NO812190L - Katalysator. - Google Patents
Katalysator.Info
- Publication number
- NO812190L NO812190L NO812190A NO812190A NO812190L NO 812190 L NO812190 L NO 812190L NO 812190 A NO812190 A NO 812190A NO 812190 A NO812190 A NO 812190A NO 812190 L NO812190 L NO 812190L
- Authority
- NO
- Norway
- Prior art keywords
- carbon atoms
- phosphite
- compound
- titanium
- titanium halide
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 47
- -1 titanium halide Chemical class 0.000 claims abstract description 97
- 239000010936 titanium Substances 0.000 claims abstract description 54
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 43
- 150000001875 compounds Chemical class 0.000 claims abstract description 40
- 238000010298 pulverizing process Methods 0.000 claims abstract description 30
- 239000000047 product Substances 0.000 claims abstract description 24
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 19
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 claims abstract description 19
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims abstract description 18
- 150000002681 magnesium compounds Chemical class 0.000 claims abstract description 16
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 15
- 150000002367 halogens Chemical class 0.000 claims abstract description 14
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims abstract description 9
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims description 67
- 125000004432 carbon atom Chemical group C* 0.000 claims description 35
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 20
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 10
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 10
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 claims description 9
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 239000003350 kerosene Substances 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 239000004743 Polypropylene Substances 0.000 claims description 4
- 229920001155 polypropylene Polymers 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 3
- BKHZQJRTFNFCTG-UHFFFAOYSA-N tris(2-methylphenyl) phosphite Chemical compound CC1=CC=CC=C1OP(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C BKHZQJRTFNFCTG-UHFFFAOYSA-N 0.000 claims description 3
- 239000004793 Polystyrene Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910052810 boron oxide Inorganic materials 0.000 claims description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000005375 organosiloxane group Chemical group 0.000 claims description 2
- 229920002223 polystyrene Polymers 0.000 claims description 2
- XTTGYFREQJCEML-UHFFFAOYSA-N tributyl phosphite Chemical compound CCCCOP(OCCCC)OCCCC XTTGYFREQJCEML-UHFFFAOYSA-N 0.000 claims description 2
- 229910052814 silicon oxide Inorganic materials 0.000 claims 1
- 238000006116 polymerization reaction Methods 0.000 abstract description 36
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 abstract description 12
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 abstract description 12
- 229910001629 magnesium chloride Inorganic materials 0.000 abstract description 6
- 229910052782 aluminium Inorganic materials 0.000 abstract description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract description 2
- 239000004711 α-olefin Substances 0.000 abstract description 2
- 229910003074 TiCl4 Inorganic materials 0.000 abstract 1
- 230000000694 effects Effects 0.000 description 21
- 229920000642 polymer Polymers 0.000 description 21
- 239000000203 mixture Substances 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 13
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 13
- QSSJZLPUHJDYKF-UHFFFAOYSA-N methyl 4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C=C1 QSSJZLPUHJDYKF-UHFFFAOYSA-N 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 8
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 8
- 239000002002 slurry Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 125000005907 alkyl ester group Chemical group 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 239000012265 solid product Substances 0.000 description 7
- FHUODBDRWMIBQP-UHFFFAOYSA-N Ethyl p-anisate Chemical compound CCOC(=O)C1=CC=C(OC)C=C1 FHUODBDRWMIBQP-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 238000012662 bulk polymerization Methods 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 4
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 125000002723 alicyclic group Chemical group 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 230000007306 turnover Effects 0.000 description 4
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000002370 organoaluminium group Chemical group 0.000 description 3
- 150000002902 organometallic compounds Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 229930195734 saturated hydrocarbon Natural products 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 150000003609 titanium compounds Chemical class 0.000 description 3
- OJVAMHKKJGICOG-UHFFFAOYSA-N 2,5-hexanedione Chemical compound CC(=O)CCC(C)=O OJVAMHKKJGICOG-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 2
