SE425486B - Heterocykliskt substituerade bensoesyraderivat som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoyl-bensoesyraderivat - Google Patents
Heterocykliskt substituerade bensoesyraderivat som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoyl-bensoesyraderivatInfo
- Publication number
- SE425486B SE425486B SE7802175A SE7802175A SE425486B SE 425486 B SE425486 B SE 425486B SE 7802175 A SE7802175 A SE 7802175A SE 7802175 A SE7802175 A SE 7802175A SE 425486 B SE425486 B SE 425486B
- Authority
- SE
- Sweden
- Prior art keywords
- group
- methyl ester
- carbon atoms
- acid methyl
- phenoxy
- Prior art date
Links
- 239000000543 intermediate Substances 0.000 title claims description 4
- 238000002360 preparation method Methods 0.000 title claims 2
- 239000002934 diuretic Substances 0.000 title abstract description 5
- 230000001882 diuretic effect Effects 0.000 title abstract 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 title description 7
- NAETXYOXMDYNLE-UHFFFAOYSA-N 3-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=CC(C(O)=O)=C1 NAETXYOXMDYNLE-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 44
- -1 alkoxy radical Chemical class 0.000 claims abstract description 34
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 25
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 21
- 125000003277 amino group Chemical group 0.000 claims abstract description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 239000001257 hydrogen Substances 0.000 claims abstract description 15
- 125000005843 halogen group Chemical group 0.000 claims abstract description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 125000001424 substituent group Chemical group 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000001301 oxygen Substances 0.000 claims abstract description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 abstract description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 abstract description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 2
- 229920006395 saturated elastomer Polymers 0.000 abstract 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000005042 acyloxymethyl group Chemical group 0.000 abstract 1
- 125000004849 alkoxymethyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000001589 carboacyl group Chemical group 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- 125000001072 heteroaryl group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- 125000004076 pyridyl group Chemical group 0.000 abstract 1
- 230000000894 saliuretic effect Effects 0.000 abstract 1
- 238000010561 standard procedure Methods 0.000 abstract 1
- 150000003456 sulfonamides Chemical class 0.000 abstract 1
- 125000004434 sulfur atom Chemical group 0.000 abstract 1
- 125000001544 thienyl group Chemical group 0.000 abstract 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 256
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 114
- 239000000243 solution Substances 0.000 description 106
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 97
- 229910052757 nitrogen Inorganic materials 0.000 description 81
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 75
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 72
- 239000013078 crystal Substances 0.000 description 66
- YBERTMQAGHYOFM-UHFFFAOYSA-N methyl 2-(dimethylaminomethylideneamino)sulfonylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S(=O)(=O)N=CN(C)C YBERTMQAGHYOFM-UHFFFAOYSA-N 0.000 description 53
- 238000006243 chemical reaction Methods 0.000 description 48
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 47
- 238000003756 stirring Methods 0.000 description 45
- 238000001953 recrystallisation Methods 0.000 description 44
- 239000002253 acid Substances 0.000 description 39
- 239000002244 precipitate Substances 0.000 description 39
- 239000000047 product Substances 0.000 description 35
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- 150000003949 imides Chemical class 0.000 description 31
- 239000000203 mixture Substances 0.000 description 27
- 238000001816 cooling Methods 0.000 description 26
- 239000012279 sodium borohydride Substances 0.000 description 22
- 229910000033 sodium borohydride Inorganic materials 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 150000002148 esters Chemical class 0.000 description 21
