MX2007013276A - Derivados de quinolina y quinoxalina como inhibidores de actividad enzimatica de cinasa. - Google Patents
Derivados de quinolina y quinoxalina como inhibidores de actividad enzimatica de cinasa.Info
- Publication number
- MX2007013276A MX2007013276A MX2007013276A MX2007013276A MX2007013276A MX 2007013276 A MX2007013276 A MX 2007013276A MX 2007013276 A MX2007013276 A MX 2007013276A MX 2007013276 A MX2007013276 A MX 2007013276A MX 2007013276 A MX2007013276 A MX 2007013276A
- Authority
- MX
- Mexico
- Prior art keywords
- methoxy
- quinolin
- yloxy
- compound according
- alkyl
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title claims abstract description 14
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title description 10
- 108091000080 Phosphotransferase Proteins 0.000 title description 2
- 230000002255 enzymatic effect Effects 0.000 title description 2
- 102000020233 phosphotransferase Human genes 0.000 title description 2
- 125000001567 quinoxalinyl group Chemical class N1=C(C=NC2=CC=CC=C12)* 0.000 title description 2
- -1 cyano, cyclopropyl Chemical group 0.000 claims abstract description 398
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 280
- 150000001875 compounds Chemical class 0.000 claims abstract description 237
- 239000001257 hydrogen Chemical group 0.000 claims abstract description 61
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 36
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 25
- 125000003118 aryl group Chemical group 0.000 claims abstract description 24
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 21
- 102000003989 Aurora kinases Human genes 0.000 claims abstract description 20
- 230000000694 effects Effects 0.000 claims abstract description 20
- 108090000433 Aurora kinases Proteins 0.000 claims abstract description 19
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 19
- 125000006413 ring segment Chemical group 0.000 claims abstract description 18
- 125000002950 monocyclic group Chemical group 0.000 claims abstract description 14
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 13
- 108010051152 Carboxylesterase Proteins 0.000 claims abstract description 12
- 102000013392 Carboxylesterase Human genes 0.000 claims abstract description 12
- 125000002843 carboxylic acid group Chemical group 0.000 claims abstract description 9
- 125000004185 ester group Chemical group 0.000 claims abstract description 9
- 230000003834 intracellular effect Effects 0.000 claims abstract description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 4
- 239000002253 acid Substances 0.000 claims description 102
- 239000000203 mixture Substances 0.000 claims description 90
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 80
- 150000003254 radicals Chemical class 0.000 claims description 55
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 210000004027 cell Anatomy 0.000 claims description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims description 20
- 125000001424 substituent group Chemical group 0.000 claims description 20
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 19
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 125000001153 fluoro group Chemical group F* 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 14
- 125000004076 pyridyl group Chemical group 0.000 claims description 12
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 11
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 11
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 11
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 11
- 101150101604 ACVR1B gene Proteins 0.000 claims description 10
- 206010028980 Neoplasm Diseases 0.000 claims description 10
- 201000010099 disease Diseases 0.000 claims description 10
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 10
- 230000005764 inhibitory process Effects 0.000 claims description 10
- GPTFURBXHJWNHR-UHFFFAOYSA-N protopine Chemical compound C1=C2C(=O)CC3=CC=C4OCOC4=C3CN(C)CCC2=CC2=C1OCO2 GPTFURBXHJWNHR-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 101100490437 Mus musculus Acvrl1 gene Proteins 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 9
- 210000002540 macrophage Anatomy 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 201000011510 cancer Diseases 0.000 claims description 8
- 125000004122 cyclic group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 102000004190 Enzymes Human genes 0.000 claims description 7
- 108090000790 Enzymes Proteins 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 230000002401 inhibitory effect Effects 0.000 claims description 7
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 7
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims description 6
- 125000004450 alkenylene group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000005441 aurora Substances 0.000 claims description 5
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 claims description 5
- 125000002837 carbocyclic group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 150000003568 thioethers Chemical class 0.000 claims description 5
- DGVRQOFMFZGCJY-OAQYLSRUSA-N (2r)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 DGVRQOFMFZGCJY-OAQYLSRUSA-N 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 150000001204 N-oxides Chemical class 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 4
- 239000012453 solvate Substances 0.000 claims description 4
- CVUARBOFEQLVSK-JOCHJYFZSA-N (2r)-2-amino-5-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypentanoic acid Chemical compound C1=CN=C2C=C(OCCC[C@@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 CVUARBOFEQLVSK-JOCHJYFZSA-N 0.000 claims description 3
- 208000023275 Autoimmune disease Diseases 0.000 claims description 3
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical group [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000004419 alkynylene group Chemical group 0.000 claims description 3
- 230000004663 cell proliferation Effects 0.000 claims description 3
- 238000001727 in vivo Methods 0.000 claims description 3
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 claims description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 3
- 230000035755 proliferation Effects 0.000 claims description 3
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 2
- 108020000002 NR3 subfamily Proteins 0.000 claims 3
- 239000008194 pharmaceutical composition Substances 0.000 claims 2
- VXVVXQYKXVYROC-FQEVSTJZSA-N (2s)-2-amino-4-[4-[2-fluoro-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C(=C1)F)=CC=C1NC(=O)NC1=CC=C(C(F)(F)F)C=C1 VXVVXQYKXVYROC-FQEVSTJZSA-N 0.000 claims 1
- 125000001766 1,2,4-oxadiazol-3-yl group Chemical group [H]C1=NC(*)=NO1 0.000 claims 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- 108020004021 3-ketosteroid receptors Proteins 0.000 claims 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 150000004677 hydrates Chemical class 0.000 claims 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims 1
- 210000001616 monocyte Anatomy 0.000 claims 1
- 125000005400 pyridylcarbonyl group Chemical group N1=C(C=CC=C1)C(=O)* 0.000 claims 1
- 238000011200 topical administration Methods 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 3
- 125000001475 halogen functional group Chemical group 0.000 abstract 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 262
- 238000005481 NMR spectroscopy Methods 0.000 description 221
- 238000006243 chemical reaction Methods 0.000 description 148
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 138
- 230000002829 reductive effect Effects 0.000 description 138
- 239000007787 solid Substances 0.000 description 130
- 239000000243 solution Substances 0.000 description 130
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 120
- 235000019439 ethyl acetate Nutrition 0.000 description 104
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 103
- 239000011541 reaction mixture Substances 0.000 description 101
