SE441273B - Etenpolymerisationskatalysator omfattande ett uppburet silylkromat, forfarande for dess framstellning samt anvendning derav - Google Patents
Etenpolymerisationskatalysator omfattande ett uppburet silylkromat, forfarande for dess framstellning samt anvendning deravInfo
- Publication number
- SE441273B SE441273B SE7800738A SE7800738A SE441273B SE 441273 B SE441273 B SE 441273B SE 7800738 A SE7800738 A SE 7800738A SE 7800738 A SE7800738 A SE 7800738A SE 441273 B SE441273 B SE 441273B
- Authority
- SE
- Sweden
- Prior art keywords
- weight
- silica
- catalyst
- support
- calculated
- Prior art date
Links
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 title claims description 24
- CQBWEBXPMRPCSI-UHFFFAOYSA-M O[Cr](O[SiH3])(=O)=O Chemical compound O[Cr](O[SiH3])(=O)=O CQBWEBXPMRPCSI-UHFFFAOYSA-M 0.000 title claims description 21
- 239000002685 polymerization catalyst Substances 0.000 title claims description 20
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 121
- 239000000377 silicon dioxide Substances 0.000 claims description 60
- 239000003054 catalyst Substances 0.000 claims description 40
- 239000005977 Ethylene Substances 0.000 claims description 23
- 238000002360 preparation method Methods 0.000 claims description 16
- 229910052782 aluminium Inorganic materials 0.000 claims description 15
- 238000006116 polymerization reaction Methods 0.000 claims description 15
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 claims description 14
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 13
- 239000010936 titanium Substances 0.000 claims description 13
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 12
- 229910052719 titanium Inorganic materials 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- AQLZCGLPNYEIDH-UHFFFAOYSA-N C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)O[Cr](=O)(=O)O[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 Chemical group C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)O[Cr](=O)(=O)O[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 AQLZCGLPNYEIDH-UHFFFAOYSA-N 0.000 claims description 10
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 9
- 230000008021 deposition Effects 0.000 claims description 8
- 239000012025 fluorinating agent Substances 0.000 claims description 8
- 239000011148 porous material Substances 0.000 claims description 8
- 229910052593 corundum Inorganic materials 0.000 claims description 7
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 7
- 229910001845 yogo sapphire Inorganic materials 0.000 claims description 7
- 150000002430 hydrocarbons Chemical group 0.000 claims description 6
- 239000002245 particle Substances 0.000 claims description 6
- 238000007334 copolymerization reaction Methods 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- LXPCOISGJFXEJE-UHFFFAOYSA-N oxifentorex Chemical group C=1C=CC=CC=1C[N+](C)([O-])C(C)CC1=CC=CC=C1 LXPCOISGJFXEJE-UHFFFAOYSA-N 0.000 claims description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims 6
- 239000004711 α-olefin Substances 0.000 claims 5
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims 3
- 229910052804 chromium Inorganic materials 0.000 claims 3
- 229910010413 TiO 2 Inorganic materials 0.000 claims 2
- 240000005589 Calophyllum inophyllum Species 0.000 claims 1
- 230000003197 catalytic effect Effects 0.000 claims 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 25