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 19
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 18
- 239000007868 Raney catalyst Substances 0.000 description 18
- 229910000564 Raney nickel Inorganic materials 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 150000004702 methyl esters Chemical class 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 13
- 229940014800 succinic anhydride Drugs 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZZTYSYZHDBRDFC-UHFFFAOYSA-N 2-(dimethylaminomethylideneamino)sulfonylbenzoic acid Chemical compound CN(C)C=NS(=O)(=O)C1=C(C(=O)O)C=CC=C1 ZZTYSYZHDBRDFC-UHFFFAOYSA-N 0.000 description 11
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 239000012043 crude product Substances 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- VGKUIQWRNJBNJC-UHFFFAOYSA-N methyl 3-amino-4-phenoxy-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC=C1 VGKUIQWRNJBNJC-UHFFFAOYSA-N 0.000 description 10
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- 239000005711 Benzoic acid Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 238000006396 nitration reaction Methods 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- DFATXMYLKPCSCX-UHFFFAOYSA-N 3-methylsuccinic anhydride Chemical compound CC1CC(=O)OC1=O DFATXMYLKPCSCX-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 5
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- UJEWTUDSLQGTOA-UHFFFAOYSA-N Piretanide Chemical compound C=1C=CC=CC=1OC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1N1CCCC1 UJEWTUDSLQGTOA-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 229960004050 aminobenzoic acid Drugs 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- TUAMRELNJMMDMT-UHFFFAOYSA-N 3,5-xylenol Chemical compound CC1=CC(C)=CC(O)=C1 TUAMRELNJMMDMT-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- WYNZBCSTICYTAO-UHFFFAOYSA-N ethyl 2-(dimethylaminomethylideneamino)sulfonylbenzoate Chemical compound C(C)OC(C1=C(C=CC=C1)S(=O)(=O)N=CN(C)C)=O WYNZBCSTICYTAO-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- 230000020477 pH reduction Effects 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 3
- 229940030606 diuretics Drugs 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- GBOAFIODIUPOGZ-UHFFFAOYSA-N methyl 3-amino-4-(4-methylphenoxy)-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=C(C)C=C1 GBOAFIODIUPOGZ-UHFFFAOYSA-N 0.000 description 3
- GSCYRFYSMSQVKX-UHFFFAOYSA-N methyl 3-nitro-4-phenoxy-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1OC1=CC=CC=C1 GSCYRFYSMSQVKX-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- AGRIQBHIKABLPJ-UHFFFAOYSA-N 1-Pyrrolidinecarboxaldehyde Chemical compound O=CN1CCCC1 AGRIQBHIKABLPJ-UHFFFAOYSA-N 0.000 description 2
- WXUAQHNMJWJLTG-UHFFFAOYSA-N 2-methylbutanedioic acid Chemical compound OC(=O)C(C)CC(O)=O WXUAQHNMJWJLTG-UHFFFAOYSA-N 0.000 description 2
- QYHXFJMWVSUXMW-UHFFFAOYSA-N 3-(methylsulfamoyl)-4-phenoxy-5-pyrrolidin-1-ylbenzoic acid Chemical compound C=1C=CC=CC=1OC=1C(S(=O)(=O)NC)=CC(C(O)=O)=CC=1N1CCCC1 QYHXFJMWVSUXMW-UHFFFAOYSA-N 0.000 description 2
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 2
- RIHWJROUZAYQGA-UHFFFAOYSA-N 3-chlorooxolane-2,5-dione Chemical compound ClC1CC(=O)OC1=O RIHWJROUZAYQGA-UHFFFAOYSA-N 0.000 description 2
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 2
- BITCZCKWZFSLKH-UHFFFAOYSA-N 4-(4-methylphenoxy)-3-nitro-5-sulfamoylbenzoic acid Chemical compound C1=CC(C)=CC=C1OC1=C([N+]([O-])=O)C=C(C(O)=O)C=C1S(N)(=O)=O BITCZCKWZFSLKH-UHFFFAOYSA-N 0.000 description 2
- FHQAWINGVCDTTG-UHFFFAOYSA-N 4-chloro-3-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC=C1Cl FHQAWINGVCDTTG-UHFFFAOYSA-N 0.000 description 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- WXGYZMSGMPFLPV-UHFFFAOYSA-N methyl 3,5-diamino-4-phenoxybenzoate Chemical compound NC1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC=C1 WXGYZMSGMPFLPV-UHFFFAOYSA-N 0.000 description 2
- ZKYCAYQUHKVHIR-UHFFFAOYSA-N methyl 3,5-dinitro-4-phenoxybenzoate Chemical compound [O-][N+](=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1OC1=CC=CC=C1 ZKYCAYQUHKVHIR-UHFFFAOYSA-N 0.000 description 2
- WSDGTEVEZCDJGX-UHFFFAOYSA-N methyl 3-amino-4-phenoxy-5-pyrrolidin-1-ylbenzoate Chemical compound C1CCCN1C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC=C1 WSDGTEVEZCDJGX-UHFFFAOYSA-N 0.000 description 2
