NO133274B - - Google Patents
Download PDFInfo
- Publication number
- NO133274B NO133274B NO1683/70A NO168370A NO133274B NO 133274 B NO133274 B NO 133274B NO 1683/70 A NO1683/70 A NO 1683/70A NO 168370 A NO168370 A NO 168370A NO 133274 B NO133274 B NO 133274B
- Authority
- NO
- Norway
- Prior art keywords
- dimethyl
- ester
- methyl
- dicarboxylic acid
- pyridine
- Prior art date
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 35
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 239000013078 crystal Substances 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- -1 amine salts Chemical class 0.000 description 21
- GKESTCSMPAVCFO-UHFFFAOYSA-N NC.ClO Chemical compound NC.ClO GKESTCSMPAVCFO-UHFFFAOYSA-N 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 6
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 239000000370 acceptor Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 1
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 1
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 description 1
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 1
- BDCLDNALSPBWPQ-UHFFFAOYSA-N 3-oxohexanoic acid Chemical compound CCCC(=O)CC(O)=O BDCLDNALSPBWPQ-UHFFFAOYSA-N 0.000 description 1
- YGCZTXZTJXYWCO-UHFFFAOYSA-N 3-phenylpropanal Chemical compound O=CCCC1=CC=CC=C1 YGCZTXZTJXYWCO-UHFFFAOYSA-N 0.000 description 1
- KRPXKIUVLKBXSJ-UHFFFAOYSA-N 4-(4-methoxycarbonylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylic acid dimethyl ester Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC=C(C(=O)OC)C=C1 KRPXKIUVLKBXSJ-UHFFFAOYSA-N 0.000 description 1
- HETBKLHJEWXWBM-UHFFFAOYSA-N 4-chloro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(C=O)=CC=C1Cl HETBKLHJEWXWBM-UHFFFAOYSA-N 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- MUVOTCAWGGPMNO-UHFFFAOYSA-N COC(=O)C1=C(N(C(=C(C1C1=CC=C(C=C1)N(C)C)C(=O)OC)C)C)C Chemical compound COC(=O)C1=C(N(C(=C(C1C1=CC=C(C=C1)N(C)C)C(=O)OC)C)C)C MUVOTCAWGGPMNO-UHFFFAOYSA-N 0.000 description 1
- PFHRATGNBQDTHC-UHFFFAOYSA-N ClO.C(C)OC(CN)=O Chemical compound ClO.C(C)OC(CN)=O PFHRATGNBQDTHC-UHFFFAOYSA-N 0.000 description 1
- ZDQWESQEGGJUCH-UHFFFAOYSA-N Diisopropyl adipate Chemical compound CC(C)OC(=O)CCCCC(=O)OC(C)C ZDQWESQEGGJUCH-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 1
- 229960002327 chloral hydrate Drugs 0.000 description 1
- 229940117916 cinnamic aldehyde Drugs 0.000 description 1
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- ULYPIXORALMQAH-UHFFFAOYSA-N diethyl 1,2,6-trimethyl-4-phenyl-4h-pyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)N(C)C(C)=C(C(=O)OCC)C1C1=CC=CC=C1 ULYPIXORALMQAH-UHFFFAOYSA-N 0.000 description 1
- URFHQGGTDBEBGM-UHFFFAOYSA-N diethyl 1,2,6-trimethyl-4-propan-2-yl-4H-pyridine-3,5-dicarboxylate Chemical compound C(C)OC(=O)C1=C(N(C(=C(C1C(C)C)C(=O)OCC)C)C)C URFHQGGTDBEBGM-UHFFFAOYSA-N 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- OIXJTRWGTCWVGH-UHFFFAOYSA-N dimethyl 1,2,6-trimethyl-4-(2-phenylethenyl)-4H-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(N(C(=C(C1C=CC1=CC=CC=C1)C(=O)OC)C)C)C OIXJTRWGTCWVGH-UHFFFAOYSA-N 0.000 description 1
- KTROMQYPJIPJJD-UHFFFAOYSA-N dimethyl 1,2,6-trimethyl-4-(4-nitrophenyl)-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC=C([N+]([O-])=O)C=C1 KTROMQYPJIPJJD-UHFFFAOYSA-N 0.000 description 1