- 230000000052 comparative effect Effects 0.000 description 16
- 239000000155 melt Substances 0.000 description 15
- 239000002002 slurry Substances 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 8
- -1 aluminum compound Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000011156 evaluation Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229920001519 homopolymer Polymers 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229920000573 polyethylene Polymers 0.000 description 5
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 229920001038 ethylene copolymer Polymers 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 150000002222 fluorine compounds Chemical class 0.000 description 4
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 3
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 150000003609 titanium compounds Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 2
- JLDSOYXADOWAKB-UHFFFAOYSA-N aluminium nitrate Chemical compound [Al+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O JLDSOYXADOWAKB-UHFFFAOYSA-N 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 description 1
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 description 1
- 229910019975 (NH4)2SiF6 Inorganic materials 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UMJCFHSRYBYEOJ-UHFFFAOYSA-N C1=CC=C2C([Si](C=3C4=CC=CC=C4C=CC=3)(C=3C4=CC=CC=C4C=CC=3)O[Cr](=O)(O[Si](C=3C4=CC=CC=C4C=CC=3)(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=O)=CC=CC2=C1 Chemical compound C1=CC=C2C([Si](C=3C4=CC=CC=C4C=CC=3)(C=3C4=CC=CC=C4C=CC=3)O[Cr](=O)(O[Si](C=3C4=CC=CC=C4C=CC=3)(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=O)=CC=CC2=C1 UMJCFHSRYBYEOJ-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NMGYKLMMQCTUGI-UHFFFAOYSA-J diazanium;titanium(4+);hexafluoride Chemical compound [NH4+].[NH4+].[F-].[F-].[F-].[F-].[F-].[F-].[Ti+4] NMGYKLMMQCTUGI-UHFFFAOYSA-J 0.000 description 1
- PUUOOWSPWTVMDS-UHFFFAOYSA-N difluorosilane Chemical compound F[SiH2]F PUUOOWSPWTVMDS-UHFFFAOYSA-N 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F10/02—Ethene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/761,213 US4100105A (en) | 1977-01-21 | 1977-01-21 | Titanium-modified silyl chromate catalysts for ethylene polymerization |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7800738L SE7800738L (sv) | 1978-07-22 |
| SE441273B true SE441273B (sv) | 1985-09-23 |
Family
ID=25061518
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7800738A SE441273B (sv) | 1977-01-21 | 1978-01-20 | Etenpolymerisationskatalysator omfattande ett uppburet silylkromat, forfarande for dess framstellning samt anvendning derav |
Country Status (26)
| Country | Link |
|---|---|
| US (2) | US4100105A (online.php) |
| JP (1) | JPS5391092A (online.php) |
| AR (1) | AR223142A1 (online.php) |
| AU (1) | AU524400B2 (online.php) |
| BE (1) | BE863121A (online.php) |
| BR (1) | BR7800318A (online.php) |
| CA (1) | CA1111408A (online.php) |
| CS (1) | CS203181B2 (online.php) |
| DE (1) | DE2802517A1 (online.php) |
| DK (1) | DK152216C (online.php) |
| EG (1) | EG13129A (online.php) |
| ES (2) | ES466207A1 (online.php) |
| FI (1) | FI63950C (online.php) |
| FR (1) | FR2378048A1 (online.php) |
| GB (1) | GB1551596A (online.php) |
| HK (1) | HK37483A (online.php) |
| IN (1) | IN147022B (online.php) |
