PL88930B1 - - Google Patents
Download PDFInfo
- Publication number
- PL88930B1 PL88930B1 PL1972153002A PL15300272A PL88930B1 PL 88930 B1 PL88930 B1 PL 88930B1 PL 1972153002 A PL1972153002 A PL 1972153002A PL 15300272 A PL15300272 A PL 15300272A PL 88930 B1 PL88930 B1 PL 88930B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- group
- substituted
- groups
- derivative
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 33
- 239000002253 acid Substances 0.000 claims description 18
- LCAAMXMULMCKLJ-UHFFFAOYSA-N talastine Chemical class C12=CC=CC=C2C(=O)N(CCN(C)C)N=C1CC1=CC=CC=C1 LCAAMXMULMCKLJ-UHFFFAOYSA-N 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 12
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 9
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 238000002844 melting Methods 0.000 claims description 8
- 230000008018 melting Effects 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229960002742 talastine Drugs 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims 2
- 125000002619 bicyclic group Chemical group 0.000 claims 1
- 125000004185 ester group Chemical group 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- -1 heterocyclic ring amine Chemical class 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 11
- 229960001340 histamine Drugs 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- IJAPPYDYQCXOEF-UHFFFAOYSA-N phthalazin-1(2H)-one Chemical group C1=CC=C2C(=O)NN=CC2=C1 IJAPPYDYQCXOEF-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000443 aerosol Substances 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 230000001558 histaminolytic effect Effects 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 230000009471 action Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- JUCCMEHWBGPJKS-UHFFFAOYSA-N 4-benzyl-2h-phthalazin-1-one Chemical compound C12=CC=CC=C2C(=O)NN=C1CC1=CC=CC=C1 JUCCMEHWBGPJKS-UHFFFAOYSA-N 0.000 description 4
- 241000700198 Cavia Species 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000013558 reference substance Substances 0.000 description 4
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 3
- 206010013975 Dyspnoeas Diseases 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 239000000739 antihistaminic agent Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000002148 esters Chemical group 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical group C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 description 2
- 208000000059 Dyspnea Diseases 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 2
- 208000024780 Urticaria Diseases 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000007815 allergy Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000001387 anti-histamine Effects 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000012493 hydrazine sulfate Substances 0.000 description 2
- 229910000377 hydrazine sulfate Inorganic materials 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 208000013220 shortness of breath Diseases 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- HAFWELDDNUXLCK-TYYBGVCCSA-N (e)-but-2-enedioic acid;hydrate Chemical compound O.OC(=O)\C=C\C(O)=O HAFWELDDNUXLCK-TYYBGVCCSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HXXLTZIDUOBALI-UHFFFAOYSA-N 1-azabicyclo[2.2.2]octan-3-ylhydrazine;dihydrochloride Chemical compound Cl.Cl.C1CC2C(NN)CN1CC2 