- BKMYNRUQEBEWJM-UHFFFAOYSA-N methyl 3-amino-5-(2,5-dioxopyrrolidin-1-yl)-4-phenoxybenzoate Chemical compound O=C1CCC(=O)N1C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC=C1 BKMYNRUQEBEWJM-UHFFFAOYSA-N 0.000 description 2
- PRPWLZLYDBMMOO-UHFFFAOYSA-N methyl 3-chlorosulfonyl-4-phenoxy-5-pyrrolidin-1-ylbenzoate Chemical compound C=1C=CC=CC=1OC=1C(S(Cl)(=O)=O)=CC(C(=O)OC)=CC=1N1CCCC1 PRPWLZLYDBMMOO-UHFFFAOYSA-N 0.000 description 2
- TUUAWLRZSQVSEJ-UHFFFAOYSA-N methyl 4-(4-methylphenoxy)-3-nitro-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1OC1=CC=C(C)C=C1 TUUAWLRZSQVSEJ-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000011973 solid acid Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000003860 tertiary carboxamides Chemical class 0.000 description 2
- WVUYYXUATWMVIT-UHFFFAOYSA-N 1-bromo-4-ethoxybenzene Chemical compound CCOC1=CC=C(Br)C=C1 WVUYYXUATWMVIT-UHFFFAOYSA-N 0.000 description 1
- NAMDIHYPBYVYAP-UHFFFAOYSA-N 1-methoxy-2-(2-methoxyethoxy)ethane Chemical compound COCCOCCOC.COCCOCCOC NAMDIHYPBYVYAP-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- KLZYRCVPDWTZLH-UHFFFAOYSA-N 2,3-dimethylsuccinic acid Chemical compound OC(=O)C(C)C(C)C(O)=O KLZYRCVPDWTZLH-UHFFFAOYSA-N 0.000 description 1
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 1
- DHZZPKMVVSTYLF-UHFFFAOYSA-N 2-(2-methylanilino)ethanol Chemical compound CC1=CC=CC=C1NCCO DHZZPKMVVSTYLF-UHFFFAOYSA-N 0.000 description 1
- VSOOBQALJVLTBH-UHFFFAOYSA-N 2-aminosulfonyl-benzoic acid methyl ester Chemical compound COC(=O)C1=CC=CC=C1S(N)(=O)=O VSOOBQALJVLTBH-UHFFFAOYSA-N 0.000 description 1
- KVQJVAOMYWTLEO-UHFFFAOYSA-N 2-chlorobutanoyl chloride Chemical compound CCC(Cl)C(Cl)=O KVQJVAOMYWTLEO-UHFFFAOYSA-N 0.000 description 1
- KDNIOKSLVIGAAN-UHFFFAOYSA-N 2-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC=CC=C1C(O)=O KDNIOKSLVIGAAN-UHFFFAOYSA-N 0.000 description 1
- ACJPFLIEHGFXGP-UHFFFAOYSA-N 3,3-dimethyloxolane-2,5-dione Chemical compound CC1(C)CC(=O)OC1=O ACJPFLIEHGFXGP-UHFFFAOYSA-N 0.000 description 1
- XUPDAYVRINNSDP-UHFFFAOYSA-N 3-(2,5-dihydropyrrol-1-yl)-4-(4-methylphenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=CC(C)=CC=C1OC1=C(N2CC=CC2)C=C(C(O)=O)C=C1S(N)(=O)=O XUPDAYVRINNSDP-UHFFFAOYSA-N 0.000 description 1
- CCMFALOSFFRVES-UHFFFAOYSA-N 3-(3-chloropyrrolidin-1-yl)-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound C=1C=CC=CC=1OC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1N1CCC(Cl)C1 CCMFALOSFFRVES-UHFFFAOYSA-N 0.000 description 1
- FGMRHNYMZYMARX-UHFFFAOYSA-N 3-amino-2-nitrobenzoic acid Chemical class NC1=CC=CC(C(O)=O)=C1[N+]([O-])=O FGMRHNYMZYMARX-UHFFFAOYSA-N 0.000 description 1
- ZFQWZHGDRRHUBY-UHFFFAOYSA-N 3-amino-5-sulfamoylbenzoic acid Chemical class NC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1 ZFQWZHGDRRHUBY-UHFFFAOYSA-N 0.000 description 1
- YQLVIOYSGHEJDA-UHFFFAOYSA-N 3-methyloxane-2,6-dione Chemical compound CC1CCC(=O)OC1=O YQLVIOYSGHEJDA-UHFFFAOYSA-N 0.000 description 1
- NXJUSSNAIUIVKY-UHFFFAOYSA-N 3-nitro-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1OC1=CC=CC=C1 NXJUSSNAIUIVKY-UHFFFAOYSA-N 0.000 description 1
- NOLIYKXTQHJVQL-UHFFFAOYSA-N 3-nitro-5-sulfamoyl-4-[3-(trifluoromethyl)phenoxy]benzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1OC1=CC=CC(C(F)(F)F)=C1 NOLIYKXTQHJVQL-UHFFFAOYSA-N 0.000 description 1
- CCKDQRJEUZFGIC-UHFFFAOYSA-N 3-pyrrolidin-1-yl-5-sulfamoyl-4-[3-(trifluoromethyl)phenoxy]benzoic acid Chemical compound C=1C=CC(C(F)(F)F)=CC=1OC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1N1CCCC1 CCKDQRJEUZFGIC-UHFFFAOYSA-N 0.000 description 1
- XZYOYUXUZOVMCI-UHFFFAOYSA-N 4-(3,5-dimethylphenoxy)-3-nitro-5-sulfamoylbenzoic acid Chemical compound CC1=CC(C)=CC(OC=2C(=CC(=CC=2[N+]([O-])=O)C(O)=O)S(N)(=O)=O)=C1 XZYOYUXUZOVMCI-UHFFFAOYSA-N 0.000 description 1
- JWSZFBBQURCONC-UHFFFAOYSA-N 4-(3,5-dimethylphenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid Chemical compound CC1=CC(C)=CC(OC=2C(=CC(=CC=2N2CCCC2)C(O)=O)S(N)(=O)=O)=C1 JWSZFBBQURCONC-UHFFFAOYSA-N 0.000 description 1
- QHODPXYVVMNECI-UHFFFAOYSA-N 4-(4-chlorophenoxy)-3-(3-methylpyrrolidin-1-yl)-5-sulfamoylbenzoic acid Chemical compound C1C(C)CCN1C1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1OC1=CC=C(Cl)C=C1 QHODPXYVVMNECI-UHFFFAOYSA-N 0.000 description 1