- UUGLJVMIFJNVFH-UHFFFAOYSA-N Hexyl benzoate Chemical compound CCCCCCOC(=O)C1=CC=CC=C1 UUGLJVMIFJNVFH-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910010068 TiCl2 Inorganic materials 0.000 description 2
- 229910010062 TiCl3 Inorganic materials 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229920006125 amorphous polymer Polymers 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- NMJJFJNHVMGPGM-UHFFFAOYSA-N butyl formate Chemical compound CCCCOC=O NMJJFJNHVMGPGM-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 229940095102 methyl benzoate Drugs 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- DDIZAANNODHTRB-UHFFFAOYSA-N methyl p-anisate Chemical compound COC(=O)C1=CC=C(OC)C=C1 DDIZAANNODHTRB-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 2
- PGMYKACGEOXYJE-UHFFFAOYSA-N pentyl acetate Chemical compound CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 150000008301 phosphite esters Chemical class 0.000 description 2
- 229920002959 polymer blend Polymers 0.000 description 2
- 230000000379 polymerizing effect Effects 0.000 description 2
- 150000003138 primary alcohols Chemical group 0.000 description 2
- UDEWPOVQBGFNGE-UHFFFAOYSA-N propyl benzoate Chemical compound CCCOC(=O)C1=CC=CC=C1 UDEWPOVQBGFNGE-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 235000003441 saturated fatty acids Nutrition 0.000 description 2
- 150000004671 saturated fatty acids Chemical class 0.000 description 2
- 229920002545 silicone oil Polymers 0.000 description 2
- ZWYDDDAMNQQZHD-UHFFFAOYSA-L titanium(ii) chloride Chemical compound [Cl-].[Cl-].[Ti+2] ZWYDDDAMNQQZHD-UHFFFAOYSA-L 0.000 description 2
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- QEGNUYASOUJEHD-UHFFFAOYSA-N 1,1-dimethylcyclohexane Chemical compound CC1(C)CCCCC1 QEGNUYASOUJEHD-UHFFFAOYSA-N 0.000 description 1
- UAIVFDJJMVMUGY-UHFFFAOYSA-N 1,2,4-trimethylpiperazine Chemical compound CC1CN(C)CCN1C UAIVFDJJMVMUGY-UHFFFAOYSA-N 0.000 description 1
- HNAGHMKIPMKKBB-UHFFFAOYSA-N 1-benzylpyrrolidine-3-carboxamide Chemical compound C1C(C(=O)N)CCN1CC1=CC=CC=C1 HNAGHMKIPMKKBB-UHFFFAOYSA-N 0.000 description 1
- YPJRYQGOKHKNKZ-UHFFFAOYSA-N 1-ethyl-1-methylcyclohexane Chemical compound CCC1(C)CCCCC1 YPJRYQGOKHKNKZ-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- IEOPZUMPHCZMCS-UHFFFAOYSA-N 2-(methoxymethyl)oxolane Chemical compound COCC1CCCO1 IEOPZUMPHCZMCS-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-M 2-chlorobenzoate Chemical compound [O-]C(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-M 0.000 description 1
- WOYWLLHHWAMFCB-UHFFFAOYSA-N 2-ethylhexyl acetate Chemical compound CCCCC(CC)COC(C)=O WOYWLLHHWAMFCB-UHFFFAOYSA-N 0.000 description 1
- UADWUILHKRXHMM-UHFFFAOYSA-N 2-ethylhexyl benzoate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1 UADWUILHKRXHMM-UHFFFAOYSA-N 0.000 description 1
- 229940106004 2-ethylhexyl benzoate Drugs 0.000 description 1
- YBFYRBILSHBEHV-UHFFFAOYSA-N 2-ethylhexyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OCC(CC)CCCC)=CC=CC2=C1 YBFYRBILSHBEHV-UHFFFAOYSA-N 0.000 description 1
- CMAOLVNGLTWICC-UHFFFAOYSA-N 2-fluoro-5-methylbenzonitrile Chemical compound CC1=CC=C(F)C(C#N)=C1 CMAOLVNGLTWICC-UHFFFAOYSA-N 0.000 description 1
- DUAYDERMVQWIJD-UHFFFAOYSA-N 2-n,2-n,6-trimethyl-1,3,5-triazine-2,4-diamine Chemical compound CN(C)C1=NC(C)=NC(N)=N1 DUAYDERMVQWIJD-UHFFFAOYSA-N 0.000 description 1
- PZRWFKGUFWPFID-UHFFFAOYSA-N 3,9-dioctadecoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound C1OP(OCCCCCCCCCCCCCCCCCC)OCC21COP(OCCCCCCCCCCCCCCCCCC)OC2 PZRWFKGUFWPFID-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- ICMAFTSLXCXHRK-UHFFFAOYSA-N Ethyl pentanoate Chemical compound CCCCC(=O)OCC ICMAFTSLXCXHRK-UHFFFAOYSA-N 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- OLBVUFHMDRJKTK-UHFFFAOYSA-N [N].[O] Chemical class [N].[O] OLBVUFHMDRJKTK-UHFFFAOYSA-N 0.000 description 1
- YUWBVKYVJWNVLE-UHFFFAOYSA-N [N].[P] Chemical class [N].[P] YUWBVKYVJWNVLE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000008431 aliphatic amides Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005234 alkyl aluminium group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000008430 aromatic amides Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000008365 aromatic ketones Chemical class 0.000 description 1
- 150000008378 aryl ethers Chemical class 0.000 description 1
- UADWUILHKRXHMM-ZDUSSCGKSA-N benzoflex 181 Natural products CCCC[C@H](CC)COC(=O)C1=CC=CC=C1 UADWUILHKRXHMM-ZDUSSCGKSA-N 0.000 description 1
- XSIFPSYPOVKYCO-UHFFFAOYSA-N benzoic acid butyl ester Natural products CCCCOC(=O)C1=CC=CC=C1 XSIFPSYPOVKYCO-UHFFFAOYSA-N 0.000 description 1
- KYZHGEFMXZOSJN-UHFFFAOYSA-N benzoic acid isobutyl ester Natural products CC(C)COC(=O)C1=CC=CC=C1 KYZHGEFMXZOSJN-UHFFFAOYSA-N 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N butanoic acid ethyl ester Natural products CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- GWCTUKHUBWMAMI-GQCTYLIASA-N butyl (e)-but-2-enoate Chemical compound CCCCOC(=O)\C=C\C GWCTUKHUBWMAMI-GQCTYLIASA-N 0.000 description 1
- YCURFOQQPNHZAO-UHFFFAOYSA-N butyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OCCCC)=CC=CC2=C1 YCURFOQQPNHZAO-UHFFFAOYSA-N 0.000 description 1