| IT (1) | IT1093202B (online.php) |
| MX (1) | MX4482E (online.php) |
| NL (1) | NL177315C (online.php) |
| NO (1) | NO155140C (online.php) |
| NZ (1) | NZ186280A (online.php) |
| PH (1) | PH13673A (online.php) |
| SE (1) | SE441273B (online.php) |
| SU (1) | SU1025322A3 (online.php) |
| ZA (1) | ZA777666B (online.php) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4263422A (en) * | 1979-12-31 | 1981-04-21 | The Dow Chemical Company | Polymerization of olefins with dual, independently supported catalysts |
| US4792592A (en) * | 1981-03-26 | 1988-12-20 | Union Carbide Corporation | Process for reducing sheeting during polymerization of alpha-olefins |
| US4532311A (en) * | 1981-03-26 | 1985-07-30 | Union Carbide Corporation | Process for reducing sheeting during polymerization of alpha-olefins |
| JPH0725817B2 (ja) * | 1986-04-23 | 1995-03-22 | 日本石油株式会社 | オレフイン重合用触媒 |
| JPH072798B2 (ja) * | 1987-10-28 | 1995-01-18 | 住友化学工業株式会社 | オレフィン重合用固体触媒成分 |
| EP0594914A1 (en) * | 1992-10-26 | 1994-05-04 | Bp Chemicals S.N.C. | Preparation of a catalyst for the manufacture of polyethylene |
| US6720396B2 (en) | 2000-11-30 | 2004-04-13 | Univation Technologies, Llc | Polymerization process |
| FR2825357B1 (fr) * | 2001-05-31 | 2004-04-30 | Cit Alcatel | Procede de dopage de la silice par du fluor |
| US6989344B2 (en) * | 2002-12-27 | 2006-01-24 | Univation Technologies, Llc | Supported chromium oxide catalyst for the production of broad molecular weight polyethylene |
| DE602004021787D1 (de) * | 2003-03-28 | 2009-08-13 | Union Carbide Chem Plastic | Katalysatoren basiert auf chrom in einem mineralöl und verfahren zur polymerisation von ethylen |
| US6982304B2 (en) * | 2003-12-22 | 2006-01-03 | Union Carbide Chemicals & Plastics Technology Corporation | Blow molding resins with improved ESCR |
| US7790826B2 (en) | 2004-05-06 | 2010-09-07 | DowGlobal Technologies Inc. | Polymer molding compositions |
| KR101224323B1 (ko) | 2004-12-17 | 2013-01-21 | 다우 글로벌 테크놀로지스 엘엘씨 | 레올로지 개질된 폴리에틸렌 조성물 |
| US7629422B2 (en) | 2004-12-21 | 2009-12-08 | Univation Technologies, Llc | Process for transitioning between Ziegler-Natta-based and chromium-based catalysts |
| CN100436316C (zh) * | 2005-12-16 | 2008-11-26 | 厦门大学 | 一种硅胶载体的制备方法 |
| CA2605044C (en) * | 2007-10-01 | 2014-12-02 | Nova Chemicals Corporation | Polymerization process using a mixed catalyst system |
| CA2740755C (en) | 2011-05-25 | 2019-01-15 | Nova Chemicals Corporation | Chromium catalysts for olefin polymerization |
| CA2783494C (en) | 2012-07-23 | 2019-07-30 | Nova Chemicals Corporation | Adjusting polymer composition |
| CA2800056A1 (en) | 2012-12-24 | 2014-06-24 | Nova Chemicals Corporation | Polyethylene blend compositions |
| RU2670954C9 (ru) | 2013-11-21 | 2018-11-21 | ЮНИВЕЙШН ТЕКНОЛОДЖИЗ, ЭлЭлСи | Способы регулирования свойств полимера |
| CA2837591A1 (en) | 2013-12-19 | 2015-06-19 | Nova Chemicals Corporation | Polyethylene composition for extrusion coating |
| US9914794B2 (en) | 2014-05-27 | 2018-03-13 | Sabic Global Technologies B.V. | Process for transitioning between incompatible catalysts |
| US10543473B2 (en) | 2014-06-24 | 2020-01-28 | Nova Chemicals (International) S.A. | Controlling local fluid age in a stirred reactor |
| CA2857456C (en) | 2014-07-22 | 2022-05-03 | Nova Chemicals Corporation | Improved control over particulate feed |