- QSWOXWCIUWBXBT-UHFFFAOYSA-N 4-(4-chlorophenoxy)-3-nitro-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1OC1=CC=C(Cl)C=C1 QSWOXWCIUWBXBT-UHFFFAOYSA-N 0.000 description 1
- LFFIVZOMUVXWMX-UHFFFAOYSA-N 4-(4-chlorophenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid Chemical compound C=1C=C(Cl)C=CC=1OC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1N1CCCC1 LFFIVZOMUVXWMX-UHFFFAOYSA-N 0.000 description 1
- NWJASWQDOYAVBG-UHFFFAOYSA-N 4-(4-fluorophenoxy)-3-(3-methylpyrrolidin-1-yl)-5-sulfamoylbenzoic acid Chemical compound FC1=CC=C(OC2=C(C=C(C(=O)O)C=C2S(N)(=O)=O)N2CC(CC2)C)C=C1 NWJASWQDOYAVBG-UHFFFAOYSA-N 0.000 description 1
- SULJSKTZCORWCP-UHFFFAOYSA-N 4-(4-fluorophenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid Chemical compound FC1=CC=C(OC2=C(C=C(C(=O)O)C=C2S(N)(=O)=O)N2CCCC2)C=C1 SULJSKTZCORWCP-UHFFFAOYSA-N 0.000 description 1
- WRORTCQUWWVUEV-UHFFFAOYSA-N 4-(4-methoxyphenoxy)-3-(3-methylpyrrolidin-1-yl)-5-sulfamoylbenzoic acid Chemical compound C1=CC(OC)=CC=C1OC1=C(N2CC(C)CC2)C=C(C(O)=O)C=C1S(N)(=O)=O WRORTCQUWWVUEV-UHFFFAOYSA-N 0.000 description 1
- RUBHNUKQOFEONL-UHFFFAOYSA-N 4-(4-methoxyphenoxy)-3-nitro-5-sulfamoylbenzoic acid Chemical compound C1=CC(OC)=CC=C1OC1=C([N+]([O-])=O)C=C(C(O)=O)C=C1S(N)(=O)=O RUBHNUKQOFEONL-UHFFFAOYSA-N 0.000 description 1
- CVOPZJFENAZTRI-UHFFFAOYSA-N 4-(4-methylphenyl)sulfanyl-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid Chemical compound C1=CC(C)=CC=C1SC1=C(N2CCCC2)C=C(C(O)=O)C=C1S(N)(=O)=O CVOPZJFENAZTRI-UHFFFAOYSA-N 0.000 description 1
- KLSLBUSXWBJMEC-UHFFFAOYSA-N 4-Propylphenol Chemical compound CCCC1=CC=C(O)C=C1 KLSLBUSXWBJMEC-UHFFFAOYSA-N 0.000 description 1
- UNETVGRYCZQKPJ-UHFFFAOYSA-N 4-benzyl-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1N1CCCC1 UNETVGRYCZQKPJ-UHFFFAOYSA-N 0.000 description 1
- HLOODOZAHCJKBE-UHFFFAOYSA-N 4-chloro-2-(dimethylaminomethylideneamino)sulfonyl-3-nitrobenzoic acid Chemical compound [N+](=O)([O-])C=1C(=C(C(=O)O)C=CC=1Cl)S(=O)(=O)N=CN(C)C HLOODOZAHCJKBE-UHFFFAOYSA-N 0.000 description 1
- ACYLUAGCBGTEJF-UHFFFAOYSA-N 4-chloro-3-nitro-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1Cl ACYLUAGCBGTEJF-UHFFFAOYSA-N 0.000 description 1
- MNVMYTVDDOXZLS-UHFFFAOYSA-N 4-methoxyguaiacol Natural products COC1=CC=C(O)C(OC)=C1 MNVMYTVDDOXZLS-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PVTRUXDNYDEGHN-UHFFFAOYSA-N CN(C)C.CCCC(Cl)=O Chemical compound CN(C)C.CCCC(Cl)=O PVTRUXDNYDEGHN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 240000006927 Foeniculum vulgare Species 0.000 description 1
- 235000004204 Foeniculum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- GAOGDPGUNDSDBW-UHFFFAOYSA-N NS(C(C(N1CCCC1)=C(C=C1)SC2=CC=CC=C2)=C1C(O)=O)(=O)=O Chemical compound NS(C(C(N1CCCC1)=C(C=C1)SC2=CC=CC=C2)=C1C(O)=O)(=O)=O GAOGDPGUNDSDBW-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 241000721230 Paraphlebia zoe Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- IRXBNHGNHKNOJI-UHFFFAOYSA-N butanedioyl dichloride Chemical compound ClC(=O)CCC(Cl)=O IRXBNHGNHKNOJI-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- MPTQRFCYZCXJFQ-UHFFFAOYSA-L copper(II) chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Cu+2] MPTQRFCYZCXJFQ-UHFFFAOYSA-L 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- OABZFRQPGYTMFB-UHFFFAOYSA-N ethyl 4-chloro-4-sulfamoylcyclohexa-1,5-diene-1-carboxylate Chemical compound CCOC(=O)C1=CCC(Cl)(S(N)(=O)=O)C=C1 OABZFRQPGYTMFB-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000002523 gelfiltration Methods 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- AOXPHVNMBPFOFS-UHFFFAOYSA-N methyl 2-nitrobenzoate Chemical compound COC(=O)C1=CC=CC=C1[N+]([O-])=O AOXPHVNMBPFOFS-UHFFFAOYSA-N 0.000 description 1
- KSSBCHHJZDXKDW-UHFFFAOYSA-N methyl 3-(3-chloropyrrolidin-1-yl)-4-phenoxy-5-sulfamoylbenzoate Chemical compound COC(C1=CC(=C(C(=C1)S(N)(=O)=O)OC1=CC=CC=C1)N1CC(CC1)Cl)=O KSSBCHHJZDXKDW-UHFFFAOYSA-N 0.000 description 1
- VZQOKMYWCSUNFY-UHFFFAOYSA-N methyl 3-(methylsulfamoyl)-4-phenoxy-5-pyrrolidin-1-ylbenzoate Chemical compound C=1C=CC=CC=1OC=1C(S(=O)(=O)NC)=CC(C(=O)OC)=CC=1N1CCCC1 VZQOKMYWCSUNFY-UHFFFAOYSA-N 0.000 description 1
- FEJYSRFTTCZIJF-UHFFFAOYSA-N methyl 3-amino-4-(3,5-dimethylphenoxy)-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC(C)=CC(C)=C1 FEJYSRFTTCZIJF-UHFFFAOYSA-N 0.000 description 1