- 230000002308 calcification Effects 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- HYZXMVILOKSUKA-UHFFFAOYSA-K chloro(dimethyl)alumane;dichloro(methyl)alumane Chemical compound C[Al](C)Cl.C[Al](Cl)Cl HYZXMVILOKSUKA-UHFFFAOYSA-K 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- VJRUISVXILMZSL-UHFFFAOYSA-M dibutylalumanylium;chloride Chemical compound CCCC[Al](Cl)CCCC VJRUISVXILMZSL-UHFFFAOYSA-M 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- 229940052296 esters of benzoic acid for local anesthesia Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- HHEIMYAXCOIQCJ-UHFFFAOYSA-N ethyl 2,2-dimethylpropanoate Chemical compound CCOC(=O)C(C)(C)C HHEIMYAXCOIQCJ-UHFFFAOYSA-N 0.000 description 1
- LMXMLKHKWPCFTG-UHFFFAOYSA-N ethyl 4-butoxybenzoate Chemical compound CCCCOC1=CC=C(C(=O)OCC)C=C1 LMXMLKHKWPCFTG-UHFFFAOYSA-N 0.000 description 1
- RWBYCMPOFNRISR-UHFFFAOYSA-N ethyl 4-chlorobenzoate Chemical compound CCOC(=O)C1=CC=C(Cl)C=C1 RWBYCMPOFNRISR-UHFFFAOYSA-N 0.000 description 1
- NWPWRAWAUYIELB-UHFFFAOYSA-N ethyl 4-methylbenzoate Chemical compound CCOC(=O)C1=CC=C(C)C=C1 NWPWRAWAUYIELB-UHFFFAOYSA-N 0.000 description 1
- XDRMBCMMABGNMM-UHFFFAOYSA-N ethyl benzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=CC=C1 XDRMBCMMABGNMM-UHFFFAOYSA-N 0.000 description 1
- JJOYCHKVKWDMEA-UHFFFAOYSA-N ethyl cyclohexanecarboxylate Chemical compound CCOC(=O)C1CCCCC1 JJOYCHKVKWDMEA-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VAJCYQHLYBTSHG-UHFFFAOYSA-N ethyl n,n-diethylcarbamate Chemical compound CCOC(=O)N(CC)CC VAJCYQHLYBTSHG-UHFFFAOYSA-N 0.000 description 1
- HQKSINSCHCDMLS-UHFFFAOYSA-N ethyl naphthalene-2-carboxylate Chemical compound C1=CC=CC2=CC(C(=O)OCC)=CC=C21 HQKSINSCHCDMLS-UHFFFAOYSA-N 0.000 description 1
- MGDOJPNDRJNJBK-UHFFFAOYSA-N ethylaluminum Chemical compound [Al].C[CH2] MGDOJPNDRJNJBK-UHFFFAOYSA-N 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-O guanidinium Chemical compound NC(N)=[NH2+] ZRALSGWEFCBTJO-UHFFFAOYSA-O 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- BLQJIBCZHWBKSL-UHFFFAOYSA-L magnesium iodide Chemical compound [Mg+2].[I-].[I-] BLQJIBCZHWBKSL-UHFFFAOYSA-L 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- WVWZECQNFWFVFW-UHFFFAOYSA-N methyl 2-methylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C WVWZECQNFWFVFW-UHFFFAOYSA-N 0.000 description 1
- ZQWPRMPSCMSAJU-UHFFFAOYSA-N methyl cyclohexanecarboxylate Chemical compound COC(=O)C1CCCCC1 ZQWPRMPSCMSAJU-UHFFFAOYSA-N 0.000 description 1
- HMRROBKAACRWBP-UHFFFAOYSA-N methyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)=CC=CC2=C1 HMRROBKAACRWBP-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229930003658 monoterpene Natural products 0.000 description 1
- 235000002577 monoterpenes Nutrition 0.000 description 1
- RLVGHTRVYWUWSH-UHFFFAOYSA-N n,n,2,2-tetramethylpropanamide Chemical compound CN(C)C(=O)C(C)(C)C RLVGHTRVYWUWSH-UHFFFAOYSA-N 0.000 description 1
- SKECXRFZFFAANN-UHFFFAOYSA-N n,n-dimethylmethanethioamide Chemical compound CN(C)C=S SKECXRFZFFAANN-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- VECVSKFWRQYTAL-UHFFFAOYSA-N octyl benzoate Chemical compound CCCCCCCCOC(=O)C1=CC=CC=C1 VECVSKFWRQYTAL-UHFFFAOYSA-N 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000008039 phosphoramides Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- WEHMFTWWOGBHCR-UHFFFAOYSA-N propyl 4-methoxybenzoate Chemical compound CCCOC(=O)C1=CC=C(OC)C=C1 WEHMFTWWOGBHCR-UHFFFAOYSA-N 0.000 description 1
- DVFZYEJUWGWKLC-UHFFFAOYSA-N propyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OCCC)=CC=CC2=C1 DVFZYEJUWGWKLC-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002210 silicon-based material Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- VHAHQCUPIDGTHM-UHFFFAOYSA-N trianthracen-9-yl phosphite Chemical compound C1=CC=C2C(OP(OC=3C4=CC=CC=C4C=C4C=CC=CC4=3)OC=3C4=CC=CC=C4C=C4C=CC=CC4=3)=C(C=CC=C3)C3=CC2=C1 VHAHQCUPIDGTHM-UHFFFAOYSA-N 0.000 description 1
- FICPQAZLPKLOLH-UHFFFAOYSA-N tricyclohexyl phosphite Chemical compound C1CCCCC1OP(OC1CCCCC1)OC1CCCCC1 FICPQAZLPKLOLH-UHFFFAOYSA-N 0.000 description 1
- XBEXIHMRFRFRAM-UHFFFAOYSA-N tridodecylalumane Chemical compound CCCCCCCCCCCC[Al](CCCCCCCCCCCC)CCCCCCCCCCCC XBEXIHMRFRFRAM-UHFFFAOYSA-N 0.000 description 1
- AJSTXXYNEIHPMD-UHFFFAOYSA-N triethyl borate Chemical compound CCOB(OCC)OCC AJSTXXYNEIHPMD-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- ADQGXUHCBBVRGM-UHFFFAOYSA-N trinaphthalen-1-yl phosphite Chemical compound C1=CC=C2C(OP(OC=3C4=CC=CC=C4C=CC=3)OC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ADQGXUHCBBVRGM-UHFFFAOYSA-N 0.000 description 1
- LFXVBWRMVZPLFK-UHFFFAOYSA-N trioctylalumane Chemical compound CCCCCCCC[Al](CCCCCCCC)CCCCCCCC LFXVBWRMVZPLFK-UHFFFAOYSA-N 0.000 description 1
- YIVQLLZRHJPWTH-UHFFFAOYSA-N triphenanthren-4-yl phosphite Chemical compound C1=CC=CC2=C3C(OP(OC=4C5=C6C=CC=CC6=CC=C5C=CC=4)OC=4C5=C6C=CC=CC6=CC=C5C=CC=4)=CC=CC3=CC=C21 YIVQLLZRHJPWTH-UHFFFAOYSA-N 0.000 description 1
- WEDGIYFCSMJGTP-UHFFFAOYSA-N tris(10-cyclodecylanthracen-9-yl) phosphite Chemical compound C1CCCCCCCCC1C(C1=CC=CC=C11)=C(C=CC=C2)C2=C1OP(OC=1C2=CC=CC=C2C(C2CCCCCCCCC2)=C2C=CC=CC2=1)OC(C1=CC=CC=C11)=C(C=CC=C2)C2=C1C1CCCCCCCCC1 WEDGIYFCSMJGTP-UHFFFAOYSA-N 0.000 description 1
