PL115260B1 - Process for preparing novel derivatives of 1,2-dihydroquinolin-2-one - Google Patents
Process for preparing novel derivatives of 1,2-dihydroquinolin-2-one Download PDFInfo
- Publication number
- PL115260B1 PL115260B1 PL1979216409A PL21640979A PL115260B1 PL 115260 B1 PL115260 B1 PL 115260B1 PL 1979216409 A PL1979216409 A PL 1979216409A PL 21640979 A PL21640979 A PL 21640979A PL 115260 B1 PL115260 B1 PL 115260B1
- Authority
- PL
- Poland
- Prior art keywords
- residue
- general formula
- formula
- keto
- dihydroquinolinone
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims description 28
- 238000002360 preparation method Methods 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 12
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 150000004885 piperazines Chemical class 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000005905 mesyloxy group Chemical group 0.000 claims description 5
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 claims description 5
- 238000007126 N-alkylation reaction Methods 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- -1 4-substituted-piperazin-1-yl Chemical group 0.000 abstract description 6
- 229910052736 halogen Inorganic materials 0.000 abstract description 4
- 150000002367 halogens Chemical group 0.000 abstract description 4
- 230000003266 anti-allergic effect Effects 0.000 abstract description 3
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 150000002431 hydrogen Chemical group 0.000 abstract 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- GQMHYGCWUDYARM-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1CC1=CC=C(Cl)C=C1 GQMHYGCWUDYARM-UHFFFAOYSA-N 0.000 description 3
- MYEVEFULPUKTSZ-UHFFFAOYSA-N 7-hydroxy-4-methyl-1H-quinolin-2-one Chemical compound OC1=CC=C2C(C)=CC(=O)NC2=C1 MYEVEFULPUKTSZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 235000019634 flavors Nutrition 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 2
- MLWJMEZPVTZSKE-UHFFFAOYSA-N 6-hydroxy-4-methyl-1h-quinolin-2-one Chemical compound C1=C(O)C=C2C(C)=CC(=O)NC2=C1 MLWJMEZPVTZSKE-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 1
- KULRQQDUKMJDJH-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(2-propoxyphenyl)methyl]piperazine Chemical compound CCCOC1=CC=CC=C1CN1CCN(CCCCl)CC1 KULRQQDUKMJDJH-UHFFFAOYSA-N 0.000 description 1
- FNPMXZQPFBMFEB-UHFFFAOYSA-N 1-(3-chloropropyl)-4-[(4-methylphenyl)methyl]piperazine Chemical compound C1=CC(C)=CC=C1CN1CCN(CCCCl)CC1 FNPMXZQPFBMFEB-UHFFFAOYSA-N 0.000 description 1
- VGISFWWEOGVMED-UHFFFAOYSA-N 1-(chloromethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CCl)=C1 VGISFWWEOGVMED-UHFFFAOYSA-N 0.000 description 1
- GSJXJZOWHSTWOX-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]piperazine Chemical compound C1=CC(Cl)=CC=C1CN1CCNCC1 GSJXJZOWHSTWOX-UHFFFAOYSA-N 0.000 description 1
- XOSNEZPIANDZMR-UHFFFAOYSA-N 1-benzyl-4-(3-chloropropyl)piperazine Chemical compound C1CN(CCCCl)CCN1CC1=CC=CC=C1 XOSNEZPIANDZMR-UHFFFAOYSA-N 0.000 description 1
- ZXYOVPGWVNDRGN-UHFFFAOYSA-N 1-propoxyquinolin-2-one Chemical compound C1=CC=C2C=CC(=O)N(OCCC)C2=C1 ZXYOVPGWVNDRGN-UHFFFAOYSA-N 0.000 description 1
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical class C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000000160 carbon, hydrogen and nitrogen elemental analysis Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AQLYZDRHNHZHIS-UHFFFAOYSA-N quinoline-2,6-diol Chemical compound N1C(=O)C=CC2=CC(O)=CC=C21 AQLYZDRHNHZHIS-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pulmonology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Immunology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782827566 DE2827566A1 (de) | 1978-06-23 | 1978-06-23 | 1,2-dihydro-chinolin-2-on-derivate und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL216409A1 PL216409A1 (cg-RX-API-DMAC10.html) | 1980-03-24 |
| PL115260B1 true PL115260B1 (en) | 1981-03-31 |
Family
ID=6042551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1979216409A PL115260B1 (en) | 1978-06-23 | 1979-06-18 | Process for preparing novel derivatives of 1,2-dihydroquinolin-2-one |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4234585A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0006506B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS552693A (cg-RX-API-DMAC10.html) |