| ES3007208T3 (en) | 2014-09-02 | 2025-03-19 | Univation Tech Llc | Method of treating a chromium-based catalyst for polyolefin production |
| ES2866947T3 (es) | 2014-09-02 | 2021-10-20 | Univation Tech Llc | Producción de poliolefinas con catalizadores a base de cromo |
| ES2838599T3 (es) | 2014-09-02 | 2021-07-02 | Univation Tech Llc | Producción de poliolefina con catalizadores basados en cromo |
| CA2870027C (en) | 2014-11-07 | 2022-04-26 | Matthew Zaki Botros | Blow molding composition and process |
| CN107001516B (zh) | 2014-11-24 | 2023-06-06 | 尤尼威蒂恩技术有限责任公司 | 用于烯烃聚合的铬基催化剂组合物 |
| CA2967399C (en) | 2014-11-24 | 2023-03-28 | Univation Technologies, Llc | Composition comprising particles |
| CA2891002C (en) | 2015-05-13 | 2022-09-06 | Veronica Rose Zimmerman | Modeling a bed plate and its use |
| PL3377421T3 (pl) | 2015-11-19 | 2021-06-14 | Dow Global Technologies Llc | Kompozycje polietylenowe mające właściwości żywego zawiasu |
| MY187286A (en) | 2015-12-10 | 2021-09-19 | Dow Global Technologies Llc | Polyethylene compositions for the preparation of tapes, fibers, or monofilaments |
| EP3394169B1 (en) | 2015-12-21 | 2024-06-12 | Dow Global Technologies LLC | Polyethylene formulations with improved barrier and toughness for molding applications |
| US11492467B2 (en) | 2015-12-21 | 2022-11-08 | Dow Global Technologies Llc | Polyethylene formulations with improved barrier and environmental stress crack resistance |
| US10913831B2 (en) | 2016-01-29 | 2021-02-09 | Univation Technologies, Llc | Polyolefin film with improved toughness |
| ES2954927T3 (es) | 2016-04-20 | 2023-11-27 | Univation Tech Llc | Modificador del índice de flujo de polímero |
| US11180577B2 (en) | 2016-12-15 | 2021-11-23 | Univation Technologies, Llc | Rating polymerization processes |
| WO2019083716A1 (en) | 2017-10-27 | 2019-05-02 | Univation Technologies, Llc | RESINS AND FILMS BASED ON A POLYETHYLENE COPOLYMER |
| CA3079202A1 (en) | 2017-10-27 | 2019-05-02 | Univation Technologies, Llc | Selectively transitioning polymerization processes |
| US10738182B2 (en) | 2018-04-23 | 2020-08-11 | Dow Global Technologies Llc | Molded articles and methods thereof |
| SG11202010809YA (en) | 2018-05-24 | 2020-12-30 | Univation Tech Llc | Unimodal polyethylene copolymer and film thereof |
| US11649305B2 (en) | 2018-07-31 | 2023-05-16 | Univation Technologies, Llc | Unimodal polyethylene copolymer and film thereof |
| US12012472B2 (en) | 2018-07-31 | 2024-06-18 | Univation Technologies, Llc | Unimodal polyethylene copolymer and film thereof |
| KR102889869B1 (ko) | 2018-09-24 | 2025-11-25 | 셰브론 필립스 케미컬 컴퍼니 엘피 | 증가된 중합 활성을 갖는 지지된 크롬 촉매를 제조하는 방법 |
| US20220213302A1 (en) | 2019-06-10 | 2022-07-07 | Univation Technologies, Llc | Polyethylene blend |
| ES2980582T3 (es) | 2020-04-07 | 2024-10-02 | Nova Chem Int Sa | Polietileno de alta densidad para artículos rígidos |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1545098C3 (de) * | 1963-09-05 | 1980-11-06 | Union Carbide Corp., New York, N.Y. (V.St.A.) | Verfahren zur Polymerisation von Äthylen |
| NL128841C (online.php) | 1963-06-21 | |||
| NL135065C (online.php) * | 1965-05-14 | |||
| US3445367A (en) * | 1965-11-22 | 1969-05-20 | Phillips Petroleum Co | Catalyst and process for making olefin polymers of narrow molecular weight distribution |