- KOTIEURILWQMQP-UHFFFAOYSA-N dimethyl 1,2,6-trimethyl-4-[2-(trifluoromethyl)phenyl]-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC=CC=C1C(F)(F)F KOTIEURILWQMQP-UHFFFAOYSA-N 0.000 description 1
- LSZKWMDDOOFGAX-UHFFFAOYSA-N dimethyl 1,2,6-trimethyl-4-[3-(trifluoromethyl)phenyl]-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC=CC(C(F)(F)F)=C1 LSZKWMDDOOFGAX-UHFFFAOYSA-N 0.000 description 1
- KPLOFHGCRPXDTN-UHFFFAOYSA-N dimethyl 4-(2-chloro-5-nitrophenyl)-1,2,6-trimethyl-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC([N+]([O-])=O)=CC=C1Cl KPLOFHGCRPXDTN-UHFFFAOYSA-N 0.000 description 1
- PNRGSPPYQYPAGN-UHFFFAOYSA-N dimethyl 4-(4-chloro-3-nitrophenyl)-1,2,6-trimethyl-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC=C(Cl)C([N+]([O-])=O)=C1 PNRGSPPYQYPAGN-UHFFFAOYSA-N 0.000 description 1
- AXUGLKBNJFHZDR-UHFFFAOYSA-N dimethyl 4-(4-methoxyphenyl)-1,2,6-trimethyl-4h-pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC)C1C1=CC=C(OC)C=C1 AXUGLKBNJFHZDR-UHFFFAOYSA-N 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000003956 methylamines Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE1923990A DE1923990C3 (de) | 1969-05-10 | 1969-05-10 | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern |
Publications (2)
Publication Number | Publication Date |
---|---|
NO133274B true NO133274B (en:Method) | 1975-12-29 |
NO133274C NO133274C (en:Method) | 1976-04-07 |
Family
ID=5733869
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO1683/70A NO133274C (en:Method) | 1969-05-10 | 1970-05-04 |
Country Status (15)
Country | Link |
---|---|
US (1) | US3773773A (en:Method) |
JP (1) | JPS4935277B1 (en:Method) |
AT (1) | AT299200B (en:Method) |
BE (1) | BE750139A (en:Method) |
BR (1) | BR6915159D0 (en:Method) |
DE (1) | DE1923990C3 (en:Method) |
DK (1) | DK136246B (en:Method) |
FI (1) | FI52078C (en:Method) |
FR (1) | FR2051515B1 (en:Method) |
GB (1) | GB1305793A (en:Method) |
IL (1) | IL34304A (en:Method) |
NL (1) | NL7006628A (en:Method) |
NO (1) | NO133274C (en:Method) |
SE (1) | SE376915B (en:Method) |
YU (1) | YU33268B (en:Method) |
Families Citing this family (53)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE1963188A1 (de) * | 1969-12-17 | 1971-06-24 | Bayer Ag | Neue Cyanphenyl-1,4-dihydropyridinderivate |
DE2117572C3 (de) * | 1971-04-10 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin ^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
US4021434A (en) * | 1972-01-22 | 1977-05-03 | Yamanouchi Pharmaceutical Co., Ltd. | Sodium β-[2,6-dimethyl-3,5-bis(ethoxycarbonyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-1-yl]ethyl sulfate |
GB1430961A (en) * | 1972-01-22 | 1976-04-07 | Yamanouchi Pharma Co Ltd | 1-substituted-1,4-dihyddrypyridine derivatives |
US3988458A (en) * | 1972-03-06 | 1976-10-26 | Bayer Aktiengesellschaft | Bicyclic derivatives of 1,4-dihydropyridine 3,5-carboxylic acid esters |
US3887558A (en) * | 1972-03-06 | 1975-06-03 | Bayer Ag | Process for producing 2,6-diamino -1,4- dihydro-3,5-pyridine-dicarboxylates and derivatives thereof |
US3857849A (en) * | 1973-02-28 | 1974-12-31 | Bayer Ag | 2-amino-1,4-dihydropyridine derivatives |
US3992545A (en) * | 1972-03-06 | 1976-11-16 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives in pharmaceutical compositions |
DD106832A5 (en:Method) * | 1972-03-06 | 1974-07-05 | ||
US3939171A (en) * | 1972-03-06 | 1976-02-17 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
