NO174494B - Fremgangsmaate for anvendelse av viskoese hydrokarboner som brennbare, forforstoevede brennstoffer - Google Patents
Fremgangsmaate for anvendelse av viskoese hydrokarboner som brennbare, forforstoevede brennstoffer Download PDFInfo
- Publication number
- NO174494B NO174494B NO852637A NO852637A NO174494B NO 174494 B NO174494 B NO 174494B NO 852637 A NO852637 A NO 852637A NO 852637 A NO852637 A NO 852637A NO 174494 B NO174494 B NO 174494B
- Authority
- NO
- Norway
- Prior art keywords
- oil
- hydrocarbon
- water
- surfactant
- approx
- Prior art date
Links
- 239000000446 fuel Substances 0.000 title claims description 128
- 150000002430 hydrocarbons Chemical class 0.000 title claims description 127
- 229930195733 hydrocarbon Natural products 0.000 title claims description 126
- 238000000034 method Methods 0.000 title claims description 71
- 239000004094 surface-active agent Substances 0.000 claims description 208
- 239000003921 oil Substances 0.000 claims description 144
- 239000000839 emulsion Substances 0.000 claims description 142
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 138
- 239000010779 crude oil Substances 0.000 claims description 86
- 239000004215 Carbon black (E152) Substances 0.000 claims description 75
- 239000000203 mixture Substances 0.000 claims description 39
- 239000008346 aqueous phase Substances 0.000 claims description 37
- 230000005484 gravity Effects 0.000 claims description 34
- 239000012188 paraffin wax Substances 0.000 claims description 33
- 239000008186 active pharmaceutical agent Substances 0.000 claims description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 24
- 150000001491 aromatic compounds Chemical class 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 21
- -1 ethoxylated alcohol sulfate Chemical class 0.000 claims description 21
- 125000000129 anionic group Chemical group 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 239000010763 heavy fuel oil Substances 0.000 claims description 11
- 239000011575 calcium Chemical group 0.000 claims description 10
- 239000011734 sodium Chemical group 0.000 claims description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 9
- 238000004806 packaging method and process Methods 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 8
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical group OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 8
- 229910052791 calcium Inorganic materials 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- 150000001298 alcohols Chemical class 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 239000011591 potassium Chemical group 0.000 claims description 7
- 229910052700 potassium Inorganic materials 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 5
- 159000000000 sodium salts Chemical class 0.000 claims description 5
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical class CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical class CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 229920000847 nonoxynol Polymers 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 125000005023 xylyl group Chemical group 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims 1
- 239000000126 substance Substances 0.000 description 46
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 39
- 238000002485 combustion reaction Methods 0.000 description 34
- 239000007956 bioemulsifier Substances 0.000 description 33
- 239000012071 phase Substances 0.000 description 32
- 235000010633 broth Nutrition 0.000 description 26
- 238000002474 experimental method Methods 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 238000004519 manufacturing process Methods 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 239000000463 material Substances 0.000 description 21
- 230000002829 reductive effect Effects 0.000 description 21
- 241000588624 Acinetobacter calcoaceticus Species 0.000 description 20
- 239000000295 fuel oil Substances 0.000 description 18
- 239000002736 nonionic surfactant Substances 0.000 description 17
- 239000002002 slurry Substances 0.000 description 16
- 230000000694 effects Effects 0.000 description 15
- 238000002156 mixing Methods 0.000 description 15