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 98
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 82
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 77
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 76
- 239000012267 brine Substances 0.000 description 61
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 61
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- 238000004440 column chromatography Methods 0.000 description 52
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 46
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- 239000000047 product Substances 0.000 description 44
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 43
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 41
- 235000019341 magnesium sulphate Nutrition 0.000 description 41
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 39
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- 238000000746 purification Methods 0.000 description 33
- 230000015572 biosynthetic process Effects 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical group CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 150000002148 esters Chemical class 0.000 description 30
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 30
- 238000003786 synthesis reaction Methods 0.000 description 30
- 101150041968 CDC13 gene Proteins 0.000 description 29
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 29
- 239000012044 organic layer Substances 0.000 description 28
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 28
- 239000003921 oil Substances 0.000 description 25
- 235000019198 oils Nutrition 0.000 description 25
- 229910000027 potassium carbonate Inorganic materials 0.000 description 25
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 22
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 22
- 235000019441 ethanol Nutrition 0.000 description 22
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 22
- 239000000284 extract Substances 0.000 description 21
- 235000011121 sodium hydroxide Nutrition 0.000 description 21
- 238000001914 filtration Methods 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 18
- 239000012299 nitrogen atmosphere Substances 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- 239000010410 layer Substances 0.000 description 17
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 17
- 239000000706 filtrate Substances 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 15
- 239000011734 sodium Substances 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 14
- MNLNTCJWJBWEJJ-LURJTMIESA-N (2s)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCBr MNLNTCJWJBWEJJ-LURJTMIESA-N 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 11
- 238000002953 preparative HPLC Methods 0.000 description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- DGVRQOFMFZGCJY-NRFANRHFSA-N (2s)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 DGVRQOFMFZGCJY-NRFANRHFSA-N 0.000 description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 108090000371 Esterases Proteins 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 235000011181 potassium carbonates Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 125000001544 thienyl group Chemical group 0.000 description 8
- SYKLZPMKNBDEOF-UHFFFAOYSA-N 4-chloro-6-methoxy-7-phenylmethoxyquinoline Chemical compound COC1=CC2=C(Cl)C=CN=C2C=C1OCC1=CC=CC=C1 SYKLZPMKNBDEOF-UHFFFAOYSA-N 0.000 description 7
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 7
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 7
- 238000003556 assay Methods 0.000 description 7
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 7
- CVPWYDXAVJCNAG-UHFFFAOYSA-N n-(4-hydroxyphenyl)benzamide Chemical compound C1=CC(O)=CC=C1NC(=O)C1=CC=CC=C1 CVPWYDXAVJCNAG-UHFFFAOYSA-N 0.000 description 7
- 235000015320 potassium carbonate Nutrition 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 6
- 108010033040 Histones Proteins 0.000 description 6
- 102000006947 Histones Human genes 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 238000003818 flash chromatography Methods 0.000 description 6
- 230000004048 modification Effects 0.000 description 6
- 238000012986 modification Methods 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 229910014455 Ca-Cb Inorganic materials 0.000 description 5
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 5
- RSKYVXWPMYUPIE-UHFFFAOYSA-N N-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxyphenyl]benzamide Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 RSKYVXWPMYUPIE-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 5
- LMYNKFDVIZBWDF-VKHMYHEASA-N (2s)-2-amino-4-bromobutanoic acid Chemical compound OC(=O)[C@@H](N)CCBr LMYNKFDVIZBWDF-VKHMYHEASA-N 0.000 description 4
- BYTVSLLWGLWELQ-DEOSSOPVSA-N (2s)-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 BYTVSLLWGLWELQ-DEOSSOPVSA-N 0.000 description 4
- PZEMWPDUXBZKJN-LURJTMIESA-N (2s)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCO PZEMWPDUXBZKJN-LURJTMIESA-N 0.000 description 4
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 4
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 108010077544 Chromatin Proteins 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 101000938676 Homo sapiens Liver carboxylesterase 1 Proteins 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 239000003719 aurora kinase inhibitor Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 210000003483 chromatin Anatomy 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- LQGDKFVWDXOYDG-NSHDSACASA-N cyclopentyl (2s)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound CC(C)(C)OC(=O)N[C@@H](CCBr)C(=O)OC1CCCC1 LQGDKFVWDXOYDG-NSHDSACASA-N 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 125000000842 isoxazolyl group Chemical group 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- XRZRFMIWVJBZPB-UHFFFAOYSA-N n-(4-hydroxyphenyl)-4-(trifluoromethyl)benzamide Chemical compound C1=CC(O)=CC=C1NC(=O)C1=CC=C(C(F)(F)F)C=C1 XRZRFMIWVJBZPB-UHFFFAOYSA-N 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 125000000168 pyrrolyl group Chemical group 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- 230000000699 topical effect Effects 0.000 description 4
- 239000003981 vehicle Substances 0.000 description 4
- AOLVDEVIUHXUCG-QFIPXVFZSA-N (2s)-2-amino-4-[4-[4-(benzylamino)phenoxy]-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NCC1=CC=CC=C1 AOLVDEVIUHXUCG-QFIPXVFZSA-N 0.000 description 3
- ZSPIVUJYZVOSMN-NSHDSACASA-N (2s)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCO[Si](C)(C)C(C)(C)C ZSPIVUJYZVOSMN-NSHDSACASA-N 0.000 description 3
- JZVCTQWGTVFUIE-JTQLQIEISA-N (2s)-4-bromo-2-(phenylmethoxycarbonylamino)butanoic acid Chemical compound BrCC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 JZVCTQWGTVFUIE-JTQLQIEISA-N 0.000 description 3
- LHLCNVYTYABQMR-UHFFFAOYSA-N 3-bromo-4-chloro-6-methoxy-7-phenylmethoxyquinoline Chemical compound COC1=CC2=C(Cl)C(Br)=CN=C2C=C1OCC1=CC=CC=C1 LHLCNVYTYABQMR-UHFFFAOYSA-N 0.000 description 3
- LBGIYCBNJBHZSZ-UHFFFAOYSA-N 4-chloro-6-methoxy-7-phenylmethoxyquinazoline Chemical compound COC1=CC2=C(Cl)N=CN=C2C=C1OCC1=CC=CC=C1 LBGIYCBNJBHZSZ-UHFFFAOYSA-N 0.000 description 3
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 102100021864 Cocaine esterase Human genes 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 101000898006 Homo sapiens Cocaine esterase Proteins 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 210000000436 anus Anatomy 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000007717 exclusion Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 125000001786 isothiazolyl group Chemical group 0.000 description 3
- GTTFJYUWPUKXJH-UHFFFAOYSA-N n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=CC=C1 GTTFJYUWPUKXJH-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 125000002971 oxazolyl group Chemical group 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 230000002062 proliferating effect Effects 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 description 3
