) | X-선 조영제로서 아이오디사놀의 신규 제조방법 | |
KR100567449B1 (ko) | 아이오디사놀 유도체의 제조방법 | |
MXPA99007245A (en) | Process for the preparation of iodinated contrast agents and intermediates therefor | |
CZ276799A3 (cs) | Způsob výroby 2,3- dihydroxypropylaminoderivátů | |
JPH11505827A (ja) | ヨウ素化方法 | |
CA2145035A1 (en) | Polyiodinated compounds, process for preparing them and diagnostic compositions | |
KR100524146B1 (ko) | 아이오디사놀의 신규 제조방법 | |
JP3793584B2 (ja) | 5−アミノ−2,2−ジアルキル−1,3−ジオキサンの製造方法 | |
CN115960010A (zh) | 苯胺类化合物的制备 | |
KR20040095799A (ko) | 아이오디사놀 유도체의 개선된 제조방법 | |
CN116496171A (zh) | 碘海醇的合成 | |
JPH05502048A (ja) | 水溶性非イオンx線造影剤及びそれらの製造法 |