- 230000009467 reduction Effects 0.000 description 14
- 239000003381 stabilizer Substances 0.000 description 14
- 102000004190 Enzymes Human genes 0.000 description 13
- 108090000790 Enzymes Proteins 0.000 description 13
- 239000003945 anionic surfactant Substances 0.000 description 13
- 239000010426 asphalt Substances 0.000 description 13
- 230000000813 microbial effect Effects 0.000 description 13
- 239000010747 number 6 fuel oil Substances 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 13
- 239000000523 sample Substances 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- RUVPEAOBARYHEY-ZUEOXWNTSA-N O[C@@H]1C(O[C@@H]([C@H]([C@@H]1O)O)C)OC(CC(=O)OCC)CCCCCCCCCCCCCCC Chemical compound O[C@@H]1C(O[C@@H]([C@H]([C@@H]1O)O)C)OC(CC(=O)OCC)CCCCCCCCCCCCCCC RUVPEAOBARYHEY-ZUEOXWNTSA-N 0.000 description 12
- 239000008367 deionised water Substances 0.000 description 12
- 229910021641 deionized water Inorganic materials 0.000 description 12
- 235000014113 dietary fatty acids Nutrition 0.000 description 12
- 239000000194 fatty acid Substances 0.000 description 12
- 229930195729 fatty acid Natural products 0.000 description 12
- 238000000855 fermentation Methods 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 11
- 230000001804 emulsifying effect Effects 0.000 description 11
- 239000007788 liquid Substances 0.000 description 11
- 150000004665 fatty acids Chemical group 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 238000005086 pumping Methods 0.000 description 10
- 108091005804 Peptidases Proteins 0.000 description 9
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 9
- 229920001222 biopolymer Polymers 0.000 description 9
- 239000003876 biosurfactant Substances 0.000 description 9
- 230000015556 catabolic process Effects 0.000 description 9
- 238000004581 coalescence Methods 0.000 description 9
- 238000003860 storage Methods 0.000 description 9
- 239000011269 tar Substances 0.000 description 9
- 239000002158 endotoxin Substances 0.000 description 8
- 230000004151 fermentation Effects 0.000 description 8
- 229920006008 lipopolysaccharide Polymers 0.000 description 8
- MUCMKTPAZLSKTL-UHFFFAOYSA-N (3RS)-3-hydroxydodecanoic acid Natural products CCCCCCCCCC(O)CC(O)=O MUCMKTPAZLSKTL-UHFFFAOYSA-N 0.000 description 7
- 239000004365 Protease Substances 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 239000008399 tap water Substances 0.000 description 7
- 235000020679 tap water Nutrition 0.000 description 7
- 208000034723 Amelia Diseases 0.000 description 6
- 208000006586 Ectromelia Diseases 0.000 description 6
- 206010024503 Limb reduction defect Diseases 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- XMRUJYGYYCLRGJ-UHFFFAOYSA-N azanium;2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethyl sulfate Chemical compound [NH4+].CCCCCCCCCC1=CC=C(OCCOCCOCCOCCOS([O-])(=O)=O)C=C1 XMRUJYGYYCLRGJ-UHFFFAOYSA-N 0.000 description 6
- 238000006731 degradation reaction Methods 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- DCAYPVUWAIABOU-UHFFFAOYSA-N hexadecane Chemical compound CCCCCCCCCCCCCCCC DCAYPVUWAIABOU-UHFFFAOYSA-N 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 238000005292 vacuum distillation Methods 0.000 description 6
- 241000589291 Acinetobacter Species 0.000 description 5
- 229920001732 Lignosulfonate Polymers 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000000567 combustion gas Substances 0.000 description 5
- 238000004945 emulsification Methods 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 238000007711 solidification Methods 0.000 description 5
- 230000008023 solidification Effects 0.000 description 5
- 230000003068 static effect Effects 0.000 description 5
- 239000006228 supernatant Substances 0.000 description 5
- MSWZFWKMSRAUBD-GASJEMHNSA-N 2-amino-2-deoxy-D-galactopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O MSWZFWKMSRAUBD-GASJEMHNSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 238000010348 incorporation Methods 0.000 description 4
- 239000003350 kerosene Substances 0.000 description 4
- 238000005065 mining Methods 0.000 description 4
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 4
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 4