| AT (1) | ATE224T1 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1122218A (cg-RX-API-DMAC10.html) |
| CS (2) | CS207799B2 (cg-RX-API-DMAC10.html) |
| DE (2) | DE2827566A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES481729A1 (cg-RX-API-DMAC10.html) |
| HU (1) | HU177959B (cg-RX-API-DMAC10.html) |
| IL (1) | IL57577A (cg-RX-API-DMAC10.html) |
| PL (1) | PL115260B1 (cg-RX-API-DMAC10.html) |
| SU (1) | SU831077A3 (cg-RX-API-DMAC10.html) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS54130587A (en) * | 1978-03-30 | 1979-10-09 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| JPS55162774A (en) * | 1979-06-06 | 1980-12-18 | Otsuka Pharmaceut Co Ltd | Carbostyril derivative |
| DE3034237A1 (de) * | 1979-09-18 | 1981-04-16 | Otsuka Pharmaceutical Co. Ltd., Tokyo | Carbostyrilderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende, antihistaminisch wirkende mittel |
| PH17194A (en) * | 1980-03-06 | 1984-06-19 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives,and pharmaceutical composition containing the same |
| DE3033112A1 (de) * | 1980-09-03 | 1982-04-01 | Hochtemperatur-Reaktorbau GmbH, 5000 Köln | Atomkernreaktor |
| JPS57130210A (en) * | 1981-02-06 | 1982-08-12 | Kinseishiya Kk | Power switch noise remover for audio appliance |
| US4442111A (en) * | 1981-07-25 | 1984-04-10 | Dr. Karl Thomae Gesellschaft Mit Beschrankter Haftung | Antithrombotic sulfimino and sulfoximino indolinones-2 |
| DE3225169A1 (de) * | 1982-07-06 | 1984-01-12 | Basf Ag, 6700 Ludwigshafen | Chinolinderivate, verfahren zu ihrer herstellung, diese enthaltende mikrobizide und ihre verwendung zur bekaempfung von pilzen |
| DE3434271A1 (de) * | 1984-09-19 | 1986-03-20 | Beiersdorf Ag, 2000 Hamburg | Substituierte 3,4-dihydro-chinolin-2(1h)-one verfahren zu ihrer herstellung und ihre verwendung sowie diese verbindungen enthaltende zubereitungen |
| DE3442570A1 (de) * | 1984-11-22 | 1986-05-22 | Hoechst Ag, 6230 Frankfurt | Neue substituierte phenylpiperazinderivate, verfahren zu deren herstellung und die verwendung substituierter phenylpiperazinderivate als aggressionshemmer fuer tiere |
| GB8502267D0 (en) * | 1985-01-30 | 1985-02-27 | Pfizer Ltd | Quinolone inotropic agents |
| JPS63119467A (ja) * | 1987-10-21 | 1988-05-24 | Otsuka Pharmaceut Co Ltd | カルボスチリル誘導体 |
| US5006528A (en) * | 1988-10-31 | 1991-04-09 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| JP2608788B2 (ja) * | 1988-10-31 | 1997-05-14 | 大塚製薬 株式会社 | 精神分裂病治療剤 |
| US5457099A (en) * | 1992-07-02 | 1995-10-10 | Sawai Pharmaceutical Co., Ltd. | Carbostyril derivatives and antiallergic agent |
| DE4410822A1 (de) * | 1994-03-24 | 1995-09-28 | Schering Ag | Neue Piperidin-Derivate |
| CA2180190A1 (en) * | 1995-07-10 | 1997-01-11 | Kazumi Ogata | Benzylpiperazine derivatives |
| GB0203778D0 (en) * | 2002-02-18 | 2002-04-03 | Glaxo Group Ltd | Compounds |
| CN100497325C (zh) * | 2004-04-21 | 2009-06-10 | 齐鲁制药有限公司 | 哌嗪衍生物及其在制备喹啉酮衍生物中的用途 |
| TWI320783B (en) | 2005-04-14 | 2010-02-21 | Otsuka Pharma Co Ltd | Heterocyclic compound |
| CN101538252B (zh) * | 2008-03-20 | 2011-04-20 | 成都康弘药业集团股份有限公司 | 阿立哌唑的制备方法及其中间体 |
| PH12012502076A1 (en) | 2010-08-24 | 2013-02-04 | Otsuka Pharma Co Ltd | Suspension and cake composition containing carbostyryl derivative and silicone oil and/or silicone oil derivative |
| WO2013169964A1 (en) * | 2012-05-09 | 2013-11-14 | Sunovion Pharmaceuticals Inc. | Heteroaryl compounds and methods of use thereof |
| CN109180577B (zh) * | 2018-10-15 | 2021-11-16 | 迪嘉药业集团有限公司 | 一种阿立哌唑的制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH534687A (de) * | 1968-07-05 | 1973-03-15 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 2-Oxo-1,2-dihydro-chinolins |
| JPS48103590A (cg-RX-API-DMAC10.html) * | 1972-04-13 | 1973-12-25 | ||
| DE2337461A1 (de) * | 1973-07-24 | 1975-02-06 | Boehringer Mannheim Gmbh | Neue indolderivate und verfahren zu deren herstellung |
| GB1501149A (en) * | 1975-07-11 | 1978-02-15 | Nisshin Flour Milling Co | Isocarbostyril derivatives |