| US3622521A (en) * | 1967-08-21 | 1971-11-23 | Phillips Petroleum Co | Olefin polymerization with chromium and titanium-containing compounds |
| US3704287A (en) * | 1970-09-17 | 1972-11-28 | Union Carbide Corp | High temperature reduced catalyst and process |
| US3974101A (en) * | 1970-10-08 | 1976-08-10 | Phillips Petroleum Company | Olefin polymerization catalyst |
| US3887494A (en) * | 1970-11-12 | 1975-06-03 | Phillips Petroleum Co | Olefin polymerization catalyst |
| US3798202A (en) * | 1971-10-12 | 1974-03-19 | Phillips Petroleum Co | Polyolefin production |
| US3870656A (en) * | 1972-05-25 | 1975-03-11 | Phillips Petroleum Co | Preparation of silica-containing compositions |
| GB1429174A (en) * | 1972-06-12 | 1976-03-24 | Bp Chem Int Ltd | Polymerisation process and catalyst |
| US3884832A (en) * | 1974-02-04 | 1975-05-20 | Chemplex Co | Organotin chromate polymerization catalyst |
| US3941761A (en) * | 1974-02-04 | 1976-03-02 | Chemplex Company | Method of polymerizing olefins |
| GB1495547A (en) * | 1974-03-22 | 1977-12-21 | British Petroleum Co | Polymerisation catalyst |
| US3959178A (en) * | 1974-03-28 | 1976-05-25 | Phillips Petroleum Company | Mixed hydrocarbyloxide treated catalyst activated at different temperatures |
| US3950316A (en) * | 1974-05-03 | 1976-04-13 | Phillips Petroleum Company | Catalyst support formed by adding acidic material to silica containing titanium |
| GB1447605A (en) | 1974-05-08 | 1976-08-25 | Phillips Petroleum Co | Olefin polymerization catalyst peparation |
| GB1505994A (en) * | 1974-06-11 | 1978-04-05 | British Petroleum Co | Polymerisation process |
| US4001196A (en) * | 1974-12-04 | 1977-01-04 | Phillips Petroleum Company | Reactivation of organochromium olefin polymerization catalyst in presence of oxygen |
| US3976632A (en) * | 1974-12-04 | 1976-08-24 | Phillips Petroleum Company | Reactivation of organochromium olefin polymerization catalyst in presence of oxygen |
| US4011382A (en) * | 1975-03-10 | 1977-03-08 | Union Carbide Corporation | Preparation of low and medium density ethylene polymer in fluid bed reactor |
| US3984351A (en) * | 1975-03-14 | 1976-10-05 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4049896A (en) * | 1975-03-14 | 1977-09-20 | National Petro Chemicals Corporation | Olefin polymerization catalyst |
| US4016343A (en) * | 1975-08-22 | 1977-04-05 | Chemplex Company | Tetravalent chromium alkoxide polymerization catalyst and method |
| US4053437A (en) * | 1976-03-04 | 1977-10-11 | Chemplex Company | Polyolefin catalyst and method for its preparation |
| US4065612A (en) * | 1976-03-30 | 1977-12-27 | Union Carbide Corporation | Phenol modified polymerization catalyst and polymerization process |
-
1977
- 1977-01-21 US US05/761,213 patent/US4100105A/en not_active Expired - Lifetime
- 1977-12-28 ZA ZA00777666A patent/ZA777666B/xx unknown
-
1978
- 1978-01-12 CA CA294,855A patent/CA1111408A/en not_active Expired
- 1978-01-16 FI FI780140A patent/FI63950C/fi not_active IP Right Cessation
- 1978-01-18 AU AU32514/78A patent/AU524400B2/en not_active Expired
- 1978-01-19 BR BR7800318A patent/BR7800318A/pt unknown
- 1978-01-20 NO NO780227A patent/NO155140C/no unknown
- 1978-01-20 SU SU782568008A patent/SU1025322A3/ru active
- 1978-01-20 BE BE184483A patent/BE863121A/xx not_active IP Right Cessation
- 1978-01-20 GB GB2471/78A patent/GB1551596A/en not_active Expired