- 239000007764 o/w emulsion Substances 0.000 description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 4
- 230000000171 quenching effect Effects 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 3
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- YDZIJQXINJLRLL-UHFFFAOYSA-N alpha-hydroxydodecanoic acid Natural products CCCCCCCCCCC(O)C(O)=O YDZIJQXINJLRLL-UHFFFAOYSA-N 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 238000000889 atomisation Methods 0.000 description 3
- 230000001580 bacterial effect Effects 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003245 coal Substances 0.000 description 3
- 239000000571 coke Substances 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 239000000779 smoke Substances 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 238000004227 thermal cracking Methods 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- IEORSVTYLWZQJQ-UHFFFAOYSA-N 2-(2-nonylphenoxy)ethanol Chemical class CCCCCCCCCC1=CC=CC=C1OCCO IEORSVTYLWZQJQ-UHFFFAOYSA-N 0.000 description 2
- IDOQDZANRZQBTP-UHFFFAOYSA-N 2-[2-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol Chemical compound CC(C)(C)CC(C)(C)C1=CC=CC=C1OCCO IDOQDZANRZQBTP-UHFFFAOYSA-N 0.000 description 2
- PLFJWWUZKJKIPZ-UHFFFAOYSA-N 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol Chemical compound CC(C)CC(C)CC(CC(C)C)OCCOCCOCCO PLFJWWUZKJKIPZ-UHFFFAOYSA-N 0.000 description 2
- MWRSABPHNREIIX-UHFFFAOYSA-N 9,9-dimethyldecan-1-ol Chemical class CC(C)(C)CCCCCCCCO MWRSABPHNREIIX-UHFFFAOYSA-N 0.000 description 2
- 241000186063 Arthrobacter Species 0.000 description 2
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 2
- 241000186216 Corynebacterium Species 0.000 description 2
- 108050001049 Extracellular proteins Proteins 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 241000187654 Nocardia Species 0.000 description 2
- 229920004929 Triton X-114 Polymers 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004676 glycans Polymers 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 229920002113 octoxynol Polymers 0.000 description 2
- 125000005429 oxyalkyl group Chemical group 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000007670 refining Methods 0.000 description 2
- 230000000284 resting effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000005070 sampling Methods 0.000 description 2
- 150000003333 secondary alcohols Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000000194 supercritical-fluid extraction Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000009974 thixotropic effect Effects 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- HDTRYLNUVZCQOY-UHFFFAOYSA-N α-D-glucopyranosyl-α-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OC1C(O)C(O)C(O)C(CO)O1 HDTRYLNUVZCQOY-UHFFFAOYSA-N 0.000 description 1
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- AFCVWLYXQPVNJI-UHFFFAOYSA-N 12-aminododecyl benzenesulfonate Chemical class NCCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 AFCVWLYXQPVNJI-UHFFFAOYSA-N 0.000 description 1
- UTXPMECBRCEYCI-UHFFFAOYSA-N 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethanol Chemical compound CCCCCCCCCC1=CC=C(OCCOCCOCCOCCO)C=C1 UTXPMECBRCEYCI-UHFFFAOYSA-N 0.000 description 1
- HVCOBJNICQPDBP-UHFFFAOYSA-N 3-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxydecanoyloxy]decanoic acid;hydrate Chemical group O.OC1C(OC(CC(=O)OC(CCCCCCC)CC(O)=O)CCCCCCC)OC(C)C(O)C1OC1C(O)C(O)C(O)C(C)O1 HVCOBJNICQPDBP-UHFFFAOYSA-N 0.000 description 1
- QCKVUTCVXGLZQC-UHFFFAOYSA-N 3-hydroxy-1,2-dimethyl-1,2,3,9-tetrahydrocarbazol-4-one Chemical compound N1C2=CC=CC=C2C2=C1C(C)C(C)C(O)C2=O QCKVUTCVXGLZQC-UHFFFAOYSA-N 0.000 description 1
- 101000765274 Acinetobacter calcoaceticus Anthranilate synthase component 1 Proteins 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000826760 Barnea Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000186146 Brevibacterium Species 0.000 description 1
- 230000005653 Brownian motion process Effects 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- 229930186217 Glycolipid Natural products 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000186359 Mycobacterium Species 0.000 description 1
