PL72724B1 - - Google Patents
Download PDFInfo
- Publication number
- PL72724B1 PL72724B1 PL1970141321A PL14132170A PL72724B1 PL 72724 B1 PL72724 B1 PL 72724B1 PL 1970141321 A PL1970141321 A PL 1970141321A PL 14132170 A PL14132170 A PL 14132170A PL 72724 B1 PL72724 B1 PL 72724B1
- Authority
- PL
- Poland
- Prior art keywords
- compound
- group
- general formula
- reacted
- carbamic acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 16
- -1 alkyl radical Chemical class 0.000 claims description 15
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 13
- 150000004702 methyl esters Chemical class 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 7
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 6
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 3
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 claims description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims 2
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical group [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 235000011114 ammonium hydroxide Nutrition 0.000 claims 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000006637 cyclobutyl carbonyl group Chemical group 0.000 claims 1
- 125000006638 cyclopentyl carbonyl group Chemical group 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 claims 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 150000002367 halogens Chemical group 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- VNCHICMXBKDTOS-UHFFFAOYSA-N (3,4-diaminophenyl)-phenylmethanone;hydron;chloride Chemical compound Cl.C1=C(N)C(N)=CC=C1C(=O)C1=CC=CC=C1 VNCHICMXBKDTOS-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 241001494479 Pecora Species 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229940126062 Compound A Drugs 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- NGOOFAMQPUEDJM-UHFFFAOYSA-N (4-amino-3-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C(=O)C1=CC=CC=C1 NGOOFAMQPUEDJM-UHFFFAOYSA-N 0.000 description 2
- YBDBYPQFIMSFJW-UHFFFAOYSA-N (4-chloro-3-nitrophenyl)-phenylmethanone Chemical compound C1=C(Cl)C([N+](=O)[O-])=CC(C(=O)C=2C=CC=CC=2)=C1 YBDBYPQFIMSFJW-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241000760144 Syphacia muris Species 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- UKNKFVBQMUMOLP-UHFFFAOYSA-N bis(2,3-diaminophenyl)methanone Chemical class NC1=CC=CC(C(=O)C=2C(=C(N)C=CC=2)N)=C1N UKNKFVBQMUMOLP-UHFFFAOYSA-N 0.000 description 2
- AIKXISKDXIUFQO-UHFFFAOYSA-N bis(3-amino-2-nitrophenyl)methanone Chemical class NC1=CC=CC(C(=O)C=2C(=C(N)C=CC=2)[N+]([O-])=O)=C1[N+]([O-])=O AIKXISKDXIUFQO-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- NNBBQNFHCVVQHZ-UHFFFAOYSA-N methyl carbamimidothioate;sulfuric acid Chemical compound CSC(N)=N.OS(O)(=O)=O NNBBQNFHCVVQHZ-UHFFFAOYSA-N 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical class NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- WEYSQARHSRZNTC-UHFFFAOYSA-N 1h-benzimidazol-2-ylcarbamic acid Chemical class C1=CC=C2NC(NC(=O)O)=NC2=C1 WEYSQARHSRZNTC-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 241000244186 Ascaris Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000893172 Chabertia Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001126268 Cooperia Species 0.000 description 1