- XUHUMYVYHLHMCD-UHFFFAOYSA-N tris(2-cyclohexylphenyl) phosphite Chemical compound C1CCCCC1C1=CC=CC=C1OP(OC=1C(=CC=CC=1)C1CCCCC1)OC1=CC=CC=C1C1CCCCC1 XUHUMYVYHLHMCD-UHFFFAOYSA-N 0.000 description 1
- HECNCEQNDSEKBN-UHFFFAOYSA-N tris(3-cyclopentylphenyl) phosphite Chemical compound C1CCCC1C1=CC=CC(OP(OC=2C=C(C=CC=2)C2CCCC2)OC=2C=C(C=CC=2)C2CCCC2)=C1 HECNCEQNDSEKBN-UHFFFAOYSA-N 0.000 description 1
- VAURMQDVZLSKAA-UHFFFAOYSA-N tris(4-propan-2-ylphenyl) phosphite Chemical compound C1=CC(C(C)C)=CC=C1OP(OC=1C=CC(=CC=1)C(C)C)OC1=CC=C(C(C)C)C=C1 VAURMQDVZLSKAA-UHFFFAOYSA-N 0.000 description 1
- OCWODPBASKRIFT-UHFFFAOYSA-N tris(6-cycloheptylnaphthalen-2-yl) phosphite Chemical compound C1CCCCCC1C1=CC=C(C=C(OP(OC=2C=C3C=CC(=CC3=CC=2)C2CCCCCC2)OC=2C=C3C=CC(=CC3=CC=2)C2CCCCCC2)C=C2)C2=C1 OCWODPBASKRIFT-UHFFFAOYSA-N 0.000 description 1
- DHILVJHGUPRKCF-UHFFFAOYSA-N tris(6-phenylanthracen-2-yl) phosphite Chemical compound C=1C=C2C=C3C=C(C=4C=CC=CC=4)C=CC3=CC2=CC=1OP(OC=1C=C2C=C3C=CC(=CC3=CC2=CC=1)C=1C=CC=CC=1)OC(C=C1C=C2C=C3)=CC=C1C=C2C=C3C1=CC=CC=C1 DHILVJHGUPRKCF-UHFFFAOYSA-N 0.000 description 1
- IYBHTOZULFOMEW-UHFFFAOYSA-N tris(7-phenylnaphthalen-1-yl) phosphite Chemical compound C=1C=CC2=CC=C(C=3C=CC=CC=3)C=C2C=1OP(OC=1C2=CC(=CC=C2C=CC=1)C=1C=CC=CC=1)OC(C1=C2)=CC=CC1=CC=C2C1=CC=CC=C1 IYBHTOZULFOMEW-UHFFFAOYSA-N 0.000 description 1
- NBPZCUCIKOQELK-UHFFFAOYSA-N tris(7-phenylphenanthren-1-yl) phosphite Chemical compound C=1C=CC(C2=CC=C(C=C2C=C2)C=3C=CC=CC=3)=C2C=1OP(OC=1C2=C(C3=CC=C(C=C3C=C2)C=2C=CC=CC=2)C=CC=1)OC1=CC=CC(C2=CC=3)=C1C=CC2=CC=3C1=CC=CC=C1 NBPZCUCIKOQELK-UHFFFAOYSA-N 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/42—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors
- C08F4/44—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides
- C08F4/60—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides together with refractory metals, iron group metals, platinum group metals, manganese, rhenium technetium or compounds thereof
- C08F4/62—Refractory metals or compounds thereof
- C08F4/64—Titanium, zirconium, hafnium or compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S526/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S526/904—Monomer polymerized in presence of transition metal containing catalyst at least part of which is supported on a polymer, e.g. prepolymerized catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/163,615 US4347160A (en) | 1980-06-27 | 1980-06-27 | Titanium halide catalyst system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO812190L true NO812190L (no) | 1981-12-28 |
Family
ID=22590797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO812190A NO812190L (no) | 1980-06-27 | 1981-06-26 | Katalysator. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4347160A (es) |
| EP (1) | EP0043185B1 (es) |
| JP (1) | JPS5731909A (es) |
| KR (1) | KR840001736B1 (es) |
| AT (1) | ATE9807T1 (es) |
| AU (1) | AU543559B2 (es) |
| BR (1) | BR8103956A (es) |
| CA (1) | CA1159043A (es) |
| DD (1) | DD159880A5 (es) |
| DE (1) | DE3166568D1 (es) |
| ES (1) | ES503428A0 (es) |
| NO (1) | NO812190L (es) |
| PT (1) | PT73235B (es) |
| RO (1) | RO82539B (es) |
| YU (1) | YU156281A (es) |
| ZA (1) | ZA813374B (es) |
Families Citing this family (132)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4451688A (en) * | 1981-12-03 | 1984-05-29 | Nippon Oil Company, Limited | Process for preparing polyolefins |
| US4525555A (en) * | 1983-01-14 | 1985-06-25 | Nippon Oil Company, Limited | Process for preparing polyolefins |
| JPH0446764Y2 (es) * | 1984-10-23 | 1992-11-04 | ||
| IT1197320B (it) * | 1986-10-02 | 1988-11-30 | Ausimont Spa | Catalizzatori per la preparazione di copolimeri olefinici elastomerici,saturi ed insaturi,e vopolimeri con essi ottenuti |
| US5278118A (en) * | 1986-10-02 | 1994-01-11 | Ausimont, S.P.A. | Catalysts for the preparation of elastomeric olefinic copolymers |
| US5270410A (en) * | 1989-04-25 | 1993-12-14 | Shell Oil Company | Process for the production of elastomeric, primarily syndiotactic polypropylene and catalysts for use in said process |
| US5270276A (en) * | 1989-04-25 | 1993-12-14 | Shell Oil Company | Process for the production of elastomeric, primarily syndiotactic polypropylene and catalysts for use in said process |
| US4971936A (en) * | 1989-07-10 | 1990-11-20 | Shell Oil Company | Catalyst component for making primarily isotactic elastomeric polypropylene or polybutene |
| US5166340A (en) * | 1989-07-26 | 1992-11-24 | Himont Incorporated | Organosilane compounds |
| FR2658498B1 (fr) * | 1990-02-19 | 1992-05-15 | Atochem | Particules de chlorure de magnesium a structure tronc conique, composante catalytique supportee sur ces particules, polyolefines obtenues a partir de cette composante catalytique, procedes de fabrication de ces produits. |
| US5118649A (en) * | 1990-02-26 | 1992-06-02 | Shell Oil Company | Process for the production of elastomeric primarily isotactic polyolefins and catalysts for use in said process |
| US5118767A (en) * | 1990-02-26 | 1992-06-02 | Shell Oil Company | Process for producing mildly elastomeric primarily isotatic polypropylene and poly-1-butene |