- 238000012552 review Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 238000013518 transcription Methods 0.000 description 3
- 230000035897 transcription Effects 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- XWXAZEIXZPPWET-QHCPKHFHSA-N (2s)-2-acetamido-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](NC(C)=O)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 XWXAZEIXZPPWET-QHCPKHFHSA-N 0.000 description 2
- JBZCJJTXCVKEQV-HNNXBMFYSA-N (2s)-2-amino-4-(6-methoxy-4-phenoxyquinolin-7-yl)oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC1=CC=CC=C1 JBZCJJTXCVKEQV-HNNXBMFYSA-N 0.000 description 2
- YPRQWGKIOAYREC-HNNXBMFYSA-N (2s)-2-amino-4-[4-(3-fluorophenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC1=CC=CC(F)=C1 YPRQWGKIOAYREC-HNNXBMFYSA-N 0.000 description 2
- CPIJEDTXRWROJW-FQEVSTJZSA-N (2s)-2-amino-4-[4-(4-benzamido-2-methoxyphenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C=1C=C(OC=2C3=CC(OC)=C(OCC[C@H](N)C(O)=O)C=C3N=CC=2)C(OC)=CC=1NC(=O)C1=CC=CC=C1 CPIJEDTXRWROJW-FQEVSTJZSA-N 0.000 description 2
- HMAGDRIBLOECKK-FQEVSTJZSA-N (2s)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinazolin-7-yl]oxybutanoic acid Chemical compound N1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 HMAGDRIBLOECKK-FQEVSTJZSA-N 0.000 description 2
- DXARKSUKSKALHZ-NRFANRHFSA-N (2s)-2-amino-4-[4-(4-benzamidophenoxy)-7-methoxyquinolin-6-yl]oxybutanoic acid Chemical compound C=12C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=NC=CC=1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 DXARKSUKSKALHZ-NRFANRHFSA-N 0.000 description 2
- WDRKGXSXKOWBHI-IBGZPJMESA-N (2s)-2-amino-4-[4-[[1-(2-anilino-2-oxoethyl)pyrazol-4-yl]amino]-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1NC(=C1)C=NN1CC(=O)NC1=CC=CC=C1 WDRKGXSXKOWBHI-IBGZPJMESA-N 0.000 description 2
- OLNMRHKKDRPOPP-INIZCTEOSA-N (2s)-2-amino-4-[6-methoxy-4-(4-methoxyphenoxy)quinolin-7-yl]oxybutanoic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC=NC2=CC(OCC[C@H](N)C(O)=O)=C(OC)C=C12 OLNMRHKKDRPOPP-INIZCTEOSA-N 0.000 description 2
- CGVHHSQEWQMAQO-HNNXBMFYSA-N (2s)-2-amino-4-[6-methoxy-4-[(2-methyl-1,3-benzothiazol-5-yl)oxy]quinolin-7-yl]oxybutanoic acid Chemical compound C1=C2SC(C)=NC2=CC(OC2=C3C=C(C(=CC3=NC=C2)OCC[C@H](N)C(O)=O)OC)=C1 CGVHHSQEWQMAQO-HNNXBMFYSA-N 0.000 description 2
- CVUARBOFEQLVSK-QFIPXVFZSA-N (2s)-2-amino-5-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypentanoic acid Chemical compound C1=CN=C2C=C(OCCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 CVUARBOFEQLVSK-QFIPXVFZSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- WJWWLANEKWRRPW-UHFFFAOYSA-N 2-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxyphenyl]-1-phenylethanone Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1OC(C=C1)=CC=C1CC(=O)C1=CC=CC=C1 WJWWLANEKWRRPW-UHFFFAOYSA-N 0.000 description 2
- LOSKNFQZTWYZHI-UHFFFAOYSA-N 2-pyrazol-1-ylacetic acid Chemical compound OC(=O)CN1C=CC=N1 LOSKNFQZTWYZHI-UHFFFAOYSA-N 0.000 description 2
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 2
- UEEBFKHFDNLZQD-UHFFFAOYSA-N 3-bromo-6-methoxy-7-phenylmethoxy-1h-quinolin-4-one Chemical compound COC1=CC2=C(O)C(Br)=CN=C2C=C1OCC1=CC=CC=C1 UEEBFKHFDNLZQD-UHFFFAOYSA-N 0.000 description 2
- CXPOMKZQKONFEH-UHFFFAOYSA-N 3-fluoro-4-(6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyaniline Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC1=CC=C(N)C=C1F CXPOMKZQKONFEH-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- VTHHRADLOLKTLD-UHFFFAOYSA-N 4-(benzyloxy)-5-methoxy-2-nitrobenzoic acid Chemical compound COC1=CC(C(O)=O)=C([N+]([O-])=O)C=C1OCC1=CC=CC=C1 VTHHRADLOLKTLD-UHFFFAOYSA-N 0.000 description 2
- RQJDUEKERVZLLU-UHFFFAOYSA-N 4-Hydroxybenzylamine Chemical compound NCC1=CC=C(O)C=C1 RQJDUEKERVZLLU-UHFFFAOYSA-N 0.000 description 2
- REZZBEULFSTIKX-UHFFFAOYSA-N 4-[4-(benzylamino)phenoxy]-6-methoxyquinolin-7-ol Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1OC(C=C1)=CC=C1NCC1=CC=CC=C1 REZZBEULFSTIKX-UHFFFAOYSA-N 0.000 description 2
- NKWZPFHSWLSOON-UHFFFAOYSA-N 4-chloro-6-methoxyquinolin-7-ol Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1Cl NKWZPFHSWLSOON-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- XQXPVVBIMDBYFF-UHFFFAOYSA-N 4-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C=C1 XQXPVVBIMDBYFF-UHFFFAOYSA-N 0.000 description 2
- OXRDTRDGXMHOOV-UHFFFAOYSA-N 6-methoxy-7-phenylmethoxy-1h-quinolin-4-one Chemical compound COC1=CC2=C(O)C=CN=C2C=C1OCC1=CC=CC=C1 OXRDTRDGXMHOOV-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 102100032306 Aurora kinase B Human genes 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 101000798306 Homo sapiens Aurora kinase B Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- UKAUYVFTDYCKQA-VKHMYHEASA-N L-homoserine Chemical compound OC(=O)[C@@H](N)CCO UKAUYVFTDYCKQA-VKHMYHEASA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 102100030817 Liver carboxylesterase 1 Human genes 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- FYQDTSMDLRXZAA-UHFFFAOYSA-N N-[4-(7-hydroxy-6-methoxyquinazolin-4-yl)oxyphenyl]benzamide Chemical compound N1=CN=C2C=C(O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 FYQDTSMDLRXZAA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 235000001465 calcium Nutrition 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 2
- XASGFOVGTYZBNT-SANMLTNESA-N cyclopentyl (2s)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 XASGFOVGTYZBNT-SANMLTNESA-N 0.000 description 2
- URFOGPYFHMIAQS-LJAQVGFWSA-N cyclopentyl (2s)-4-[4-(4-benzamidophenoxy)-7-methoxyquinolin-6-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound C=12C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC3CCCC3)C(OC)=CC2=NC=CC=1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 URFOGPYFHMIAQS-LJAQVGFWSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000001952 enzyme assay Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 210000003527 eukaryotic cell Anatomy 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000001965 increasing effect Effects 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 238000012417 linear regression Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- LNFQIIJBXJNNFI-UHFFFAOYSA-N n-(5-aminopyrimidin-2-yl)benzamide Chemical compound N1=CC(N)=CN=C1NC(=O)C1=CC=CC=C1 LNFQIIJBXJNNFI-UHFFFAOYSA-N 0.000 description 2
- AWBBDCVSBBOIJZ-UHFFFAOYSA-N n-[4-(3-bromo-6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyphenyl]benzamide Chemical compound BrC1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 AWBBDCVSBBOIJZ-UHFFFAOYSA-N 0.000 description 2
- VSABKGJCCWONMP-UHFFFAOYSA-N n-[4-(6-methoxy-7-phenylmethoxyquinazolin-4-yl)oxyphenyl]benzamide Chemical compound N1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 VSABKGJCCWONMP-UHFFFAOYSA-N 0.000 description 2
- HPLSZTPWRXEMTR-UHFFFAOYSA-N n-[4-(6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyphenyl]acetamide Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC1=CC=C(NC(C)=O)C=C1 HPLSZTPWRXEMTR-UHFFFAOYSA-N 0.000 description 2
- 239000002687 nonaqueous vehicle Substances 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229960003540 oxyquinoline Drugs 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 2
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 230000005748 tumor development Effects 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- OTMBNEYLUZRPKM-MHZLTWQESA-N (2S)-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxy-2-(cyclohexylamino)butanoic acid Chemical compound C(C1=CC=CC=C1)(=O)NC1=CC=C(OC2=CC=NC3=CC(=C(C=C23)OC)OCC[C@@H](C(=O)O)NC2CCCCC2)C=C1 OTMBNEYLUZRPKM-MHZLTWQESA-N 0.000 description 1
- KMIDALMOELWSMC-YFKPBYRVSA-N (2s)-2-(bromomethyl)pyrrolidine Chemical compound BrC[C@@H]1CCCN1 KMIDALMOELWSMC-YFKPBYRVSA-N 0.000 description 1
