AT313288B - Verfahren zur Herstellung neuer, basisch substituierter Benzylphthalazon-Derivate und ihrer Salze - Google Patents
Verfahren zur Herstellung neuer, basisch substituierter Benzylphthalazon-Derivate und ihrer SalzeInfo
- Publication number
- AT313288B AT313288B AT25672A AT25672A AT313288B AT 313288 B AT313288 B AT 313288B AT 25672 A AT25672 A AT 25672A AT 25672 A AT25672 A AT 25672A AT 313288 B AT313288 B AT 313288B
- Authority
- AT
- Austria
- Prior art keywords
- benzylphthalazone
- derivatives
- salts
- preparation
- new
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title 1
- LCAAMXMULMCKLJ-UHFFFAOYSA-N talastine Chemical class C12=CC=CC=C2C(=O)N(CCN(C)C)N=C1CC1=CC=CC=C1 LCAAMXMULMCKLJ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH101271A CH572914A5 (de) | 1971-01-22 | 1971-01-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT313288B true AT313288B (de) | 1974-02-11 |
Family
ID=4200381
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT25672A AT313288B (de) | 1971-01-22 | 1972-01-13 | Verfahren zur Herstellung neuer, basisch substituierter Benzylphthalazon-Derivate und ihrer Salze |
Country Status (21)
| Country | Link |
|---|---|
| AR (1) | AR197293A1 (de) |
| AT (1) | AT313288B (de) |
| AU (1) | AU3767472A (de) |
| BE (1) | BE778269A (de) |
| CA (1) | CA1010041A (de) |
| CH (1) | CH572914A5 (de) |
| DE (1) | DE2164058C3 (de) |
| DK (1) | DK136981B (de) |
| ES (1) | ES398949A1 (de) |
| FI (1) | FI53704C (de) |
| FR (1) | FR2122517B1 (de) |
| GB (1) | GB1377231A (de) |
| HK (1) | HK62577A (de) |
| HU (1) | HU163979B (de) |
| IL (1) | IL38496A (de) |
| NL (1) | NL177116C (de) |
| OA (1) | OA04087A (de) |
| PL (1) | PL88930B1 (de) |
| SE (1) | SE404604B (de) |
| YU (1) | YU35361B (de) |
| ZA (1) | ZA718712B (de) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3575135D1 (de) * | 1984-09-14 | 1990-02-08 | Asta Pharma Ag | Substituierte benzylphthalazinon-derivate. |
| DE3836579A1 (de) * | 1987-11-13 | 1989-05-24 | Asta Pharma Ag | Azelastin enthaltende arzneimittel zur anwendung in der nase und/oder am auge |
| ATE84968T1 (de) * | 1987-11-13 | 1993-02-15 | Asta Medica Ag | Azelastin enthaltende arzneimittel zur anwendung in der nase und/oder am auge. |
| DE3850044D1 (de) * | 1987-11-13 | 1994-07-14 | Asta Medica Ag | Azelastin-Embonat, Verfahren zu seiner Herstellung und pharmazeutische Zubereitungen, die als Wirkstoff Azelastin-Embonat enthalten. |
| IE64051B1 (en) * | 1987-11-13 | 1995-06-28 | Asta Medica Ag | Azelastine embonate process for its preparation and pharmaceutical preparations which contain azelastine embonate as active substance |
| DE3912292A1 (de) * | 1988-04-20 | 1989-11-09 | Asta Pharma Ag | Azelastin enthaltende arzneimittel mit kontrollierter wirkstoffabgabe |
| US5110814A (en) * | 1989-01-11 | 1992-05-05 | Asta Pharma Ag | Azelastine and its salts used to combat psoriasis |
| ATE107643T1 (de) * | 1989-05-05 | 1994-07-15 | Asta Medica Ag | Salze des azelastins mit verbesserter löslichkeit. |
| DE4207234A1 (de) * | 1992-03-07 | 1993-09-09 | Asta Medica Ag | Neue aminocarbonsaeure-derivate mit antiallergischer/antiasthmatischer wirkung und verfahren zu deren herstellung |