| US5089573A (en) * | 1990-02-26 | 1992-02-18 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5164352A (en) * | 1990-05-11 | 1992-11-17 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5118768A (en) * | 1990-05-11 | 1992-06-02 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5102842A (en) * | 1990-08-23 | 1992-04-07 | Himont Incorporated | Catalyst for the polymerization of alpha-olefins containing trifluoropropyl substituted silane compounds |
| JPH0518550U (ja) * | 1991-08-28 | 1993-03-09 | 西日本鉄道株式会社 | 自動車用消火装置 |
| US6130180A (en) * | 1997-12-23 | 2000-10-10 | Montell North America Inc. | Catalyst for the polymerization of alpha-olefins containing substituted amino silane compounds |
| US6015768A (en) * | 1998-04-22 | 2000-01-18 | Ray; Sabyasachi Sinha | Process for preparation of a heterogeneous catalyst useful for preparation of super high molecular weight polymers of alpha-olefin |
| KR20010102300A (ko) | 1999-12-22 | 2001-11-15 | 간디 지오프레이 에이치. | 방향족 실란 화합물을 함유하는 알파-올레핀 중합 촉매계 |
| KR101040388B1 (ko) * | 2007-01-30 | 2011-06-09 | 주식회사 엘지화학 | 트리옥사실로칸을 포함하는 올레핀 중합용 촉매 및 이를이용한 올레핀 중합 방법 |
| ATE535554T1 (de) | 2008-10-08 | 2011-12-15 | Borealis Ag | Verfahren zur herstellung von sehr steifem polyproylen |
| EP2174965B1 (en) * | 2008-10-08 | 2013-05-29 | Borealis AG | Preparation of propylene copolymer with dynamically operated reactor |
| WO2010076231A1 (en) | 2008-12-29 | 2010-07-08 | Borealis Ag | Cable layer of modified soft polypropylene with improved stress whitening resistance |
| EP2216347A1 (en) | 2009-01-30 | 2010-08-11 | Borealis AG | A method of catalyst transitions in olefin polymerizations |
| ATE529450T1 (de) | 2009-02-25 | 2011-11-15 | Borealis Ag | Multimodales polymer aus propylen, zusammensetzung damit und verfahren zur herstellung davon |
| BRPI1010294A2 (pt) | 2009-04-09 | 2016-03-22 | Borealis Ag | composição de poliolefina termoplástica. |
| US7619049B1 (en) | 2009-04-13 | 2009-11-17 | Formosa Plastics Corporation, U.S.A. | Cyclic organosilicon compounds as electron donors for polyolefin catalysts |
| US7790819B1 (en) | 2009-04-13 | 2010-09-07 | Formosa Plastics Corporation, U.S.A. | Bicyclic organosilicon compounds as electron donors for polyolefin catalysts |
| EP2452920A1 (en) | 2010-11-12 | 2012-05-16 | Borealis AG | A method for recovering transition metal tetrahalide and hydrocarbons from a waste stream |
| EP2452976A1 (en) | 2010-11-12 | 2012-05-16 | Borealis AG | Heterophasic propylene copolymers with improved stiffness/impact/flowability balance |
| EP2452956A1 (en) | 2010-11-12 | 2012-05-16 | Borealis AG | Improved process for polymerising propylene |
| EP2452975A1 (en) | 2010-11-12 | 2012-05-16 | Borealis AG | Soft heterophasic propylene copolymers |
| EP2452960B1 (en) | 2010-11-12 | 2015-01-07 | Borealis AG | Process for preparing propylene polymers with an ultra high melt flow rate |
| EP2452957A1 (en) | 2010-11-12 | 2012-05-16 | Borealis AG | Improved process for producing heterophasic propylene copolymers |
| EP2452959B1 (en) | 2010-11-12 | 2015-01-21 | Borealis AG | Process for producing propylene random copolymers and their use |
| EP2495037B1 (en) | 2011-03-02 | 2020-08-19 | Borealis AG | High throughput reactor assembly for polymerization of olefins |
| ES2817776T3 (es) | 2011-03-02 | 2021-04-08 | Borealis Ag | Un procedimiento para la producción de polímeros |
| ES2605429T3 (es) | 2011-06-15 | 2017-03-14 | Borealis Ag | Mezcla del reactor in situ de un polipropileno nucleado catalizado por Ziegler-Natta y un polipropileno catalizado por metaloceno |
| EP2617741B1 (en) | 2012-01-18 | 2016-01-13 | Borealis AG | Process for polymerizing olefin polymers in the presence of a catalyst system and a method of controlling the process |
| US9815918B2 (en) | 2012-03-19 | 2017-11-14 | Formosa Plastics Corporation, U.S.A. | Catalyst component for high activity and high stereoselectivity in olefin polymerization |
| US8575283B1 (en) | 2012-06-28 | 2013-11-05 | Formosa Plastics Corporation, U.S.A. | Heterocyclic organic compounds as electron donors for polyolefin catalysts |
| WO2014032794A1 (en) | 2012-08-29 | 2014-03-06 | Borealis Ag | Reactor assembly and method for polymerization of olefins |
| EP2719725B1 (en) | 2012-10-11 | 2018-12-05 | Abu Dhabi Polymers Company Limited (Borouge) | Nucleated polypropylene composition for containers |
| EP2745927A1 (en) | 2012-12-21 | 2014-06-25 | Borealis AG | Fluidized bed reactor with internal moving bed reaction unit |
| EP2745926A1 (en) | 2012-12-21 | 2014-06-25 | Borealis AG | Gas phase polymerization and reactor assembly comprising a fluidized bed reactor and an external moving bed reactor |
| EP2749580B1 (en) | 2012-12-28 | 2016-09-14 | Borealis AG | Process for producing copolymers of propylene |
| EP2787034A1 (en) | 2013-04-05 | 2014-10-08 | Borealis AG | High stiffness polypropylene compositions |
| EP2796500B1 (en) | 2013-04-22 | 2018-04-18 | Abu Dhabi Polymers Company Limited (Borouge) | Propylene random copolymer composition for pipe applications |
| EP2796474B1 (en) | 2013-04-22 | 2018-01-10 | Borealis AG | Multistage process for producing polypropylene compositions |