- 241000187481 Mycobacterium phlei Species 0.000 description 1
- 238000001016 Ostwald ripening Methods 0.000 description 1
- 235000008098 Oxalis acetosella Nutrition 0.000 description 1
- 241000364057 Peoria Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 102000001183 RAG-1 Human genes 0.000 description 1
- 108060006897 RAG1 Proteins 0.000 description 1
- HIWPGCMGAMJNRG-ACCAVRKYSA-N Sophorose Natural products O([C@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 HIWPGCMGAMJNRG-ACCAVRKYSA-N 0.000 description 1
- 102000005158 Subtilisins Human genes 0.000 description 1
- 108010056079 Subtilisins Proteins 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 229920002359 Tetronic® Polymers 0.000 description 1
- HDTRYLNUVZCQOY-WSWWMNSNSA-N Trehalose Natural products O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 HDTRYLNUVZCQOY-WSWWMNSNSA-N 0.000 description 1
- 244000126309 Trifolium dubium Species 0.000 description 1
- 229920004896 Triton X-405 Polymers 0.000 description 1
- 229920004898 Triton X-705 Polymers 0.000 description 1
- 241000364021 Tulsa Species 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 229940047662 ammonium xylenesulfonate Drugs 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- HIWPGCMGAMJNRG-UHFFFAOYSA-N beta-sophorose Natural products OC1C(O)C(CO)OC(O)C1OC1C(O)C(O)C(O)C(CO)O1 HIWPGCMGAMJNRG-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000005537 brownian motion Methods 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 238000004523 catalytic cracking Methods 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical class CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 238000002036 drum drying Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000002337 glycosamines Chemical class 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 229940055036 mycobacterium phlei Drugs 0.000 description 1
- HESSGHHCXGBPAJ-UHFFFAOYSA-N n-[3,5,6-trihydroxy-1-oxo-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-yl]acetamide Chemical compound CC(=O)NC(C=O)C(O)C(C(O)CO)OC1OC(CO)C(O)C(O)C1O HESSGHHCXGBPAJ-UHFFFAOYSA-N 0.000 description 1
- 239000003345 natural gas Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 239000010743 number 2 fuel oil Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000005298 paramagnetic effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 238000011020 pilot scale process Methods 0.000 description 1
- 239000011295 pitch Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 150000004804 polysaccharides Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 238000012807 shake-flask culturing Methods 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- UELAIMNOXLAYRW-UHFFFAOYSA-M sodium;1,4-dicyclohexyloxy-1,4-dioxobutane-2-sulfonate Chemical compound [Na+].C1CCCCC1OC(=O)C(S(=O)(=O)[O-])CC(=O)OC1CCCCC1 UELAIMNOXLAYRW-UHFFFAOYSA-M 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000003335 steric effect Effects 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000013595 supernatant sample Substances 0.000 description 1
- 230000002277 temperature effect Effects 0.000 description 1
- 150000003625 trehaloses Chemical class 0.000 description 1
- 238000000108 ultra-filtration Methods 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10L—FUELS NOT OTHERWISE PROVIDED FOR; NATURAL GAS; SYNTHETIC NATURAL GAS OBTAINED BY PROCESSES NOT COVERED BY SUBCLASSES C10G, C10K; LIQUEFIED PETROLEUM GAS; ADDING MATERIALS TO FUELS OR FIRES TO REDUCE SMOKE OR UNDESIRABLE DEPOSITS OR TO FACILITATE SOOT REMOVAL; FIRELIGHTERS
- C10L1/00—Liquid carbonaceous fuels
- C10L1/32—Liquid carbonaceous fuels consisting of coal-oil suspensions or aqueous emulsions or oil emulsions
- C10L1/328—Oil emulsions containing water or any other hydrophilic phase
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K23/00—Use of substances as emulsifying, wetting, dispersing, or foam-producing agents
- C09K23/017—Mixtures of compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S516/00—Colloid systems and wetting agents; subcombinations thereof; processes of
- Y10S516/01—Wetting, emulsifying, dispersing, or stabilizing agents
- Y10S516/06—Protein or carboxylic compound containing