| DE4343409C2 (de) * | 1993-12-18 | 1997-03-20 | Asta Medica Ag | Verbessertes Verfahren zur Herstellung von Hexahydroazepinonen und Hexahydroazepinolen |
| DE4345224C2 (de) * | 1993-12-18 | 1999-07-01 | Asta Medica Ag | Verfahren zur Herstellung von Säureadditionssalzen des Azelastins und Flezelastins |
| GB2389530B (en) | 2002-06-14 | 2007-01-10 | Cipla Ltd | Pharmaceutical compositions |
| EP2522365B1 (de) | 2004-11-24 | 2016-10-26 | Meda Pharmaceuticals Inc. | Zusammensetzungen aus Azelastin und Verwendungsverfahren dafür |
| US20070020330A1 (en) | 2004-11-24 | 2007-01-25 | Medpointe Healthcare Inc. | Compositions comprising azelastine and methods of use thereof |
| US8758816B2 (en) | 2004-11-24 | 2014-06-24 | Meda Pharmaceuticals Inc. | Compositions comprising azelastine and methods of use thereof |
| AR060535A1 (es) * | 2006-04-20 | 2008-06-25 | Glaxo Group Ltd | Pirido-piridazinonas y ftalazinonas como antagonistas duales de los receptores h1 y h3 de histamina |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1046625B (de) * | 1957-08-15 | 1958-12-18 | Hydrierwerk Rodleben Veb | Verfahren zur Herstellung basisch substituierter Phthalazone |
| GB1100911A (en) * | 1963-08-20 | 1968-01-24 | Benger Lab Ltd | Phthalazine derivatives |
| DK119061B (da) * | 1966-10-28 | 1970-11-09 | Hydrierwerk Rodleben Veb | Fremgangsmåde til fremstilling af basisk substituerede phthalazoner eller salte eller kvaternære ammoniumforbindelser deraf. |
-
1971
- 1971-01-22 CH CH101271A patent/CH572914A5/xx not_active IP Right Cessation
- 1971-12-23 DE DE2164058A patent/DE2164058C3/de not_active Expired
- 1971-12-30 ZA ZA718712A patent/ZA718712B/xx unknown
-
1972
- 1972-01-03 IL IL38496A patent/IL38496A/xx unknown
- 1972-01-06 AU AU37674/72A patent/AU3767472A/en not_active Expired
- 1972-01-11 NL NLAANVRAGE7200400,A patent/NL177116C/xx not_active IP Right Cessation
- 1972-01-12 GB GB143372A patent/GB1377231A/en not_active Expired
- 1972-01-13 AT AT25672A patent/AT313288B/de active
- 1972-01-17 YU YU112/72A patent/YU35361B/xx unknown
- 1972-01-18 CA CA132,681A patent/CA1010041A/en not_active Expired
- 1972-01-18 ES ES398949A patent/ES398949A1/es not_active Expired
- 1972-01-19 AR AR240139A patent/AR197293A1/es active
- 1972-01-19 FR FR7201729A patent/FR2122517B1/fr not_active Expired
- 1972-01-20 PL PL1972153002A patent/PL88930B1/pl unknown
- 1972-01-20 BE BE778269A patent/BE778269A/xx not_active IP Right Cessation
- 1972-01-21 DK DK30272AA patent/DK136981B/da unknown
- 1972-01-21 SE SE7200722A patent/SE404604B/xx unknown
- 1972-01-21 HU HUAA695A patent/HU163979B/hu unknown
- 1972-01-21 FI FI160/72A patent/FI53704C/fi active
- 1972-05-15 OA OA54568A patent/OA04087A/xx unknown
-
1977
- 1977-12-22 HK HK625/77A patent/HK62577A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU163979B (de) | 1973-12-28 |
| BE778269A (fr) | 1972-07-19 |
| NL7200400A (de) | 1972-07-25 |
| NL177116C (nl) | 1985-08-01 |
| CH572914A5 (de) | 1976-02-27 |
| PL88930B1 (de) | 1976-10-30 |
| YU35361B (en) | 1980-12-31 |
| HK62577A (en) | 1977-12-30 |
| FI53704B (de) | 1978-03-31 |
| FR2122517A1 (de) | 1972-09-01 |
| OA04087A (fr) | 1979-10-30 |
| DK136981B (da) | 1977-12-27 |