| EP2796502A1 (en) | 2013-04-22 | 2014-10-29 | Abu Dhabi Polymers Company Limited (Borouge) | Propylene random copolymer composition for pipe applications |
| ES2632593T3 (es) | 2013-04-22 | 2017-09-14 | Borealis Ag | Procedimiento de dos fases de producción de composiciones de polipropileno |
| ES2628082T3 (es) | 2013-04-22 | 2017-08-01 | Borealis Ag | Procedimiento con múltiples etapas para producir composiciones de polipropileno resistentes a baja temperatura |
| EP2796499B1 (en) | 2013-04-22 | 2018-05-30 | Abu Dhabi Polymers Company Limited (Borouge) | Polypropylene composition with improved impact resistance for pipe applications |
| PL2796498T3 (pl) | 2013-04-22 | 2019-03-29 | Abu Dhabi Polymers Company Limited (Borouge) | Multimodalna kompozycja polipropylenowa do zastosowania w rurach |
| PL2796501T3 (pl) | 2013-04-22 | 2017-01-31 | Abu Dhabi Polymers Company Limited (Borouge) | Wielomodalna polipropylenowa kompozycja do zastosowań do rur |
| EP3033389B1 (en) | 2013-08-14 | 2017-10-11 | Borealis AG | Propylene composition with improved impact resistance at low temperature |
| CA2919171A1 (en) | 2013-08-21 | 2015-02-26 | Borealis Ag | High flow polyolefin composition with high stiffness and toughness |
| MX2016001930A (es) | 2013-08-21 | 2016-05-26 | Borealis Ag | Composicion de poliolefina de alto flujo con alta rigidez y tenacidad. |
| EP2853562A1 (en) | 2013-09-27 | 2015-04-01 | Borealis AG | Two-stage process for producing polypropylene compositions |
| EP2853563B1 (en) | 2013-09-27 | 2016-06-15 | Borealis AG | Films suitable for BOPP processing from polymers with high XS and high Tm |
| ES2568615T3 (es) | 2013-10-11 | 2016-05-03 | Borealis Ag | Película para etiquetas orientada en la dirección de la máquina |
| US10519259B2 (en) | 2013-10-24 | 2019-12-31 | Borealis Ag | Low melting PP homopolymer with high content of regioerrors and high molecular weight |
| ES2574428T3 (es) | 2013-10-24 | 2016-06-17 | Borealis Ag | Artículo moldeado por soplado basado en copolímero al azar bimodal |
| EP3063185B9 (en) | 2013-10-29 | 2017-11-15 | Borealis AG | Solid single site catalysts with high polymerisation activity |
| EA031527B1 (ru) | 2013-11-22 | 2019-01-31 | Бореалис Аг | Гомополимер пропилена с низкой эмиссией и с высокой скоростью течения расплава |
| BR112016011829B1 (pt) | 2013-12-04 | 2022-01-18 | Borealis Ag | Composição de polipropileno, fibra e trama soprada em fusão, artigo e uso da composição de polipropileno |
| WO2015091839A1 (en) | 2013-12-18 | 2015-06-25 | Borealis Ag | Bopp film with improved stiffness/toughness balance |
| EP2886600B1 (en) | 2013-12-19 | 2018-05-30 | Abu Dhabi Polymers Co. Ltd (Borouge) LLC. | Multimodal polypropylene with respect to comonomer content |
| WO2015095985A1 (en) | 2013-12-24 | 2015-07-02 | Abu Dhabi Polymers Co. Ltd (Borouge) Llc | Superior impact strength at low temperature by rubber design |
| EP3094660B1 (en) | 2014-01-17 | 2018-12-19 | Borealis AG | Process for preparing propylene/1-butene copolymers |
| CN112225997B (zh) | 2014-02-06 | 2023-09-22 | 北欧化工公司 | 高冲击强度的柔性共聚物 |
| BR112016017227B1 (pt) | 2014-02-06 | 2021-06-29 | Borealis Ag | Copolímero de propileno heterofásico, película não orientada, recipiente, e uso de um copolímero de propileno heterofásico |
| EP2907841A1 (en) | 2014-02-14 | 2015-08-19 | Borealis AG | Polypropylene composite |
| EP2913345B1 (en) | 2014-02-28 | 2016-11-02 | Borealis AG | Gas phase polymerization process |
| EP2913346B1 (en) | 2014-02-28 | 2016-11-02 | Borealis AG | Process for polymerizing olefins in a fluidized bed |
| EP2933291A1 (en) | 2014-04-17 | 2015-10-21 | Borealis AG | Propylene copolymer composition for pipe applications |
| EP2947118B1 (en) | 2014-05-20 | 2017-11-29 | Borealis AG | Polypropylene composition for automotive interior applications |
| EP2995631A1 (en) | 2014-09-12 | 2016-03-16 | Borealis AG | Process for producing graft copolymers on polyolefin backbone |
| US9593184B2 (en) | 2014-10-28 | 2017-03-14 | Formosa Plastics Corporation, Usa | Oxalic acid diamides as modifiers for polyolefin catalysts |
| EP3018156B1 (en) | 2014-11-05 | 2023-03-22 | Borealis AG | Branched polypropylene for foam applications |
| EP3023450B1 (en) | 2014-11-21 | 2017-07-19 | Borealis AG | Process for producing pellets of soft copolymers |
| PL3103818T3 (pl) | 2015-06-12 | 2018-12-31 | Borealis Ag | Sposób i aparat do polimeryzacji olefin w fazie gazowej |
| EP3328955B1 (en) | 2015-07-30 | 2020-03-18 | Borealis AG | Polypropylene composition with improved hot-tack force |
| EP3124567A1 (en) | 2015-07-30 | 2017-02-01 | Borealis AG | Polypropylene based hot-melt adhesive composition |
| EP3147324B1 (en) | 2015-09-28 | 2018-09-26 | Borealis AG | Polypropylene pipes with improved pressure resistance |
| US10676604B2 (en) | 2015-10-21 | 2020-06-09 | Borealis Ag | Long-branched polypropylene composition with increased melt strength stability |
| PL3368605T3 (pl) | 2015-10-28 | 2022-08-22 | Borealis Ag | Kompozycja polipropylenowa dla elementu warstwowego |
| EP3178853B1 (en) | 2015-12-07 | 2018-07-25 | Borealis AG | Process for polymerising alpha-olefin monomers |
| EP3184167B8 (en) | 2015-12-22 | 2022-03-30 | Borealis AG | A method for returning polymer to a fluidised bed reactor |