HXXLTZIDUOBALI-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- ZENKHFMQQOXZJJ-UHFFFAOYSA-N 4-chloro-1-methylazepane Chemical compound CN1CCCC(Cl)CC1 ZENKHFMQQOXZJJ-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- OMOVVBIIQSXZSZ-UHFFFAOYSA-N [6-(4-acetyloxy-5,9a-dimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3h-pyrano[3,4-b]oxepin-5-yl)-5-formyloxy-3-(furan-3-yl)-3a-methyl-7-methylidene-1a,2,3,4,5,6-hexahydroindeno[1,7a-b]oxiren-4-yl] 2-hydroxy-3-methylpentanoate Chemical compound CC12C(OC(=O)C(O)C(C)CC)C(OC=O)C(C3(C)C(CC(=O)OC4(C)COC(=O)CC43)OC(C)=O)C(=C)C32OC3CC1C=1C=COC=1 OMOVVBIIQSXZSZ-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 208000012871 acute dyspnea Diseases 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960004931 histamine dihydrochloride Drugs 0.000 description 1
- PPZMYIBUHIPZOS-UHFFFAOYSA-N histamine dihydrochloride Chemical compound Cl.Cl.NCCC1=CN=CN1 PPZMYIBUHIPZOS-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- ZGCHATBSUIJLRL-UHFFFAOYSA-N hydrazine sulfate Chemical compound NN.OS(O)(=O)=O ZGCHATBSUIJLRL-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 206010025482 malaise Diseases 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- UJQMLHKSZKBMMO-UHFFFAOYSA-N n,n-diethylethanamine;pyridine Chemical compound C1=CC=NC=C1.CCN(CC)CC UJQMLHKSZKBMMO-UHFFFAOYSA-N 0.000 description 1
- 201000009240 nasopharyngitis Diseases 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N p-menthan-3-ol Chemical compound CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000005506 phthalide group Chemical group 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH101271A CH572914A5 (Direct) | 1971-01-22 | 1971-01-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88930B1 true PL88930B1 (Direct) | 1976-10-30 |
Family
ID=4200381
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972153002A PL88930B1 (Direct) | 1971-01-22 | 1972-01-20 |
Country Status (21)
| Country | Link |
|---|---|
| AR (1) | AR197293A1 (Direct) |
| AT (1) | AT313288B (Direct) |
| AU (1) | AU3767472A (Direct) |
| BE (1) | BE778269A (Direct) |
| CA (1) | CA1010041A (Direct) |
| CH (1) | CH572914A5 (Direct) |
| DE (1) | DE2164058C3 (Direct) |
| DK (1) | DK136981B (Direct) |
| ES (1) | ES398949A1 (Direct) |
| FI (1) | FI53704C (Direct) |
| FR (1) | FR2122517B1 (Direct) |
| GB (1) | GB1377231A (Direct) |
| HK (1) | HK62577A (Direct) |
| HU (1) | HU163979B (Direct) |
| IL (1) | IL38496A (Direct) |
| NL (1) | NL177116C (Direct) |
| OA (1) | OA04087A (Direct) |
| PL (1) | PL88930B1 (Direct) |
| SE (1) | SE404604B (Direct) |
| YU (1) | YU35361B (Direct) |
| ZA (1) | ZA718712B (Direct) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0174464B1 (de) * | 1984-09-14 | 1990-01-03 | ASTA Pharma AG | Substituierte Benzylphthalazinon-Derivate |
| ES2053679T3 (es) * | 1987-11-13 | 1994-08-01 | Asta Medica Ag | Embonato de azelastina, procedimiento para su preparacion y preparados farmaceuticos que contienen embonato de azelastina como principio activo. |
| EP0316633B1 (de) * | 1987-11-13 | 1993-01-27 | ASTA Medica Aktiengesellschaft | Azelastin enthaltende Arzneimittel zur Anwendung in der Nase und/oder am Auge |
| AU609210B2 (en) * | 1987-11-13 | 1991-04-26 | Viatris Gmbh & Co. Kg | Azelastine embonate, processes for its preparation and pharmaceutical formulations which contain azelastine embonate as active substance |