- UTBJZHJSGKGWAA-UHFFFAOYSA-N methyl 3-amino-4-(4-chlorophenoxy)-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=C(Cl)C=C1 UTBJZHJSGKGWAA-UHFFFAOYSA-N 0.000 description 1
- KFPDOOCSCWGFSK-UHFFFAOYSA-N methyl 3-amino-4-(4-methoxyphenoxy)-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=C(OC)C=C1 KFPDOOCSCWGFSK-UHFFFAOYSA-N 0.000 description 1
- FDJYDZXNYYLRIJ-UHFFFAOYSA-N methyl 3-amino-4-benzyl-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1CC1=CC=CC=C1 FDJYDZXNYYLRIJ-UHFFFAOYSA-N 0.000 description 1
- GMXSPMKYAOAVCU-UHFFFAOYSA-N methyl 3-amino-4-phenylsulfanyl-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1SC1=CC=CC=C1 GMXSPMKYAOAVCU-UHFFFAOYSA-N 0.000 description 1
- OZLACQIGXFNCLJ-UHFFFAOYSA-N methyl 3-amino-5-(methylsulfamoyl)-4-phenoxybenzoate Chemical compound CNS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC=C1 OZLACQIGXFNCLJ-UHFFFAOYSA-N 0.000 description 1
- UMIJEMFJEZCPQS-UHFFFAOYSA-N methyl 3-amino-5-nitro-4-phenoxybenzoate Chemical compound [O-][N+](=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC=C1 UMIJEMFJEZCPQS-UHFFFAOYSA-N 0.000 description 1
- HVBBBPUHHFWTAD-UHFFFAOYSA-N methyl 3-amino-5-sulfamoyl-4-[3-(trifluoromethyl)phenoxy]benzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC(N)=C1OC1=CC=CC(C(F)(F)F)=C1 HVBBBPUHHFWTAD-UHFFFAOYSA-N 0.000 description 1
- SQIBNKUEUWGZBH-UHFFFAOYSA-N methyl 3-chlorosulfonylbenzoate Chemical compound COC(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 SQIBNKUEUWGZBH-UHFFFAOYSA-N 0.000 description 1
- XRYAKSDEOMNYOF-UHFFFAOYSA-N methyl 3-nitro-4-phenoxy-5-pyrrolidin-1-ylbenzoate Chemical compound C=1C=CC=CC=1OC=1C([N+]([O-])=O)=CC(C(=O)OC)=CC=1N1CCCC1 XRYAKSDEOMNYOF-UHFFFAOYSA-N 0.000 description 1
- BWOGMDQQOVUAFH-UHFFFAOYSA-N methyl 3-nitro-5-sulfamoyl-2-[3-(trifluoromethyl)phenoxy]benzoate Chemical compound COC(=O)C1=CC(S(N)(=O)=O)=CC([N+]([O-])=O)=C1OC1=CC=CC(C(F)(F)F)=C1 BWOGMDQQOVUAFH-UHFFFAOYSA-N 0.000 description 1
- OBXGRZWALNTHIC-UHFFFAOYSA-N methyl 4-(3,5-dimethylphenoxy)-3-nitro-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1OC1=CC(C)=CC(C)=C1 OBXGRZWALNTHIC-UHFFFAOYSA-N 0.000 description 1
- AXSTXCGKABOEPW-UHFFFAOYSA-N methyl 4-(4-chlorophenoxy)-3-nitro-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1OC1=CC=C(Cl)C=C1 AXSTXCGKABOEPW-UHFFFAOYSA-N 0.000 description 1
- JNTJPOSQYILQSP-UHFFFAOYSA-N methyl 4-(4-methoxyphenoxy)-3-nitro-5-sulfamoylbenzoate Chemical compound NS(=O)(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1OC1=CC=C(OC)C=C1 JNTJPOSQYILQSP-UHFFFAOYSA-N 0.000 description 1
- BHZXUNSMGQJGTP-UHFFFAOYSA-N methyl 4-benzyl-3-pyrrolidin-1-yl-5-sulfamoylbenzoate Chemical compound C=1C=CC=CC=1CC=1C(S(N)(=O)=O)=CC(C(=O)OC)=CC=1N1CCCC1 BHZXUNSMGQJGTP-UHFFFAOYSA-N 0.000 description 1
- IPQHNKPCTMMTLI-UHFFFAOYSA-N methyl 4-chloro-3-sulfamoylbenzoate Chemical compound COC(=O)C1=CC=C(Cl)C(S(N)(=O)=O)=C1 IPQHNKPCTMMTLI-UHFFFAOYSA-N 0.000 description 1
- WYUJUHDZHVCFGK-UHFFFAOYSA-N methyl 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoate Chemical compound C=1C=CC=CC=1OC=1C(S(N)(=O)=O)=CC(C(=O)OC)=CC=1N1CCCC1 WYUJUHDZHVCFGK-UHFFFAOYSA-N 0.000 description 1
- GTMKFFRDEQCSAP-UHFFFAOYSA-N methyl 5-amino-3-(dimethylaminomethylidene)-4-phenylsulfanyl-6-sulfamoylcyclohexa-1,5-diene-1-carboxylate Chemical compound COC(C=1C(=C(C(C(C=1)=CN(C)C)SC1=CC=CC=C1)N)S(=O)(=O)N)=O GTMKFFRDEQCSAP-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- YVOFTMXWTWHRBH-UHFFFAOYSA-N pentanedioyl dichloride Chemical compound ClC(=O)CCCC(Cl)=O YVOFTMXWTWHRBH-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- HMSLXWQWEJXFFR-UHFFFAOYSA-M potassium;4-chlorophenolate Chemical compound [K+].[O-]C1=CC=C(Cl)C=C1 HMSLXWQWEJXFFR-UHFFFAOYSA-M 0.000 description 1
- NOCQQZLSUGMTIS-UHFFFAOYSA-M potassium;4-methoxyphenolate Chemical compound [K+].COC1=CC=C([O-])C=C1 NOCQQZLSUGMTIS-UHFFFAOYSA-M 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012063 pure reaction product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 230000000054 salidiuretic effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- LEWPSSCATGWXEP-UHFFFAOYSA-M sodium;1,3-benzodioxol-5-olate Chemical compound [Na+].[O-]C1=CC=C2OCOC2=C1 LEWPSSCATGWXEP-UHFFFAOYSA-M 0.000 description 1