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Engineering & Computer Science (AREA)
- Organic Chemistry (AREA)
- Materials Engineering (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Colloid Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Fats And Perfumes (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/547,892 US4618348A (en) | 1983-11-02 | 1983-11-02 | Combustion of viscous hydrocarbons |
| US06/653,808 US4684372A (en) | 1983-11-02 | 1984-09-24 | Combustion of viscous hydrocarbons |
| PCT/US1984/001669 WO1985001889A1 (en) | 1983-11-02 | 1984-10-15 | Bioemulsifier-stabilized hydrocarbosols |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO852637L NO852637L (no) | 1985-07-01 |
| NO174494B true NO174494B (no) | 1994-02-07 |
| NO174494C NO174494C (es) | 1994-05-18 |
Family
ID=27068688
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO852637A NO174494B (no) | 1983-11-02 | 1985-07-01 | Fremgangsmaate for anvendelse av viskoese hydrokarboner som brennbare, forforstoevede brennstoffer |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4684372A (es) |
| EP (1) | EP0144257B1 (es) |
| JP (2) | JP2543495B2 (es) |
| AU (1) | AU574403B2 (es) |
| CA (1) | CA1340969C (es) |
| DE (1) | DE3485895T2 (es) |
| DK (1) | DK171344B1 (es) |
| ES (2) | ES8605569A1 (es) |
| FI (1) | FI852614A0 (es) |
| MX (1) | MX160502A (es) |
| NO (1) | NO174494B (es) |
| WO (1) | WO1985001889A1 (es) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4757833A (en) * | 1985-10-24 | 1988-07-19 | Pfizer Inc. | Method for improving production of viscous crude oil |
| DE3634644A1 (de) * | 1985-10-24 | 1987-04-30 | Pfizer | Verfahren zur verbesserung der foerderung von viskosem rohoel |
| US5013462A (en) * | 1985-10-24 | 1991-05-07 | Pfizer Inc. | Method for improving production of viscous crude oil |
| IL76981A (en) * | 1985-11-07 | 1989-02-28 | Univ Ramot | Bacterially produced hetero polysaccharide dispersants for inorganic minerals in aqueous medium and their preparation |
| US4795478A (en) * | 1986-06-17 | 1989-01-03 | Intevep, S.A. | Viscous hydrocarbon-in-water emulsions |
| US5263848A (en) * | 1986-11-24 | 1993-11-23 | Canadian Occidental Petroleum, Ltd. | Preparation of oil-in-aqueous phase emulsion and removing contaminants by burning |
| US5000872A (en) * | 1987-10-27 | 1991-03-19 | Canadian Occidental Petroleum, Ltd. | Surfactant requirements for the low-shear formation of water continuous emulsions from heavy crude oil |
| US4978365A (en) * | 1986-11-24 | 1990-12-18 | Canadian Occidental Petroleum Ltd. | Preparation of improved stable crude oil transport emulsions |
| US4983319A (en) * | 1986-11-24 | 1991-01-08 | Canadian Occidental Petroleum Ltd. | Preparation of low-viscosity improved stable crude oil transport emulsions |
| US5083613A (en) * | 1989-02-14 | 1992-01-28 | Canadian Occidental Petroleum, Ltd. | Process for producing bitumen |
| US5156652A (en) * | 1986-12-05 | 1992-10-20 | Canadian Occidental Petroleum Ltd. | Low-temperature pipeline emulsion transportation enhancement |
| US4952315A (en) * | 1987-05-05 | 1990-08-28 | Nabil Saab | Method, system and emulsifier substance for treatment of materials containing harmful substances |
| GB2231061B (en) * | 1987-09-11 | 1992-05-20 | Intevep Sa | Viscous hydrocarbon-in-water emulsions |
| US4966235A (en) * | 1988-07-14 | 1990-10-30 | Canadian Occidental Petroleum Ltd. | In situ application of high temperature resistant surfactants to produce water continuous emulsions for improved crude recovery |
| DE4041005A1 (de) * | 1990-12-20 | 1992-06-25 | Heino Stache | Verfahren zur herstellung einer emulsion aus dieselkraftstoff und wasser und vorrichtung zur herstellung einer emulsion |
| US5834539A (en) * | 1991-10-15 | 1998-11-10 | Krivohlavek; Dennis | Multiple phase emulsions in burner fuel, combustion, emulsion and explosives applications |
| US5263850A (en) * | 1992-02-05 | 1993-11-23 | Boston Thermal Energy Corporation | Emission control system for an oil-fired combustion process |
| JP2648094B2 (ja) * | 1994-07-11 | 1997-08-27 | 花王株式会社 | 超重質油エマルション燃料 |
| JP2710266B2 (ja) * | 1994-07-11 | 1998-02-10 | 花王株式会社 | 超重質油エマルション燃料 |
| GB9517646D0 (en) | 1995-08-30 | 1995-11-01 | Quadrise Ltd | Emulsion fuels and their use in gas turbines |