| DE3836579A1 (de) * | 1987-11-13 | 1989-05-24 | Asta Pharma Ag | Azelastin enthaltende arzneimittel zur anwendung in der nase und/oder am auge |
| DE3912292A1 (de) * | 1988-04-20 | 1989-11-09 | Asta Pharma Ag | Azelastin enthaltende arzneimittel mit kontrollierter wirkstoffabgabe |
| US5110814A (en) * | 1989-01-11 | 1992-05-05 | Asta Pharma Ag | Azelastine and its salts used to combat psoriasis |
| EP0396069B1 (de) * | 1989-05-05 | 1994-06-22 | ASTA Medica Aktiengesellschaft | Salze des Azelastins mit verbesserter Löslichkeit |
| DE4207234A1 (de) * | 1992-03-07 | 1993-09-09 | Asta Medica Ag | Neue aminocarbonsaeure-derivate mit antiallergischer/antiasthmatischer wirkung und verfahren zu deren herstellung |
| DE4343409C2 (de) * | 1993-12-18 | 1997-03-20 | Asta Medica Ag | Verbessertes Verfahren zur Herstellung von Hexahydroazepinonen und Hexahydroazepinolen |
| DE4345224C2 (de) * | 1993-12-18 | 1999-07-01 | Asta Medica Ag | Verfahren zur Herstellung von Säureadditionssalzen des Azelastins und Flezelastins |
| GB2389530B (en) | 2002-06-14 | 2007-01-10 | Cipla Ltd | Pharmaceutical compositions |
| US8758816B2 (en) | 2004-11-24 | 2014-06-24 | Meda Pharmaceuticals Inc. | Compositions comprising azelastine and methods of use thereof |
| KR20140048349A (ko) | 2004-11-24 | 2014-04-23 | 메다 파마슈티컬즈 인코포레이티드 | 아젤라스틴을 포함하는 조성물 및 이의 사용 방법 |
| US20070020330A1 (en) | 2004-11-24 | 2007-01-25 | Medpointe Healthcare Inc. | Compositions comprising azelastine and methods of use thereof |
| PE20080360A1 (es) * | 2006-04-20 | 2008-05-22 | Glaxo Group Ltd | Derivados 4-bencilftalazinona 2-sustituidos como antagonistas de histaminas h1 y h3 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1046625B (de) * | 1957-08-15 | 1958-12-18 | Hydrierwerk Rodleben Veb | Verfahren zur Herstellung basisch substituierter Phthalazone |
| GB1100911A (en) * | 1963-08-20 | 1968-01-24 | Benger Lab Ltd | Phthalazine derivatives |
| FR1512879A (fr) * | 1966-10-28 | 1968-02-09 | Hydrierwerk Rodleben Veb | Procédé pour la fabrication de phtalazones avec substituants basiques |
-
1971
- 1971-01-22 CH CH101271A patent/CH572914A5/xx not_active IP Right Cessation
- 1971-12-23 DE DE2164058A patent/DE2164058C3/de not_active Expired
- 1971-12-30 ZA ZA718712A patent/ZA718712B/xx unknown
-
1972
- 1972-01-03 IL IL38496A patent/IL38496A/xx unknown
- 1972-01-06 AU AU37674/72A patent/AU3767472A/en not_active Expired
- 1972-01-11 NL NLAANVRAGE7200400,A patent/NL177116C/xx not_active IP Right Cessation
- 1972-01-12 GB GB143372A patent/GB1377231A/en not_active Expired
- 1972-01-13 AT AT25672A patent/AT313288B/de active
- 1972-01-17 YU YU112/72A patent/YU35361B/xx unknown
- 1972-01-18 CA CA132,681A patent/CA1010041A/en not_active Expired
- 1972-01-18 ES ES398949A patent/ES398949A1/es not_active Expired
- 1972-01-19 AR AR240139A patent/AR197293A1/es active
- 1972-01-19 FR FR7201729A patent/FR2122517B1/fr not_active Expired
- 1972-01-20 BE BE778269A patent/BE778269A/xx not_active IP Right Cessation
- 1972-01-20 PL PL1972153002A patent/PL88930B1/pl unknown
- 1972-01-21 HU HUAA695A patent/HU163979B/hu unknown
- 1972-01-21 SE SE7200722A patent/SE404604B/xx unknown
- 1972-01-21 FI FI160/72A patent/FI53704C/fi active
- 1972-01-21 DK DK30272AA patent/DK136981B/da unknown
- 1972-05-15 OA OA54568A patent/OA04087A/xx unknown
-
1977
- 1977-12-22 HK HK625/77A patent/HK62577A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH572914A5 (Direct) | 1976-02-27 |