- YQPOWDGQEHXHBS-YFKPBYRVSA-N (2s)-2-(bromomethyl)pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCC[C@H]1CBr YQPOWDGQEHXHBS-YFKPBYRVSA-N 0.000 description 1
- AJDUMMXHVCMISJ-ZDUSSCGKSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(=O)OCC1=CC=CC=C1 AJDUMMXHVCMISJ-ZDUSSCGKSA-N 0.000 description 1
- AQTUACKQXJNHFQ-LURJTMIESA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(O)=O AQTUACKQXJNHFQ-LURJTMIESA-N 0.000 description 1
- WGAMYQDADHZHGG-FQEVSTJZSA-N (2s)-2-amino-4-[4-(4-benzamido-2-fluorophenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C(=C1)F)=CC=C1NC(=O)C1=CC=CC=C1 WGAMYQDADHZHGG-FQEVSTJZSA-N 0.000 description 1
- JXKORQLGACMPJT-FQEVSTJZSA-N (2s)-2-amino-4-[4-(4-benzamido-3-fluorophenoxy)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1F)=CC=C1NC(=O)C1=CC=CC=C1 JXKORQLGACMPJT-FQEVSTJZSA-N 0.000 description 1
- VDQAYWXZNPTRCB-NRFANRHFSA-N (2s)-2-amino-4-[4-(4-benzamidoanilino)-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1NC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 VDQAYWXZNPTRCB-NRFANRHFSA-N 0.000 description 1
- LVPLWDOEFVPRBG-SFHVURJKSA-N (2s)-2-amino-4-[4-[(2-benzamidopyrimidin-5-yl)amino]-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1NC(C=N1)=CN=C1NC(=O)C1=CC=CC=C1 LVPLWDOEFVPRBG-SFHVURJKSA-N 0.000 description 1
- CEMRXHMUMZOIMA-NRFANRHFSA-N (2s)-2-amino-4-[4-[4-(benzenesulfonamido)phenoxy]-6-methoxyquinolin-7-yl]oxybutanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NS(=O)(=O)C1=CC=CC=C1 CEMRXHMUMZOIMA-NRFANRHFSA-N 0.000 description 1
- MTCZQGQKVJDADE-DEOSSOPVSA-N (2s)-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxy-2-(2,2-dimethylpropanoylamino)butanoic acid Chemical compound C1=CN=C2C=C(OCC[C@H](NC(=O)C(C)(C)C)C(O)=O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 MTCZQGQKVJDADE-DEOSSOPVSA-N 0.000 description 1
- OTYQKCSLOJGSBH-ZDUSSCGKSA-N (3s)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-(3-phenylpropanoylamino)butanoic acid Chemical compound CC(C)(C)OC(=O)[C@H](CC(O)=O)NC(=O)CCC1=CC=CC=C1 OTYQKCSLOJGSBH-ZDUSSCGKSA-N 0.000 description 1
- IQFUADQPSYSDIP-UHFFFAOYSA-N (4-aminophenyl)carbamic acid Chemical compound NC1=CC=C(NC(O)=O)C=C1 IQFUADQPSYSDIP-UHFFFAOYSA-N 0.000 description 1
- AUOCATKFKICGLW-UHFFFAOYSA-N (4-benzamidophenyl)carbamic acid Chemical compound C1=CC(NC(=O)O)=CC=C1NC(=O)C1=CC=CC=C1 AUOCATKFKICGLW-UHFFFAOYSA-N 0.000 description 1
- KUJDGSFHKVQDQL-UHFFFAOYSA-N (4-nitro-1h-pyrazol-1-yl)acetic acid Chemical compound OC(=O)CN1C=C([N+]([O-])=O)C=N1 KUJDGSFHKVQDQL-UHFFFAOYSA-N 0.000 description 1
- JTENPJXMALZPHY-NSHDSACASA-N (4s)-5-cyclopentyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](CCC(O)=O)C(=O)OC1CCCC1 JTENPJXMALZPHY-NSHDSACASA-N 0.000 description 1
- RPICISNQFPOMMT-SDNWHVSQSA-N (E)-2-cyano-3-(4-methoxy-3-phenylmethoxyanilino)prop-2-enoic acid Chemical compound C(C1=CC=CC=C1)OC=1C=C(C=CC=1OC)N/C=C(/C(=O)O)\C#N RPICISNQFPOMMT-SDNWHVSQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- UKAUYVFTDYCKQA-UHFFFAOYSA-N -2-Amino-4-hydroxybutanoic acid Natural products OC(=O)C(N)CCO UKAUYVFTDYCKQA-UHFFFAOYSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- JCIIKRHCWVHVFF-UHFFFAOYSA-N 1,2,4-thiadiazol-5-amine;hydrochloride Chemical compound Cl.NC1=NC=NS1 JCIIKRHCWVHVFF-UHFFFAOYSA-N 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- RUBQQRMAWLSCCJ-UHFFFAOYSA-N 1,2-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1 RUBQQRMAWLSCCJ-UHFFFAOYSA-N 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- LPUCHTNHUHOTRY-UHFFFAOYSA-N 1-(3-bicyclo[2.2.1]heptanyl)ethanamine Chemical compound C1CC2C(C(N)C)CC1C2 LPUCHTNHUHOTRY-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- SOUAKRHPKDIMLI-UHFFFAOYSA-N 1-[3-fluoro-4-(6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC(C(=C1)F)=CC=C1NC(=O)NC1=CC=C(C(F)(F)F)C=C1 SOUAKRHPKDIMLI-UHFFFAOYSA-N 0.000 description 1
- JCDKKJAGDDMRME-UHFFFAOYSA-N 1-[3-fluoro-4-(7-hydroxy-6-methoxyquinolin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1OC(C(=C1)F)=CC=C1NC(=O)NC1=CC=C(C(F)(F)F)C=C1 JCDKKJAGDDMRME-UHFFFAOYSA-N 0.000 description 1
- MUHDGRRSZNIKOL-UHFFFAOYSA-N 1-[4-(6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)NC1=CC=C(C(F)(F)F)C=C1 MUHDGRRSZNIKOL-UHFFFAOYSA-N 0.000 description 1
- STZNDAZHORUGQI-UHFFFAOYSA-N 1-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxyphenyl]-3-(4-methylphenyl)urea Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)NC1=CC=C(C)C=C1 STZNDAZHORUGQI-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- QZTWVDCKDWZCLV-UHFFFAOYSA-N 1-isocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(N=C=O)C=C1 QZTWVDCKDWZCLV-UHFFFAOYSA-N 0.000 description 1
- MYKBXOQHDQLNGL-UHFFFAOYSA-N 1-methoxy-4-nitro-2-phenylmethoxybenzene Chemical compound COC1=CC=C([N+]([O-])=O)C=C1OCC1=CC=CC=C1 MYKBXOQHDQLNGL-UHFFFAOYSA-N 0.000 description 1
- FGOJCPKOOGIRPA-UHFFFAOYSA-N 1-o-tert-butyl 4-o-ethyl 5-oxoazepane-1,4-dicarboxylate Chemical compound CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CCC1=O FGOJCPKOOGIRPA-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- PTQCMUDKRFNQCR-UHFFFAOYSA-N 2,4-dichloro-6-methoxy-7-phenylmethoxyquinazoline Chemical compound COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1OCC1=CC=CC=C1 PTQCMUDKRFNQCR-UHFFFAOYSA-N 0.000 description 1
- RJXOVESYJFXCGI-UHFFFAOYSA-N 2,4-difluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1F RJXOVESYJFXCGI-UHFFFAOYSA-N 0.000 description 1
- GSBWTENEHYZYDG-UHFFFAOYSA-N 2-(4-aminopyrazol-1-yl)-n-phenylacetamide Chemical group C1=C(N)C=NN1CC(=O)NC1=CC=CC=C1 GSBWTENEHYZYDG-UHFFFAOYSA-N 0.000 description 1
- VCWCUMTYRJJXHF-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-1-phenylethanone Chemical compound C1=CC(O)=CC=C1CC(=O)C1=CC=CC=C1 VCWCUMTYRJJXHF-UHFFFAOYSA-N 0.000 description 1
- JABKESJVYSQBGF-UHFFFAOYSA-N 2-(4-methoxyphenyl)-1-phenylethanone Chemical compound C1=CC(OC)=CC=C1CC(=O)C1=CC=CC=C1 JABKESJVYSQBGF-UHFFFAOYSA-N 0.000 description 1
- CXJOONIFSVSFAD-UHFFFAOYSA-N 2-(4-methoxyphenyl)acetyl chloride Chemical compound COC1=CC=C(CC(Cl)=O)C=C1 CXJOONIFSVSFAD-UHFFFAOYSA-N 0.000 description 1
- IZLVFLOBTPURLP-UHFFFAOYSA-N 2-Methoxy-4-nitrophenol Chemical compound COC1=CC([N+]([O-])=O)=CC=C1O IZLVFLOBTPURLP-UHFFFAOYSA-N 0.000 description 1
- KXKCTSZYNCDFFG-UHFFFAOYSA-N 2-Methoxy-5-nitrophenol Chemical compound COC1=CC=C([N+]([O-])=O)C=C1O KXKCTSZYNCDFFG-UHFFFAOYSA-N 0.000 description 1
- PNFVIPIQXAIUAY-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CCC(C(O)=O)NC(=O)OC(C)(C)C PNFVIPIQXAIUAY-UHFFFAOYSA-N 0.000 description 1
- UKFTXWKNVSVVCJ-UHFFFAOYSA-N 2-[(6-hydrazinylpyridazin-3-yl)-(2-hydroxyethyl)amino]ethanol;hydron;dichloride Chemical class Cl.Cl.NNC1=CC=C(N(CCO)CCO)N=N1 UKFTXWKNVSVVCJ-UHFFFAOYSA-N 0.000 description 1
- PQVSBSREFMJEBQ-UHFFFAOYSA-N 2-[4-(6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyphenyl]-1-phenylethanone Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC(C=C1)=CC=C1CC(=O)C1=CC=CC=C1 PQVSBSREFMJEBQ-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- CYJFMVXMHCGPSW-UHFFFAOYSA-N 2-amino-5-methoxy-4-phenylmethoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=C(N)C=C1OCC1=CC=CC=C1 CYJFMVXMHCGPSW-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- YKRBSHWNSVNCNM-UHFFFAOYSA-N 2-chloro-6-methoxy-n-(5-methyl-1h-pyrazol-3-yl)-7-phenylmethoxyquinazolin-4-amine Chemical compound N1=C(Cl)N=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1NC=1C=C(C)NN=1 YKRBSHWNSVNCNM-UHFFFAOYSA-N 0.000 description 1
- XOZAJNLUAODXSP-UHFFFAOYSA-N 2-fluoro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(F)N=C1 XOZAJNLUAODXSP-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- BVIJQMCYYASIFP-UHFFFAOYSA-N 2-methylcyclopentan-1-ol Chemical compound CC1CCCC1O BVIJQMCYYASIFP-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- JGMBQAGNZLBZCE-UHFFFAOYSA-N 3-methoxy-4-phenylmethoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC=C1OCC1=CC=CC=C1 JGMBQAGNZLBZCE-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- VEALHWXMCIRWGC-UHFFFAOYSA-N 3-methylcyclopentan-1-ol Chemical compound CC1CCC(O)C1 VEALHWXMCIRWGC-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- JAOINXWEFKZYIL-UHFFFAOYSA-N 4-(1-methyl-2-oxoquinolin-4-yl)oxy-n-(4-methylpyridin-2-yl)butanamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CC1=CC=NC(NC(=O)CCCOC=2C3=CC=CC=C3N(C)C(=O)C=2)=C1 JAOINXWEFKZYIL-UHFFFAOYSA-N 0.000 description 1