- 241000498255 Enterobius vermicularis Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 241000920462 Heterakis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 241001137882 Nematodirus Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000243795 Ostertagia Species 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 241000975704 Syphacia Species 0.000 description 1
- 241000243797 Trichostrongylus Species 0.000 description 1
- 241001489151 Trichuris Species 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 238000005915 ammonolysis reaction Methods 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 210000003238 esophagus Anatomy 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000004987 o-phenylenediamines Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 208000014837 parasitic helminthiasis infectious disease Diseases 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 235000013594 poultry meat Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83524669A | 1969-06-20 | 1969-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL72724B1 true PL72724B1 (Home) | 1974-08-30 |
Family
ID=25269027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141321A PL72724B1 (Home) | 1969-06-20 | 1970-06-16 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3657267A (Home) |
| JP (1) | JPS501272B1 (Home) |
| AT (2) | AT302358B (Home) |
| BE (1) | BE752089A (Home) |
| CH (1) | CH520684A (Home) |
| CS (1) | CS201522B2 (Home) |
| DK (2) | DK134602B (Home) |
| ES (1) | ES380579A1 (Home) |
| FI (1) | FI52719C (Home) |
| FR (1) | FR2052988B1 (Home) |
| GB (1) | GB1307306A (Home) |
| HK (1) | HK77976A (Home) |
| IL (1) | IL34746A (Home) |
| IT (1) | IT1035027B (Home) |
| MY (1) | MY7300477A (Home) |
| NL (1) | NL147139B (Home) |
| PL (1) | PL72724B1 (Home) |
| SE (1) | SE366045B (Home) |
| YU (1) | YU34195B (Home) |
| ZA (1) | ZA704191B (Home) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2201208A1 (de) * | 1972-01-12 | 1973-08-02 | Basf Ag | Verfahren zur herstellung von aromatischen ketonen |
| US3929821A (en) * | 1972-12-29 | 1975-12-30 | Syntex Inc | 5 (6)-Benzene ring substituted benzimidazole-2-carbamate derivatives |
| US4258198A (en) * | 1973-05-29 | 1981-03-24 | Smithkline Corporation | 5-Cycloalkyl thio- and oxy-2-carbalkoxyaminobenzimidazoles |
| US3969526A (en) * | 1973-05-29 | 1976-07-13 | Smithkline Corporation | Anthelmintic 5-heterocycliothio and oxy-2-carbalkoxyaminobenzimidazles |
| DE2443297A1 (de) * | 1974-09-10 | 1976-03-18 | Hoechst Ag | Anthelminthisch wirksame basisch substituierte 2-carbalkoxy-amino-benzimidazolyl-5(6)-phenylaether und -ketone sowie verfahren zu ihrer herstellung |
| US4026936A (en) * | 1975-08-07 | 1977-05-31 | Hoffmann-La Roche Inc. | Anthelmintic pyridine and thiazole substituted benzimidazole carbamates |
| US4031234A (en) * | 1975-08-18 | 1977-06-21 | Syntex (U.S.A.) Inc. | 1,5(6)-Disubstituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
| US4032536A (en) * | 1976-07-22 | 1977-06-28 | Janssen Pharmaceutica N.V. | (1h-benzimidazol-2-yl)carbamates |
| IT1076022B (it) * | 1977-04-20 | 1985-04-22 | Montedison Spa | Benzimidazolcarbammati antielmintici |
| JPS5535611A (en) * | 1978-08-31 | 1980-03-12 | Matsushita Electric Works Ltd | Instrument with mouth washing instrument |
| US4299837A (en) | 1979-12-05 | 1981-11-10 | Montedison S.P.A. | Anthelmintic benzimidazole-carbamates |
| US4435418A (en) | 1982-12-13 | 1984-03-06 | Smithkline Beckman Corporation | 5-Phenylethenylbenzimidazoles |