- 1978-01-20 FR FR7801618A patent/FR2378048A1/fr active Granted
- 1978-01-20 MX MX78100707U patent/MX4482E/es unknown
- 1978-01-20 DE DE19782802517 patent/DE2802517A1/de active Granted
- 1978-01-20 JP JP441278A patent/JPS5391092A/ja active Granted
- 1978-01-20 IN IN82/CAL/78A patent/IN147022B/en unknown
- 1978-01-20 IT IT19503/78A patent/IT1093202B/it active
- 1978-01-20 CS CS78410A patent/CS203181B2/cs unknown
- 1978-01-20 NL NLAANVRAGE7800749,A patent/NL177315C/xx not_active IP Right Cessation
- 1978-01-20 SE SE7800738A patent/SE441273B/sv not_active IP Right Cessation
- 1978-01-20 NZ NZ186280A patent/NZ186280A/xx unknown
- 1978-01-20 AR AR270782A patent/AR223142A1/es active
- 1978-01-20 ES ES466207A patent/ES466207A1/es not_active Expired
- 1978-01-20 DK DK029778A patent/DK152216C/da not_active IP Right Cessation
- 1978-01-20 PH PH20695A patent/PH13673A/en unknown
- 1978-01-21 EG EG34/78A patent/EG13129A/xx active
- 1978-03-07 ES ES467604A patent/ES467604A1/es not_active Expired
- 1978-04-12 US US05/895,662 patent/US4152502A/en not_active Expired - Lifetime
-
1983
- 1983-09-29 HK HK374/83A patent/HK37483A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE441273B (sv) | Etenpolymerisationskatalysator omfattande ett uppburet silylkromat, forfarande for dess framstellning samt anvendning derav | |
| FI63764C (fi) | Foerfarande foer polymerisation av alfa-olefiner och foer framstaellning i detsamma anvaendbart fast katalytiskt komplex | |
| CA1098106A (en) | Preparation of modified and activated chromocene catalysts for ethylene polymerization | |
| CA1263104A (en) | Polymerization catalyst, production and use | |
| EP0113937A1 (en) | Supported catalyst for polymerization of olefins | |
| US3844975A (en) | Thermally aged hydride based polymerization catalyst | |
| US4402861A (en) | Polymerization catalyst and method | |
| CA1263103A (en) | Polymerization catalyst, production and use | |
| SE451586B (sv) | Katalysatorsystem, forfarande for dess framstellning och anvendning derav for olefinpolymerisation | |
| CA1248510A (en) | Polymerization catalyst, production and use | |
| US5063188A (en) | Catalyst component for ethylene polyermization and copolymerization | |
| FI92405B (fi) | Uusi olefiinipolymerointikatalyytti, menetelmä sen valmistamiseksi ja sen käyttö olefiinien polymerointiin | |
| US5104837A (en) | Catalyst and polymerization of olefins | |
| CN101472961A (zh) | 基于1,3-二醚的用于烯烃聚合的催化剂组分 | |
| CA2003992A1 (en) | Homogeneous or supported vanadium based catalyst for olefin polymerization | |
| JPS6187710A (ja) | 重合用触媒 | |
| EP0604855B1 (en) | Components and catalysts for the polymerization of olefins | |
| US6489410B1 (en) | Supported catalyst composition for polymerization of olefins | |
| JPS6187708A (ja) | 重合用触媒 | |
| US3941761A (en) | Method of polymerizing olefins | |
| KR800001246B1 (ko) | 에틸렌중합용 티타늄 변형된 실릴크롬산염 촉매의 제법 | |
| KR800001212B1 (ko) | 티타늄 변형된 실릴크롬산염촉매를 사용한 에틸렌 중합 방법 | |
| SE458612B (sv) | Katalysatorkomposition baserad paa aktiverad silika och en reaktionsprodukt av vanadinpentoxid och ett kloreringsmedel samt saett att framstaella en olefinpolymer haermed | |
| EP0754706B1 (en) | Supported polymerization-catalyst and its use for olefin polymerization | |
| CN1050136C (zh) | 丙烯聚合载体催化剂的制备 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7800738-2 Effective date: 19891201 Format of ref document f/p: F |