| US5725609A (en) * | 1996-02-09 | 1998-03-10 | Intevep, S.A. | Water in viscous hydrocarbon emulsion combustible fuel for diesel engines and process for making same |
| US6080211A (en) | 1999-02-19 | 2000-06-27 | Igen, Inc. | Lipid vesicle-based fuel additives and liquid energy sources containing same |
| ITMI20011496A1 (it) * | 2001-07-13 | 2003-01-13 | Enitecnologie Spa | Composizioni bifasiche disperdenti per prodotti oleosi |
| FR2852666B1 (fr) * | 2003-03-17 | 2005-09-09 | Methode d'optimisation du transport par pipeline de bruts lourds | |
| JP2005264423A (ja) * | 2004-02-20 | 2005-09-29 | Kiyoto Dezuki | カーペットの製造装置 |
| ATE491861T1 (de) | 2006-02-07 | 2011-01-15 | Diamond Qc Technologies Inc | Mit kohlendioxid angereicherte rauchgaseinspritzung zur kohlenwasserstoffgewinnung |
| KR20100105611A (ko) * | 2007-11-28 | 2010-09-29 | 사우디 아라비안 오일 컴퍼니 | 고온 가압수에 의한 고도 밀납 원유 업그레이드 공정 |
| US7779914B2 (en) * | 2008-12-10 | 2010-08-24 | Conocophillips Company | Process for producing heavy oil |
| US20110277376A1 (en) * | 2009-02-04 | 2011-11-17 | Archer-Daniels-Midland Company | Incorporation of biologically derived carbon into petroleum products |
| US8394260B2 (en) | 2009-12-21 | 2013-03-12 | Saudi Arabian Oil Company | Petroleum upgrading process |
| US9382485B2 (en) | 2010-09-14 | 2016-07-05 | Saudi Arabian Oil Company | Petroleum upgrading process |
| EP3795652A1 (en) | 2018-05-17 | 2021-03-24 | FMT Serviços Indústria e Comércio Ltda | Viscosity-modifying, demulsifying and flow-improving composition, method for the production thereof, uses of same, and method for increasing production in heavy and extra-heavy oil wells |
| AU2021218014A1 (en) * | 2021-08-16 | 2023-03-02 | The University Of Queensland | Apparatus and method for forming emulsions for use in flotation |
Family Cites Families (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2447475A (en) * | 1945-11-29 | 1948-08-17 | Monsanto Chemicals | Emulsifiable oils |
| GB801119A (en) * | 1954-02-26 | 1958-09-10 | Unilever Ltd | Improvements in or relating to emulsions |
| US3006354A (en) * | 1956-03-15 | 1961-10-31 | Shell Oil Co | Method for transporting liquids through pipelines |
| NL111349C (es) * | 1958-01-14 | |||
| US3067038A (en) * | 1960-03-01 | 1962-12-04 | Keico Company | Edible compositions comprising oil-in-water emulsions |
| US3487844A (en) * | 1966-01-03 | 1970-01-06 | Chevron Res | Pipelining crude oil |
| US3352109A (en) * | 1966-05-04 | 1967-11-14 | Petrolite Corp | Hybrid thixotropic rocket and jet fuels comprising oil in water emulsions |
| US3490237A (en) * | 1966-07-18 | 1970-01-20 | Petrolite Corp | Thixotropic oil-in-water emulsion fuels |
| US3519006A (en) * | 1966-12-05 | 1970-07-07 | Ralph Simon | Pipelining oil/water mixtures |
| US3425429A (en) * | 1967-01-11 | 1969-02-04 | Chevron Res | Method of moving viscous crude oil through a pipeline |
| US3380531A (en) * | 1967-05-18 | 1968-04-30 | Chevron Res | Method of pumping viscous crude |
| US3490471A (en) * | 1967-12-22 | 1970-01-20 | Texaco Inc | Pipeline transportation of viscous hydrocarbons |
| US3630953A (en) * | 1968-01-02 | 1971-12-28 | Chevron Res | Tailored surfactants for use in forming oil-in-water emulsions of waxy crude oil |
| US3467195A (en) * | 1968-04-25 | 1969-09-16 | Chevron Res | Pumping viscous crude |
| US3876391A (en) * | 1969-02-28 | 1975-04-08 | Texaco Inc | Process of preparing novel micro emulsions |
| US4002435A (en) * | 1971-11-17 | 1977-01-11 | Wenzel Edward C | Clear and stable liquid fuel compositions for internal combustion engines |
| US3997398A (en) * | 1972-08-31 | 1976-12-14 | Canadian Patents And Development Limited | Emulsifying agents of microbiological origin |
| JPS5432444B2 (es) * | 1973-01-18 | 1979-10-15 | ||
| JPS5925121B2 (ja) * | 1973-03-10 | 1984-06-14 | 東洋ゴム工業株式会社 | 固状油の燃焼方法 |
| US3941692A (en) * | 1973-04-03 | 1976-03-02 | David Gutnick | Cleaning of cargo compartments |
| US3902869A (en) * | 1973-08-24 | 1975-09-02 | Svenska Utvecklings Ab | Fuel composition with increased octane number |
| US3958915A (en) * | 1974-02-15 | 1976-05-25 | The Toyo Rubber Industry Co., Ltd. | Method of burning emulsion oils |