- IIHZUISTNNNXQQ-UHFFFAOYSA-M sodium;3-methoxyphenolate Chemical compound [Na+].COC1=CC=CC([O-])=C1 IIHZUISTNNNXQQ-UHFFFAOYSA-M 0.000 description 1
- FENGEGUDMXHOBU-UHFFFAOYSA-M sodium;4-fluorophenolate Chemical compound [Na+].[O-]C1=CC=C(F)C=C1 FENGEGUDMXHOBU-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
- C07D207/327—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/45—Non condensed piperidines, e.g. piperocaine having oxo groups directly attached to the heterocyclic ring, e.g. cycloheximide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/10—Antioedematous agents; Diuretics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/52—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring condensed with a ring other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/34—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/86—Oxygen atoms
- C07D211/88—Oxygen atoms attached in positions 2 and 6, e.g. glutarimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
- C07D265/32—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings with oxygen atoms directly attached to ring carbon atoms
- C07D265/33—Two oxygen atoms, in positions 3 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Indole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2419970A DE2419970C3 (de) | 1974-04-25 | 1974-04-25 | 3-<l-Pyrrolidinyl)-4-phenoxy-5sulfamoylbenzoesäure und Verfahren zu ihrer Herstellung |
| DE2461601A DE2461601C2 (de) | 1974-04-25 | 1974-12-27 | 3-Pyrrolidino-4-phenoxy-5-sulfamoylbenzoesäureester und Verfahren zu ihrer Herstellung |
| AU46290/79A AU521892B2 (en) | 1974-04-25 | 1979-04-19 | Sulphamoylbenzoic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7802175L SE7802175L (sv) | 1978-02-27 |
| SE425486B true SE425486B (sv) | 1982-10-04 |
Family
ID=27154410
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7802175A SE425486B (sv) | 1974-04-25 | 1978-02-27 | Heterocykliskt substituerade bensoesyraderivat som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoyl-bensoesyraderivat |
| SE7802176A SE425488B (sv) | 1974-04-25 | 1978-02-27 | Bensoesyraderivat avsedda som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoylbensoesyraderivat |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7802176A SE425488B (sv) | 1974-04-25 | 1978-02-27 | Bensoesyraderivat avsedda som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoylbensoesyraderivat |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4010273A (OSRAM) |
| JP (1) | JPS624385B2 (OSRAM) |
| AT (1) | AT356091B (OSRAM) |
| AU (1) | AU521892B2 (OSRAM) |
| BE (1) | BE828441A (OSRAM) |
| CA (1) | CA1039734A (OSRAM) |
| CH (5) | CH615910A5 (OSRAM) |
| DE (2) | DE2419970C3 (OSRAM) |
| FR (1) | FR2324298A1 (OSRAM) |
| GB (1) | GB1504505A (OSRAM) |
| LU (1) | LU72348A1 (OSRAM) |
| NL (1) | NL188410C (OSRAM) |
| OA (1) | OA04987A (OSRAM) |
| SE (2) | SE425486B (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK156300B (da) * | 1979-05-04 | 1989-07-31 | Hoechst Ag | Analogifremgangsmaade til fremstilling af substituerede pyrrolidinyl-benzoesyrederivater |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4093735A (en) * | 1974-04-25 | 1978-06-06 | Hoechst Aktiengesellschaft | 5-Sulfamoylbenzoic acid derivatives carrying a heterocyclic substituent |
| CH628622A5 (de) * | 1976-12-24 | 1982-03-15 | Ciba Geigy Ag | Verfahren zur herstellung von neuen in 4-stellung substituierten 3-sulfamoylbenzoesaeuren. |
| ES465207A1 (es) * | 1976-12-24 | 1978-11-16 | Hoechst Ag | Procedimiento para la preparacion de derivados de acidos pi-rrolo-benzoicos. |
| DE2966048D1 (en) * | 1978-07-20 | 1983-09-15 | Basf Ag | N-arylsulfonyl pyrroles, their preparation and medicaments containing them |
| EP0010799B1 (en) * | 1978-10-27 | 1982-05-19 | Shell Internationale Researchmaatschappij B.V. | A process for the preparation of 3-azabicyclo(3.1.0)hexane derivatives and modifications thereof |
| DE3208189A1 (de) * | 1982-03-06 | 1983-09-08 | Hoechst Ag, 6230 Frankfurt | 2-aminomethyl-6-sulfamoylphenolderivate, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen |
| CA2213693C (en) * | 1995-02-22 | 2008-04-15 | Hoechst Pharmaceuticals & Chemicals K.K. | Amorphous piretanide, piretanide polymorphs, process for their preparation and their use |
| US5908858A (en) | 1996-04-05 | 1999-06-01 | Sankyo Company, Limited | 1,2-diphenylpyrrole derivatives, their preparation and their therapeutic uses |