- ZCQHXCZWPBJLKD-UHFFFAOYSA-N 4-(2-fluoro-4-nitrophenoxy)-6-methoxy-7-phenylmethoxyquinoline Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC1=CC=C([N+]([O-])=O)C=C1F ZCQHXCZWPBJLKD-UHFFFAOYSA-N 0.000 description 1
- GRFYHMYJGCPLFJ-UHFFFAOYSA-N 4-(bromomethyl)piperidine-1-carboxylic acid Chemical compound OC(=O)N1CCC(CBr)CC1 GRFYHMYJGCPLFJ-UHFFFAOYSA-N 0.000 description 1
- MERLDGDYUMSLAY-UHFFFAOYSA-N 4-[(4-aminophenyl)disulfanyl]aniline Chemical compound C1=CC(N)=CC=C1SSC1=CC=C(N)C=C1 MERLDGDYUMSLAY-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- YVPONOUVXOCATL-UHFFFAOYSA-N 4-chloro-6-methoxy-7-phenylmethoxyquinoline-3-carbonitrile Chemical compound COC1=CC2=C(Cl)C(C#N)=CN=C2C=C1OCC1=CC=CC=C1 YVPONOUVXOCATL-UHFFFAOYSA-N 0.000 description 1
- GXGHEFVSWVGPAO-UHFFFAOYSA-N 4-chloro-7-methoxyquinolin-6-ol Chemical compound C1=CC(Cl)=C2C=C(O)C(OC)=CC2=N1 GXGHEFVSWVGPAO-UHFFFAOYSA-N 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- RMHMYTLAUXIOPR-UHFFFAOYSA-N 4-hydroxy-n-phenylbenzamide Chemical compound C1=CC(O)=CC=C1C(=O)NC1=CC=CC=C1 RMHMYTLAUXIOPR-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- DTAGRANHLLXXLI-UHFFFAOYSA-N 4-methoxy-3-phenylmethoxyaniline Chemical compound COC1=CC=C(N)C=C1OCC1=CC=CC=C1 DTAGRANHLLXXLI-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- VRWNGTZFEHJVFT-UHFFFAOYSA-N 5-(ethoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound CCOC=C1C(=O)OC(C)(C)OC1=O VRWNGTZFEHJVFT-UHFFFAOYSA-N 0.000 description 1
- FYTLHYRDGXRYEY-UHFFFAOYSA-N 5-Methyl-3-pyrazolamine Chemical compound CC=1C=C(N)NN=1 FYTLHYRDGXRYEY-UHFFFAOYSA-N 0.000 description 1
- VRLHUTPCEBIETH-UHFFFAOYSA-N 5-methoxy-2-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1OCC1=CC=CC=C1 VRLHUTPCEBIETH-UHFFFAOYSA-N 0.000 description 1
- SSHFCFRJYJIJDV-UHFFFAOYSA-N 5-nitropyrimidin-2-amine Chemical compound NC1=NC=C([N+]([O-])=O)C=N1 SSHFCFRJYJIJDV-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- JBOBEJVAAJSGEC-UHFFFAOYSA-N 6-methoxy-4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-phenylsulfanylquinazolin-7-ol Chemical compound N1=C(SC=2C=CC=CC=2)N=C2C=C(O)C(OC)=CC2=C1NC=1C=C(C)NN=1 JBOBEJVAAJSGEC-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- 244000047478 Afzelia bijuga Species 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 108010039627 Aprotinin Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229940123877 Aurora kinase inhibitor Drugs 0.000 description 1
- VGGGPCQERPFHOB-MCIONIFRSA-N Bestatin Chemical compound CC(C)C[C@H](C(O)=O)NC(=O)[C@@H](O)[C@H](N)CC1=CC=CC=C1 VGGGPCQERPFHOB-MCIONIFRSA-N 0.000 description 1
- VGGGPCQERPFHOB-UHFFFAOYSA-N Bestatin Natural products CC(C)CC(C(O)=O)NC(=O)C(O)C(N)CC1=CC=CC=C1 VGGGPCQERPFHOB-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 229910014585 C2-Ce Inorganic materials 0.000 description 1
- DPTUQQQSVMSFHE-UHFFFAOYSA-N COC1=CC=C(C=C1)CC(=O)C1=CC=CC=C1.OC1=CC=C(C=C1)CC(=O)C1=CC=CC=C1 Chemical compound COC1=CC=C(C=C1)CC(=O)C1=CC=CC=C1.OC1=CC=C(C=C1)CC(=O)C1=CC=CC=C1 DPTUQQQSVMSFHE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- 206010010144 Completed suicide Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- PQNNIEWMPIULRS-UHFFFAOYSA-N Cytostatin Natural products CC=CC=CC=CC(O)C(C)C(OP(O)(O)=O)CCC(C)C1OC(=O)C=CC1C PQNNIEWMPIULRS-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 108700019348 Drosophila aurA Proteins 0.000 description 1
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 108010002352 Interleukin-1 Proteins 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 206010023203 Joint destruction Diseases 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 description 1
- 235000014852 L-arginine Nutrition 0.000 description 1
- 229930064664 L-arginine Natural products 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- GDBQQVLCIARPGH-UHFFFAOYSA-N Leupeptin Natural products CC(C)CC(NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N GDBQQVLCIARPGH-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 102000006386 Myelin Proteins Human genes 0.000 description 1
- 108010083674 Myelin Proteins Proteins 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- YUGXPGAIGAXWMP-UHFFFAOYSA-N N-[4-(3-bromo-7-hydroxy-6-methoxyquinolin-4-yl)oxyphenyl]benzamide Chemical compound C(=O)(C1=CC=CC=C1)NC1=CC=C(C=C1)OC1=C2C=C(OC)C(O)=CC2=NC=C1Br YUGXPGAIGAXWMP-UHFFFAOYSA-N 0.000 description 1
- RNIDHOWUEPJZQA-UHFFFAOYSA-N N-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxyphenyl]thiophene-2-carboxamide Chemical compound C1=CN=C2C=C(O)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CS1 RNIDHOWUEPJZQA-UHFFFAOYSA-N 0.000 description 1
- MMQILKWADSOFND-UHFFFAOYSA-N N-[4-[(3-cyano-7-hydroxy-6-methoxyquinolin-4-yl)amino]phenyl]benzamide Chemical compound N#CC1=CN=C2C=C(O)C(OC)=CC2=C1NC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 MMQILKWADSOFND-UHFFFAOYSA-N 0.000 description 1
- BKAYIFDRRZZKNF-VIFPVBQESA-N N-acetylcarnosine Chemical compound CC(=O)NCCC(=O)N[C@H](C(O)=O)CC1=CN=CN1 BKAYIFDRRZZKNF-VIFPVBQESA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 108010047956 Nucleosomes Proteins 0.000 description 1
- 108700020796 Oncogene Proteins 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 108700012920 TNF Proteins 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- PQNNIEWMPIULRS-SUTYWZMXSA-N [(8e,10e,12e)-7-hydroxy-6-methyl-2-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)tetradeca-8,10,12-trien-5-yl] dihydrogen phosphate Chemical compound C\C=C\C=C\C=C\C(O)C(C)C(OP(O)(O)=O)CCC(C)C1OC(=O)C=CC1C PQNNIEWMPIULRS-SUTYWZMXSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 230000003322 aneuploid effect Effects 0.000 description 1
- 208000036878 aneuploidy Diseases 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 229960004405 aprotinin Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- JUCVMCNRABNRJD-UHFFFAOYSA-N azane;ethyl acetate Chemical compound N.CCOC(C)=O JUCVMCNRABNRJD-UHFFFAOYSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical class [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- FHRRJZZGSJXPRQ-UHFFFAOYSA-N benzyl phenylmethoxycarbonyl carbonate Chemical compound C=1C=CC=CC=1COC(=O)OC(=O)OCC1=CC=CC=C1 FHRRJZZGSJXPRQ-UHFFFAOYSA-N 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 238000003570 cell viability assay Methods 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 210000003793 centrosome Anatomy 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229960003260 chlorhexidine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 230000024321 chromosome segregation Effects 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical class C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HQMGHFHGJNVQEY-HHHXNRCGSA-N cyclopentyl (2r)-2-amino-5-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxypentanoate Chemical compound C1=CN=C2C=C(OCCC[C@@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 HQMGHFHGJNVQEY-HHHXNRCGSA-N 0.000 description 1
- LQGDKFVWDXOYDG-LLVKDONJSA-N cyclopentyl (2r)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound CC(C)(C)OC(=O)N[C@H](CCBr)C(=O)OC1CCCC1 LQGDKFVWDXOYDG-LLVKDONJSA-N 0.000 description 1
- MCTUONAXICFYOD-QFIPXVFZSA-N cyclopentyl (2s)-2-(benzylamino)-4-(4-chloro-6-methoxyquinolin-7-yl)oxybutanoate Chemical compound N([C@@H](CCOC1=CC2=NC=CC(Cl)=C2C=C1OC)C(=O)OC1CCCC1)CC1=CC=CC=C1 MCTUONAXICFYOD-QFIPXVFZSA-N 0.000 description 1
- OREUOOJNQOUCEO-VWLOTQADSA-N cyclopentyl (2s)-2-amino-4-[4-(4-benzamido-2-fluorophenoxy)-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C(=C1)F)=CC=C1NC(=O)C1=CC=CC=C1 OREUOOJNQOUCEO-VWLOTQADSA-N 0.000 description 1