| US3943954A (en) * | 1974-04-29 | 1976-03-16 | Texaco Inc. | Pipeline transportation of viscous hydrocarbons |
| US4084940A (en) * | 1974-12-23 | 1978-04-18 | Petrolite Corporation | Emulsions of enhanced ignitibility |
| US4158551A (en) * | 1975-01-27 | 1979-06-19 | Feuerman Arnold I | Gasoline-water emulsion |
| JPS51125961A (en) * | 1975-03-10 | 1976-11-02 | Sumitomo Electric Ind Ltd | Treating method of oil-containing emulsified waste water |
| US4046519A (en) * | 1975-10-31 | 1977-09-06 | Mobil Oil Corporation | Novel microemulsions |
| US4192767A (en) * | 1976-03-08 | 1980-03-11 | Texaco Inc. | Aqueous surfactant solutions and oil-in-water emulsions |
| US4134415A (en) * | 1976-03-08 | 1979-01-16 | Texaco Inc. | Pipeline transportation of heavy crude oil |
| US4108193A (en) * | 1976-03-08 | 1978-08-22 | Texaco Inc. | Pipeline method for transporting viscous hydrocarbons |
| JPS537072A (en) * | 1976-07-09 | 1978-01-23 | Hitachi Ltd | Touching sensor |
| JPS5341688A (en) * | 1976-09-29 | 1978-04-15 | Hitachi Ltd | Local station side change-over system of remote supervisory control system |
| JPS5345803A (en) * | 1976-10-04 | 1978-04-25 | Sumitomo Rubber Ind Ltd | Tire with puncture preventive layer |
| US4392865A (en) * | 1977-02-23 | 1983-07-12 | Lanko, Inc. | Hydrocarbon-water fuels, emulsions, slurries and other particulate mixtures |
| JPS5429529A (en) * | 1977-08-09 | 1979-03-05 | Toshiba Corp | Electromagnetic tablet unit |
| JPS5431405A (en) * | 1977-08-15 | 1979-03-08 | Lion Corp | Dispersing agent for coal in oil containing dialkylsulfosuccinic ester salt |
| JPS5431404A (en) * | 1977-08-15 | 1979-03-08 | Lion Corp | Dispersing agent for coal in oil containing alkylbenzenesulfonic acid |
| US4162143A (en) * | 1978-03-13 | 1979-07-24 | Ici Americas Inc. | Emulsifier blend and aqueous fuel oil emulsions |
| US4246920A (en) * | 1979-02-22 | 1981-01-27 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| JPS5534840A (en) * | 1978-08-31 | 1980-03-11 | Matsushita Electric Works Ltd | Mounting fixture for thin wall electric equipment |
| US4246919A (en) * | 1978-12-13 | 1981-01-27 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| US4249554A (en) * | 1979-01-26 | 1981-02-10 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| IT1119551B (it) * | 1979-01-30 | 1986-03-10 | Metalli Ind Spa | Procedimento per il trattamento di una emulsione esausta di olii in acqua utilizzata in una lavorazione industriale ed apparecchiatura atta a realizzare tale procedimento |
| JPS55106294A (en) * | 1979-02-08 | 1980-08-14 | Kao Corp | Pour point depressant for oil |
| US4239052A (en) * | 1979-02-21 | 1980-12-16 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| US4311830A (en) * | 1979-02-22 | 1982-01-19 | Petroleum Fermentations N.V. | Apo-α-emulsans |
| US4276094A (en) * | 1979-02-22 | 1981-06-30 | Biotechnologie Aktiengesellschaft Fur Emulsan | Cleaning oil-contaminated vessels with α-emulsans |
| US4311829A (en) * | 1979-02-22 | 1982-01-19 | Petroleum Fermentations N.V. | Apo-β-emulsans |
| US4234689A (en) * | 1979-02-22 | 1980-11-18 | Biotechnologie Aktiengesellschaft Fur Emulsan | Production of α-emulsans |
| US4311832A (en) * | 1979-02-22 | 1982-01-19 | Petroleum Fermentations N.V. | Proemulsans |
| US4230801A (en) * | 1979-02-22 | 1980-10-28 | Biotechnologie Aktiengesellschaft Fur Emulsan | Production of α-emulsans |
| CA1149302A (en) * | 1979-02-22 | 1983-07-05 | David L. Gutnick | Emulsans |
| US4311831A (en) * | 1979-02-22 | 1982-01-19 | Petroleum Fermentations N.V. | Apo-ψ-emulsans |
| US4395354A (en) * | 1979-02-22 | 1983-07-26 | Petroleum Fermentations N.V. | αEmulsans |
| ZA80912B (en) * | 1979-02-22 | 1981-03-25 | Biotech Ag Emulsan | Emulsans |
| US4265264A (en) * | 1979-04-30 | 1981-05-05 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| SE447392B (sv) * | 1979-06-29 | 1986-11-10 | Berol Kemi Ab | Emulsion av vatten i en mineralolja samt emulgeringsmedlet |
| US4285356A (en) * | 1979-10-12 | 1981-08-25 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| US4287902A (en) * | 1979-11-05 | 1981-09-08 | Conoco, Inc. | Method of transporting viscous hydrocarbons |