| US8008283B2 (en) * | 1998-12-23 | 2011-08-30 | Neurotherapeutics Pharma, Inc. | Methods and compositions for the treatment of neuropsychiatric disorders |
| US8722668B2 (en) * | 1998-12-23 | 2014-05-13 | Daryl W. Hochman | Methods and compositions for the treatment of neuropathic pain and neuropsychiatric disorders |
| RS20050106A (sr) | 2002-08-19 | 2007-11-15 | Pfizer Products Inc., | Kombinovana terapija hiperproliferativnih bolesti |
| RU2391340C2 (ru) * | 2004-08-11 | 2010-06-10 | Киорин Фармасьютикал Ко., Лтд. | Новое циклическое производное аминобензойной кислоты |
| US20080275093A1 (en) * | 2004-11-15 | 2008-11-06 | Nitromed, Inc. | Diuretic Compounds Comprising Heterocyclic Nitric Oxide Donor Groups, Compositions and Methods of Use |
| DE102005002130A1 (de) * | 2005-01-17 | 2006-07-27 | Sanofi-Aventis Deutschland Gmbh | Substituierte N-Aminomethylensulfonamide, ihre Herstellung und Verwendung als Arzneimittel |
| US20070149526A1 (en) * | 2005-10-17 | 2007-06-28 | Neurotherapeutics Pharma, L.L.C. | Diuretic and diuretic-like compound analogs |
| US7741317B2 (en) | 2005-10-21 | 2010-06-22 | Bristol-Myers Squibb Company | LXR modulators |
| US7888376B2 (en) | 2005-11-23 | 2011-02-15 | Bristol-Myers Squibb Company | Heterocyclic CETP inhibitors |
| WO2008070496A2 (en) | 2006-12-01 | 2008-06-12 | Bristol-Myers Squibb Company | N- ( (3-benzyl) -2, 2- (bis-phenyl) -propan-1-amine derivatives as cetp inhibitors for the treatment of atherosclerosis and cardiovascular diseases |
| EP2170062A4 (en) | 2007-07-12 | 2010-12-29 | Tragara Pharmaceuticals Inc | METHOD AND COMPOSITIONS FOR THE TREATMENT OF CANCER DISORDERS, TUMORS AND TUMOR-DISORDED DISEASES |
| US9616075B2 (en) | 2012-07-20 | 2017-04-11 | University Of Rochester | Method of treating and preventing brain impairment using Na+-K+-2Cl-cotransporter isoform 1 inhibitors |
| AU2014255381A1 (en) | 2013-04-17 | 2015-10-08 | Pfizer Inc. | N-piperidin-3-ylbenzamide derivatives for treating cardiovascular diseases |
| WO2016055901A1 (en) | 2014-10-08 | 2016-04-14 | Pfizer Inc. | Substituted amide compounds |
| WO2018204532A1 (en) | 2017-05-03 | 2018-11-08 | Vivace Therapeutics, Inc. | Non-fused tricyclic compounds |
| AU2018321291A1 (en) | 2017-08-21 | 2020-03-26 | Vivace Therapeutics, Inc. | Benzosulfonyl compounds |
| US11524943B1 (en) | 2017-12-06 | 2022-12-13 | Vivace Therapeutics, Inc. | Benzocarbonyl compounds |
| KR102787665B1 (ko) | 2018-04-06 | 2025-03-27 | 지렌틴 아게 | 다한증 치료용 부메타니드 유도체 |
| US20210163406A1 (en) | 2018-04-06 | 2021-06-03 | University Of Pittsburgh - Of The Commonwealth System Of Higher Education | Bumetanide Derivatives for the Therapy of Stroke and Other Neurological Diseases/Disorders Involving NKCCs |
| CA3100503A1 (en) | 2018-05-16 | 2019-11-21 | Vivace Therapeutics, Inc. | Oxadiazole compounds |
| CR20210441A (es) | 2019-01-18 | 2022-03-11 | Astrazeneca Ab | Inhibidores de la pcsk9 y métodos de uso de los mismos |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1122541B (de) * | 1959-12-28 | 1962-01-25 | Hoechst Ag | Verfahren zur Herstellung von Sulfamyl-anthranilsaeuren |
| US3565920A (en) * | 1966-12-29 | 1971-02-23 | Ciba Geigy Corp | 5-sulfamyl-anthranilic acids |
| IE33874B1 (en) * | 1968-12-24 | 1974-11-27 | Leo Pharm Prod Ltd | New sulphamyl-benzoic acid derivatives |
| US3939267A (en) * | 1972-10-13 | 1976-02-17 | Ciba-Geigy Corporation | 4-Ethers of 3-amino-5-sulfamoylbenzoic acids |
-
1974
- 1974-04-25 DE DE2419970A patent/DE2419970C3/de not_active Expired
- 1974-12-27 DE DE2461601A patent/DE2461601C2/de not_active Expired
-
1975
- 1975-04-18 NL NLAANVRAGE7504653,A patent/NL188410C/xx not_active IP Right Cessation
- 1975-04-22 CH CH510175A patent/CH615910A5/de not_active IP Right Cessation
- 1975-04-23 US US05/570,649 patent/US4010273A/en not_active Expired - Lifetime
- 1975-04-23 LU LU72348A patent/LU72348A1/xx unknown
- 1975-04-24 AT AT316475A patent/AT356091B/de not_active IP Right Cessation
- 1975-04-24 CA CA225,818A patent/CA1039734A/en not_active Expired
- 1975-04-25 GB GB17337/75A patent/GB1504505A/en not_active Expired
- 1975-04-25 OA OA55483A patent/OA04987A/xx unknown
- 1975-04-25 JP JP50050627A patent/JPS624385B2/ja not_active Expired
- 1975-04-25 BE BE155823A patent/BE828441A/xx not_active IP Right Cessation