- FJLCMYPJJQXCEQ-VWLOTQADSA-N cyclopentyl (2s)-2-amino-4-[4-(4-benzamido-2-methoxyphenoxy)-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C=1C=C(OC=2C3=CC(OC)=C(OCC[C@H](N)C(=O)OC4CCCC4)C=C3N=CC=2)C(OC)=CC=1NC(=O)C1=CC=CC=C1 FJLCMYPJJQXCEQ-VWLOTQADSA-N 0.000 description 1
- ASDGNHUOZPOXJI-VWLOTQADSA-N cyclopentyl (2s)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinazolin-7-yl]oxybutanoate Chemical compound N1=CN=C2C=C(OCC[C@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 ASDGNHUOZPOXJI-VWLOTQADSA-N 0.000 description 1
- NLOAZWBFBCNRMG-MHZLTWQESA-N cyclopentyl (2s)-2-amino-4-[4-[4-(2-anilino-2-oxoethyl)phenoxy]-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1CC(=O)NC1=CC=CC=C1 NLOAZWBFBCNRMG-MHZLTWQESA-N 0.000 description 1
- SGSNRURFIBJNPZ-SANMLTNESA-N cyclopentyl (2s)-2-amino-4-[4-[4-(benzenesulfonamido)phenoxy]-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NS(=O)(=O)C1=CC=CC=C1 SGSNRURFIBJNPZ-SANMLTNESA-N 0.000 description 1
- WOQOCKTXKKAQGC-SANMLTNESA-N cyclopentyl (2s)-2-amino-4-[6-methoxy-4-[4-(phenylcarbamoyl)phenoxy]quinolin-7-yl]oxybutanoate Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1C(=O)NC1=CC=CC=C1 WOQOCKTXKKAQGC-SANMLTNESA-N 0.000 description 1
- GXEITLDVSJRTBK-NDEPHWFRSA-N cyclopentyl (2s)-4-[4-(4-benzamidophenoxy)-6-methoxyquinazolin-7-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound N1=CN=C2C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 GXEITLDVSJRTBK-NDEPHWFRSA-N 0.000 description 1
- DYQRMBVVXJPVKP-LJAQVGFWSA-N cyclopentyl (2s)-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound C1=CN=C2C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 DYQRMBVVXJPVKP-LJAQVGFWSA-N 0.000 description 1
- SLRITCORLPGTBD-LJAQVGFWSA-N cyclopentyl (2s)-4-[4-(4-benzamidophenyl)sulfanyl-6-methoxyquinolin-7-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound C1=CN=C2C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC3CCCC3)C(OC)=CC2=C1SC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 SLRITCORLPGTBD-LJAQVGFWSA-N 0.000 description 1
- JCQBCVUQMSQMBG-VWLOTQADSA-N cyclopentyl (2s)-4-[4-[(2-benzamidopyrimidin-5-yl)amino]-6-methoxyquinazolin-7-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound N1=CN=C2C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC3CCCC3)C(OC)=CC2=C1NC(C=N1)=CN=C1NC(=O)C1=CC=CC=C1 JCQBCVUQMSQMBG-VWLOTQADSA-N 0.000 description 1
- YSTWVIIJGORNDB-PMERELPUSA-N cyclopentyl (2s)-4-[4-[4-(benzylamino)phenoxy]-6-methoxyquinolin-7-yl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound C1=CN=C2C=C(OCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC3CCCC3)C(OC)=CC2=C1OC(C=C1)=CC=C1NCC1=CC=CC=C1 YSTWVIIJGORNDB-PMERELPUSA-N 0.000 description 1
- PAYKVUCMEUURFR-NSHDSACASA-N cyclopentyl (2s)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound CC(C)(C)OC(=O)N[C@@H](CCO)C(=O)OC1CCCC1 PAYKVUCMEUURFR-NSHDSACASA-N 0.000 description 1
- AFDHXXZVZMXPNZ-LBPRGKRZSA-N cyclopentyl (2s)-5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate Chemical compound CC(C)(C)OC(=O)N[C@@H](CCCBr)C(=O)OC1CCCC1 AFDHXXZVZMXPNZ-LBPRGKRZSA-N 0.000 description 1
- SFVVFQPZOYJNMX-LBPRGKRZSA-N cyclopentyl (2s)-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate Chemical compound CC(C)(C)OC(=O)N[C@@H](CCCO)C(=O)OC1CCCC1 SFVVFQPZOYJNMX-LBPRGKRZSA-N 0.000 description 1
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 1
- 230000021953 cytokinesis Effects 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 230000002074 deregulated effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 1
- MQYQOVYIJOLTNX-UHFFFAOYSA-N dichloromethane;n,n-dimethylformamide Chemical group ClCCl.CN(C)C=O MQYQOVYIJOLTNX-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003596 drug target Substances 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- HKSZLNNOFSGOKW-UHFFFAOYSA-N ent-staurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(C)O1 HKSZLNNOFSGOKW-UHFFFAOYSA-N 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- ZYBWTEQKHIADDQ-UHFFFAOYSA-N ethanol;methanol Chemical compound OC.CCO ZYBWTEQKHIADDQ-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- LZJWXPBXSXZGSQ-QHCPKHFHSA-N ethyl (2s)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C=12C=C(OC)C(OCC[C@H](N)C(=O)OCC)=CC2=NC=CC=1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 LZJWXPBXSXZGSQ-QHCPKHFHSA-N 0.000 description 1
- NFSJREUATSYLFX-JEDNCBNOSA-N ethyl (2s)-2-amino-4-bromobutanoate;hydrochloride Chemical compound Cl.CCOC(=O)[C@@H](N)CCBr NFSJREUATSYLFX-JEDNCBNOSA-N 0.000 description 1
- YXTOPOZRFOXANL-QMMMGPOBSA-N ethyl (2s)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate Chemical compound CCOC(=O)[C@H](CCBr)NC(=O)OC(C)(C)C YXTOPOZRFOXANL-QMMMGPOBSA-N 0.000 description 1
- IKNYNBFYOGGYHN-DTQAZKPQSA-N ethyl (e)-2-cyano-3-(4-methoxy-3-phenylmethoxyanilino)prop-2-enoate Chemical compound CCOC(=O)C(\C#N)=C\NC1=CC=C(OC)C(OCC=2C=CC=CC=2)=C1 IKNYNBFYOGGYHN-DTQAZKPQSA-N 0.000 description 1
- KTMGNAIGXYODKQ-VOTSOKGWSA-N ethyl (e)-2-cyano-3-ethoxyprop-2-enoate Chemical compound CCO\C=C(/C#N)C(=O)OCC KTMGNAIGXYODKQ-VOTSOKGWSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 238000010579 first pass effect Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000006195 histone acetylation Effects 0.000 description 1
- 102000054098 human CES1 Human genes 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 230000003463 hyperproliferative effect Effects 0.000 description 1
- 229960003943 hypromellose Drugs 0.000 description 1
- 125000005946 imidazo[1,2-a]pyridyl group Chemical group 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 239000012155 injection solvent Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000005990 isobenzothienyl group Chemical group 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 208000018937 joint inflammation Diseases 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- GDBQQVLCIARPGH-ULQDDVLXSA-N leupeptin Chemical compound CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(N)N GDBQQVLCIARPGH-ULQDDVLXSA-N 0.000 description 1
- 108010052968 leupeptin Proteins 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- IWCVDCOJSPWGRW-UHFFFAOYSA-M magnesium;benzene;chloride Chemical compound [Mg+2].[Cl-].C1=CC=[C-]C=C1 IWCVDCOJSPWGRW-UHFFFAOYSA-M 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- FPGZHXRPIFVQOL-UHFFFAOYSA-N methyl 3-methoxy-4-phenylmethoxybenzoate Chemical compound COC1=CC(C(=O)OC)=CC=C1OCC1=CC=CC=C1 FPGZHXRPIFVQOL-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000011278 mitosis Effects 0.000 description 1
- 230000000394 mitotic effect Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- XBRSNMYZHZKDSW-UHFFFAOYSA-N n-(4-hydroxyphenyl)thiophene-2-carboxamide Chemical compound C1=CC(O)=CC=C1NC(=O)C1=CC=CS1 XBRSNMYZHZKDSW-UHFFFAOYSA-N 0.000 description 1
- RNUAWDALQXZXBA-UHFFFAOYSA-N n-(4-sulfanylphenyl)benzamide Chemical compound C1=CC(S)=CC=C1NC(=O)C1=CC=CC=C1 RNUAWDALQXZXBA-UHFFFAOYSA-N 0.000 description 1
- RMRZAIYBQXBLHN-UHFFFAOYSA-N n-(5-nitropyrimidin-2-yl)benzamide Chemical compound N1=CC([N+](=O)[O-])=CN=C1NC(=O)C1=CC=CC=C1 RMRZAIYBQXBLHN-UHFFFAOYSA-N 0.000 description 1
- NWLRRSZDIXRCCO-UHFFFAOYSA-N n-[(4-hydroxyphenyl)methyl]benzamide Chemical compound C1=CC(O)=CC=C1CNC(=O)C1=CC=CC=C1 NWLRRSZDIXRCCO-UHFFFAOYSA-N 0.000 description 1
- ZAHHRSCDSWSVTO-UHFFFAOYSA-N n-[4-(6-methoxy-7-phenylmethoxyquinolin-4-yl)oxyphenyl]benzamide Chemical compound C1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 ZAHHRSCDSWSVTO-UHFFFAOYSA-N 0.000 description 1
- FSWRYLHGAONKLA-UHFFFAOYSA-N n-[4-(7-methoxy-6-phenylmethoxyquinolin-4-yl)oxyphenyl]benzamide Chemical compound C=12C=C(OCC=3C=CC=CC=3)C(OC)=CC2=NC=CC=1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 FSWRYLHGAONKLA-UHFFFAOYSA-N 0.000 description 1
- VBKNPSYHKKJAFB-UHFFFAOYSA-N n-[4-(trifluoromethyl)phenyl]formamide Chemical compound FC(F)(F)C1=CC=C(NC=O)C=C1 VBKNPSYHKKJAFB-UHFFFAOYSA-N 0.000 description 1