| JPS54130587A (en) * | 1978-03-30 | 1979-10-09 | Otsuka Pharmaceut Co Ltd | Carbostyryl derivative |
| JPS55124766A (en) * | 1979-03-20 | 1980-09-26 | Otsuka Pharmaceut Co Ltd | Antihistaminic |
-
1978
- 1978-06-23 DE DE19782827566 patent/DE2827566A1/de not_active Withdrawn
-
1979
- 1979-06-04 US US06/045,472 patent/US4234585A/en not_active Expired - Lifetime
- 1979-06-08 DE DE7979101827T patent/DE2960820D1/de not_active Expired
- 1979-06-08 EP EP79101827A patent/EP0006506B1/de not_active Expired
- 1979-06-08 AT AT79101827T patent/ATE224T1/de not_active IP Right Cessation
- 1979-06-13 CA CA000329712A patent/CA1122218A/en not_active Expired
- 1979-06-17 IL IL57577A patent/IL57577A/xx unknown
- 1979-06-18 PL PL1979216409A patent/PL115260B1/pl unknown
- 1979-06-20 ES ES481729A patent/ES481729A1/es not_active Expired
- 1979-06-21 CS CS798953A patent/CS207799B2/cs unknown
- 1979-06-21 CS CS794286A patent/CS207798B2/cs unknown
- 1979-06-22 HU HU79BO1793A patent/HU177959B/hu not_active IP Right Cessation
- 1979-06-22 SU SU792782353A patent/SU831077A3/ru active
- 1979-06-22 JP JP7823079A patent/JPS552693A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS552693A (en) | 1980-01-10 |
| ES481729A1 (es) | 1980-03-01 |
| IL57577A0 (en) | 1979-10-31 |
| DE2960820D1 (en) | 1981-12-03 |
| CS207798B2 (en) | 1981-08-31 |
| EP0006506B1 (de) | 1981-09-16 |
| CA1122218A (en) | 1982-04-20 |
| PL216409A1 (cg-RX-API-DMAC10.html) | 1980-03-24 |
| IL57577A (en) | 1982-03-31 |
| EP0006506A1 (de) | 1980-01-09 |
| DE2827566A1 (de) | 1980-01-10 |
| JPS6331465B2 (cg-RX-API-DMAC10.html) | 1988-06-23 |
| ATE224T1 (de) | 1981-10-15 |
| SU831077A3 (ru) | 1981-05-15 |
| HU177959B (en) | 1982-02-28 |
| US4234585A (en) | 1980-11-18 |
| CS207799B2 (en) | 1981-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL115260B1 (en) | Process for preparing novel derivatives of 1,2-dihydroquinolin-2-one | |
| US4582837A (en) | Imidazo[4,5-b] and [4,5-c]pyridine derivatives having cardiotonic activity | |
| AU611997B2 (en) | 3,4 amino quinolines and 4 amino 3 nitroquinolines | |
| US4818756A (en) | 2-pyrimidinyl-1-piperazine derivatives, processes for their preparation and medicaments containing them | |
| US4400506A (en) | Processes for the manufacture of pyrimido[6,1-a]isoquinolinones | |
| CZ17094A3 (en) | BENZIMIDAZOLE DERIVATIVES AS 5-HT1a AND 5-HT2 ANTAGONISTS | |
| CS227024B2 (en) | Method of preparing new pyrimidinones | |
| CS226405B2 (en) | Method of preparing piperidinepropoxyquinoline and piperidinepropoxycoumarin | |
| CH638202A5 (de) | 3-(pyrazol-1-yl)-pyridazin-derivate, deren salze und verfahren zu ihrer herstellung. | |
| HU196995B (en) | Process for producing tetrahydroquinoline derivatives and pharmaceuticals comprising same | |
| PL94634B1 (pl) | Sposob wytwarzania nowych arylopiperazynowych pochodnych adeniny | |
| HU193073B (en) | Process for producing new benzimidazoles | |
| CA1208643A (en) | 1,5-diphenyl-pyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing them | |
| IE55312B1 (en) | Piperazine derivatives,their production and pharmaceutical compositions containing them | |
| EP1962849B1 (en) | Quinoline derivatives useful in the treatment of mglur5 receptor-mediated disorders | |
| US4656171A (en) | 2-phenyl-imidazo-pyrazines, useful as cardiotonics | |
| US5500423A (en) | 5,6-dihydro-4H-imidazo[4,5,1-ij]quinolines | |
| DK153487B (da) | Analogifremgangsmaade til fremstilling af 2-(perhydro-1,4-diazino)-pyrimidooe5,4-daapyrimidinderivater | |
| NO147838B (no) | Mellomprodukt til bruk ved fremstilling av det hypotensive middel 2-(4-(2-furoyl)piperazin-1-yl)-4-amino-6,7-dimetoksykinazolin | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| US5972945A (en) | 2-aminoalkylaminoquinolines; dopamine receptor subtype specific ligands | |
| FI77238B (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla fenylalkyl(piperazinyl eller homopiperazinyl)alkyltioler eller tiokarbamater. | |
| WO1996002540A1 (de) | Heterocyclyl-1-phenyl substituierte chinoloncarbonsäuren als antivirale mittel | |
| Volovenko et al. | Synthesis of condensed pyrrolo [b] pyrazines | |
| CZ111898A3 (cs) | Nové deriváty naftylpiperazinu |