| EP3184166A1 (en) | 2015-12-22 | 2017-06-28 | Borealis AG | A method for withdrawing agglomerates from a fluidised bed reactor |
| EP3187512A1 (en) | 2015-12-31 | 2017-07-05 | Borealis AG | Process for preparing propylene copolymer compositions |
| US9777084B2 (en) | 2016-02-19 | 2017-10-03 | Formosa Plastics Corporation, Usa | Catalyst system for olefin polymerization and method for producing olefin polymer |
| WO2017157484A1 (en) | 2016-03-14 | 2017-09-21 | Borealis Ag | Polypropylene composition comprising flame retardant |
| EP3243622B1 (en) | 2016-05-13 | 2020-09-09 | Borealis AG | Process for hydraulic conveying of polyolefin pellets |
| EP3281973A1 (en) | 2016-08-11 | 2018-02-14 | Borealis AG | Polypropylene composition with flame retardant activity |
| US11427660B2 (en) | 2016-08-17 | 2022-08-30 | Formosa Plastics Corporation, Usa | Organosilicon compounds as electron donors for olefin polymerization catalysts and methods of making and using same |
| US9815920B1 (en) | 2016-10-14 | 2017-11-14 | Formosa Plastics Corporation, Usa | Olefin polymerization catalyst components and process for the production of olefin polymers therewith |
| MX2019003759A (es) | 2016-11-09 | 2019-07-04 | Borealis Ag | Composicion de polipropileno. |
| WO2018141672A1 (en) | 2017-02-01 | 2018-08-09 | Borealis Ag | Article comprising a layer element |
| US10822438B2 (en) | 2017-05-09 | 2020-11-03 | Formosa Plastics Corporation | Catalyst system for enhanced stereo-specificity of olefin polymerization and method for producing olefin polymer |
| US10124324B1 (en) | 2017-05-09 | 2018-11-13 | Formosa Plastics Corporation, Usa | Olefin polymerization catalyst components and process for the production of olefin polymers therewith |
| ES2786756T3 (es) | 2017-06-20 | 2020-10-13 | Borealis Ag | Un método, una disposición y uso de una disposición para la polimerización de olefinas |
| EP3418309A1 (en) | 2017-06-20 | 2018-12-26 | Borealis AG | A method, an arrangement and use of an arrangement of preparing polymer |
| EP3418310B1 (en) | 2017-06-23 | 2020-04-08 | Borealis AG | Process and apparatus for removing polymer material from a gas-solids olefin polymerization reactor |
| CN109135067A (zh) | 2017-06-27 | 2019-01-04 | 阿布扎比聚合物有限责任公司(博禄) | 用于制造高压管的聚丙烯组合物 |
| DK3473674T3 (da) | 2017-10-19 | 2022-06-20 | Abu Dhabi Polymers Co Ltd Borouge Llc | Polypropylensammensætning |
| EP3479896A1 (en) | 2017-11-03 | 2019-05-08 | Borealis AG | Polymerization reactor system comprising at least one withdrawal valve |
| EP3483189A1 (en) | 2017-11-14 | 2019-05-15 | Borealis AG | Automated method for terminating an olefin polymerization reaction under emergency conditions |
| ES2806646T3 (es) | 2017-11-17 | 2021-02-18 | Borealis Ag | Procedimiento para mejorar la capacidad de enfriamiento de un reactor de polimerización de olefinas de gas-sólidos |
| ES2795985T3 (es) | 2017-11-17 | 2020-11-25 | Borealis Ag | Procedimiento de división del gas de fluidización de retorno en un reactor de polimerización de olefinas de gas sólidos |
| WO2019219902A1 (en) | 2018-05-18 | 2019-11-21 | Abu Dhabi Polymers Co. Ltd (Borouge) L.L.C. | Improving rheological properties of thermoplastic polyolefin compositions |
| JP2021525289A (ja) | 2018-05-28 | 2021-09-24 | ボレアリス エージー | 光起電（ｐｖ）モジュール用装置 |
| EP3807330A1 (en) | 2018-06-14 | 2021-04-21 | Borealis AG | Process for polymerizing olefin in a gas phase reactor with improved thermal homogeneity |
| CN112638958B (zh) | 2018-07-19 | 2023-06-02 | 博里利斯股份公司 | 制备uhmwpe均聚物的方法 |
| TWI785263B (zh) | 2018-08-02 | 2022-12-01 | 奧地利商柏列利斯股份公司 | 在多階段式聚合方法中聚合乙烯之方法 |
| EP3608364A1 (en) | 2018-08-06 | 2020-02-12 | Borealis AG | Multimodal propylene random copolymer based composition suitable as hot melt adhesive composition |
| US20210277290A1 (en) | 2018-08-06 | 2021-09-09 | Borealis Ag | Propylene random copolymer based hot melt adhesive composition |
| WO2020064568A1 (en) | 2018-09-28 | 2020-04-02 | Borealis Ag | Process for producing a prepolymerized solid ziegler-natta catalyst |
| US11897975B2 (en) | 2018-09-28 | 2024-02-13 | Borealis Ag | Multi-stage process for producing a C2 to C8 olefin polymer composition |
| KR102593922B1 (ko) | 2018-10-31 | 2023-10-25 | 보레알리스 아게 | 개선된 균질성을 갖는 고압력 저항성 파이프용 폴리에틸렌 조성물 |
| EP3647645A1 (en) | 2018-10-31 | 2020-05-06 | Borealis AG | Polyethylene composition for high pressure resistant pipes |
| CN113166292A (zh) | 2018-11-30 | 2021-07-23 | 博里利斯股份公司 | 洗涤工艺 |
| US20220177616A1 (en) | 2019-06-04 | 2022-06-09 | Borealis Ag | Process and reactor assembly for the enhancement of hydrodynamics in a gas-solids fluidized bed reactor |
| WO2020260021A1 (en) | 2019-06-24 | 2020-12-30 | Borealis Ag | Process for preparing polypropylene with improved recovery |
| EP3868793A1 (en) | 2020-02-24 | 2021-08-25 | Borealis AG | Process for producing alpha-olefin polymers in a multistage polymerization process |
| EP3915782B1 (en) | 2020-05-25 | 2024-07-17 | Borealis AG | Layer element suitable as integrated backsheet element of a photovoltaic module |
| BR112022023508A2 (pt) | 2020-05-25 | 2022-12-20 | Borealis Ag | Elemento de camada adequado como chapa posterior integrada para um módulo fotovoltaico bifacial |