US3935223A (en) * | 1972-03-06 | 1976-01-27 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
US3933834A (en) * | 1972-03-06 | 1976-01-20 | Bayer Aktiengesellschaft | Unsymmetrical esters of N-substituted 1,4-dihydropyridine 3,5-dicarboxylic acid |
US3957998A (en) * | 1972-03-06 | 1976-05-18 | Bayer Aktiengesellschaft | Use of 2,6-diamino-4-substituted-1,4-dihydropyridine-3,5-dicarboxylic acid esters for effecting coronary vessel dilation and treating hypertension |
US3985886A (en) * | 1972-03-06 | 1976-10-12 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives and process for their preparation |
US3917620A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
DE2218644C3 (de) * | 1972-04-18 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | Basische Ester von 1,4-Dihydropyridinen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
US3968117A (en) * | 1972-06-10 | 1976-07-06 | Bayer Aktiengesellschaft | 1,4-Dihydropyridines |
DE2228363A1 (de) * | 1972-06-10 | 1974-01-03 | Bayer Ag | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
DE2239815C2 (de) * | 1972-08-12 | 1983-02-10 | Bayer Ag, 5090 Leverkusen | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
US4136187A (en) * | 1972-08-12 | 1979-01-23 | Bayer Aktiengesellschaft | Antihypertensive 2-amino-4,5-dihydropyridine derivatives |
DE2242786A1 (de) * | 1972-08-31 | 1974-03-14 | Bayer Ag | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
DE2242787C2 (de) * | 1972-08-31 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | 4-Phenyl-6-amino-3,4-dihydropyridon-(2)-3,5-dicarbonsäure-diäthylesterderivate, ein Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
GB1409865A (en) * | 1973-02-13 | 1975-10-15 | Science Union & Cie | Dihydropyridines derivatives their preparation and pharmaceu tical compositions containing them |
FR2218107A1 (en) * | 1973-02-20 | 1974-09-13 | Yamanouchi Pharma Co Ltd | Amino alkyl 2,6-dialkyl-4-aryl-1,4 dihydropyridine-3, carboxylates - useful as cerebral vasodilators and musculotropic spasmolytic agents |
US4002762A (en) * | 1973-03-03 | 1977-01-11 | Bayer Aktiengesellschaft | 2-Amino-3,4-dihydropyridines used to effect coronary vessel dilation and treat hypertension |
GB1425729A (en) * | 1973-06-12 | 1976-02-18 | Smith Kline French Lab | 1,4-dihydropyridine compounds |
DE2335466A1 (de) * | 1973-07-12 | 1975-01-30 | Bayer Ag | Alkoxyalkyl-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
US4020178A (en) * | 1973-07-12 | 1977-04-26 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine esters used as coronary dilators and anti-hypertensives |
FR2320750A1 (fr) * | 1975-08-12 | 1977-03-11 | Hexachimie | Dihydro-1,4 pyridines et leur application therapeutique |
US4466972A (en) * | 1977-06-20 | 1984-08-21 | Sandoz Ltd. | Benzoxadiazoles and benzothiadiazoles, their preparation and pharmaceutical compositions containing them |
DE2738153A1 (de) * | 1977-08-24 | 1979-03-08 | Bayer Ag | 2-pyridyl-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
FR2405937A1 (fr) * | 1977-10-14 | 1979-05-11 | Labaz | Nouveaux derives de dihydropyridine, leur procede de preparation et leur application |
SU798099A1 (ru) * | 1978-03-06 | 1981-01-23 | Ордена Трудового Красного Знамениинститут Органического Синтезаан Латвийской Ccp | 1-Бензил-2,6-диметил-4-о-или-M-НиТРОфЕНил-3,5-диэТОКСиКАРбОНил- 1,4-дигидРОпиРидиНы, пРО Вл ющиЕКОРОНАРОдилАТиРующую АКТиВНОСТь |