- QNPSKTGWMSAYOQ-UHFFFAOYSA-N n-[4-[(3-cyano-6-methoxy-7-phenylmethoxyquinolin-4-yl)amino]phenyl]benzamide Chemical compound N#CC1=CN=C2C=C(OCC=3C=CC=CC=3)C(OC)=CC2=C1NC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 QNPSKTGWMSAYOQ-UHFFFAOYSA-N 0.000 description 1
- WHEOIEDUQSMVTO-UHFFFAOYSA-N n-[4-[(4-benzamidophenyl)disulfanyl]phenyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(C=C1)=CC=C1SSC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 WHEOIEDUQSMVTO-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 210000001623 nucleosome Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- LVSJDHGRKAEGLX-UHFFFAOYSA-N oxolane;2,2,2-trifluoroacetic acid Chemical compound C1CCOC1.OC(=O)C(F)(F)F LVSJDHGRKAEGLX-UHFFFAOYSA-N 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229950000964 pepstatin Drugs 0.000 description 1
- 108010091212 pepstatin Proteins 0.000 description 1
- FAXGPCHRFPCXOO-LXTPJMTPSA-N pepstatin A Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229940096826 phenylmercuric acetate Drugs 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical class N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000011894 semi-preparative HPLC Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- HKSZLNNOFSGOKW-FYTWVXJKSA-N staurosporine Chemical compound C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1[C@H]1C[C@@H](NC)[C@@H](OC)[C@]4(C)O1 HKSZLNNOFSGOKW-FYTWVXJKSA-N 0.000 description 1
- CGPUWJWCVCFERF-UHFFFAOYSA-N staurosporine Natural products C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1CC(NC)C(OC)C4(OC)O1 CGPUWJWCVCFERF-UHFFFAOYSA-N 0.000 description 1
- WPLOVIFNBMNBPD-ATHMIXSHSA-N subtilin Chemical compound CC1SCC(NC2=O)C(=O)NC(CC(N)=O)C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(C(C)CC)C(=O)NC(=C)C(=O)NC(CCCCN)C(O)=O)CSC(C)C2NC(=O)C(CC(C)C)NC(=O)C1NC(=O)C(CCC(N)=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C1NC(=O)C(=C/C)/NC(=O)C(CCC(N)=O)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C2NC(=O)CNC(=O)C3CCCN3C(=O)C(NC(=O)C3NC(=O)C(CC(C)C)NC(=O)C(=C)NC(=O)C(CCC(O)=O)NC(=O)C(NC(=O)C(CCCCN)NC(=O)C(N)CC=4C5=CC=CC=C5NC=4)CSC3)C(C)SC2)C(C)C)C(C)SC1)CC1=CC=CC=C1 WPLOVIFNBMNBPD-ATHMIXSHSA-N 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- BFFLLBPMZCIGRM-MRVPVSSYSA-N tert-butyl (2r)-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H]1CO BFFLLBPMZCIGRM-MRVPVSSYSA-N 0.000 description 1
- OSMADJAEHVCZKN-QMMMGPOBSA-N tert-butyl (2s)-2-(bromomethyl)pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@H]1CBr OSMADJAEHVCZKN-QMMMGPOBSA-N 0.000 description 1
- KTVMETVFDHPDJZ-DEOSSOPVSA-N tert-butyl (2s)-2-amino-4-[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxybutanoate Chemical compound C1=CN=C2C=C(OCC[C@H](N)C(=O)OC(C)(C)C)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 KTVMETVFDHPDJZ-DEOSSOPVSA-N 0.000 description 1
- QMBVLZOEQAEXJC-ZDUSSCGKSA-N tert-butyl (2s)-4-bromo-2-(phenylmethoxycarbonylamino)butanoate Chemical compound CC(C)(C)OC(=O)[C@H](CCBr)NC(=O)OCC1=CC=CC=C1 QMBVLZOEQAEXJC-ZDUSSCGKSA-N 0.000 description 1
- FXRLWSYREBUSNL-ZDUSSCGKSA-N tert-butyl (2s)-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoate Chemical compound CC(C)(C)OC(=O)[C@H](CCO)NC(=O)OCC1=CC=CC=C1 FXRLWSYREBUSNL-ZDUSSCGKSA-N 0.000 description 1
- ADTQLZMVZLYYBF-UHFFFAOYSA-N tert-butyl 2-[[4-(4-benzamidophenoxy)-6-methoxyquinolin-7-yl]oxymethyl]pyrrolidine-1-carboxylate Chemical compound C1=CN=C2C=C(OCC3N(CCC3)C(=O)OC(C)(C)C)C(OC)=CC2=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 ADTQLZMVZLYYBF-UHFFFAOYSA-N 0.000 description 1
- YGJXBTRLYHCWGD-UHFFFAOYSA-N tert-butyl 4-(bromomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CBr)CC1 YGJXBTRLYHCWGD-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000004867 thiadiazoles Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 229950009811 ubenimex Drugs 0.000 description 1
- 238000010798 ubiquitination Methods 0.000 description 1
- 230000034512 ubiquitination Effects 0.000 description 1
- 238000000825 ultraviolet detection Methods 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/42—Nitrogen atoms attached in position 4
- C07D215/44—Nitrogen atoms attached in position 4 with aryl radicals attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/94—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Immunology (AREA)
- Transplantation (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Enzymes And Modification Thereof (AREA)
- Materials For Medical Uses (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0509227.5A GB0509227D0 (en) | 2005-05-05 | 2005-05-05 | Intracellular enzyme inhibitors |
| PCT/GB2006/001609 WO2006117552A1 (en) | 2005-05-05 | 2006-05-04 | Quinoline and quinoxaline derivatives as inhibitors of kinase enzymatic activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MX2007013276A true MX2007013276A (es) | 2008-01-21 |
Family
ID=34685159
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MX2007013276A MX2007013276A (es) | 2005-05-05 | 2006-05-04 | Derivados de quinolina y quinoxalina como inhibidores de actividad enzimatica de cinasa. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US8148531B2 (enExample) |
| EP (1) | EP1877383B1 (enExample) |
| JP (1) | JP2008540390A (enExample) |
| KR (1) | KR20080010400A (enExample) |
| CN (1) | CN101166726A (enExample) |
| AT (1) | ATE523492T1 (enExample) |
| AU (1) | AU2006243068B2 (enExample) |
| BR (1) | BRPI0609857A2 (enExample) |
| CA (1) | CA2606338A1 (enExample) |
| GB (1) | GB0509227D0 (enExample) |
| IL (1) | IL186551A0 (enExample) |
| MX (1) | MX2007013276A (enExample) |
| NZ (1) | NZ562520A (enExample) |
| WO (1) | WO2006117552A1 (enExample) |
| ZA (1) | ZA200709304B (enExample) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX2007004403A (es) | 2004-10-12 | 2007-04-27 | Astrazeneca Ab | Derivados de quinazolina. |
| EP1964577B1 (en) * | 2005-05-05 | 2016-04-13 | GlaxoSmithKline Intellectual Property Development Limited | Alpha aminoacid ester-drug conjugates hydrolysable by carboxylesterase |
| US8119655B2 (en) | 2005-10-07 | 2012-02-21 | Takeda Pharmaceutical Company Limited | Kinase inhibitors |
| US7572809B2 (en) * | 2005-12-19 | 2009-08-11 | Hoffmann-La Roche Inc. | Isoquinoline aminopyrazole derivatives |
| UY30183A1 (es) * | 2006-03-02 | 2007-10-31 | Astrazeneca Ab | Derivados de quinolina |
| US20110053931A1 (en) * | 2006-06-08 | 2011-03-03 | John Gaudino | Quinoline compounds and methods of use |
| GB0619753D0 (en) | 2006-10-06 | 2006-11-15 | Chroma Therapeutics Ltd | Enzyme inhibitors |
| JP2010505962A (ja) | 2006-10-09 | 2010-02-25 | 武田薬品工業株式会社 | キナーゼ阻害剤 |
| JP5043120B2 (ja) * | 2006-10-30 | 2012-10-10 | クロマ セラピューティクス リミテッド | ヒストンデアセチラーゼの阻害剤としてのヒドロキサメート |
| GB0803747D0 (en) | 2008-02-29 | 2008-04-09 | Martin | Enzyme and receptor modulation |
| KR101325237B1 (ko) | 2008-04-16 | 2013-11-04 | 막스-플랑크-게젤샤프트 츄어 푀르더룽 데어 비쎈샤프텐 에.파우. | Axl 키나아제 억제제인 퀴놀린 유도체 |
| GB0903480D0 (en) | 2009-02-27 | 2009-04-08 | Chroma Therapeutics Ltd | Enzyme Inhibitors |
| EP2311809A1 (en) * | 2009-10-16 | 2011-04-20 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V. | Quinolinyloxyphenylsulfonamides |
| JP2011241170A (ja) * | 2010-05-18 | 2011-12-01 | Mercian Corp | ビタミンd誘導体およびその製造方法 |
| RU2449988C1 (ru) * | 2011-04-29 | 2012-05-10 | Федеральное Государственное Бюджетное Учреждение Науки Институт Физиологически Активных Веществ Российской Академии Наук (Ифав Ран) | 2,2,2-трифтор-1-трифторметилэтиловый эфир циклогексилкарбаминовой кислоты в качестве эффективного средства для селективного необратимого ингибирования карбоксилэстеразы |
| CA2846574C (en) | 2011-08-26 | 2020-07-07 | Neupharma, Inc. | Quinoxaline sulfonamide derivates for use as kinase inhibitors |
| CN115403531A (zh) | 2011-09-14 | 2022-11-29 | 润新生物公司 | 作为激酶抑制剂的化学实体、组合物及方法 |
| EP2757885B1 (en) | 2011-09-21 | 2017-03-15 | Neupharma, Inc. | Certain chemical entites, compositions, and methods |