| EP0041770A3 (en) * | 1980-05-23 | 1984-07-11 | Texas Instruments Incorporated | A programmable read-only-memory element and method of fabrication thereof |
| US4333488A (en) * | 1980-09-08 | 1982-06-08 | Conoco Inc. | Method of transporting viscous hydrocarbons |
| US4477258A (en) * | 1980-10-30 | 1984-10-16 | Labofina, S.A. | Diesel fuel compositions and process for their production |
| US4445908A (en) * | 1980-12-01 | 1984-05-01 | The United States Of America As Represented By The United States Department Of Energy | Extracting alcohols from aqueous solutions |
| US4382802A (en) * | 1981-06-02 | 1983-05-10 | K-V Pharmaceutical Company | Fire starters |
| JPS59185287A (ja) * | 1983-04-05 | 1984-10-20 | ライオン株式会社 | 石油回収用ミセル溶液 |
-
1984
- 1984-09-24 US US06/653,808 patent/US4684372A/en not_active Expired - Lifetime
- 1984-10-15 WO PCT/US1984/001669 patent/WO1985001889A1/en active Application Filing
- 1984-10-15 JP JP59504013A patent/JP2543495B2/ja not_active Expired - Lifetime
- 1984-10-15 AU AU35565/84A patent/AU574403B2/en not_active Expired
- 1984-10-17 CA CA000465601A patent/CA1340969C/en not_active Expired - Fee Related
- 1984-10-29 DE DE8484402168T patent/DE3485895T2/de not_active Expired - Lifetime
- 1984-10-29 EP EP84402168A patent/EP0144257B1/en not_active Expired - Lifetime
- 1984-10-31 ES ES537272A patent/ES8605569A1/es not_active Expired
- 1984-11-05 MX MX203286A patent/MX160502A/es unknown
-
1985
- 1985-05-07 ES ES542876A patent/ES8603281A1/es not_active Expired
- 1985-07-01 NO NO852637A patent/NO174494B/no not_active IP Right Cessation
- 1985-07-01 DK DK298385A patent/DK171344B1/da not_active IP Right Cessation
- 1985-07-02 FI FI852614A patent/FI852614A0/fi not_active Application Discontinuation
-
1992
- 1992-02-26 JP JP4039778A patent/JP2644411B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0144257A3 (en) | 1986-02-19 |
| AU3556584A (en) | 1985-05-22 |
| DE3485895D1 (de) | 1992-10-01 |
| FI852614L (fi) | 1985-07-02 |
| ES8605569A1 (es) | 1986-03-16 |
| FI852614A0 (fi) | 1985-07-02 |
| JP2543495B2 (ja) | 1996-10-16 |
| ES542876A0 (es) | 1985-12-16 |
| DE3485895T2 (de) | 1993-04-01 |
| AU574403B2 (en) | 1988-07-07 |
| US4684372B1 (es) | 1990-05-01 |
| WO1985001889A1 (en) | 1985-05-09 |
| NO852637L (no) | 1985-07-01 |
| ES8603281A1 (es) | 1985-12-16 |
| MX160502A (es) | 1990-03-12 |
| US4684372A (en) | 1987-08-04 |
| DK171344B1 (da) | 1996-09-16 |
| ES537272A0 (es) | 1986-03-16 |
| NO174494C (es) | 1994-05-18 |
| EP0144257A2 (en) | 1985-06-12 |
| JPS61501754A (ja) | 1986-08-21 |
| CA1340969C (en) | 2000-04-25 |
| JPH05230479A (ja) | 1993-09-07 |
| DK298385D0 (da) | 1985-07-01 |
| JP2644411B2 (ja) | 1997-08-25 |
| EP0144257B1 (en) | 1992-08-26 |
| DK298385A (da) | 1985-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO174494B (no) | Fremgangsmaate for anvendelse av viskoese hydrokarboner som brennbare, forforstoevede brennstoffer | |
| EP0243452B1 (en) | Method for reducing emissions utilizing pre-atomized fuels | |
| US4618348A (en) | Combustion of viscous hydrocarbons | |
| US4943390A (en) | Bioemulsifier-stabilized hydrocarbosols | |
| US4793826A (en) | Bioemulsifier-stabilized hydrocarbosols | |
| US4886519A (en) | Method for reducing sox emissions during the combustion of sulfur-containing combustible compositions | |
| US4821757A (en) | Bioemulsifier stabilized hydrocarbosols | |
| US5834539A (en) | Multiple phase emulsions in burner fuel, combustion, emulsion and explosives applications | |
| CA2243054C (en) | Multiple emulsion and method for preparing same | |
| US5505877A (en) | Making multiple phase emulsion or gel | |
| US6113659A (en) | Fuel comprising a petroleum hydrocarbon in water colloidal dispersion | |
| EP0184433B1 (en) | Preparation of emulsions | |
| JP2892155B2 (ja) | 硫黄含有可燃性組成の燃焼中における酸化硫黄化合物放出の抑制方法 | |
| USRE36983E (en) | Pre-atomized fuels and process for producing same | |
| CA2159942A1 (en) | Stable heavy oil-in-water emulsions | |
| MXPA00009643A (es) | Proceso para mover residuos altamente viscosos que se derivan del procesado del petroleo | |
| GB2231059A (en) | Hydrocarbon-in-water emulsions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM1K | Lapsed by not paying the annual fees |