| NL177116C (nl) | 1985-08-01 |
| SU440838A3 (Direct) | 1974-08-25 |
| HU163979B (Direct) | 1973-12-28 |
| AR197293A1 (es) | 1974-03-29 |
| GB1377231A (en) | 1974-12-11 |
| DK136981B (da) | 1977-12-27 |
| FR2122517B1 (Direct) | 1975-08-01 |
| HK62577A (en) | 1977-12-30 |
| AT313288B (de) | 1974-02-11 |
| NL7200400A (Direct) | 1972-07-25 |
| FR2122517A1 (Direct) | 1972-09-01 |
| DE2164058A1 (de) | 1972-07-27 |
| FI53704B (Direct) | 1978-03-31 |
| DE2164058B2 (de) | 1980-10-23 |
| IL38496A0 (en) | 1972-03-28 |
| ES398949A1 (es) | 1975-06-01 |
| OA04087A (fr) | 1979-10-30 |
| NL177116B (nl) | 1985-03-01 |
| AU3767472A (en) | 1973-07-12 |
| CA1010041A (en) | 1977-05-10 |
| IL38496A (en) | 1975-05-22 |
| YU11272A (en) | 1980-06-30 |
| FI53704C (fi) | 1978-07-10 |
| DK136981C (Direct) | 1978-06-05 |
| ZA718712B (en) | 1972-09-27 |
| DE2164058C3 (de) | 1981-08-13 |
| BE778269A (fr) | 1972-07-19 |
| YU35361B (en) | 1980-12-31 |
| SE404604B (sv) | 1978-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3813384A (en) | Basically substituted benzyl phthalazone derivatives,acid salts thereof and process for the production thereof | |
| PL88930B1 (Direct) | ||
| US5576318A (en) | Benzimidazolone derivatives | |
| CA2407972C (en) | Azabicyclic carbamates and their use as alpha-7 nicotinic acetylcholine receptor agonists | |
| Boido et al. | Synthesis and preliminary pharmacological evaluation of some cytisine derivatives | |
| EP0891354B1 (en) | N-aminoalkyldibenzofurancarboxamides as dopamine receptor subtype specific ligands | |
| OA13317A (fr) | Dérivés de N-hétérocyclylméthylbenzamides, leur préparation et leur application en thérapeutique. | |
| IE58020B1 (en) | Piperazine derivatives | |
| PL166565B1 (pl) | Sposób wytwarzania nowych pochodnych amin aromatycznych PL PL | |
| WO2001047898A2 (de) | Substituierte piperazinderivate und ihre verwendung als inhibitoren des mikrosomalen triglyzerid-transferproteins (mtp) | |
| EP0303387B1 (en) | Kynurenic acid derivatives useful in the treatment of neurodegenerative disorders | |
| JP3238397B2 (ja) | 新規のスルホニル化合物 | |
| FR2809732A1 (fr) | DERIVES DE 4(-2-PHENYLTHIAZOL-5-yl)-1,4-DIAZABICYCLO-[3.2.2] NONANE, LEUR PREPARATION ET LEUR APPLICATION ENTHERAPEUTIQUE | |
| FI64144C (fi) | Foerfarande foer framstaellning av 2-arylamino-2-imidazolinderivat | |
| EP0397040A2 (en) | N-heteroaryl-4-quinolinamines, a process for their preparation and their use as medicaments | |
| EP1025097A1 (en) | 1-(2-naphthyl) and 1-(2-azanaphthyl)-4-(1-phenylmethyl)piperazines being dopamine d 4? receptor subtype ligands | |
| SK93198A3 (en) | Quinoline-2-(1h)-one derivative, preparation method thereof and pharmaceutical composition containing the same | |
| PL177947B1 (pl) | Nowe związki tetrahydroizochinolinowe, kompozycja farmaceutyczna i sposób wytwarzania nowych związków tetrahydroizochinolinowych | |
| WO2014060328A1 (en) | 6-aminoindole derivatives as trp channel antagonists | |
| HU182070B (en) | Process for producing phenyl-piperazine derivatives | |
| JPH10508826A (ja) | シグマ2選択性リガンドである新規アルキルアミノ誘導体 | |
| ZA200103251B (en) | 3-Tetrahydropyridin-4-YL indoles for treatment of psychotic disorders. | |
| GB2249093A (en) | Piperidine derivatives and their use in pharmaceutical compositions | |
| Reitz et al. | N-aryl-N'-benzylpiperazines as potential antipsychotic agents | |
| CA1094070A (en) | 1-phenyl-piperazine derivatives |