| DE2164058C3 (de) | 1981-08-13 |
| DK136981C (de) | 1978-06-05 |
| DE2164058A1 (de) | 1972-07-27 |
| DE2164058B2 (de) | 1980-10-23 |
| IL38496A0 (en) | 1972-03-28 |
| CA1010041A (en) | 1977-05-10 |
| FR2122517B1 (de) | 1975-08-01 |
| SU440838A3 (de) | 1974-08-25 |
| SE404604B (sv) | 1978-10-16 |
| NL177116B (nl) | 1985-03-01 |
| AR197293A1 (es) | 1974-03-29 |
| GB1377231A (en) | 1974-12-11 |
| YU11272A (en) | 1980-06-30 |
| IL38496A (en) | 1975-05-22 |
| ES398949A1 (es) | 1975-06-01 |
| ZA718712B (en) | 1972-09-27 |
| AU3767472A (en) | 1973-07-12 |
| FI53704C (fi) | 1978-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT313288B (de) | Verfahren zur Herstellung neuer, basisch substituierter Benzylphthalazon-Derivate und ihrer Salze | |
| AT318647B (de) | Verfahren zur Herstellung neuer Ureidophenoxy-2-hydroxy-3-aminopropane und ihrer Salze | |
| AT295529B (de) | Verfahren zur Herstellung neuer 5,6-Dimethoxy-indazol-3-carbonsäureamide und ihrer Salze | |
| AT315834B (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen und ihrer Salze | |
| AT289791B (de) | Verfahren zur Herstellung neuer, basischer Derivate des Benzoxazolin-2-ons und ihrer Salze | |
| AT316547B (de) | Verfahren zur Herstellung neuer mesoionischer 1,3,4-Thiadiazolimin-(5)-Derivate und ihrer Salze | |
| AT321308B (de) | Verfahren zur Herstellung neuer Pyrimidinonderivate und ihrer Salze | |
| AT330167B (de) | Verfahren zur herstellung neuer pyrrolidinderivate und ihrer saureadditionssalze | |
| AT311956B (de) | Verfahren zur Herstellung neuer Phenylimidazolidinonderivate und ihrer Salze | |
| AT317200B (de) | Verfahren zur Herstellung neuer 1,2,3,4-Tetrahydrocarbazolderivate und ihrer Salze | |
| AT315828B (de) | Verfahren zur Herstellung neuer 6-Aminoalkoxy-4,7-dimethoxy-benzofuranderivaten und ihren Salze | |
| AT316538B (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen und ihrer Salze | |
| AT328435B (de) | Verfahren zur herstellung neuer imidazolderivate und ihrer salze | |
| AT319952B (de) | Verfahren zur Herstellung neuer Sulfamoylpyrimidine und ihrer Salze | |
| AT316549B (de) | Verfahren zur Herstellung neuer Pyridin-Derivate und ihrer Säureadditionssalze | |
| AT311341B (de) | Verfahren zur Herstellung neuer 3-Alkyl-5-aryloxymethylisoxazole und ihrer Salze | |
| AT325035B (de) | Verfahren zur herstellung neuer indolderivate und ihrer salze | |
| AT337179B (de) | Verfahren zur herstellung neuer 1,3-benzodioxol-derivate und ihrer salze | |
| AT293416B (de) | Verfahren zur Herstellung neuer 1-substituierter-1H-1,2,8,9-Tetraazaphenalene und ihrer Säureadditionssalze | |
| AT303030B (de) | Verfahren zur Herstellung neuer 3,5-Dioxopyrazolidinderivate und ihrer Salze | |
| AT330772B (de) | Verfahren zur herstellung neuer 1,4-benzodioxan-derivate und ihrer salze | |
| AT309422B (de) | Verfahren zur Herstellung neuer 3-Alkyl-5-aryloxymethylisoxazole und ihrer Salze | |
| AT318607B (de) | Verfahren zur Herstellung neuer 5-Nitroimidazolderivate und ihrer Salze | |
| ATA682272A (de) | Verfahren zur herstellung neuer 2,3-dihydroisoindolderivate und ihrer salze | |
| AT303724B (de) | Verfahren zur Herstellung neuer 2-(Amino-alkoxy)-4-phenyl-thiazolderivate und ihrer Salze |