- 1975-04-25 FR FR7513047A patent/FR2324298A1/fr active Granted
-
1978
- 1978-02-27 SE SE7802175A patent/SE425486B/sv not_active IP Right Cessation
- 1978-02-27 SE SE7802176A patent/SE425488B/sv not_active IP Right Cessation
-
1979
- 1979-02-23 CH CH181479A patent/CH616923A5/de not_active IP Right Cessation
- 1979-02-23 CH CH181279A patent/CH616921A5/de not_active IP Right Cessation
- 1979-02-23 CH CH181379A patent/CH616922A5/de not_active IP Right Cessation
- 1979-04-19 AU AU46290/79A patent/AU521892B2/en not_active Expired
- 1979-11-29 CH CH1064079A patent/CH620677A5/de not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK156300B (da) * | 1979-05-04 | 1989-07-31 | Hoechst Ag | Analogifremgangsmaade til fremstilling af substituerede pyrrolidinyl-benzoesyrederivater |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2419970B2 (OSRAM) | 1979-09-27 |
| JPS624385B2 (OSRAM) | 1987-01-30 |
| AU521892B2 (en) | 1982-05-06 |
| NL188410B (nl) | 1992-01-16 |
| CH616922A5 (OSRAM) | 1980-04-30 |
| ATA316475A (de) | 1979-09-15 |
| CH615910A5 (OSRAM) | 1980-02-29 |
| LU72348A1 (OSRAM) | 1977-02-03 |
| DE2461601A1 (de) | 1976-07-08 |
| CA1039734A (en) | 1978-10-03 |
| SE7802176L (sv) | 1978-02-27 |
| GB1504505A (en) | 1978-03-22 |
| NL188410C (nl) | 1992-06-16 |
| AU4629079A (en) | 1979-11-01 |
| CH620677A5 (OSRAM) | 1980-12-15 |
| BE828441A (fr) | 1975-10-27 |
| US4010273A (en) | 1977-03-01 |
| JPS50142558A (OSRAM) | 1975-11-17 |
| OA04987A (fr) | 1980-11-30 |
| FR2324298B1 (OSRAM) | 1979-08-10 |
| DE2419970C3 (de) | 1980-06-12 |
| CH616923A5 (OSRAM) | 1980-04-30 |
| FR2324298A1 (fr) | 1977-04-15 |
| DE2419970A1 (de) | 1975-11-13 |
| NL7504653A (nl) | 1975-10-28 |
| AT356091B (de) | 1980-04-10 |
| SE7802175L (sv) | 1978-02-27 |
| SE425488B (sv) | 1982-10-04 |
| CH616921A5 (OSRAM) | 1980-04-30 |
| DE2461601C2 (de) | 1982-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE425486B (sv) | Heterocykliskt substituerade bensoesyraderivat som mellanprodukter for framstellning av som diuretika anvendbara heterocykliskt substituerade 5-sulfamoyl-bensoesyraderivat | |
| Caldwell et al. | Substituted 2-sulfonamido-5-aminopyridines | |
| US2700671A (en) | Derivatives of 3.5-dioxo-pyrazolidine | |
| US3953456A (en) | Carbostyril derivatives and process for preparing the same | |
| JPH0148911B2 (OSRAM) | ||
| HU193073B (en) | Process for producing new benzimidazoles | |
| CA1208643A (en) | 1,5-diphenyl-pyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing them | |
| US4118397A (en) | Derivatives of 5-aminobenzoic acid having a heterocyclic substituent in the 3-position | |
| EP0041630B1 (en) | New 3h-naphtho(1,2-d)imidazoles, the process for preparing them, the compounds for use as antiinflammatory agents and compositions containing them | |
| US4151210A (en) | Process for the production of phenylalkyl sulphones | |
| US2554186A (en) | Para-amino hydroxybenzamides | |
| US4492710A (en) | Substituted pyrrolidinyl-benzoic acid derivatives and a process for their manufacture | |
| DK158223B (da) | Heterocyclisk substituerede benzoesyrederiveter tiheterocyclisk substituerede benzoesyrederivater til anvendelse som mellemprodukter ved fremstillingen af heterocyclisk substituerede 5-sulfamylbenzoesyrederivater | |
| NO150681B (no) | Mellomprodukter for fremstilling av heterocykliske substituerte 5-sulfamoylbenzosyrederivater | |
| CA1093565A (en) | Process for preparing pyrrolo-benzoic acid derivatives | |
| US3729487A (en) | 2-halo-3-aminothietane and 2h-thiete-1,1-dioxides | |
| US3455932A (en) | 2-arylsulfonyliminoquinoline compounds | |
| KR830000584B1 (ko) | 복소환 치환기를 가진 5-설파모일벤조산 유도체의 제조방법 | |
| US3901934A (en) | Substituted salicylonitriles | |
| US2057978A (en) | Heterocyclic compounds | |
| IL24732A (en) | Amides of sulphamylanthranilic acid and process for their preparation | |
| FI73205B (fi) | Saosom mellanprodukter vid framstaellning av heterosykliskt substituerade 5-sulfamoylbenzoesyraderivat anvaendbara foereningar. | |
| US3264323A (en) | Coumarin derivative | |
| KR800001130B1 (ko) | 설파밀벤조인산 유도체의 제조방법 | |
| Turner et al. | α-(Dialkylaminomethyl)-8-amino (or hydroxy)-4-quinolinemethanols1 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7802175-5 Effective date: 19941110 Format of ref document f/p: F |