| US4438135A (en) | 1983-01-07 | 1984-03-20 | Smithkline Beckman Corporation | 1-(3,4-Bis-(3-(lower alkoxycarbonyl)-2-thioureido)-phenyl-1-phenylthylenes |
| WO1990010630A1 (en) * | 1989-03-15 | 1990-09-20 | Janssen Pharmaceutica N.V. | [5(6)-(benzisoxa-, benzisothia- or indazol-3-yl)-1h-benzimidazol-2-yl] carbamates |
| NZ232785A (en) * | 1989-03-15 | 1991-03-26 | Janssen Pharmaceutica Nv | 5-(1,2 benzisoxazol-, benzimidazol and benzisothiazol-3- yl)-1h-benzimadazol-2-yl carbamic acid ester derivatives preparatory processes, intermediates and anthelmintic compositions |
| US5256681A (en) * | 1989-03-15 | 1993-10-26 | Janssen Pharmaceutica N.V. | [5(6)-(benzisoxa-,benzisothia-or indazol-3-yl)-1H-benzimidazol-2-yl]carbamates |
| US5278181A (en) * | 1992-05-12 | 1994-01-11 | Board Of Regents Acting On Behalf Of The University Of Michigan | Soluble alkyl[5-[amino (phenyl)methyl]-1H-benzimidazol-2-yl] carbamate anthelmintics |
| WO2007014846A1 (en) * | 2005-07-28 | 2007-02-08 | Intervet International B.V. | Novel benzimidazole (thio) carbamates with antiparasitic activity and the synthesis thereof |
| CA2655056C (en) * | 2006-06-12 | 2016-04-12 | Smith & Nephew, Inc. | Systems, methods and devices for tibial resection |
| PL2037914T3 (pl) | 2006-06-14 | 2014-04-30 | Intervet Int Bv | Zawiesina zawierająca karbaminian benzoimidazolu i polisorbat |
| MX340846B (es) | 2012-01-27 | 2016-07-28 | Rhein Siegfried Sa De Cv | Composición de nitazoxanida mejorada y proceso para prepararla. |
| BR112015006861B1 (pt) | 2012-09-27 | 2021-10-13 | Siegfried Rhein S.A. De C.V. | Composição farmacêutica sinérgica e processo para preparar a dita composição |
| EP3889139B1 (en) * | 2015-11-30 | 2025-03-19 | The Children's Medical Center Corporation | Compounds for treating proliferative diseases |
| EP3641747B1 (en) | 2017-06-22 | 2023-09-06 | Cipla Limited | Par-4 secretagogues for the treatment of cancer |
| CN109467512B (zh) * | 2018-12-18 | 2021-06-08 | 苏州开元民生科技股份有限公司 | 一种3,4-二氨基-二苯甲酮的合成方法 |
| CN113979949A (zh) * | 2021-12-17 | 2022-01-28 | 山东国邦药业有限公司 | 一种氟苯咪唑的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1111957A (en) * | 1966-05-20 | 1968-05-01 | Smith Kline French Lab | Improvements in or relating to anthelmintic compositions |
-
1969
- 1969-06-20 US US835246A patent/US3657267A/en not_active Expired - Lifetime
-
1970
- 1970-05-29 GB GB2604470A patent/GB1307306A/en not_active Expired
- 1970-05-29 CH CH809370A patent/CH520684A/fr not_active IP Right Cessation
- 1970-06-08 FR FR707021022A patent/FR2052988B1/fr not_active Expired
- 1970-06-09 ES ES380579A patent/ES380579A1/es not_active Expired
- 1970-06-16 PL PL1970141321A patent/PL72724B1/pl unknown
- 1970-06-17 SE SE08385/70A patent/SE366045B/xx unknown
- 1970-06-17 BE BE752089D patent/BE752089A/xx not_active IP Right Cessation
- 1970-06-18 FI FI701720A patent/FI52719C/fi active
- 1970-06-18 AT AT825571A patent/AT302358B/de not_active IP Right Cessation
- 1970-06-18 IT IT51551/70A patent/IT1035027B/it active
- 1970-06-18 AT AT549770A patent/AT307798B/de not_active IP Right Cessation
- 1970-06-18 IL IL34746A patent/IL34746A/xx unknown
- 1970-06-18 YU YU1544/70A patent/YU34195B/xx unknown
- 1970-06-19 NL NL707009024A patent/NL147139B/xx not_active IP Right Cessation
- 1970-06-19 JP JP45053435A patent/JPS501272B1/ja active Pending
- 1970-06-19 ZA ZA704191A patent/ZA704191B/xx unknown
- 1970-06-19 CS CS704330A patent/CS201522B2/cs unknown