DE3022030A1 (de) * | 1980-06-12 | 1981-12-17 | Bayer Ag, 5090 Leverkusen | 4-thiazol- bzw. 4-imidazol-substituierte, 1,4-dihydropyridine, verfahren zu deren herstellung sowie diese enthaltende arzneimittel |
US4321384A (en) * | 1981-02-27 | 1982-03-23 | American Home Products Corporation | Antihypertensive agents |
US4365063A (en) * | 1981-08-31 | 1982-12-21 | American Home Products Corporation | Antihypertensive agents |
NZ201395A (en) * | 1981-07-30 | 1987-02-20 | Bayer Ag | Pharmaceutical compositions containing 1,4-dihydropyridines and certain of these dihydropyridines |
JPS58159490A (ja) * | 1982-02-23 | 1983-09-21 | Nikken Kagaku Kk | 1,4−ジヒドロピリジン化合物 |
US4500532A (en) * | 1983-03-03 | 1985-02-19 | Usv Pharmaceutical Corporation | 1-(Substituted aminoalkyl)-1,4-dihydropyridines |
US4771057A (en) * | 1986-02-03 | 1988-09-13 | University Of Alberta | Reduced pyridyl derivatives with cardiovascular regulating properties |
EP0388482B1 (de) * | 1989-03-20 | 1994-07-06 | Siemens Aktiengesellschaft | Lichtempfindliches Gemisch |
US5258521A (en) * | 1989-07-26 | 1993-11-02 | Tosoh Corporation | Process of producing optically active propionic acid ester derivatives |
DE4011695A1 (de) * | 1990-04-11 | 1991-10-17 | Bayer Ag | Verwendung von n-alkylierten 1,4-dihydropyridindicarbonsaeureestern als arzneimittel, neue verbindungen und verfahren zu ihrer herstellung |
DE4125271A1 (de) * | 1991-07-31 | 1993-02-11 | Bayer Ag | Neue n-alkylierte 1,4-dihydropyridindicarbonsaeureester |
DE4133257A1 (de) * | 1991-10-08 | 1993-04-15 | Bayer Ag | N-methyl-nimodipin, verfahren zu seiner herstellung und seine verwendung als zerebraltherapeutikum |
DE4223867A1 (de) * | 1992-07-20 | 1994-01-27 | Bayer Ag | Spezieller 1,4-Dihydropyridin-3,5-dicarbonsäureester, Verfahren zu seiner Herstellung und seine pharmazeutische Verwendung |
DE4430094A1 (de) * | 1994-08-25 | 1996-02-29 | Bayer Ag | Verwendung von 3,5-Dicarbonsäureester-1,4-Dihydropyridinen als Arzneimittel |
JPH1039510A (ja) * | 1996-07-29 | 1998-02-13 | Nitto Denko Corp | ネガ型フォトレジスト組成物及びその利用 |
EP1043998B1 (en) * | 1997-12-13 | 2007-03-07 | Bristol-Myers Squibb Company | USE OF PYRAZOLO [3,4-b] PYRIDINE AS CYCLIN DEPENDANT KINASE INHIBITORS |
US6653481B2 (en) * | 2000-12-29 | 2003-11-25 | Synthon Bv | Process for making amlodipine |
CN110606822A (zh) * | 2011-11-24 | 2019-12-24 | 里克特吉迪翁公司 | 具有hsp调节活性的1,4-二氢吡啶衍生物 |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3325505A (en) * | 1965-02-24 | 1967-06-13 | Smith Kline French Lab | 4-cycloalkyl(or cycloalkenyl)-dihydropyridines |
US3441648A (en) * | 1967-02-07 | 1969-04-29 | Smithkline Corp | Compositions and methods for lowering blood pressure with 1,4-dihydropyridines |
-
1969
- 1969-05-10 DE DE1923990A patent/DE1923990C3/de not_active Expired
- 1969-12-15 BR BR215159/69A patent/BR6915159D0/pt unknown
-
1970
- 1970-04-13 IL IL34304A patent/IL34304A/en unknown
- 1970-04-20 YU YU1026/70A patent/YU33268B/xx unknown
- 1970-04-21 GB GB1902770A patent/GB1305793A/en not_active Expired
- 1970-04-27 SE SE7005793A patent/SE376915B/xx unknown
- 1970-05-04 NO NO1683/70A patent/NO133274C/no unknown
- 1970-05-04 DK DK224370AA patent/DK136246B/da unknown
- 1970-05-04 JP JP45037598A patent/JPS4935277B1/ja active Pending
- 1970-05-05 FI FI701259A patent/FI52078C/fi active
- 1970-05-06 AT AT409470A patent/AT299200B/de not_active IP Right Cessation