| EP4144435A1 (en) | 2021-09-01 | 2023-03-08 | Borealis AG | Gas phase polymerization process with improved gas recycling |
| EP4389783A1 (en) | 2022-12-20 | 2024-06-26 | Borealis AG | Catalyst transition process |
| EP4389776A1 (en) | 2022-12-20 | 2024-06-26 | Borealis AG | Process |
| EP4389820A1 (en) | 2022-12-21 | 2024-06-26 | Borealis AG | Polypropylene random copolymer compositions with improved impact resistance for pipe applications |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA920299A (en) * | 1968-08-01 | 1973-01-30 | Mitsui Petrochemical Industries | Process for the polymerization and/or copolymerization of olefins with use of ziegler-type catalytsts supported on carrier |
| BE765033R (fr) * | 1970-04-06 | 1971-09-30 | Inst Francais Du Petrole | Nouveau procede d'hydrogenation et catalyseurs d'hydrogenation correspondants |
| US3953414A (en) * | 1972-09-13 | 1976-04-27 | Montecatini Edison S.P.A., | Catalysts for the polymerization of olefins to spherically shaped polymers |
| GB1527736A (en) * | 1975-11-20 | 1978-10-11 | Mitsui Petrochemical Ind | Process for preparing a polymerisation catalyst component |
| SE7613662L (sv) * | 1975-12-10 | 1977-06-11 | Mitsui Petrochemical Ind | Polymerisation av alfa-olefiner |
| JPS52104593A (en) * | 1976-03-01 | 1977-09-02 | Mitsui Petrochem Ind Ltd | Polymerization of olefins |
| US4180636A (en) * | 1976-06-24 | 1979-12-25 | Showa Denko Kabushiki Kaisha | Process for polymerizing or co-polymerizing propylene |
| US4130503A (en) * | 1977-12-23 | 1978-12-19 | Phillips Petroleum Company | Phosphite in MgX2 supported TiX3 /AlCl3 catalyst system |
| US4243552A (en) * | 1978-12-11 | 1981-01-06 | Phillips Petroleum Company | Polymerization catalyst and process |
-
1980
- 1980-06-27 US US06/163,615 patent/US4347160A/en not_active Expired - Lifetime
-
1981
- 1981-05-07 CA CA000377072A patent/CA1159043A/en not_active Expired
- 1981-05-07 AU AU70248/81A patent/AU543559B2/en not_active Expired - Fee Related
- 1981-05-20 ZA ZA00813374A patent/ZA813374B/xx unknown
- 1981-05-29 EP EP81302378A patent/EP0043185B1/en not_active Expired
- 1981-05-29 DE DE8181302378T patent/DE3166568D1/de not_active Expired
- 1981-05-29 AT AT81302378T patent/ATE9807T1/de not_active IP Right Cessation
- 1981-06-05 JP JP8675781A patent/JPS5731909A/ja active Pending
- 1981-06-09 KR KR1019810002061A patent/KR840001736B1/ko active IP Right Grant
- 1981-06-22 PT PT73235A patent/PT73235B/pt unknown
- 1981-06-22 YU YU01562/81A patent/YU156281A/xx unknown
- 1981-06-23 BR BR8103956A patent/BR8103956A/pt unknown
- 1981-06-24 DD DD81231100A patent/DD159880A5/de unknown
- 1981-06-26 ES ES503428A patent/ES503428A0/es active Granted
- 1981-06-26 NO NO812190A patent/NO812190L/no unknown
- 1981-06-26 RO RO104703A patent/RO82539B/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3166568D1 (en) | 1984-11-15 |
| ES8203638A1 (es) | 1982-04-16 |
| RO82539B (ro) | 1984-05-30 |
| JPS5731909A (en) | 1982-02-20 |
| CA1159043A (en) | 1983-12-20 |
| RO82539A (ro) | 1984-04-12 |
| ATE9807T1 (de) | 1984-10-15 |
| ZA813374B (en) | 1982-06-30 |
| PT73235B (en) | 1982-07-22 |
| DD159880A5 (de) | 1983-04-13 |
| AU7024881A (en) | 1982-01-07 |
| AU543559B2 (en) | 1985-04-26 |
| PT73235A (en) | 1981-07-01 |
| ES503428A0 (es) | 1982-04-16 |
| US4347160A (en) | 1982-08-31 |
| BR8103956A (pt) | 1982-03-09 |
| EP0043185B1 (en) | 1984-10-10 |
| KR840001736B1 (ko) | 1984-10-18 |
| KR830006338A (ko) | 1983-09-24 |
| YU156281A (en) | 1983-12-31 |
| EP0043185A1 (en) | 1982-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO812190L (no) | Katalysator. | |
| US4435550A (en) | Method for polymerizing α-olefin | |
| US4393182A (en) | Olefin polymerization process with novel supported titanium catalyst compositions | |
| EP1572756B1 (en) | Catalyst components for the polymerization of olefins | |
| EP0206817B1 (en) | Catalyst for producing olefin polymers and polymerization process using the catalyst | |
| JPH0216324B2 (es) | ||
| NO812459L (no) | Katalysatorsystem for anvendelse ved polymerisering av alfa-olefiner. | |
| US4581426A (en) | Process for polymerization of α-olefins and catalysts therefor | |
| EP0026027B1 (en) | Method for polymerizing alpha olefin | |
| US4250287A (en) | 1-Olefin polymerization catalyst | |
| EP0040711B1 (en) | Titanium halide catalyst for polymerization | |
| EP1511780B1 (en) | Ziegler natta catalyst components for the polymerization of olefins | |
| US4220745A (en) | Process for polymerization of α-olefins | |
| US4365048A (en) | Method for polymerizing α-olefin | |
| JPS6247446B2 (es) | ||
| JPS6119644B2 (es) | ||
| US20040152590A1 (en) | Ziegler natra catalyst for the polymerization of olefins | |
| US5258474A (en) | Process for producing α-olefin polymer | |
| US4349483A (en) | Process for the preparation of aluminum trihydrocarbyls | |
| US4680350A (en) | Purified catalyst support | |
| JPH0680092B2 (ja) | オレフイン重合用触媒成分の調製法 | |
| JP3496999B2 (ja) | オレフィン重合用固体触媒成分の製造方法 | |
| KR930001065B1 (ko) | α-올레핀의 단독 중합체 또는 공중합체의 제조방법 | |
| CA1095885A (en) | Magnesium reducing agent for producing titanium trihalide catalyst component | |
| JPH07109305A (ja) | エチレン系重合体の製造方法 |