| US9249111B2 (en) | 2011-09-30 | 2016-02-02 | Neupharma, Inc. | Substituted quinoxalines as B-RAF kinase inhibitors |
| WO2013112950A2 (en) | 2012-01-25 | 2013-08-01 | Neupharma, Inc. | Certain chemical entities, compositions, and methods |
| TWI485146B (zh) * | 2012-02-29 | 2015-05-21 | Taiho Pharmaceutical Co Ltd | Novel piperidine compounds or salts thereof |
| CN103304489B (zh) * | 2012-03-16 | 2015-03-11 | 中国农业科学院兰州畜牧与兽药研究所 | 嘧啶苯甲酰胺类化合物及其制备和应用 |
| GB201211310D0 (en) | 2012-06-26 | 2012-08-08 | Chroma Therapeutics Ltd | CSF-1R kinase inhibitors |
| MA37700B1 (fr) | 2012-06-26 | 2018-03-30 | Bayer Pharma AG | N-[4-(quinolin-4-yloxy)cyclohexyl(méthyl)](hétéro)arylcarboxamides utilisables en tant qu'antagonistes des récepteurs aux androgènes, leur production et leur utilisation en tant que médicaments |
| CN104812389B (zh) | 2012-09-24 | 2020-07-17 | 润新生物公司 | 某些化学实体、组合物及方法 |
| DK3222616T3 (da) | 2012-10-17 | 2019-08-19 | Macrophage Pharma Ltd | N-[2-{4-[6-amino-5-(2,4-difluorbenzoyl)-2-oxopyridin-1(2H)-yl]-3,5-difluorphenyl}ethyl]-L-alanin og terbutylester deraf |
| EP2916838B1 (en) | 2012-11-12 | 2019-03-13 | Neupharma, Inc. | Certain chemical entities, compositions, and methods |
| CN103965107B (zh) * | 2013-02-06 | 2016-08-17 | 沈阳药科大学 | 2-芳基取代喹啉类化合物及其用途 |
| JP6669499B2 (ja) | 2013-02-15 | 2020-03-18 | カラ ファーマシューティカルズ インコーポレイテッド | 治療用化合物 |
| WO2014130612A1 (en) | 2013-02-20 | 2014-08-28 | Kala Pharmaceuticals, Inc. | Therapeutic compounds and uses thereof |
| US9688688B2 (en) | 2013-02-20 | 2017-06-27 | Kala Pharmaceuticals, Inc. | Crystalline forms of 4-((4-((4-fluoro-2-methyl-1H-indol-5-yl)oxy)-6-methoxyquinazolin-7-yl)oxy)-1-(2-oxa-7-azaspiro[3.5]nonan-7-yl)butan-1-one and uses thereof |
| CN104837895B (zh) * | 2013-07-01 | 2017-06-06 | Lg化学株式会社 | 聚硅氧烷化合物及其制备方法以及包含它的共聚碳酸酯树脂 |
| CN108530458A (zh) | 2013-11-01 | 2018-09-14 | 卡拉制药公司 | 治疗化合物的结晶形式及其用途 |
| US9890173B2 (en) | 2013-11-01 | 2018-02-13 | Kala Pharmaceuticals, Inc. | Crystalline forms of therapeutic compounds and uses thereof |
| CN104072492A (zh) * | 2013-11-27 | 2014-10-01 | 苏州摩尔医药有限公司 | 一种抗肿瘤靶向治疗药物Tivozanib的合成方法 |
| CN105085433B (zh) * | 2014-05-19 | 2019-06-25 | 中国科学院上海药物研究所 | 取代酰胺苯酚类化合物及其制备方法、药物组合物和用途 |
| MY187540A (en) | 2014-08-01 | 2021-09-28 | Nuevolution As | Compounds active towards bromodomains |
| KR20180086187A (ko) | 2015-10-05 | 2018-07-30 | 더 트러스티이스 오브 콜롬비아 유니버시티 인 더 시티 오브 뉴욕 | 자가포식 유동의 활성체 및 포스포리파제 d 및 타우를 포함하는 단백질 응집물의 클리어런스 및 단백질질환의 치료 |
| WO2017168448A1 (en) | 2016-03-30 | 2017-10-05 | Council Of Scientific & Industrial Research | Silicon incorporated quinolines with anti-malarial and anti-toxoplasmosis activity |
| CN106083715A (zh) * | 2016-06-01 | 2016-11-09 | 谢阳 | 一种喹啉、喹唑啉类化合物及其药物组合物和应用 |
| AU2017324713B2 (en) | 2016-09-08 | 2020-08-13 | KALA BIO, Inc. | Crystalline forms of therapeutic compounds and uses thereof |
| EP3509421A4 (en) | 2016-09-08 | 2020-05-20 | Kala Pharmaceuticals, Inc. | CRYSTALLINE FORMS OF THERAPEUTIC COMPOUNDS AND USES THEREOF |
| EP3509423A4 (en) | 2016-09-08 | 2020-05-13 | Kala Pharmaceuticals, Inc. | CRYSTALLINE FORMS OF THERAPEUTIC COMPOUNDS AND USES THEREOF |
| BR112019007271A2 (pt) * | 2016-10-10 | 2019-09-17 | Dev Ct Biotechnology | compostos de quinoxalina como inibidores do receptor da tirosina quinase do tipo iii |
| GB201713975D0 (en) | 2017-08-31 | 2017-10-18 | Macrophage Pharma Ltd | Medical use |
| CN111303024B (zh) * | 2018-12-12 | 2023-03-28 | 安徽中科拓苒药物科学研究有限公司 | 一种喹啉结构的pan-KIT激酶抑制剂及其用途 |
| CN112778217B (zh) * | 2019-11-08 | 2024-01-26 | 沈阳化工研究院有限公司 | 一种喹唑啉类化合物及其应用 |
| US20240270683A1 (en) * | 2021-06-17 | 2024-08-15 | Chandrasekhar Dayal Mudaliar | A process for preparation of an intermediate of l-glufosinate |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6143764A (en) | 1995-11-07 | 2000-11-07 | Kirin Beer Kabushiki Kaisha | Quinoline and quinazoline derivatives inhibiting platelet-derived growth factor receptor autophosphorylation and pharmaceutical compositions containing the same |
| US6448256B1 (en) | 1999-05-24 | 2002-09-10 | University Of Massachusetts | Antibiotic prodrugs |
| GB9922171D0 (en) * | 1999-09-21 | 1999-11-17 | Zeneca Ltd | Chemical compounds |
| AU7301000A (en) * | 1999-09-21 | 2001-04-24 | Astrazeneca Ab | Quinazoline derivatives and their use as pharmaceuticals |
| EP1299381B1 (en) * | 2000-06-28 | 2008-05-07 | AstraZeneca AB | Substituted quinazoline derivatives and their use as inhibitors |
| ATE370123T1 (de) * | 2001-11-27 | 2007-09-15 | Wyeth Corp | 3-cyanochinoline als inhibitoren von egf-r- und her2-kinasen |
| TW200813014A (en) * | 2002-03-28 | 2008-03-16 | Astrazeneca Ab | Quinazoline derivatives |
| PA8603801A1 (es) * | 2003-05-27 | 2004-12-16 | Janssen Pharmaceutica Nv | Derivados de la quinazolina |
| JP2007506716A (ja) * | 2003-09-25 | 2007-03-22 | アストラゼネカ アクチボラグ | キナゾリン誘導体 |
| WO2005097134A2 (en) * | 2004-03-31 | 2005-10-20 | The Scripps Research Institute | Quinazoline based protein kinase inhibitors |
| WO2007033196A1 (en) * | 2005-09-14 | 2007-03-22 | Bristol-Myers Squibb Company | Met kinase inhibitors |
-
2005
- 2005-05-05 GB GBGB0509227.5A patent/GB0509227D0/en not_active Ceased
-
2006
- 2006-05-04 EP EP06726986A patent/EP1877383B1/en not_active Not-in-force
- 2006-05-04 CA CA002606338A patent/CA2606338A1/en not_active Abandoned
- 2006-05-04 WO PCT/GB2006/001609 patent/WO2006117552A1/en not_active Ceased
- 2006-05-04 MX MX2007013276A patent/MX2007013276A/es active IP Right Grant
- 2006-05-04 JP JP2008509501A patent/JP2008540390A/ja active Pending
- 2006-05-04 BR BRPI0609857-6A patent/BRPI0609857A2/pt not_active IP Right Cessation
- 2006-05-04 KR KR1020077024927A patent/KR20080010400A/ko not_active Ceased
- 2006-05-04 NZ NZ562520A patent/NZ562520A/en not_active IP Right Cessation
- 2006-05-04 CN CNA2006800146825A patent/CN101166726A/zh active Pending
- 2006-05-04 AT AT06726986T patent/ATE523492T1/de not_active IP Right Cessation
- 2006-05-04 AU AU2006243068A patent/AU2006243068B2/en not_active Ceased
- 2006-05-04 US US11/918,898 patent/US8148531B2/en not_active Expired - Fee Related
-
2007
- 2007-10-10 IL IL186551A patent/IL186551A0/en unknown
- 2007-10-29 ZA ZA200709304A patent/ZA200709304B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US20090131461A1 (en) | 2009-05-21 |
| EP1877383A1 (en) | 2008-01-16 |
| EP1877383B1 (en) | 2011-09-07 |
| NZ562520A (en) | 2010-10-29 |
| JP2008540390A (ja) | 2008-11-20 |
| AU2006243068A1 (en) | 2006-11-09 |
| AU2006243068B2 (en) | 2011-05-26 |
| KR20080010400A (ko) | 2008-01-30 |
| WO2006117552A1 (en) | 2006-11-09 |
| IL186551A0 (en) | 2008-01-20 |
| US8148531B2 (en) | 2012-04-03 |
| CA2606338A1 (en) | 2006-11-09 |
| GB0509227D0 (en) | 2005-06-15 |
| CN101166726A (zh) | 2008-04-23 |
| ZA200709304B (en) | 2008-11-26 |
| ATE523492T1 (de) | 2011-09-15 |
| BRPI0609857A2 (pt) | 2010-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1877383B1 (en) | Quinoline and quinoxaline derivatives as inhibitors of kinase enzymatic activity | |
| US10624882B2 (en) | Rho kinase inhibitors | |
| JP5395668B2 (ja) | Hdac阻害剤 | |
| US7932246B2 (en) | Histone deacetylase inhibitors | |
| JP4405602B2 (ja) | ヒストン脱アセチル化酵素阻害剤 | |
| WO2006117570A1 (en) | Quinoline derivatives as kinase enzyme inhibitors | |
| JP2003523335A (ja) | Ldl−pla2阻害剤としてのピリミジン−4−オン誘導体 | |
| JPWO2008038768A1 (ja) | 二環性ピリミジン構造を有する化合物及びそれを含有する医薬組成物 | |
| ES2605727T9 (es) | Inhibidores de MAP cinasa p38 | |
| US20090203711A1 (en) | Inhibitors of P38 Map Kinase | |
| JPWO2009096435A1 (ja) | 縮合複素環誘導体およびその用途 | |
| KR20090087013A (ko) | 히스톤 탈아세틸효소의 억제제로서 히드록사메이트 | |
| US20100267774A1 (en) | P38 map kinase inhibitors | |
| JPWO1999025712A1 (ja) | 新規アミド化合物及びこれを含有する医薬 | |
| US20100152188A1 (en) | Novel Heterocyclic Compounds | |
| WO2008053158A1 (en) | Inhibitors of p38 mitogen-activated protein kinase | |
| WO2020153434A1 (ja) | ピラゾール化合物 | |
| CN101687816A (zh) | 作为cdc25磷酸酶抑制剂的三氨基嘧啶衍生物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Grant or registration |