- 1970-06-22 DK DK321770AA patent/DK134602B/da not_active IP Right Cessation
-
1973
- 1973-12-30 MY MY477/73A patent/MY7300477A/xx unknown
-
1975
- 1975-12-19 DK DK580275A patent/DK580275A/da unknown
-
1976
- 1976-12-09 HK HK779/76*UA patent/HK77976A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1035027B (it) | 1979-10-20 |
| FR2052988B1 (Home) | 1973-08-10 |
| MY7300477A (en) | 1973-12-31 |
| SE366045B (Home) | 1974-04-08 |
| CS201522B2 (en) | 1980-11-28 |
| BE752089A (fr) | 1970-12-17 |
| FR2052988A1 (Home) | 1971-04-16 |
| DK134602C (Home) | 1977-06-27 |
| DK134602B (da) | 1976-12-06 |
| ZA704191B (en) | 1972-02-23 |
| IL34746A0 (en) | 1970-08-19 |
| DK580275A (da) | 1975-12-19 |
| FI52719C (fi) | 1977-11-10 |
| US3657267A (en) | 1972-04-18 |
| NL7009024A (Home) | 1970-12-22 |
| JPS501272B1 (Home) | 1975-01-16 |
| FI52719B (Home) | 1977-08-01 |
| HK77976A (en) | 1976-12-17 |
| YU154470A (en) | 1978-09-18 |
| CH520684A (fr) | 1972-03-31 |
| ES380579A1 (es) | 1973-04-01 |
| DE2029637B2 (de) | 1976-09-23 |
| AT307798B (de) | 1973-06-12 |
| YU34195B (en) | 1979-02-28 |
| NL147139B (nl) | 1975-09-15 |
| AT302358B (de) | 1972-10-10 |
| GB1307306A (en) | 1973-02-21 |
| IL34746A (en) | 1973-01-30 |
| DE2029637A1 (de) | 1971-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL72724B1 (Home) | ||
| US3954791A (en) | Anthelmintically active 2-carbalkoxy-amino-benzimidazole-5(6)-phenyl ethers | |
| US3539616A (en) | 1-amidino-3-(cyanophenyl) ureas | |
| CA1107284A (en) | Process for the preparation of aniline derivatives | |
| DK151628B (da) | Analogifremgangsmaade til fremstilling af benzimidazolderivater | |
| US3996369A (en) | Anthelmintically active 2-carbalkoxyamino benzimidazolyl-5(6)-sulfonic acid phenyl esters | |
| DE2441201C2 (de) | Anthelminthisch wirksame 2-Carbalkoxyamino-5(6)-phenyl-sulfonyloxy-benzimidazole und Verfahren zu ihrer Herstellung | |
| DE2348104A1 (de) | Anthelmintisch wirksame 2-carbalkoxyamino-benzimidazolyl-5(6)-amino-phenylaether und verfahren zu ihrer herstellung | |
| US4254143A (en) | Monocarboxylates of phenylguanidinesulfonic acid esters, a process for their manufacture, compositions containing them and their use for combating helminths | |
| US3984561A (en) | Anthelmintically active 2-carbalkoxy-amino-benzimidazole-5(6)-phenyl ethers and method for using the same | |
| CA1104142A (en) | Anthelmintic benzimidazol-carbamates | |
| NO833158L (no) | Substituerte benzensulfonsyreestere, fremgangsmaate til deres fremstilling og deres anvendelse som legemiddel | |
| US3823154A (en) | 2-trifluoromethylbenzimidazoles | |
| DE2300447A1 (de) | Substituierte 3-cyanobenzolsulfonamide | |
| PL63313B1 (Home) | ||
| KR790001340B1 (ko) | 2-카보알콕시-아미노-5(6)-페닐-설포닐옥시 벤즈이미다졸류의 제조방법 | |
| US3325508A (en) | 2-trichloromethyl benzimidazoles | |
| US3940416A (en) | Benzimidazole sulphonyl chlorides | |
| KR790001341B1 (ko) | 2-카보알콕시아미노 벤즈이미다조릴-5(6)-설폰산 페닐 에스테르류의 제조방법 | |
| CH540236A (de) | Verfahren zur Herstellung neuer Thioharnstoffe | |
| KR790001481B1 (ko) | 치환된 페닐구아니딘류의 제조방법 | |
| WO1985001283A1 (en) | Phenylguanidines | |
| CS196283B2 (cs) | Způsob výroby fenylesterů 2-alkoxykarbonylamínobenzimidazol- -5(B)-ylsůlfOnové kyseliny | |
| DE2348120A1 (de) | Anthelmintisch wirksame 2-carbalkoxyamino-benzimidazolyl-5(6)-amino-phenylaether und verfahren zu ihrer herstellung | |
| CS196280B2 (cs) | Způsob výroby 2-alkoxykarbonylamÍJio-5(6)-íenylsulfonyloxybenziinidazolů |