- 1970-05-06 NL NL7006628A patent/NL7006628A/xx unknown
- 1970-05-08 BE BE750139D patent/BE750139A/xx unknown
- 1970-05-08 FR FR707016863A patent/FR2051515B1/fr not_active Expired
-
1971
- 1971-11-22 US US00201152A patent/US3773773A/en not_active Expired - Lifetime
Also Published As
Publication number | Publication date |
---|---|
FR2051515A1 (en:Method) | 1971-04-09 |
DE1923990C3 (de) | 1978-11-23 |
FR2051515B1 (en:Method) | 1974-07-12 |
BE750139A (en:Method) | 1970-11-09 |
GB1305793A (en:Method) | 1973-02-07 |
DK136246B (da) | 1977-09-12 |
DE1923990B2 (de) | 1978-03-30 |
JPS4935277B1 (en:Method) | 1974-09-20 |
FI52078B (en:Method) | 1977-02-28 |
AT299200B (de) | 1972-06-12 |
NL7006628A (en:Method) | 1970-11-12 |
BR6915159D0 (pt) | 1973-04-19 |
US3773773A (en) | 1973-11-20 |
DE1923990A1 (de) | 1970-11-19 |
IL34304A (en) | 1973-06-29 |
YU102670A (en) | 1976-03-31 |
YU33268B (en) | 1976-08-31 |
NO133274C (en:Method) | 1976-04-07 |
DK136246C (en:Method) | 1978-02-13 |
IL34304A0 (en) | 1970-06-17 |
FI52078C (fi) | 1977-06-10 |
SE376915B (en:Method) | 1975-06-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO133274B (en:Method) | ||
US4727066A (en) | Esters of 1,4-dihydropyridines and medicaments containing the same | |
US4723011A (en) | Preparation of substituted and disubstituted-pyridine-2,3-dicarboxylate esters | |
DK169730B1 (da) | Arylimidderivater samt fremgangsmåde til fremstilling af arylpiperidincarbinolderivater | |
US4188395A (en) | 1,4-Dihydropyridine derivatives substituted in the 2 position, and their use as medicaments | |
IE57715B1 (en) | Asymmetrical diesters of 1,4-dihydro-2,6-dimethyl-pyridine-3,5-dicarboxylic acid | |
CZ290056B6 (cs) | Derivát piperazinylcyklohexanolu a piperidylcyklohexanolu, způsob jeho přípravy a farmaceutický prostředek, který ho obsahuje | |
GB2158065A (en) | Dihydropyridines | |
CA2044498C (en) | Process for the preparation of dialkyl, pyridine-2,3-dicarboxylates and derivatives thereof from dialkyl dichlorosuccinate | |
DK142869B (da) | Analogifremgangsmåde til fremstilling af 2,6-dialkyl-4-phenyl-1,4-dihydropyridin-3-carboxylsyre-aminoalkylester-forbindelser. | |
SU584770A3 (ru) | Способ получени производных 2,4-диаминопиримидин-3-оксида | |
KR100215702B1 (ko) | 클로로말레이트 또는 클로로푸마레이트 또는 이들의 혼합물로부터 치환 및 비치환 - 2,3 - 피리딘디카르복실레이트의 제조방법 및 이로써 얻어진 피리딘디카르복실레이트 화합물 | |
US3883543A (en) | N-alkyl-1,4-dihydropyridines | |
HUP0100640A2 (hu) | Eljárás 1,4-dihidropiridinek előállítására | |
US3158609A (en) | Diphenylmethyl-1-aminopiperidine hydrazones and congeners | |
CA1269384A (en) | Cns-suppressant 3-(1,2,3,6-tetrahydropyridyl-alkyl)- pyridine derivatives | |
KR930008234B1 (ko) | 플루오로메틸-치환 디하이드로 피리딘 카보디티오에이트의 제조방법 | |
NO162515B (no) | Mellomprodukter. | |
JPH0681743B2 (ja) | α−(アルキルフェニル)−4−(ヒドロキシジフェニルメチル)−1−ピペリジンブタノールの製造方法 | |
DE2532221A1 (de) | 3,3a,4,5,6,7-hexahydro-2h-pyrazolo eckige klammer auf 4,3-c eckige klammer zu pyridin-derivate | |
JP2848165B2 (ja) | 非対称ジヒドロピリジン誘導体の製造法 | |
US4029786A (en) | Morpholine derivatives for treating depression | |
US3519620A (en) | 2-vinyl-1,4-dihydroquinazoline derivatives | |
DE2643671A1 (de) | 4-phenylpiperidinyl- und 4 phenyltetrahydropyridinyl-alkylamino-ketoalkancarbonsaeuren und ihre salze mit saeuren und basen | |
EP0164213B1 (en) | Esters of 1,4-dihydro-2,6-dimethyl-3-(alkoxycarbonyl or alkoxyalkoxycarbonyl)-4-(substituted phenyl)-pyridine-5-carboxylic acid |